{"version":3,"sources":["./node_modules/@angular/animations/__ivy_ngcc__/fesm2015/animations.js","./node_modules/@angular/animations/__ivy_ngcc__/fesm2015/browser.js","./node_modules/@angular/common/__ivy_ngcc__/fesm2015/common.js","./node_modules/@angular/core/__ivy_ngcc__/fesm2015/core.js","./node_modules/@angular/platform-browser/__ivy_ngcc__/fesm2015/animations.js","./node_modules/@angular/platform-browser/__ivy_ngcc__/fesm2015/platform-browser.js","./node_modules/@angular/router/__ivy_ngcc__/fesm2015/router.js","./node_modules/ngx-owl-carousel-o/__ivy_ngcc__/fesm2015/ngx-owl-carousel-o.js","./node_modules/rxjs/_esm2015/index.js","./node_modules/rxjs/_esm2015/internal/AsyncSubject.js","./node_modules/rxjs/_esm2015/internal/BehaviorSubject.js","./node_modules/rxjs/_esm2015/internal/InnerSubscriber.js","./node_modules/rxjs/_esm2015/internal/Notification.js","./node_modules/rxjs/_esm2015/internal/Observable.js","./node_modules/rxjs/_esm2015/internal/Observer.js","./node_modules/rxjs/_esm2015/internal/OuterSubscriber.js","./node_modules/rxjs/_esm2015/internal/ReplaySubject.js","./node_modules/rxjs/_esm2015/internal/Scheduler.js","./node_modules/rxjs/_esm2015/internal/Subject.js","./node_modules/rxjs/_esm2015/internal/SubjectSubscription.js","./node_modules/rxjs/_esm2015/internal/Subscriber.js","./node_modules/rxjs/_esm2015/internal/Subscription.js","./node_modules/rxjs/_esm2015/internal/config.js","./node_modules/rxjs/_esm2015/internal/observable/ConnectableObservable.js","./node_modules/rxjs/_esm2015/internal/observable/SubscribeOnObservable.js","./node_modules/rxjs/_esm2015/internal/observable/bindCallback.js","./node_modules/rxjs/_esm2015/internal/observable/bindNodeCallback.js","./node_modules/rxjs/_esm2015/internal/observable/combineLatest.js","./node_modules/rxjs/_esm2015/internal/observable/concat.js","./node_modules/rxjs/_esm2015/internal/observable/defer.js","./node_modules/rxjs/_esm2015/internal/observable/empty.js","./node_modules/rxjs/_esm2015/internal/observable/forkJoin.js","./node_modules/rxjs/_esm2015/internal/observable/from.js","./node_modules/rxjs/_esm2015/internal/observable/fromArray.js","./node_modules/rxjs/_esm2015/internal/observable/fromEvent.js","./node_modules/rxjs/_esm2015/internal/observable/fromEventPattern.js","./node_modules/rxjs/_esm2015/internal/observable/generate.js","./node_modules/rxjs/_esm2015/internal/observable/iif.js","./node_modules/rxjs/_esm2015/internal/observable/interval.js","./node_modules/rxjs/_esm2015/internal/observable/merge.js","./node_modules/rxjs/_esm2015/internal/observable/never.js","./node_modules/rxjs/_esm2015/internal/observable/of.js","./node_modules/rxjs/_esm2015/internal/observable/onErrorResumeNext.js","./node_modules/rxjs/_esm2015/internal/observable/pairs.js","./node_modules/rxjs/_esm2015/internal/observable/partition.js","./node_modules/rxjs/_esm2015/internal/observable/race.js","./node_modules/rxjs/_esm2015/internal/observable/range.js","./node_modules/rxjs/_esm2015/internal/observable/throwError.js","./node_modules/rxjs/_esm2015/internal/observable/timer.js","./node_modules/rxjs/_esm2015/internal/observable/using.js","./node_modules/rxjs/_esm2015/internal/observable/zip.js","./node_modules/rxjs/_esm2015/internal/operators/audit.js","./node_modules/rxjs/_esm2015/internal/operators/auditTime.js","./node_modules/rxjs/_esm2015/internal/operators/buffer.js","./node_modules/rxjs/_esm2015/internal/operators/bufferCount.js","./node_modules/rxjs/_esm2015/internal/operators/bufferTime.js","./node_modules/rxjs/_esm2015/internal/operators/bufferToggle.js","./node_modules/rxjs/_esm2015/internal/operators/bufferWhen.js","./node_modules/rxjs/_esm2015/internal/operators/catchError.js","./node_modules/rxjs/_esm2015/internal/operators/combineAll.js","./node_modules/rxjs/_esm2015/internal/operators/combineLatest.js","./node_modules/rxjs/_esm2015/internal/operators/concat.js","./node_modules/rxjs/_esm2015/internal/operators/concatAll.js","./node_modules/rxjs/_esm2015/internal/operators/concatMap.js","./node_modules/rxjs/_esm2015/internal/operators/concatMapTo.js","./node_modules/rxjs/_esm2015/internal/operators/count.js","./node_modules/rxjs/_esm2015/internal/operators/debounce.js","./node_modules/rxjs/_esm2015/internal/operators/debounceTime.js","./node_modules/rxjs/_esm2015/internal/operators/defaultIfEmpty.js","./node_modules/rxjs/_esm2015/internal/operators/delay.js","./node_modules/rxjs/_esm2015/internal/operators/delayWhen.js","./node_modules/rxjs/_esm2015/internal/operators/dematerialize.js","./node_modules/rxjs/_esm2015/internal/operators/distinct.js","./node_modules/rxjs/_esm2015/internal/operators/distinctUntilChanged.js","./node_modules/rxjs/_esm2015/internal/operators/distinctUntilKeyChanged.js","./node_modules/rxjs/_esm2015/internal/operators/elementAt.js","./node_modules/rxjs/_esm2015/internal/operators/endWith.js","./node_modules/rxjs/_esm2015/internal/operators/every.js","./node_modules/rxjs/_esm2015/internal/operators/exhaust.js","./node_modules/rxjs/_esm2015/internal/operators/exhaustMap.js","./node_modules/rxjs/_esm2015/internal/operators/expand.js","./node_modules/rxjs/_esm2015/internal/operators/filter.js","./node_modules/rxjs/_esm2015/internal/operators/finalize.js","./node_modules/rxjs/_esm2015/internal/operators/find.js","./node_modules/rxjs/_esm2015/internal/operators/findIndex.js","./node_modules/rxjs/_esm2015/internal/operators/first.js","./node_modules/rxjs/_esm2015/internal/operators/groupBy.js","./node_modules/rxjs/_esm2015/internal/operators/ignoreElements.js","./node_modules/rxjs/_esm2015/internal/operators/isEmpty.js","./node_modules/rxjs/_esm2015/internal/operators/last.js","./node_modules/rxjs/_esm2015/internal/operators/map.js","./node_modules/rxjs/_esm2015/internal/operators/mapTo.js","./node_modules/rxjs/_esm2015/internal/operators/materialize.js","./node_modules/rxjs/_esm2015/internal/operators/max.js","./node_modules/rxjs/_esm2015/internal/operators/merge.js","./node_modules/rxjs/_esm2015/internal/operators/mergeAll.js","./node_modules/rxjs/_esm2015/internal/operators/mergeMap.js","./node_modules/rxjs/_esm2015/internal/operators/mergeMapTo.js","./node_modules/rxjs/_esm2015/internal/operators/mergeScan.js","./node_modules/rxjs/_esm2015/internal/operators/min.js","./node_modules/rxjs/_esm2015/internal/operators/multicast.js","./node_modules/rxjs/_esm2015/internal/operators/observeOn.js","./node_modules/rxjs/_esm2015/internal/operators/onErrorResumeNext.js","./node_modules/rxjs/_esm2015/internal/operators/pairwise.js","./node_modules/rxjs/_esm2015/internal/operators/partition.js","./node_modules/rxjs/_esm2015/internal/operators/pluck.js","./node_modules/rxjs/_esm2015/internal/operators/publish.js","./node_modules/rxjs/_esm2015/internal/operators/publishBehavior.js","./node_modules/rxjs/_esm2015/internal/operators/publishLast.js","./node_modules/rxjs/_esm2015/internal/operators/publishReplay.js","./node_modules/rxjs/_esm2015/internal/operators/race.js","./node_modules/rxjs/_esm2015/internal/operators/reduce.js","./node_modules/rxjs/_esm2015/internal/operators/refCount.js","./node_modules/rxjs/_esm2015/internal/operators/repeat.js","./node_modules/rxjs/_esm2015/internal/operators/repeatWhen.js","./node_modules/rxjs/_esm2015/internal/operators/retry.js","./node_modules/rxjs/_esm2015/internal/operators/retryWhen.js","./node_modules/rxjs/_esm2015/internal/operators/sample.js","./node_modules/rxjs/_esm2015/internal/operators/sampleTime.js","./node_modules/rxjs/_esm2015/internal/operators/scan.js","./node_modules/rxjs/_esm2015/internal/operators/sequenceEqual.js","./node_modules/rxjs/_esm2015/internal/operators/share.js","./node_modules/rxjs/_esm2015/internal/operators/shareReplay.js","./node_modules/rxjs/_esm2015/internal/operators/single.js","./node_modules/rxjs/_esm2015/internal/operators/skip.js","./node_modules/rxjs/_esm2015/internal/operators/skipLast.js","./node_modules/rxjs/_esm2015/internal/operators/skipUntil.js","./node_modules/rxjs/_esm2015/internal/operators/skipWhile.js","./node_modules/rxjs/_esm2015/internal/operators/startWith.js","./node_modules/rxjs/_esm2015/internal/operators/subscribeOn.js","./node_modules/rxjs/_esm2015/internal/operators/switchAll.js","./node_modules/rxjs/_esm2015/internal/operators/switchMap.js","./node_modules/rxjs/_esm2015/internal/operators/switchMapTo.js","./node_modules/rxjs/_esm2015/internal/operators/take.js","./node_modules/rxjs/_esm2015/internal/operators/takeLast.js","./node_modules/rxjs/_esm2015/internal/operators/takeUntil.js","./node_modules/rxjs/_esm2015/internal/operators/takeWhile.js","./node_modules/rxjs/_esm2015/internal/operators/tap.js","./node_modules/rxjs/_esm2015/internal/operators/throttle.js","./node_modules/rxjs/_esm2015/internal/operators/throttleTime.js","./node_modules/rxjs/_esm2015/internal/operators/throwIfEmpty.js","./node_modules/rxjs/_esm2015/internal/operators/timeInterval.js","./node_modules/rxjs/_esm2015/internal/operators/timeout.js","./node_modules/rxjs/_esm2015/internal/operators/timeoutWith.js","./node_modules/rxjs/_esm2015/internal/operators/timestamp.js","./node_modules/rxjs/_esm2015/internal/operators/toArray.js","./node_modules/rxjs/_esm2015/internal/operators/window.js","./node_modules/rxjs/_esm2015/internal/operators/windowCount.js","./node_modules/rxjs/_esm2015/internal/operators/windowTime.js","./node_modules/rxjs/_esm2015/internal/operators/windowToggle.js","./node_modules/rxjs/_esm2015/internal/operators/windowWhen.js","./node_modules/rxjs/_esm2015/internal/operators/withLatestFrom.js","./node_modules/rxjs/_esm2015/internal/operators/zip.js","./node_modules/rxjs/_esm2015/internal/operators/zipAll.js","./node_modules/rxjs/_esm2015/internal/scheduled/scheduleArray.js","./node_modules/rxjs/_esm2015/internal/scheduled/scheduleIterable.js","./node_modules/rxjs/_esm2015/internal/scheduled/scheduleObservable.js","./node_modules/rxjs/_esm2015/internal/scheduled/schedulePromise.js","./node_modules/rxjs/_esm2015/internal/scheduled/scheduled.js","./node_modules/rxjs/_esm2015/internal/scheduler/Action.js","./node_modules/rxjs/_esm2015/internal/scheduler/AnimationFrameAction.js","./node_modules/rxjs/_esm2015/internal/scheduler/AnimationFrameScheduler.js","./node_modules/rxjs/_esm2015/internal/scheduler/AsapAction.js","./node_modules/rxjs/_esm2015/internal/scheduler/AsapScheduler.js","./node_modules/rxjs/_esm2015/internal/scheduler/AsyncAction.js","./node_modules/rxjs/_esm2015/internal/scheduler/AsyncScheduler.js","./node_modules/rxjs/_esm2015/internal/scheduler/QueueAction.js","./node_modules/rxjs/_esm2015/internal/scheduler/QueueScheduler.js","./node_modules/rxjs/_esm2015/internal/scheduler/VirtualTimeScheduler.js","./node_modules/rxjs/_esm2015/internal/scheduler/animationFrame.js","./node_modules/rxjs/_esm2015/internal/scheduler/asap.js","./node_modules/rxjs/_esm2015/internal/scheduler/async.js","./node_modules/rxjs/_esm2015/internal/scheduler/queue.js","./node_modules/rxjs/_esm2015/internal/symbol/iterator.js","./node_modules/rxjs/_esm2015/internal/symbol/observable.js","./node_modules/rxjs/_esm2015/internal/symbol/rxSubscriber.js","./node_modules/rxjs/_esm2015/internal/util/ArgumentOutOfRangeError.js","./node_modules/rxjs/_esm2015/internal/util/EmptyError.js","./node_modules/rxjs/_esm2015/internal/util/Immediate.js","./node_modules/rxjs/_esm2015/internal/util/ObjectUnsubscribedError.js","./node_modules/rxjs/_esm2015/internal/util/TimeoutError.js","./node_modules/rxjs/_esm2015/internal/util/UnsubscriptionError.js","./node_modules/rxjs/_esm2015/internal/util/canReportError.js","./node_modules/rxjs/_esm2015/internal/util/hostReportError.js","./node_modules/rxjs/_esm2015/internal/util/identity.js","./node_modules/rxjs/_esm2015/internal/util/isArray.js","./node_modules/rxjs/_esm2015/internal/util/isArrayLike.js","./node_modules/rxjs/_esm2015/internal/util/isDate.js","./node_modules/rxjs/_esm2015/internal/util/isFunction.js","./node_modules/rxjs/_esm2015/internal/util/isInteropObservable.js","./node_modules/rxjs/_esm2015/internal/util/isIterable.js","./node_modules/rxjs/_esm2015/internal/util/isNumeric.js","./node_modules/rxjs/_esm2015/internal/util/isObject.js","./node_modules/rxjs/_esm2015/internal/util/isObservable.js","./node_modules/rxjs/_esm2015/internal/util/isPromise.js","./node_modules/rxjs/_esm2015/internal/util/isScheduler.js","./node_modules/rxjs/_esm2015/internal/util/noop.js","./node_modules/rxjs/_esm2015/internal/util/not.js","./node_modules/rxjs/_esm2015/internal/util/pipe.js","./node_modules/rxjs/_esm2015/internal/util/subscribeTo.js","./node_modules/rxjs/_esm2015/internal/util/subscribeToArray.js","./node_modules/rxjs/_esm2015/internal/util/subscribeToIterable.js","./node_modules/rxjs/_esm2015/internal/util/subscribeToObservable.js","./node_modules/rxjs/_esm2015/internal/util/subscribeToPromise.js","./node_modules/rxjs/_esm2015/internal/util/subscribeToResult.js","./node_modules/rxjs/_esm2015/internal/util/toSubscriber.js","./node_modules/rxjs/_esm2015/operators/index.js"],"names":[],"mappings":";;;;;;;;;;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,WAAW,iBAAiB;AAC5B;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAgB,WAAW;AAC3B,8BAA8B,iBAAiB;AAC/C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yFAAyF;AACzF,cAAc;AACd;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,WAAW,uBAAuB;AAClC;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY,sDAAsD;AAClE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4CAA4C,+BAA+B;AAC3E;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,oBAAoB;AAC3C;AACA;AACA;AACA;AACA;AACA;AACA,YAAY,qBAAqB;AACjC,YAAY,oBAAoB;AAChC;AACA;AACA;AACA;AACA;AACA;AACA,YAAY;AACZ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0BAA0B,sBAAsB;AAChD,0BAA0B,iBAAiB;AAC3C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY;AACZ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY,aAAa;AACzB,0BAA0B,aAAa;AACvC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yBAAyB,+BAA+B;AACxD;AACA;AACA,sCAAsC,+BAA+B;AACrE;AACA;AACA;AACA;AACA;AACA;AACA,YAAY;AACZ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAU,mCAAmC;AAC7C;AACA;AACA,UAAU,wBAAwB;AAClC;AACA;AACA;AACA;AACA;AACA;AACA,UAAU,YAAY;AACtB,wBAAwB,cAAc;AACtC;AACA;AACA;AACA;AACA;AACA,YAAY;AACZ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY;AACZ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY,oCAAoC;AAChD,YAAY,uCAAuC;AACnD,YAAY,yCAAyC;AACrD,YAAY,sCAAsC;AAClD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY,yBAAyB;AACrC,YAAY,0BAA0B;AACtC,YAAY,4BAA4B;AACxC,YAAY,2BAA2B;AACvC;AACA;;AAEA;AACA;AACA;AACA,YAAY;AACZ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,sBAAsB;AAC7C,wBAAwB,qBAAqB;AAC7C;AACA;AACA;AACA,gEAAgE,+BAA+B;AAC/F;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,WAAW,aAAa;AACxB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY,aAAa;AACzB,yBAAyB,aAAa;AACtC;AACA;AACA,yBAAyB,aAAa;AACtC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAc,eAAe;AAC7B;AACA;AACA;AACA,uCAAuC,gBAAgB;AACvD;AACA;AACA;AACA;AACA;AACA,cAAc,eAAe;AAC7B;AACA;AACA;AACA,uCAAuC,gBAAgB;AACvD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY,aAAa;AACzB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0BAA0B,cAAc;AACxC,2BAA2B,gBAAgB;AAC3C;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY;AACZ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY,aAAa,SAAS,GAAG;AACrC,gBAAgB,QAAQ;AACxB,YAAY,aAAa,OAAO,EAAE;AAClC;AACA,MAAM,UAAU,oCAAoC;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY;AACZ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY;AACZ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY;AACZ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,OAAO,WAAW;AAClB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,OAAO,iBAAiB;AACxB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6BAA6B,aAAa;AAC1C,mCAAmC,aAAa;AAChD;AACA;AACA,2CAA2C,aAAa;AACxD,iDAAiD,aAAa;AAC9D;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY;AACZ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA,WAAW,oDAAoD;AAC/D;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kCAAkC,aAAa;AAC/C;AACA;AACA;AACA,gBAAgB,aAAa;AAC7B;AACA,kCAAkC,aAAa;AAC/C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY;AACZ;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY;AACZ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb,eAAe;AACf;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb,2BAA2B;AAC3B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAU,+BAA+B;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB;AACjB;AACA;AACA;AACA;AACA,iBAAiB;AACjB;AACA;AACA;AACA;AACA,iBAAiB;AACjB,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEyQ;;AAEzQ,sC;;;;;;;;;;;;AChrCA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AACA;AACA;AACA;AACA;;AAE0H;AAC/E;;AAE3C;AACA;AACA;AACA;AACA;AACA;AACA;AACwC;AACxC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+CAA+C;AAC/C;AACA;AACA;AACA;AACA,uBAAuB,uEAAmB;AAC1C;AACA;AACA;AACA,uBAAuB,yEAAqB;AAC5C;AACA;AACA,kFAAkF,iBAAiB;AACnG;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yBAAyB,8DAAU;AACnC;AACA;AACA,yBAAyB,8DAAU;AACnC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA,yEAAyE,WAAW,EAAE,wBAAwB;AAC9G;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY;AACZ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2CAA2C;AAC3C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,uEAAmB;AACtC;AACA;AACA,oEAAoE,yCAAyC;AAC7G,4BAA4B,gEAAyB,EAAE,gEAAgE;AACvH,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,wDAAU;AACxB,KAAK,eAAe,EAAE;AACtB;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mCAAmC;AACnC,iCAAiC;AACjC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sDAAsD,IAAI;AAC1D,oBAAoB;AACpB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uEAAuE,IAAI;AAC3E;AACA;AACA,YAAY;AACZ;AACA,sCAAsC;AACtC;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2DAA2D;AAC3D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qCAAqC;AACrC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,0BAA0B;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,oEAAQ;AACvB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2EAA2E,QAAQ;AACnF;AACA,SAAS;AACT;AACA;AACA,kCAAkC,wBAAwB,eAAe,sBAAsB;AAC/F;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0EAA0E,QAAQ;AAClF;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA,2BAA2B,sBAAsB;AACjD;AACA;AACA;AACA,iBAAiB;AACjB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0EAA0E,UAAU;AACpF;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2DAA2D,SAAS;AACpE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uDAAuD,MAAM;AAC7D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0CAA0C,WAAW;AACrD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI,sBAAsB;AAC1B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB;AACjB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yBAAyB;AACzB,qBAAqB;AACrB;AACA,aAAa;AACb;AACA;AACA,8CAA8C;AAC9C,0BAA0B,gFAAgF,0BAA0B;AACpI;AACA;AACA;AACA;AACA;AACA;AACA,kCAAkC,oBAAoB;AACtD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gEAAgE,iEAAK,GAAG;AACxE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gCAAgC,iEAAK;AACrC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sCAAsC,8DAAU;AAChD;AACA;AACA;AACA,+EAA+E,WAAW;AAC1F;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4EAA4E,KAAK;AACjF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iEAAiE,KAAK,sCAAsC,yBAAyB,WAAW;AAChJ,qCAAqC,2EAA2E,UAAU,WAAW,QAAQ;AAC7I;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6CAA6C;AAC7C;AACA;AACA;AACA;AACA,aAAa;AACb,SAAS;AACT;AACA;AACA,qBAAqB;AACrB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+CAA+C;AAC/C;AACA;AACA;AACA;AACA;AACA,iFAAiF;AACjF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa,wCAAwC;AACrD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uEAAuE,sBAAsB;AAC7F;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY;AACZ;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY,aAAa;AACzB,0BAA0B,aAAa;AACvC;AACA;AACA;AACA;AACA;AACA,iBAAiB,wBAAwB,GAAG,wBAAwB;AACpE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY,WAAW;AACvB,0BAA0B,aAAa;AACvC,0BAA0B,aAAa;AACvC,0BAA0B,aAAa;AACvC,0BAA0B,0BAA0B;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8GAA8G,kBAAkB;AAChI;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAoB;AACpB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0CAA0C;AAC1C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB;AACjB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kCAAkC;AAClC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oCAAoC,iBAAiB,6CAA6C,iBAAiB,IAAI,iBAAiB;AACxI;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oEAAoE;AACpE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oEAAoE;AACpE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oCAAoC;AACpC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uEAAuE,8DAAU;AACjF,0CAA0C,8DAAU;AACpD,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAoB,8DAAU;AAC9B;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6BAA6B,8DAAU;AACvC;AACA;AACA,kCAAkC,8DAAU;AAC5C;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wBAAwB;AACxB;AACA;AACA;AACA;AACA;AACA;AACA,aAAa,0BAA0B;AACvC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;;AAEA;AACA;AACA;AACA;AACA,2BAA2B,YAAY;AACvC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B,8DAAU;AACzC,aAAa;AACb;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,kEAAkE,kBAAkB;AACpF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gEAAgE,kBAAkB;AAClF;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uEAAuE,qBAAqB,GAAG,MAAM;AACrG;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kCAAkC,uCAAuC;AACzE;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA,iEAAiE;AACjE;AACA,mEAAmE;AACnE;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB;AACjB;AACA,SAAS;AACT;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB;AACvB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0FAA0F,kBAAkB;AAC5G;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oCAAoC;AACpC;AACA;AACA;AACA;AACA;AACA,mHAAmH,IAAI;AACvH;AACA,8EAA8E;AAC9E;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA,2FAA2F,kBAAkB;AAC7G;AACA;AACA;AACA,wEAAwE,8DAAU;AAClF,aAAa;AACb,SAAS;AACT;AACA;AACA,0CAA0C;AAC1C,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gFAAgF,GAAG;AACnF;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sBAAsB;AACtB;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0CAA0C;AAC1C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gFAAgF,MAAM,mCAAmC,KAAK;AAC9H;AACA;AACA,0EAA0E,KAAK;AAC/E;AACA;AACA,qEAAqE,MAAM,+BAA+B,KAAK;AAC/G;AACA;AACA,sBAAsB;AACtB;AACA,4FAA4F;AAC5F;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+DAA+D,KAAK;AACpE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6EAA6E;AAC7E;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qBAAqB;AACrB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0BAA0B,qFAAqF;AAC/G;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA,aAAa;AACb,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB;AACjB,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB;AACjB;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB;AACjB;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wDAAwD;AACxD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B,QAAQ;AACvC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,iBAAiB;AAC5C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA,sBAAsB;AACtB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,wCAAwC;AACnE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B,uBAAuB;AACtD;AACA;AACA;AACA;AACA;AACA,2BAA2B,wCAAwC;AACnE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB;AACjB;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0GAA0G,kBAAkB;AAC5H;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,iCAAiC;AAC5D;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA,uBAAuB,wCAAwC;AAC/D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA,aAAa;AACb;AACA;AACA,aAAa;AACb,SAAS;AACT;AACA;AACA,oDAAoD,QAAQ;AAC5D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B;AAC/B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB;AACjB;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB;AACjB,aAAa;AACb;AACA;AACA;AACA;AACA,gCAAgC,wBAAwB;AACxD,qEAAqE,MAAM;AAC3E,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA,0IAA0I,8DAAU;AACpJ;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA,kGAAkG,8DAAU;AAC5G,SAAS;AACT;AACA;AACA;AACA,kEAAkE;AAClE,SAAS;AACT;AACA;AACA;AACA;AACA,mBAAmB,+BAA+B;AAClD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA,uBAAuB,0BAA0B;AACjD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B,iCAAiC;AAChE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB;AACjB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,uEAAmB;AAC9C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,uEAAmB;AACtC;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,uEAAmB;AAC9C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kCAAkC;AAClC;AACA;AACA,uCAAuC;AACvC;AACA;AACA,cAAc;AACd;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,oBAAoB;AACvC;AACA,8BAA8B,yEAAqB;AACnD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,eAAe;AAClC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,wDAAwD;AACxD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0DAA0D,KAAK,yDAAyD,qBAAqB;AAC7I;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sFAAsF;AACtF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,kBAAkB;AACrC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iDAAiD,eAAe,KAAK,aAAa,GAAG,YAAY,cAAc,eAAe,GAAG,WAAW;AAC5I;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sDAAsD,eAAe;AACrE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,KAAK,IAAI,MAAM;AAClC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,mBAAmB;AACtC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,kBAAkB;AACrC;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gCAAgC,uEAAmB;AACnD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wCAAwC,KAAK,EAAE;AAC/C;AACA;AACA;AACA;AACA,8BAA8B,IAAI,EAAE,aAAa,GAAG;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8CAA8C,IAAI,6BAA6B,OAAO;AACtF;AACA;AACA;AACA,0CAA0C,IAAI,EAAE,KAAK,IAAI,OAAO;AAChE;AACA;AACA,aAAa;AACb,8BAA8B,KAAK;AACnC,SAAS;AACT,yBAAyB;AACzB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iCAAiC,sBAAsB,EAAE,cAAc;AACvE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,gCAAgC,yBAAyB;AACzD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B;AAC/B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAE2zB;;AAE3zB,mC;;;;;;;;;;;;AC1kJA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AACA;AACA;AACA;AACA;;AAEoiB;;AAEpiB;AACA;AACA;AACA;AACA;AACA;AACA;AACwC;AACxC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qBAAqB,4DAAc;;AAEnC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI,eAAe;AACnB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4EAA4E;AAC5E;AACA;AACA,IAAI,uBAAuB,yBAAyB,eAAe;AACnE,WAAW,aAAa,sEAAsE;AAC9F,UAAU;AACV,IAAI,eAAe,IAAI,uBAAuB;AAC9C;AACA;AACA;AACA;AACA;AACA;AACA,8DAA8D,sCAAsC;AACpG,yBAAyB,wEAAkB,EAAE,uFAAuF;AACpI,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,wDAAU;AACxB;AACA;AACA;AACA;AACA,aAAa;AACb,KAAK,eAAe,EAAE;AACtB;AACA,WAAW,8DAAQ;AACnB;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iCAAiC,4DAAc;AAC/C;AACA;AACA;AACA,IAAI,eAAe;AACnB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4EAA4E,2CAA2C,sDAAe,YAAY;AAClJ,gCAAgC,wEAAkB,EAAE,iGAAiG;AACrJ;AACA,KAAK,gCAAgC,OAAO,oDAAM,qBAAqB;AACvE;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,wDAAU;AACxB;AACA;AACA;AACA;AACA,aAAa;AACb,KAAK,gBAAgB,UAAU;AAC/B,sBAAsB,oDAAM;AAC5B;AACA,aAAa,GAAG,EAAE,EAAE,QAAQ,EAAE;AAC9B;AACA;AACA;AACA;AACA,uCAAuC,8DAAQ;AAC/C;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8DAA8D,sCAAsC;AACpG,yBAAyB,wEAAkB,EAAE,gFAAgF;AAC7H,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,wDAAU;AACxB,gBAAgB,0DAA0D;AAC1E,KAAK,eAAe,EAAE;AACtB;AACA;AACA,qBAAqB,8DAAQ;AAC7B,oCAAoC,8DAAQ;AAC5C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,WAAW,oBAAoB;AAC/B,WAAW,cAAc;AACzB;AACA;AACA,kBAAkB,4CAA4C;AAC9D,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA,0BAA0B,4DAAc;AACxC;AACA;AACA,MAAM,uBAAuB,wBAAwB,eAAe;AACpE;AACA;AACA;AACA;AACA,+DAA+D;AAC/D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wCAAwC,SAAS,EAAE,KAAK;AACxD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sEAAsE,wCAAwC,sDAAe,oBAAoB,sDAAe,oBAAoB;AACpL,6BAA6B,gEAAyB,EAAE,kEAAkE;AAC1H;AACA,KAAK,yBAAyB;AAC9B,KAAK,6BAA6B,OAAO,sDAAQ,EAAE,GAAG,OAAO,oDAAM,0BAA0B;AAC7F;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,wDAAU;AACxB,KAAK,gBAAgB,UAAU,yBAAyB,GAAG;AAC3D,sBAAsB,sDAAQ;AAC9B,aAAa;AACb,sBAAsB,oDAAM;AAC5B;AACA,aAAa,GAAG,EAAE,EAAE,QAAQ,EAAE;;AAE9B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAM,uBAAuB,wBAAwB,eAAe;AACpE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sEAAsE,wCAAwC,sDAAe,oBAAoB,sDAAe,oBAAoB;AACpL,6BAA6B,gEAAyB,EAAE,kEAAkE;AAC1H;AACA,KAAK,yBAAyB;AAC9B,KAAK,6BAA6B,OAAO,sDAAQ,EAAE,GAAG,OAAO,oDAAM,0BAA0B;AAC7F;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,wDAAU;AACxB,KAAK,gBAAgB,UAAU,yBAAyB,GAAG;AAC3D,sBAAsB,sDAAQ;AAC9B,aAAa;AACb,sBAAsB,oDAAM;AAC5B;AACA,aAAa,GAAG,EAAE,EAAE,QAAQ,EAAE;;AAE9B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4BAA4B,0DAAY;AACxC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wCAAwC,mDAAmD;AAC3F;AACA;AACA,8CAA8C,4BAA4B,sDAAe,oBAAoB,sDAAe,oBAAoB;AAChJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB,wEAAkB,EAAE,+DAA+D;AACpG;AACA,KAAK,yBAAyB;AAC9B,KAAK;AACL;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,wDAAU;AACxB;AACA;AACA;AACA;AACA,aAAa;AACb,KAAK,gBAAgB,UAAU,yBAAyB,GAAG,yBAAyB,EAAE,EAAE,QAAQ,EAAE;AAClG;AACA,wBAAwB,8DAAQ,oBAAoB,8DAAQ;AAC5D;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,CAAC,8CAA8C;AAC/C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,CAAC,wBAAwB;AACzB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,CAAC,8BAA8B;AAC/B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,CAAC,4CAA4C;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,CAAC,kCAAkC;AACnC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,CAAC,oCAAoC;AACrC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,CAAC,0BAA0B;AAC3B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,WAAW,qEAAe,SAAS,8DAAgB;AACnD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB,qEAAe;AAChC;AACA,aAAa,8DAAgB,yBAAyB,8DAAgB;AACtE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB,qEAAe;AAChC,2BAA2B,8DAAgB,mBAAmB,8DAAgB;AAC9E;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB,qEAAe;AAChC,6BAA6B,8DAAgB,qBAAqB,8DAAgB;AAClF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB,qEAAe;AAChC,0BAA0B,8DAAgB;AAC1C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB,qEAAe;AAChC,gBAAgB,8DAAgB;AAChC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB,qEAAe;AAChC,gBAAgB,8DAAgB;AAChC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB,qEAAe;AAChC,oCAAoC,8DAAgB;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,iBAAiB,qEAAe;AAChC,oCAAoC,8DAAgB;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB,qEAAe;AAChC,oCAAoC,8DAAgB;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB,qEAAe;AAChC,qBAAqB,8DAAgB;AACrC;AACA;AACA,wBAAwB,8DAAgB;AACxC;AACA;AACA,wBAAwB,8DAAgB;AACxC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB,qEAAe;AAChC,gBAAgB,8DAAgB;AAChC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB,qEAAe;AAChC,gBAAgB,8DAAgB;AAChC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB,qEAAe;AAChC,gBAAgB,8DAAgB;AAChC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,WAAW,4EAAsB;AACjC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB,qEAAe;AAChC,gBAAgB,8DAAgB;AAChC;AACA;AACA;AACA;AACA;AACA,4BAA4B,kEAAoB;AAChD;AACA,cAAc,8DAAgB;AAC9B,qEAAqE,KAAK,8DAAgB;AAC1F,uBAAuB;AACvB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB,qEAAe;AAChC;AACA,uBAAuB,8DAAgB;AACvC;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB,qEAAe;AAChC;AACA;AACA,aAAa,8DAAgB;AAC7B,aAAa,8DAAgB;AAC7B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB,qEAAe;AAChC,gBAAgB,8DAAgB;AAChC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,QAAQ;AAC/B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY;AACZ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iCAAiC,EAAE;AACnC;AACA;AACA,kFAAkF,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,EAAE,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI;AAClN;AACA;AACA;AACA;AACA;AACA;AACA,CAAC,8BAA8B;AAC/B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,CAAC,4BAA4B;AAC7B;AACA;AACA;AACA;AACA;AACA;AACA,CAAC,0CAA0C;AAC3C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6BAA6B,IAAI,IAAI;AACrC;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uDAAuD,KAAK;AAC5D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sEAAsE;AACtE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0BAA0B;AAC1B;AACA;AACA;AACA;AACA;AACA,iBAAiB;AACjB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2DAA2D,WAAW;AACtE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uDAAuD,MAAM;AAC7D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oDAAoD;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kBAAkB,EAAE,IAAI,IAAI,IAAI,IAAI;AACpC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8CAA8C,MAAM;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sBAAsB;AACtB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mCAAmC,WAAW;AAC9C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAc,qBAAqB;AACnC;AACA;AACA;AACA,cAAc,gBAAgB;AAC9B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK,iBAAiB,EAAE,kBAAkB,EAAE,kBAAkB;AAC9D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK,iBAAiB,EAAE,kBAAkB,EAAE,kBAAkB;AAC9D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK,iBAAiB,EAAE,kBAAkB,EAAE,kBAAkB;AAC9D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,qBAAqB;AACxC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,gCAAgC,OAAO;AACtD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,YAAY;AAC/B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY;AACZ;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wEAAwE,QAAQ,gCAAgC,QAAQ;AACxH;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6BAA6B,mBAAmB;AAChD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,aAAa;AACpC;AACA;AACA;AACA;AACA,2BAA2B,aAAa;AACxC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAU,yCAAyC;AACnD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wCAAwC;AACxC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B;AAC/B,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kBAAkB,MAAM;AACxB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0DAA0D,MAAM;AAChE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sEAAsE,wCAAwC,sDAAe,CAAC,uDAAS,GAAG;AAC1I,6BAA6B,gEAAyB,EAAE,kEAAkE;AAC1H;AACA,KAAK,6BAA6B,OAAO,oDAAM,SAAS,uDAAS,IAAI;AACrE;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,wDAAU;AACxB,KAAK,gBAAgB,UAAU;AAC/B,sBAAsB,oDAAM;AAC5B,uBAAuB,uDAAS;AAChC,aAAa,GAAG,EAAE,EAAE,QAAQ,EAAE;;AAE9B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,WAAW,yEAAmB;AAC9B;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2CAA2C;AAC3C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iCAAiC,8CAA8C;AAC/E;AACA;AACA;AACA,iCAAiC,8BAA8B;AAC/D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAgB,yEAAmB;AACnC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iGAAiG,gEAAU,cAAc;AACzH;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA,4CAA4C,2BAA2B,+DAAwB,CAAC,6DAAsB,GAAG,+DAAwB,CAAC,6DAAsB,GAAG,+DAAwB,CAAC,wDAAiB,GAAG,+DAAwB,CAAC,uDAAgB,GAAG;AACpQ,eAAe,+DAAwB,EAAE,2DAA2D,gDAAgD,EAAE;AACtJ;AACA,KAAK,OAAO,6DAAe,EAAE;AAC7B,KAAK,OAAO,6DAAe,EAAE;AAC7B,KAAK,OAAO,wDAAU,EAAE;AACxB,KAAK,OAAO,uDAAS;AACrB;AACA;AACA,aAAa,OAAO,mDAAK,oBAAoB;AAC7C,eAAe,OAAO,mDAAK,sBAAsB;AACjD;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,uDAAS;AACvB,gBAAgB,wBAAwB;AACxC,KAAK,gBAAgB,UAAU,OAAO,6DAAsB,EAAE,GAAG,OAAO,6DAAsB,EAAE,GAAG,OAAO,wDAAiB,EAAE,GAAG,OAAO,uDAAgB,EAAE,EAAE,EAAE,GAAG;AAChK,kBAAkB,mDAAK;AACvB;AACA,SAAS;AACT,kBAAkB,mDAAK;AACvB;AACA,SAAS,GAAG,EAAE,EAAE;;AAEhB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0BAA0B,gBAAgB;AAC1C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mDAAmD,eAAe;AAClE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qEAAqE;AACrE;AACA;AACA;AACA;AACA;AACA;AACA,oEAAoE;AACpE;AACA;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wDAAwD,yDAAW;AACnE;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B,sEAAwB;AACvD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gEAAgE,qCAAqC,+DAAwB,CAAC,8DAAuB,GAAG;AACxJ,yBAAyB,+DAAwB,EAAE,+EAA+E,6NAA6N,aAAa,kEAA2B,GAAG;AAC1Y;AACA,KAAK,OAAO,8DAAgB;AAC5B;AACA;AACA,yBAAyB,OAAO,mDAAK,EAAE;AACvC,iCAAiC,OAAO,mDAAK,EAAE;AAC/C,gCAAgC,OAAO,mDAAK,EAAE;AAC9C,wCAAwC,OAAO,mDAAK,EAAE;AACtD;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,uDAAS;AACvB,gBAAgB,kCAAkC;AAClD,KAAK,gBAAgB,UAAU,OAAO,8DAAuB,EAAE,EAAE,EAAE,GAAG;AACtE,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS,GAAG,EAAE,EAAE;;AAEhB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iCAAiC,YAAY;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iCAAiC,YAAY;AAC7C,QAAQ,GAAG,GAAG,cAAc,IAAI,MAAM;AACtC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY,+DAAS;AACrB;AACA;AACA,yEAAyE,mBAAmB;AAC5F;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+CAA+C;AAC/C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+EAA+E,MAAM,aAAa,mBAAmB;AACrH;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT,uBAAuB,yBAAyB;AAChD;AACA;AACA,0DAA0D,UAAU;AACpE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4CAA4C,2BAA2B,+DAAwB,CAAC,8DAAuB,GAAG,+DAAwB,CAAC,yDAAkB,GAAG,+DAAwB,CAAC,6DAAsB,GAAG;AAC1N,eAAe,+DAAwB,EAAE,wEAAwE,mFAAmF,EAAE;AACtM;AACA,KAAK,OAAO,8DAAgB,EAAE;AAC9B,KAAK,OAAO,yDAAW,EAAE;AACzB,KAAK,OAAO,6DAAe;AAC3B;AACA;AACA,eAAe,OAAO,mDAAK,EAAE;AAC7B,oBAAoB,OAAO,mDAAK,EAAE;AAClC,qBAAqB,OAAO,mDAAK,EAAE;AACnC;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,uDAAS;AACvB,gBAAgB,+BAA+B;AAC/C,KAAK,gBAAgB,UAAU,OAAO,8DAAuB,EAAE,GAAG,OAAO,yDAAkB,EAAE,GAAG,OAAO,6DAAsB,EAAE,EAAE,EAAE,GAAG;AACtI,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS,GAAG,EAAE,EAAE;AAChB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yBAAyB;AACzB;AACA;AACA;AACA;AACA;AACA;AACA,yBAAyB;AACzB;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kCAAkC,mBAAmB,OAAO;AAC5D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iCAAiC;AACjC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iCAAiC;AACjC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sCAAsC,wBAAwB,+DAAwB,CAAC,8DAAuB,GAAG,+DAAwB,CAAC,yDAAkB,GAAG;AAC/J,YAAY,+DAAwB,EAAE,qDAAqD,2DAA2D,EAAE;AACxJ;AACA,KAAK,OAAO,8DAAgB,EAAE;AAC9B,KAAK,OAAO,yDAAW;AACvB;AACA;AACA,YAAY,OAAO,mDAAK,EAAE;AAC1B,gBAAgB,OAAO,mDAAK,EAAE;AAC9B,gBAAgB,OAAO,mDAAK,EAAE;AAC9B;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,uDAAS;AACvB,gBAAgB,qBAAqB;AACrC,KAAK,gBAAgB,UAAU,OAAO,8DAAuB,EAAE,GAAG,OAAO,yDAAkB,EAAE,EAAE,EAAE,GAAG;AACpG,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS,GAAG,EAAE,EAAE;AAChB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,SAAS,wCAAwC,gEAAU,cAAc;AACpG;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,+BAA+B;AAC1D;AACA;AACA;AACA;AACA;AACA;AACA,8CAA8C,8BAA8B;AAC5E,gBAAgB,+DAAwB,EAAE,6DAA6D,uBAAuB,EAAE;AAChI;AACA,gBAAgB,OAAO,mDAAK,EAAE;AAC9B;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,uDAAS;AACvB,gBAAgB,yBAAyB;AACzC,KAAK,gBAAgB,WAAW,EAAE,GAAG;AACrC,kBAAkB,mDAAK;AACvB,SAAS,GAAG,EAAE,EAAE;AAChB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sDAAsD,gCAAgC,+DAAwB,CAAC,8DAAuB,GAAG,+DAAwB,CAAC,yDAAkB,GAAG,+DAAwB,eAAe;AAC9N,oBAAoB,+DAAwB,EAAE,qEAAqE,+BAA+B,EAAE;AACpJ;AACA,KAAK,OAAO,8DAAgB,EAAE;AAC9B,KAAK,OAAO,yDAAW,EAAE;AACzB,KAAK,+BAA+B,OAAO,kDAAI,EAAE;AACjD;AACA;AACA,oBAAoB,OAAO,mDAAK,EAAE;AAClC;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,uDAAS;AACvB,gBAAgB,6BAA6B;AAC7C,KAAK,gBAAgB,UAAU,OAAO,8DAAuB,EAAE,GAAG,OAAO,yDAAkB,EAAE,GAAG;AAChG,sBAAsB,kDAAI;AAC1B,aAAa,GAAG,EAAE,EAAE,GAAG;AACvB,kBAAkB,mDAAK;AACvB,SAAS,GAAG,EAAE,EAAE;AAChB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4DAA4D,mCAAmC,+DAAwB,CAAC,8DAAuB,GAAG,+DAAwB,CAAC,yDAAkB,GAAG,+DAAwB,eAAe;AACvO,uBAAuB,+DAAwB,EAAE,kEAAkE;AACnH;AACA,KAAK,OAAO,8DAAgB,EAAE;AAC9B,KAAK,OAAO,yDAAW,EAAE;AACzB,KAAK,+BAA+B,OAAO,kDAAI,EAAE;AACjD;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,uDAAS;AACvB,gBAAgB,gCAAgC;AAChD,KAAK,gBAAgB,UAAU,OAAO,8DAAuB,EAAE,GAAG,OAAO,yDAAkB,EAAE,GAAG;AAChG,sBAAsB,kDAAI;AAC1B,aAAa,GAAG,EAAE,EAAE,QAAQ,EAAE;;AAE9B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8CAA8C,4BAA4B,+DAAwB,kBAAkB;AACpH,gBAAgB,+DAAwB,EAAE,6DAA6D,uBAAuB,EAAE;AAChI;AACA,KAAK;AACL;AACA;AACA,gBAAgB,OAAO,mDAAK,EAAE;AAC9B;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,uDAAS;AACvB,gBAAgB,yBAAyB;AACzC,KAAK,gBAAgB,UAAU,uBAAuB,EAAE,EAAE,GAAG;AAC7D,kBAAkB,mDAAK;AACvB,SAAS,GAAG,EAAE,EAAE;AAChB;AACA;AACA;AACA;AACA;AACA,8DAA8D,eAAe;AAC7E;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAQ,eAAe;AACvB;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yCAAyC,MAAM;AAC/C;AACA;AACA,sDAAsD,gCAAgC,+DAAwB,kBAAkB,+DAAwB,CAAC,yDAAkB,GAAG,+DAAwB,CAAC,8DAAuB,GAAG,+DAAwB,eAAe;AACxQ,oBAAoB,+DAAwB,EAAE,4DAA4D;AAC1G;AACA,KAAK,6BAA6B,OAAO,uDAAS,2BAA2B,GAAG;AAChF,KAAK,OAAO,yDAAW,EAAE;AACzB,KAAK,OAAO,8DAAgB,EAAE;AAC9B,KAAK,+BAA+B,OAAO,kDAAI,EAAE;AACjD;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,uDAAS;AACvB,gBAAgB,6BAA6B;AAC7C,KAAK,gBAAgB,UAAU;AAC/B,sBAAsB,uDAAS;AAC/B;AACA,aAAa,GAAG,GAAG,OAAO,yDAAkB,EAAE,GAAG,OAAO,8DAAuB,EAAE,GAAG;AACpF,sBAAsB,kDAAI;AAC1B,aAAa,GAAG,EAAE,EAAE,QAAQ,EAAE;;AAE9B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6BAA6B,uBAAuB;AACpD;AACA;AACA;AACA;AACA;AACA,6BAA6B,yBAAyB;AACtD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2CAA2C,MAAM,EAAE,KAAK;AACxD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4CAA4C,2BAA2B,+DAAwB,CAAC,wDAAiB,GAAG,+DAAwB,CAAC,6DAAsB,GAAG,+DAAwB,CAAC,uDAAgB,GAAG;AAClN,eAAe,+DAAwB,EAAE,2DAA2D,qBAAqB,EAAE;AAC3H;AACA,KAAK,OAAO,wDAAU,EAAE;AACxB,KAAK,OAAO,6DAAe,EAAE;AAC7B,KAAK,OAAO,uDAAS;AACrB;AACA;AACA,eAAe,OAAO,mDAAK,sBAAsB;AACjD;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,uDAAS;AACvB,gBAAgB,wBAAwB;AACxC,KAAK,gBAAgB,UAAU,OAAO,wDAAiB,EAAE,GAAG,OAAO,6DAAsB,EAAE,GAAG,OAAO,uDAAgB,EAAE,EAAE,EAAE,GAAG;AAC9H,kBAAkB,mDAAK;AACvB;AACA,SAAS,GAAG,EAAE,EAAE;;AAEhB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mDAAmD;AACnD;AACA;AACA;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8CAA8C,sBAAsB;AACpE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qEAAqE;AACrE,oEAAoE;AACpE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8DAA8D,oCAAoC,+DAAwB,CAAC,8DAAuB,GAAG;AACrJ,wBAAwB,+DAAwB,EAAE,6EAA6E,2FAA2F,aAAa,kEAA2B,GAAG;AACrQ;AACA,KAAK,OAAO,8DAAgB;AAC5B;AACA;AACA,+BAA+B,OAAO,mDAAK,EAAE;AAC7C,wBAAwB,OAAO,mDAAK,EAAE;AACtC;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,uDAAS;AACvB,gBAAgB,iCAAiC;AACjD,KAAK,gBAAgB,UAAU,OAAO,8DAAuB,EAAE,EAAE,EAAE,GAAG;AACtE,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS,GAAG,EAAE,EAAE;;AAEhB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0CAA0C,MAAM,cAAc,gEAAU,OAAO;AAC/E;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA,2BAA2B;AAC3B,6BAA6B;AAC7B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY,gEAAU;AACtB;AACA;AACA,YAAY,mEAAa;AACzB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gDAAgD,6BAA6B,2EAAoC,IAAI;AACrH,kBAAkB,0DAAmB,EAAE,8CAA8C;AACrF;AACA,KAAK,OAAO,+DAAiB;AAC7B;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,kDAAI;AAClB,gBAAgB,6BAA6B;AAC7C,KAAK,gBAAgB,UAAU,OAAO,+DAAwB,EAAE,EAAE,EAAE,QAAQ,EAAE;;AAE9E;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wDAAwD,mCAAmC;AAC3F,sBAAsB,0DAAmB,EAAE,qDAAqD;AAChG,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,kDAAI;AAClB,gBAAgB,oBAAoB;AACpC,KAAK,eAAe,EAAE;AACtB;AACA;AACA,gCAAgC,EAAE;AAClC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wDAAwD,mCAAmC;AAC3F,sBAAsB,0DAAmB,EAAE,qDAAqD;AAChG,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,kDAAI;AAClB,gBAAgB,oBAAoB;AACpC,KAAK,eAAe,EAAE;AACtB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wDAAwD,mCAAmC;AAC3F,sBAAsB,0DAAmB,EAAE,qDAAqD;AAChG,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,kDAAI;AAClB,gBAAgB,oBAAoB;AACpC,KAAK,eAAe,EAAE;;AAEtB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK,kBAAkB;AACvB,KAAK,2BAA2B;AAChC,KAAK,8BAA8B;AACnC,KAAK,0BAA0B;AAC/B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAoB,cAAc;AAClC,6BAA6B,yBAAyB;AACtD,uBAAuB,yBAAyB;AAChD;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8CAA8C,4BAA4B,+DAAwB,CAAC,uDAAS,GAAG;AAC/G,iBAAiB,0DAAmB,EAAE,2CAA2C;AACjF;AACA,KAAK,6BAA6B,OAAO,oDAAM,SAAS,uDAAS,IAAI;AACrE;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,kDAAI;AAClB,gBAAgB,2BAA2B;AAC3C,KAAK,gBAAgB,UAAU;AAC/B,sBAAsB,oDAAM;AAC5B,uBAAuB,uDAAS;AAChC,aAAa,GAAG,EAAE,EAAE,QAAQ,EAAE;;AAE9B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8EAA8E,gBAAgB;AAC9F;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0DAA0D,kCAAkC,+DAAwB,kBAAkB;AACtI,uBAAuB,0DAAmB,EAAE,uDAAuD;AACnG;AACA,KAAK;AACL;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,kDAAI;AAClB,gBAAgB,iCAAiC;AACjD,KAAK,gBAAgB,UAAU,uBAAuB,EAAE,EAAE,QAAQ,EAAE;;AAEpE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0DAA0D,oCAAoC;AAC9F,uBAAuB,0DAAmB,EAAE,uDAAuD;AACnG,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,kDAAI;AAClB,gBAAgB,iCAAiC;AACjD,KAAK,eAAe,EAAE;;AAEtB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8CAA8C,8BAA8B;AAC5E,iBAAiB,0DAAmB,EAAE,4CAA4C;AAClF,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,kDAAI;AAClB,gBAAgB,4BAA4B;AAC5C,KAAK,eAAe,EAAE;;AAEtB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY;AACZ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA,sDAAsD,gCAAgC,+DAAwB,CAAC,6DAAsB,GAAG;AACxI,qBAAqB,0DAAmB,EAAE,oDAAoD;AAC9F;AACA,KAAK,OAAO,6DAAe;AAC3B;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,kDAAI;AAClB,gBAAgB,gCAAgC;AAChD,KAAK,gBAAgB,UAAU,OAAO,6DAAsB,EAAE,EAAE,EAAE,QAAQ,EAAE;AAC5E;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAc,iBAAiB,EAAE,kBAAkB,EAAE,kBAAkB;AACvE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oDAAoD,+BAA+B,+DAAwB,CAAC,uDAAS,GAAG;AACxH,oBAAoB,0DAAmB,EAAE,gDAAgD;AACzF;AACA,KAAK,6BAA6B,OAAO,oDAAM,SAAS,uDAAS,IAAI;AACrE;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,kDAAI;AAClB,gBAAgB,iBAAiB;AACjC,KAAK,gBAAgB,UAAU;AAC/B,sBAAsB,oDAAM;AAC5B,uBAAuB,uDAAS;AAChC,aAAa,GAAG,EAAE,EAAE,QAAQ,EAAE;AAC9B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAc,iBAAiB,EAAE,kBAAkB,EAAE,kBAAkB;AACvE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oDAAoD,+BAA+B,+DAAwB,CAAC,uDAAS,GAAG;AACxH,oBAAoB,0DAAmB,EAAE,iDAAiD;AAC1F;AACA,KAAK,6BAA6B,OAAO,oDAAM,SAAS,uDAAS,IAAI;AACrE;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,kDAAI;AAClB,gBAAgB,kBAAkB;AAClC,KAAK,gBAAgB,UAAU;AAC/B,sBAAsB,oDAAM;AAC5B,uBAAuB,uDAAS;AAChC,aAAa,GAAG,EAAE,EAAE,QAAQ,EAAE;AAC9B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAc,iBAAiB,EAAE,kBAAkB,EAAE,kBAAkB;AACvE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sDAAsD,gCAAgC,+DAAwB,CAAC,uDAAS,GAAG,+DAAwB,CAAC,mEAAqB,GAAG;AAC5K,qBAAqB,0DAAmB,EAAE,mDAAmD;AAC7F;AACA,KAAK,6BAA6B,OAAO,oDAAM,SAAS,uDAAS,IAAI,GAAG;AACxE,KAAK,6BAA6B,OAAO,oDAAM,SAAS,mEAAqB,IAAI;AACjF;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,kDAAI;AAClB,gBAAgB,mBAAmB;AACnC,KAAK,gBAAgB,UAAU;AAC/B,sBAAsB,oDAAM;AAC5B,uBAAuB,uDAAS;AAChC,aAAa,GAAG,GAAG;AACnB,sBAAsB,oDAAM;AAC5B,uBAAuB,mEAAqB;AAC5C,aAAa,GAAG,EAAE,EAAE,QAAQ,EAAE;AAC9B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,MAAM;AACjC;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gDAAgD,+BAA+B;AAC/E,kBAAkB,0DAAmB,EAAE,8CAA8C;AACrF,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,kDAAI;AAClB,gBAAgB,6BAA6B;AAC7C,KAAK,eAAe,EAAE;;AAEtB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAoB,8DAAuB,EAAE,qBAAqB;AAClE,oBAAoB,8DAAuB,EAAE,4CAA4C,kCAAkC,EAAE;AAC7H,SAAS,0DAA0D;AACnE,OAAO;AACP,cAAc,oDAAoD,gEAAyB,gBAAgB,ooBAAooB,EAAE,EAAE;AACnvB,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,sDAAQ;AACtB;AACA;AACA;AACA;AACA,qBAAqB,0DAA0D;AAC/E;AACA,aAAa;AACb,KAAK,eAAe,EAAE;;AAEtB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAoB,qDAAO;;AAE3B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yBAAyB,wEAAkB;AAC3C;AACA;AACA,+CAA+C,8DAAQ,oBAAoB,8DAAQ,CAAC,0DAAY;AAChG,CAAC;AACD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uEAAuE,OAAO;AAC9E;AACA;AACA;AACA;AACA,+EAA+E,OAAO;AACtF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB;AACvB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gCAAgC;AAChC;AACA;AACA;AACA,4BAA4B;AAC5B;AACA;AACA;AACA,oDAAoD;AACpD;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAE+/D;;AAE//D,kC;;;;;;;;;;;;ACv2KA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AACA;AACA;AACA;AACA;;AAE2E;AACpC;;AAEvC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY,eAAe;AAC3B;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAc;AACd;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6DAA6D,YAAY;AACzE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4DAA4D,YAAY;AACxE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uEAAuE,UAAU,EAAE;AACnF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wBAAwB,QAAQ;AAChC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gCAAgC,gBAAgB;AAChD;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,CAAC,kCAAkC;;AAEnC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iEAAiE,SAAS;AAC1E,0GAA0G,SAAS;AACnH;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4CAA4C,gCAAgC;AAC5E,2CAA2C,+BAA+B;AAC1E;AACA;AACA;AACA;AACA;AACA;AACA,qDAAqD,wCAAwC;AAC7F;AACA,kDAAkD,0CAA0C;AAC5F,gDAAgD,wCAAwC;;AAExF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kBAAkB,qBAAqB;AACvC;AACA;AACA,kBAAkB,WAAW;AAC7B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gDAAgD,0CAA0C;AAC1F;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,CAAC,4DAA4D;AAC7D;AACA;AACA;AACA;AACA;AACA;AACA;AACA,CAAC,0CAA0C;AAC3C;AACA;AACA;AACA;AACA;AACA;AACA,CAAC,8CAA8C;;AAE/C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qFAAqF;AACrF;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4CAA4C,+BAA+B;AAC3E,2CAA2C,+BAA+B;AAC1E,4CAA4C,gCAAgC;AAC5E,2CAA2C,+BAA+B;AAC1E,8CAA8C,+BAA+B;AAC7E,+CAA+C,+BAA+B;AAC9E;AACA;AACA;AACA;AACA;AACA;AACA,8CAA8C,4CAA4C;;AAE1F;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0BAA0B;AAC1B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA,iCAAiC,WAAW;AAC5C;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0CAA0C,kCAAkC;AAC5E;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gHAAgH,MAAM;AACtH;;AAEA,2DAA2D,MAAM;AACjE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4CAA4C,iBAAiB;AAC7D;AACA;AACA;AACA,mBAAmB,kBAAkB;AACrC;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,gBAAgB;AAC3C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0EAA0E,iBAAiB;AAC3F;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAoB,EAAE,kBAAkB;AACxC;AACA,cAAc,kBAAkB,EAAE,iCAAiC,GAAG,QAAQ,KAAK,+BAA+B;AAClH;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wCAAwC,IAAI;AAC5C,mDAAmD,SAAS,GAAG,WAAW,GAAG,OAAO;AACpF;AACA;AACA;AACA;AACA;AACA,oIAAoI,gBAAgB;AACpJ;AACA;AACA;AACA,oEAAoE,OAAO,WAAW,MAAM;AAC5F;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,kBAAkB;AACrC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,iBAAiB;AACpC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,UAAU;AAC7B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAoB;AACpB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oDAAoD;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B;AAC/B;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,CAAC,0DAA0D;AAC3D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,CAAC,oDAAoD;AACrD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+EAA+E,gBAAgB;AAC/F;AACA,QAAQ,4CAA4C;AACpD;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gEAAgE,8BAA8B;AAC9F,QAAQ,oCAAoC;AAC5C;AACA;AACA;AACA;AACA;AACA;AACA,iCAAiC,4BAA4B;AAC7D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,CAAC,kDAAkD;;AAEnD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAM;AACN;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gDAAgD;AAChD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4BAA4B,UAAU;AACtC;AACA;AACA;AACA;AACA;AACA;AACA,4BAA4B,UAAU;AACtC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAM;AACN;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAM;AACN;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gCAAgC,gBAAgB;AAChD;AACA;AACA;AACA;AACA;AACA;AACA,gCAAgC,gBAAgB;AAChD;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4CAA4C,MAAM,4CAA4C,WAAW;AACzG;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI,oBAAoB;AACxB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mCAAmC,+BAA+B;AAClE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAc,mBAAmB;AACjC;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yCAAyC,qCAAqC;AAC9E,kFAAkF;AAClF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,CAAC,kDAAkD;AACnD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+CAA+C;AAC/C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAc,eAAe;AAC7B;AACA;AACA;AACA;AACA;AACA;AACA,yCAAyC;AACzC;AACA,cAAc,eAAe;AAC7B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAQ,eAAe;AACvB;AACA;AACA;AACA;AACA;AACA;AACA;AACA,WAAW,mCAAmC;AAC9C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAQ,eAAe;AACvB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gEAAgE,SAAS;AACzE;AACA;AACA,eAAe,8FAA8F;AAC7G;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mEAAmE,qBAAqB;AACxF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4BAA4B,gBAAgB;AAC5C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iDAAiD,eAAe;AAChE;AACA;AACA;AACA;AACA,oGAAoG,+BAA+B,WAAW,qBAAqB;AACnK;AACA;AACA;AACA;AACA,yGAAyG,+BAA+B,WAAW,qBAAqB;AACxK;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,gBAAgB;AACvC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY;AACZ;AACA;AACA;AACA;AACA;AACA;AACA,YAAY;AACZ;AACA;AACA;AACA;AACA;AACA;AACA,YAAY;AACZ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAQ;AACR;AACA;AACA,QAAQ;AACR;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uCAAuC;AACvC,oCAAoC;AACpC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,OAAO;AAC9B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0CAA0C;AAC1C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qDAAqD;AACrD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uDAAuD,yBAAyB;AAChF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oDAAoD,yBAAyB;AAC7E;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B,cAAc;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gDAAgD,gCAAgC;AAChF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,QAAQ,cAAc,uEAAuE;AAChH;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kBAAkB,gDAAgD;AAClE,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yDAAyD,2CAA2C;AACpG;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2CAA2C,KAAK,UAAU,WAAW;AACrE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAoB,oBAAoB;AACxC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAoB,qBAAqB;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAoB,sBAAsB;AAC1C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAoB,mBAAmB;AACvC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAoB,2BAA2B;AAC/C;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wCAAwC,OAAO;AAC/C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yBAAyB;AACzB;AACA;AACA,cAAc;AACd;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0DAA0D;AAC1D;AACA,gBAAgB;AAChB;AACA,wBAAwB;AACxB;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uIAAuI;AACvI;AACA;AACA;AACA;AACA;AACA,6DAA6D,IAAI;AACjE;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,oBAAoB;AAC3C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yFAAyF,eAAe;AACxG;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qCAAqC;AACrC;AACA;AACA;AACA,+EAA+E;AAC/E,KAAK;AACL;AACA,8CAA8C;AAC9C,KAAK;AACL,4BAA4B;AAC5B,4BAA4B;AAC5B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,CAAC,0CAA0C;;AAE3C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0DAA0D,kCAAkC;AAC5F;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0DAA0D,mCAAmC;AAC7F;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0DAA0D,iCAAiC;AAC3F;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sDAAsD,yCAAyC;AAC/F;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yDAAyD;AACzD,iCAAiC;AACjC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kDAAkD,KAAK;AACvD,2BAA2B,cAAc;AACzC,qBAAqB,KAAK;AAC1B;AACA;AACA;AACA;AACA;AACA;AACA,mDAAmD,KAAK;AACxD,2BAA2B,cAAc;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qEAAqE,KAAK,gBAAgB;AAC1F;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yBAAyB,KAAK;AAC9B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B,uBAAuB;AACtD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,6BAA6B;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yCAAyC,uBAAuB;AAChE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,6BAA6B;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,6DAA6D,MAAM;AACnE;AACA;AACA;AACA,mEAAmE,cAAc;AACjF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yEAAyE,0BAA0B;AACnG;AACA,0DAA0D,wBAAwB;AAClF;AACA;AACA;AACA,sCAAsC,SAAS;AAC/C,yHAAyH,MAAM,KAAK,SAAS,qBAAqB,UAAU;AAC5K;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,mBAAmB;AACtC;AACA,uBAAuB,eAAe,EAAE,UAAU;AAClD,uBAAuB,4DAA4D,EAAE,UAAU;AAC/F;AACA,YAAY;AACZ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAgB;AAChB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY;AACZ;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,qBAAqB;AACxC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,qBAAqB;AACxC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,sBAAsB;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qCAAqC,iBAAiB;AACtD;AACA;AACA;AACA;AACA,uBAAuB,qBAAqB;AAC5C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY;AACZ;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qEAAqE,yBAAyB;;AAE9F;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+CAA+C,eAAe;AAC9D,4CAA4C,cAAc,KAAK,mBAAmB;AAClF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kBAAkB;AAClB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yCAAyC,kCAAkC;AAC3E;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA,QAAQ;AACR,UAAU;AACV;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,uBAAuB;AAClD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAoB;AACpB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA,aAAa;AACb,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,yBAAyB;AACxC;AACA,uBAAuB,0BAA0B;AACjD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,+BAA+B;AAC9C;AACA,uBAAuB,0BAA0B;AACjD;AACA;AACA;AACA;AACA;AACA,+BAA+B,sBAAsB;AACrD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qCAAqC,YAAY;AACjD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iCAAiC;AACjC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iCAAiC;AACjC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,gCAAgC;AAC3D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,2BAA2B;AAClD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,uBAAuB;AAC1C;AACA;AACA;AACA;AACA;AACA,mBAAmB,uBAAuB;AAC1C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,qBAAqB;AAChD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wCAAwC,sBAAsB;AAC9D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,uBAAuB;AAC9C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qDAAqD;AACrD;AACA,uDAAuD;AACvD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,uBAAuB;AAC1C;AACA;AACA;AACA;AACA;AACA,kCAAkC,KAAK,IAAI,yBAAyB;AACpE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+CAA+C;AAC/C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,SAAS;AAChC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wCAAwC,gBAAgB,yBAAyB,WAAW;AAC5F;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,sBAAsB;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,oBAAoB;AAC3C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oCAAoC,SAAS,wCAAwC,cAAc;AACnG;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wDAAwD;AACxD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,0BAA0B;AACrD;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,0BAA0B;AACrD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,WAAW;AAC9B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,SAAS;AAChC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kCAAkC,gBAAgB;AAClD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,qBAAqB;AAC5C;AACA;AACA;AACA;AACA;AACA;AACA,gFAAgF,cAAc;AAC9F,0EAA0E,oBAAoB;AAC9F;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,sBAAsB;AAC7C;AACA;AACA,mDAAmD,iBAAiB;AACpE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,yBAAyB;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mHAAmH,KAAK;AACxH;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,0BAA0B;AACjD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oDAAoD,qBAAqB;AACzE,6CAA6C,uBAAuB;AACpE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oDAAoD,qBAAqB;AACzE;AACA;AACA;AACA;AACA,uBAAuB,uBAAuB;AAC9C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oDAAoD,qBAAqB;AACzE,6CAA6C,uBAAuB;AACpE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,uBAAuB;AAC9C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8BAA8B,4BAA4B;AAC1D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA,mBAAmB,mCAAmC;AACtD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,mBAAmB;AACtC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sFAAsF;AACtF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,yBAAyB;AAChD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,yBAAyB;AAChD;AACA;AACA;AACA;AACA;AACA,mCAAmC,mBAAmB;AACtD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8EAA8E,gBAAgB;AAC9F;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2CAA2C,0BAA0B;AACrE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,oBAAoB;AAC/C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,kCAAkC;AACzD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sCAAsC;AACtC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yCAAyC,uBAAuB;AAChE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sCAAsC,4CAA4C;AAClF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uCAAuC,eAAe;AACtD;AACA,QAAQ;AACR;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY;AACZ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAQ,oDAAoD;AAC5D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0DAA0D,GAAG;AAC7D;AACA,QAAQ;AACR;AACA;AACA;AACA;AACA;AACA,YAAY;AACZ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAQ;AACR;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAc,sCAAsC;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY;AACZ;AACA;AACA;AACA;AACA;AACA;AACA,4BAA4B,mBAAmB;AAC/C,QAAQ;AACR;AACA;AACA;AACA;AACA;AACA;AACA,YAAY;AACZ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAQ;AACR;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kDAAkD,sCAAsC;AACxF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY,sCAAsC;AAClD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iDAAiD,kBAAkB;AACnE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4EAA4E;AAC5E;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wFAAwF,MAAM;AAC9F;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2EAA2E;AAC3E;AACA;AACA;AACA;AACA;AACA;AACA,oEAAoE;AACpE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mEAAmE;AACnE;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8CAA8C;AAC9C,+DAA+D,GAAG;AAClE,yEAAyE,GAAG;AAC5E,kFAAkF,GAAG,6BAA6B;AAClH;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,mBAAmB;AAC1C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wDAAwD;AACxD;AACA;AACA,iEAAiE;AACjE;AACA;AACA,uCAAuC,KAAK,sBAAsB,KAAK;AACvE,mBAAmB,KAAK,gBAAgB;AACxC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAoB,gBAAgB;AACpC;AACA;AACA,oBAAoB,gBAAgB;AACpC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,gBAAgB;AACvC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uGAAuG,UAAU;AACjH;AACA;AACA,aAAa;AACb,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sFAAsF,UAAU;AAChG;AACA;AACA;AACA;AACA;AACA;AACA,qBAAqB;AACrB;AACA;AACA,aAAa;AACb;AACA;AACA,SAAS;AACT;AACA;AACA;AACA,4CAA4C,kCAAkC;AAC9E;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6BAA6B;AAC7B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4CAA4C,kCAAkC;AAC9E;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6BAA6B,kBAAkB;AAC/C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2EAA2E,QAAQ,qBAAqB,uDAAuD,KAAK,QAAQ;AAC5K;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB;AACjB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B,qCAAqC;AACpE,2BAA2B,sBAAsB;AACjD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uFAAuF;AACvF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iCAAiC,iBAAiB;AAClD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4DAA4D,iBAAiB,KAAK,gBAAgB;AAClG;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,aAAa;AACxC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,CAAC;AACD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B,sEAAsE;AACrG,+BAA+B,sEAAsE;AACrG;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iEAAiE,iEAAiE;AAClI;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iCAAiC,kBAAkB;AACnD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY;AACZ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,qBAAqB;AAChD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kEAAkE;AAClE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qBAAqB;AACrB;AACA;AACA;AACA,yCAAyC,kCAAkC;AAC3E;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B,uBAAuB;AACtD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,yBAAyB;AAChD;AACA;AACA;AACA,oDAAoD,wBAAwB;AAC5E;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,iBAAiB;AACxC;AACA;AACA;AACA;AACA,iBAAiB,kCAAkC;AACnD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,iBAAiB;AACpC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4DAA4D,eAAe;AAC3E,IAAI,eAAe,kBAAkB,eAAe;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kCAAkC,MAAM,GAAG,6BAA6B;AACxE,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAM,wEAAwE;AAC9E,MAAM;AACN;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uDAAuD,6BAA6B;AACpF,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kBAAkB,0BAA0B,kCAAkC,MAAM,GAAG,6BAA6B;AACpH,KAAK;AACL;AACA;AACA,qCAAqC,eAAe,2BAA2B;AAC/E;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6FAA6F,SAAS;AACtG;AACA;AACA;AACA;AACA,gDAAgD,eAAe;AAC/D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6DAA6D,iBAAiB;AAC9E;AACA;AACA;AACA;AACA;AACA,wBAAwB;AACxB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uCAAuC,QAAQ;AAC/C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0BAA0B,MAAM;AAChC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAM,sDAAsD;AAC5D,MAAM;AACN;AACA;AACA;AACA;AACA,2EAA2E,UAAU,GAAG,UAAU;AAClG;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uDAAuD,yBAAyB;AAChF;AACA;AACA;AACA;AACA;AACA,gCAAgC,yBAAyB;AACzD;AACA;AACA;AACA,0CAA0C,yBAAyB;AACnE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAQ,gBAAgB;AACxB;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,sBAAsB;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B,uCAAuC;AACtE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sBAAsB,0BAA0B;AAChD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,qBAAqB;AACxC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAQ;AACR;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,SAAS;AAChC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,uCAAuC;AAClE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,wBAAwB;AAC/C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iDAAiD,UAAU;AAC3D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,gCAAgC;AACnD;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAQ,kCAAkC;AAC1C,QAAQ;AACR;AACA;AACA;AACA;AACA;AACA,MAAM,mCAAmC;AACzC,MAAM;AACN;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iCAAiC,qBAAqB,iEAAiE;AACvH;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iCAAiC,qBAAqB,+DAA+D;AACrH;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B,qBAAqB,+DAA+D;AACnH;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+CAA+C,8DAA8D;AAC7G;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA,4BAA4B;AAC5B;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb,SAAS;AACT;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,kBAAkB;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sFAAsF;AACtF;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,iBAAiB;AAC5C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mCAAmC,WAAW;AAC9C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA,kDAAkD;AAClD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wCAAwC;AACxC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,gBAAgB;AACvC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,mBAAmB;AACtC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,mBAAmB;AACtC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4BAA4B,IAAI;AAChC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4BAA4B,IAAI,GAAG,IAAI;AACvC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4BAA4B,IAAI,GAAG,IAAI,GAAG,IAAI;AAC9C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4BAA4B,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI;AACrD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4BAA4B,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI;AAC5D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4BAA4B,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI;AACnE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4BAA4B,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI;AAC1E;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4BAA4B,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI;AACjF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI;AACtF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uDAAuD;AACvD,2BAA2B,mBAAmB;AAC9C;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sDAAsD,aAAa;AACnE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mCAAmC,mBAAmB,MAAM;AAC5D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8BAA8B,QAAQ;AACtC,iCAAiC,QAAQ;AACzC;AACA,qCAAqC,QAAQ;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6CAA6C;AAC7C,QAAQ;AACR;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,yBAAyB;AAChD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,iBAAiB;AAC5C;AACA;AACA;AACA;AACA;AACA;AACA,+CAA+C,aAAa,uBAAuB,mCAAmC;AACtH;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,4BAA4B;AAC/C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qBAAqB;AACrB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oDAAoD;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB,IAAI;AACrB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,IAAI;AAC3B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,IAAI,GAAG,IAAI;AAClC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,IAAI,GAAG,IAAI,GAAG,IAAI;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI;AAChD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI;AACvD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI;AAC9D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI;AACrE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI;AAC5E;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI;AACtF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uDAAuD;AACvD,2BAA2B,mBAAmB;AAC9C;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0BAA0B,cAAc;AACxC;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA,mBAAmB,cAAc;AACjC;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA,oCAAoC;AACpC;AACA;AACA;AACA;AACA;AACA,mBAAmB,cAAc;AACjC;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA,oCAAoC;AACpC;AACA;AACA;AACA;AACA;AACA,mBAAmB,cAAc;AACjC;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA,oCAAoC;AACpC;AACA;AACA;AACA;AACA;AACA,mBAAmB,cAAc;AACjC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,cAAc,EAAE;AACnC,oCAAoC;AACpC;AACA,mBAAmB,cAAc,EAAE;AACnC,oCAAoC;AACpC;AACA,mBAAmB,cAAc,EAAE;AACnC,oCAAoC;AACpC;AACA,mBAAmB,cAAc,EAAE;AACnC,oCAAoC;AACpC;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,cAAc,EAAE;AACnC,oCAAoC;AACpC;AACA,mBAAmB,cAAc,EAAE;AACnC,oCAAoC;AACpC;AACA,mBAAmB,cAAc,EAAE;AACnC,oCAAoC;AACpC;AACA,mBAAmB,cAAc,EAAE;AACnC,oCAAoC;AACpC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,cAAc,yBAAyB,cAAc;AAC5E;AACA;AACA;AACA;AACA,uBAAuB,cAAc,yBAAyB,cAAc;AAC5E;AACA;AACA;AACA,uBAAuB,cAAc,yBAAyB,cAAc;AAC5E;AACA;AACA;AACA,uBAAuB,cAAc,yBAAyB,cAAc;AAC5E;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6CAA6C;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAc;AACd;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qCAAqC,QAAQ;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qCAAqC,QAAQ;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iCAAiC,QAAQ;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iCAAiC,QAAQ;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB;AACjB,iBAAiB;AACjB,iBAAiB;AACjB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB;AACjB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oDAAoD,MAAM;AAC1D;AACA,yBAAyB,UAAU;AACnC;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kCAAkC,QAAQ;AAC1C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sCAAsC,QAAQ;AAC9C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oDAAoD,mDAAmD;AACvG;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gDAAgD,kBAAkB;AAClE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,kBAAkB;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,2BAA2B;AAClD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kCAAkC,WAAW;AAC7C;AACA;AACA,kCAAkC,WAAW;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAU,IAAI;AACd;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAgB,IAAI;AACpB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAgB,IAAI,GAAG,IAAI;AAC3B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAgB,IAAI,GAAG,IAAI,GAAG,IAAI;AAClC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAgB,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAgB,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI;AAChD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAgB,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI;AACvD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAgB,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI;AAC9D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAgB,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI;AACrE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAgB,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI;AACnF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,IAAI;AAC3B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,IAAI,GAAG,IAAI;AAClC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,IAAI,GAAG,IAAI,GAAG,IAAI;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI;AAChD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI;AACvD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI;AAC9D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI;AACrE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI;AAC5E;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI;AACtF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sBAAsB,IAAI;AAC1B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sBAAsB,KAAK,SAAS,IAAI;AACxC;AACA;AACA;AACA;AACA;AACA,yCAAyC;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sBAAsB,KAAK,SAAS,KAAK,SAAS,IAAI;AACtD;AACA;AACA;AACA;AACA;AACA;AACA,sBAAsB,gBAAgB;AACtC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sBAAsB,KAAK,SAAS,KAAK,SAAS,KAAK,SAAS,IAAI;AACpE;AACA;AACA;AACA;AACA;AACA;AACA,sBAAsB,gBAAgB,gBAAgB;AACtD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sBAAsB,KAAK,SAAS,KAAK,SAAS,KAAK,SAAS,KAAK,SAAS,IAAI;AAClF;AACA;AACA;AACA;AACA;AACA;AACA,sBAAsB,gBAAgB,gBAAgB,gBAAgB;AACtE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sBAAsB,KAAK,SAAS,KAAK,SAAS,KAAK,SAAS,KAAK,SAAS;AAC9E,uBAAuB,IAAI;AAC3B;AACA;AACA;AACA;AACA;AACA;AACA,qBAAqB,gBAAgB,gBAAgB,gBAAgB,gBAAgB;AACrF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sBAAsB,KAAK,SAAS,KAAK,SAAS,KAAK,SAAS,KAAK,SAAS,KAAK,SAAS;AAC5F,uBAAuB,IAAI;AAC3B;AACA;AACA;AACA;AACA;AACA;AACA,qBAAqB,gBAAgB,gBAAgB,gBAAgB,gBAAgB;AACrF,QAAQ;AACR;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sBAAsB,KAAK,SAAS,KAAK,SAAS,KAAK,SAAS,KAAK,SAAS,KAAK,SAAS;AAC5F,uBAAuB,KAAK,SAAS,IAAI;AACzC;AACA;AACA;AACA;AACA;AACA;AACA,qBAAqB,gBAAgB,gBAAgB,gBAAgB,gBAAgB;AACrF,QAAQ,gBAAgB;AACxB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kBAAkB,KAAK,SAAS,KAAK,SAAS,KAAK,SAAS,KAAK,SAAS,KAAK,SAAS;AACxF,mBAAmB,KAAK,SAAS,KAAK,SAAS,KAAK,SAAS,IAAI;AACjE;AACA;AACA;AACA;AACA;AACA;AACA,sBAAsB,gBAAgB,gBAAgB,gBAAgB,gBAAgB;AACtF,SAAS,gBAAgB,gBAAgB,gBAAgB;AACzD;AACA;AACA;AACA;AACA,+BAA+B,oBAAoB;AACnD;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6BAA6B,IAAI;AACjC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6BAA6B,IAAI,GAAG,IAAI;AACxC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6BAA6B,IAAI,GAAG,IAAI,GAAG,IAAI;AAC/C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6BAA6B,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI;AACtD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6BAA6B,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI;AAC7D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6BAA6B,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI;AACpE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6BAA6B,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI;AAC3E;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6BAA6B,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI;AAClF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yBAAyB,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI;AAC5F;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sDAAsD,aAAa;AACnE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4BAA4B,cAAc;AAC1C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8EAA8E,0BAA0B;AACxG;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,qBAAqB;AAC5C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oCAAoC,4CAA4C;AAChF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kCAAkC,oDAAoD;AACtF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6BAA6B,oCAAoC;AACjE;AACA;AACA;AACA;AACA,kHAAkH;AAClH;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kCAAkC,sCAAsC;AACxE;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uCAAuC,uDAAuD;AAC9F;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B,qBAAqB;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6CAA6C,QAAQ;AACrD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,qBAAqB;AAC5C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,SAAS;AAChC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oCAAoC,2BAA2B;AAC/D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,sBAAsB;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,OAAO;AACP;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0DAA0D,qBAAqB;AAC/E;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,sBAAsB;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,CAAC,kDAAkD;AACnD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,CAAC;;AAED;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB;AACnB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mCAAmC,iBAAiB;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uCAAuC,4BAA4B;AACnE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2CAA2C,iBAAiB;AAC5D;AACA;AACA;AACA;AACA;AACA,0CAA0C,iBAAiB;AAC3D;AACA;AACA;AACA;AACA;AACA,sCAAsC,iBAAiB;AACvD;AACA;AACA;AACA;AACA;AACA,yCAAyC,iBAAiB;AAC1D;AACA;AACA;AACA;AACA;AACA,gDAAgD,iBAAiB;AACjE;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qDAAqD,sBAAsB;AAC3E;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB;AACjB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B,qBAAqB;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8DAA8D,iBAAiB;AAC/E;AACA;AACA,8CAA8C,iBAAiB;AAC/D;AACA;AACA;AACA,0CAA0C,iBAAiB;AAC3D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8BAA8B,4BAA4B;AAC1D;AACA,oCAAoC,4BAA4B;AAChE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iCAAiC,iBAAiB;AAClD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,4BAA4B;AAC/C;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sDAAsD,gBAAgB;AACtE;AACA;AACA;AACA,WAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kBAAkB,4BAA4B;AAC9C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB;AACnB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oCAAoC,iBAAiB;AACrD;AACA;AACA;AACA;AACA;AACA,4CAA4C,iBAAiB;AAC7D;AACA;AACA;AACA;AACA;AACA,wCAAwC,iBAAiB;AACzD;AACA;AACA;AACA;AACA;AACA,0CAA0C,iBAAiB;AAC3D;AACA;AACA;AACA;AACA;AACA,yCAAyC,iBAAiB;AAC1D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qDAAqD,eAAe;AACpE;AACA;AACA;AACA,iBAAiB;AACjB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA,2CAA2C,iBAAiB;AAC5D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gDAAgD,iBAAiB;AACjE;AACA;AACA;AACA;AACA,4CAA4C,iBAAiB;AAC7D;AACA;AACA,8CAA8C,gBAAgB;AAC9D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0BAA0B,4BAA4B;AACtD,kBAAkB,sBAAsB;AACxC,QAAQ,sBAAsB;AAC9B;AACA;AACA;AACA;AACA;AACA;AACA,uDAAuD,qBAAqB;AAC5E;AACA;AACA;AACA;AACA;AACA;AACA,QAAQ;AACR;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uEAAuE,SAAS,aAAa,kCAAkC;AAC/H;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,CAAC;AACD;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0BAA0B,4BAA4B;AACtD,kBAAkB,sBAAsB;AACxC,QAAQ,sBAAsB;AAC9B;AACA;AACA;AACA;AACA;AACA;AACA,uDAAuD,qBAAqB;AAC5E;AACA;AACA;AACA;AACA;AACA;AACA,QAAQ;AACR;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mEAAmE,GAAG;AACtE;AACA;AACA;AACA;AACA;AACA;AACA;AACA,CAAC;;AAED;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4HAA4H,SAAS,qBAAqB,UAAU;AACpK;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6EAA6E,OAAO;AACpF;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAoB;AACpB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0BAA0B,qBAAqB;AAC/C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+GAA+G,YAAY,IAAI,SAAS,MAAM,YAAY,IAAI,MAAM;AACpK;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,OAAO,GAAG,KAAK;AACtC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA,YAAY;AACZ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kDAAkD,wCAAwC;AAC1F;AACA,gBAAgB;AAChB,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4BAA4B,eAAe;AAC3C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4BAA4B,eAAe;AAC3C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,2BAA2B;AACtD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,0BAA0B;AACrD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,qBAAqB;AACxC;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,oBAAoB;AACvC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,sBAAsB;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,0BAA0B;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,SAAS;AACpC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,SAAS;AACpC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,0BAA0B;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4BAA4B,yBAAyB;AACrD;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6BAA6B,yBAAyB;AACtD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6BAA6B,QAAQ;AACrC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oEAAoE;AACpE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iFAAiF,wDAAwD;AACzI;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oEAAoE,MAAM;AAC1E;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yCAAyC,wDAAwD;AACjG;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6CAA6C,qCAAqC;AAClF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6BAA6B,sFAAsF;AACnH;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,WAAW,8CAA8C;AACzD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,8BAA8B;AACjD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,wBAAwB;AAC/C;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2CAA2C,gBAAgB,uBAAuB,0BAA0B;AAC5G;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,mBAAmB;AACtC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,SAAS;AACpC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,SAAS;AACpC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4CAA4C;AAC5C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,kBAAkB;AACrC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qCAAqC,yCAAyC;AAC9E;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wBAAwB,gDAAgD;AACxE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2CAA2C,kBAAkB;AAC7D,+CAA+C,mBAAmB;AAClE;AACA;AACA;AACA;AACA,CAAC;AACD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8BAA8B,kCAAkC;AAChE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,iBAAiB;AAC5C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B,oCAAoC;AACnE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wDAAwD,uBAAuB;AAC/E;AACA;AACA,gFAAgF;AAChF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,OAAO,EAAE,GAAG,EAAE,QAAQ,EAAE,SAAS,EAAE;AACnC,iBAAiB;AACjB;AACA;AACA;AACA;AACA,MAAM;AACN;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2DAA2D,OAAO;AAClE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,CAAC,0CAA0C;AAC3C;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sBAAsB,uBAAuB,EAAE,YAAY;AAC3D;AACA;AACA;AACA;AACA,8BAA8B;AAC9B,qCAAqC,aAAa;AAClD;AACA;AACA;AACA;AACA,8CAA8C,IAAI;AAClD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB;AACvB;AACA;AACA;AACA;AACA;AACA,0BAA0B;AAC1B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8BAA8B;AAC9B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA,qBAAqB,oBAAoB;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY;AACZ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gCAAgC,OAAO,IAAI,WAAW,EAAE,OAAO;AAC/D;AACA;AACA;AACA;AACA;AACA;AACA,uHAAuH,QAAQ;AAC/H;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0CAA0C,iBAAiB,EAAE,OAAO;AACpE,iDAAiD,OAAO,aAAa,iBAAiB,EAAE,OAAO;AAC/F;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uCAAuC;AACvC;AACA;AACA,mBAAmB,sBAAsB;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,iCAAiC;AACpD;AACA,uBAAuB,qBAAqB;AAC5C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAQ,MAAM,GAAG,MAAM;AACvB;AACA;AACA,SAAS,MAAM,GAAG,MAAM,SAAS,MAAM,GAAG,MAAM;AAChD;AACA;AACA;AACA,SAAS,MAAM,GAAG,MAAM,SAAS,MAAM,GAAG,MAAM;AAChD;AACA;AACA;AACA,SAAS,MAAM,EAAE,MAAM,QAAQ,MAAM,EAAE,MAAM;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,qBAAqB;AAC5C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B,kBAAkB;AACjD;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kFAAkF,oBAAoB;AACtG;AACA;AACA;AACA,8EAA8E,aAAa;AAC3F;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8DAA8D;AAC9D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qDAAqD;AACrD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB;AACjB;AACA;AACA;AACA,6EAA6E,QAAQ;AACrF;AACA;AACA;AACA;AACA,2BAA2B,yBAAyB;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qDAAqD,MAAM,EAAE,kBAAkB,EAAE,IAAI;AACrF,KAAK;AACL;AACA,uEAAuE;AACvE;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qEAAqE,MAAM,aAAa,IAAI;AAC5F;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,0BAA0B;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6FAA6F,OAAO;AACpG;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gFAAgF,aAAa;AAC7F;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gFAAgF,aAAa;AAC7F;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6FAA6F,OAAO;AACpG;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,0BAA0B;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B,sBAAsB;AACrD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mDAAmD,wBAAwB;AAC3E;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kBAAkB,gBAAgB,MAAM,cAAc;AACtD;AACA;AACA;AACA;AACA;AACA,QAAQ,MAAM,GAAG,MAAM;AACvB;AACA;AACA,SAAS,MAAM,GAAG,MAAM,SAAS,MAAM,GAAG,MAAM;AAChD;AACA;AACA;AACA,SAAS,MAAM,EAAE,MAAM,QAAQ,MAAM,EAAE,MAAM;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,mBAAmB;AACtC;AACA;AACA;AACA,uBAAuB,kBAAkB;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iCAAiC,gBAAgB,yBAAyB;AAC1E;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,iCAAiC;AACpD;AACA;AACA;AACA,uBAAuB,qBAAqB;AAC5C;AACA;AACA;AACA;AACA;AACA,sCAAsC,SAAS;AAC/C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qBAAqB;AACrB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uCAAuC,oBAAoB;AAC3D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iGAAiG,cAAc,cAAc,QAAQ;AACrI;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mEAAmE,eAAe;AAClF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,+BAA+B;AACtD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iCAAiC;AACjC;AACA,yBAAyB;AACzB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qEAAqE;AACrE;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2DAA2D,GAAG,KAAK,gBAAgB,MAAM,qBAAqB;AAC9G;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oDAAoD,wBAAwB;AAC5E;AACA;AACA;AACA;AACA,aAAa,uCAAuC;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,iBAAiB;AACpC;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yCAAyC,QAAQ;AACjD;AACA;AACA;AACA;AACA;AACA;AACA,iCAAiC,KAAK;AACtC;AACA;AACA;AACA;AACA,wCAAwC,8BAA8B;AACtE;AACA;AACA;AACA;AACA,8BAA8B,8BAA8B;AAC5D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wCAAwC,8BAA8B;AACtE;AACA;AACA;AACA;AACA,8BAA8B,8BAA8B;AAC5D,8BAA8B,8BAA8B;AAC5D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wCAAwC,8BAA8B;AACtE;AACA;AACA;AACA;AACA,8BAA8B,8BAA8B;AAC5D,8BAA8B,8BAA8B;AAC5D,8BAA8B,8BAA8B;AAC5D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wCAAwC,8BAA8B;AACtE;AACA;AACA;AACA;AACA,8BAA8B,8BAA8B;AAC5D,8BAA8B,8BAA8B;AAC5D,8BAA8B,8BAA8B;AAC5D,8BAA8B,8BAA8B;AAC5D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wCAAwC,8BAA8B;AACtE;AACA;AACA;AACA;AACA,gDAAgD,8BAA8B;AAC9E;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4BAA4B,4CAAO;AACnC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA,iBAAiB;AACjB;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB;AACjB;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA,iBAAiB;AACjB;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB;AACjB;AACA;AACA;AACA;AACA;AACA,uCAAuC,iDAAY;AACnD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4BAA4B,mBAAmB,GAAG,sBAAsB,OAAO;AAC/E;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,IAAI;AACnB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iDAAiD;AACjD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6DAA6D,mBAAmB;AAChF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,0BAA0B;AACrD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,yBAAyB;AAChD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,yBAAyB;AAChD;AACA;AACA;AACA;AACA,uBAAuB,yBAAyB;AAChD;AACA;AACA;AACA;AACA;AACA,uBAAuB,iBAAiB;AACxC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,yBAAyB;AAChD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,uBAAuB;AAClD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,uBAAuB;AAC9C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qHAAqH,gBAAgB;AACrI;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,0BAA0B;AACjD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,0BAA0B;AACjD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qDAAqD,kCAAkC;AACvF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mCAAmC,2BAA2B;AAC9D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,CAAC;AACD;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sBAAsB,uBAAuB;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gDAAgD,QAAQ;AACxD,uBAAuB,uBAAuB;AAC9C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kDAAkD;AAClD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wCAAwC,8BAA8B;AACtE;AACA,2FAA2F,gBAAgB;AAC3G;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB;AACjB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6FAA6F,gBAAgB;AAC7G;AACA;AACA,SAAS;AACT;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iDAAiD,gBAAgB,4BAA4B,qBAAqB;AAClH;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6CAA6C,wBAAwB,4BAA4B,8BAA8B;AAC/H;AACA;AACA;AACA;AACA;AACA;AACA,qCAAqC,wBAAwB;AAC7D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4CAA4C,KAAK,GAAG,wBAAwB,QAAQ,8BAA8B;AAClH;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oCAAoC,wBAAwB,6CAA6C,WAAW,OAAO,WAAW;AACtI,8CAA8C,wBAAwB,mCAAmC,WAAW,OAAO,WAAW;AACtI,oFAAoF,wBAAwB,gCAAgC,WAAW,OAAO,WAAW;AACzK;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qCAAqC,wBAAwB;AAC7D;AACA;AACA;AACA;AACA;AACA,2BAA2B,wBAAwB;AACnD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qDAAqD,UAAU,4BAA4B,qBAAqB;AAChH;AACA;AACA,gDAAgD,UAAU,4BAA4B,qBAAqB;AAC3G;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,gBAAgB;AAC3C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA,yCAAyC,kBAAkB;AAC3D;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iDAAiD,UAAU;AAC3D;AACA,sDAAsD,qBAAqB;AAC3E;AACA;AACA,oDAAoD,mCAAmC;AACvF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qEAAqE,UAAU;AAC/E,2DAA2D,uCAAuC,yYAAyY;AAC3e;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gDAAgD;AAChD;AACA;AACA;AACA;AACA;AACA;AACA,uEAAuE;AACvE;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA,KAAK;AACL;AACA;AACA;AACA,kCAAkC,KAAK;AACvC;AACA;AACA;AACA;AACA;AACA;AACA,YAAY;AACZ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gFAAgF,UAAU,yCAAyC,mBAAmB,0EAA0E;AAChO;AACA;AACA,SAAS;AACT;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAoB,+DAA+D;AACnF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qFAAqF,MAAM;AAC3F,gCAAgC,wBAAwB;AACxD;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,wBAAwB;AAC/C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gFAAgF,cAAc,yCAAyC,cAAc,qEAAqE;AAC1N;AACA;AACA,SAAS;AACT;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA,qFAAqF,cAAc;AACnG;AACA;AACA,SAAS;AACT;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sBAAsB;AACtB;AACA;AACA;AACA;AACA;AACA;AACA,oBAAoB,qBAAqB,mDAAmD;AAC5F;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kCAAkC,aAAa;AAC/C;AACA;AACA;AACA;AACA;AACA,sCAAsC,sBAAsB;AAC5D;AACA;AACA;AACA;AACA;AACA,sCAAsC,sBAAsB;AAC5D;AACA;AACA;AACA;AACA;AACA,mCAAmC,mBAAmB;AACtD;AACA;AACA;AACA;AACA;AACA,kCAAkC,kBAAkB;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,6BAA6B;AAC5C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA,WAAW,0BAA0B;AACrC;AACA;AACA;AACA,mDAAmD,SAAS;AAC5D;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iEAAiE,uBAAuB;AACxF;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+CAA+C,sBAAsB;AACrE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,0BAA0B;AACrD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA,wEAAwE,uEAAuE;AAC/I,kDAAkD,oEAAoE;AACtH;AACA,KAAK,4BAA4B,yCAAyC,GAAG,iBAAiB;AAC9F;AACA,4BAA4B;AAC5B;AACA,KAAK,gBAAgB,UAAU;AAC/B;AACA;AACA,aAAa;AACb;AACA,aAAa,GAAG,EAAE,EAAE,QAAQ,EAAE;;AAE9B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI,4DAA4D;AAChE;AACA;AACA;AACA,aAAa,eAAe;AAC5B;AACA;AACA;AACA;AACA;AACA,cAAc,cAAc,EAAE,cAAc,EAAE,cAAc;AAC5D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4CAA4C,6BAA6B;AACzE,oCAAoC,wCAAwC;AAC5E,4BAA4B;AAC5B;AACA,KAAK,eAAe,EAAE;;AAEtB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,WAAW,YAAY;AACvB,WAAW,yBAAyB;AACpC,WAAW,YAAY;AACvB;AACA;AACA,kBAAkB,uCAAuC;AACzD,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,WAAW,yBAAyB;AACpC,WAAW,YAAY;AACvB;AACA;AACA,kBAAkB,iDAAiD;AACnE,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,WAAW,eAAe;AAC1B,WAAW,yBAAyB;AACpC,WAAW,YAAY;AACvB;AACA;AACA;AACA;AACA;AACA,kBAAkB,+CAA+C;AACjE,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA,8DAA8D,mBAAmB;AACjF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,WAAW,sBAAsB;AACjC,WAAW,yBAAyB;AACpC,WAAW,YAAY;AACvB;AACA;AACA,kBAAkB,+CAA+C;AACjE,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,WAAW,6BAA6B;AACxC,WAAW,yBAAyB;AACpC,WAAW,YAAY;AACvB;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,CAAC,gEAAgE;;AAEjE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAc,uBAAuB;AACrC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAoB,yBAAyB;AAC7C;AACA;AACA;AACA,oBAAoB,0BAA0B;AAC9C;AACA;AACA;AACA;AACA;AACA;AACA,kBAAkB;AAClB;AACA;AACA;AACA,yBAAyB;AACzB;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8CAA8C,8BAA8B;AAC5E,qCAAqC,0CAA0C;AAC/E,4BAA4B;AAC5B;AACA,KAAK,gBAAgB,WAAW,EAAE,QAAQ,EAAE;AAC5C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY;AACZ;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8CAA8C,yBAAyB;AACvE,qCAAqC,WAAW;AAChD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,WAAW,kBAAkB;AAC7B,WAAW,KAAK;AAChB;AACA;AACA;AACA;AACA;AACA;AACA,sBAAsB,UAAU;AAChC,oDAAoD,OAAO;AAC3D;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mCAAmC,8BAA8B,EAAE;AACnE,UAAU;AACV,QAAQ;AACR;AACA;AACA;AACA;AACA,wCAAwC,cAAc;AACtD;AACA;AACA;AACA,QAAQ;AACR;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB,2EAA2E;AAC5F;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2DAA2D,yBAAyB;AACpF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2DAA2D,yBAAyB;AACpF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8BAA8B,yBAAyB;AACvD;AACA;AACA;AACA;AACA;AACA;AACA,YAAY,WAAW;AACvB;AACA;AACA;AACA;AACA;AACA,mBAAmB;AACnB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa,oBAAoB,EAAE,SAAS,EAAE;AAC9C;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qBAAqB,gFAAgF;AACrG;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qBAAqB;AACrB;AACA,aAAa;AACb,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA,8BAA8B,uDAAuD;AACrF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oDAAoD,iDAAiD;AACrG,wCAAwC,gDAAgD;AACxF;AACA,KAAK;AACL;AACA,4BAA4B;AAC5B;AACA,KAAK,gBAAgB,UAAU,eAAe,EAAE,EAAE,QAAQ,EAAE;AAC5D;AACA,yBAAyB,kBAAkB;AAC3C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oEAAoE,yCAAyC;AAC7G,gDAAgD,gEAAgE;AAChH;AACA,4BAA4B;AAC5B;AACA,KAAK,gBAAgB,WAAW,EAAE,QAAQ,EAAE;AAC5C;AACA,2BAA2B;AAC3B;AACA;AACA;AACA;AACA;AACA,YAAY,qBAAqB;AACjC;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8CAA8C,+BAA+B;AAC7E;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gDAAgD;AAChD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8BAA8B,KAAK;AACnC;AACA;AACA;AACA;AACA;AACA,+EAA+E,kCAAkC;AACjH;AACA;AACA,mFAAmF,kCAAkC;AACrH;AACA;AACA,iBAAiB;AACjB,gDAAgD,2CAA2C;AAC3F;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAQ;AACR;AACA;AACA;AACA,eAAe,kBAAkB;AACjC,eAAe,gBAAgB;AAC/B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4BAA4B,oCAAoC;AAChE;AACA;AACA;AACA,oDAAoD,mFAAmF;AACvI;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB;AACjB,aAAa;AACb,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAQ;AACR;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yCAAyC;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0CAA0C;AAC1C,8BAA8B;AAC9B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B,eAAe;AAC9C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oDAAoD,mDAAmD;AACvG,wCAAwC,gDAAgD;AACxF;AACA,KAAK;AACL;AACA,4BAA4B;AAC5B;AACA,KAAK,gBAAgB,UAAU,iBAAiB,EAAE,EAAE,QAAQ,EAAE;AAC9D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4CAA4C;AAC5C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAM;AACN;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB;AACjB;AACA,SAAS;AACT,sCAAsC,+CAAU;AAChD;AACA;AACA;AACA;AACA;AACA,aAAa;AACb,SAAS;AACT,6BAA6B,+CAAU;AACvC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qBAAqB;AACrB,iBAAiB;AACjB,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA,qBAAqB;AACrB;AACA,aAAa;AACb;AACA;AACA;AACA;AACA,SAAS;AACT;AACA,YAAY,kDAAO,kCAAkC,4DAAK;AAC1D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAQ;AACR;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0DAA0D,wLAAwL;AAClP,2CAA2C,sDAAsD;AACjG;AACA,KAAK,eAAe;AACpB,KAAK,gBAAgB;AACrB,KAAK,iBAAiB;AACtB,KAAK,qBAAqB;AAC1B,KAAK,iCAAiC;AACtC,KAAK;AACL;AACA,4BAA4B;AAC5B;AACA,KAAK,gBAAgB,UAAU,eAAe,GAAG,gBAAgB,GAAG,iBAAiB,GAAG,qBAAqB,GAAG,iCAAiC,GAAG,8BAA8B,EAAE,EAAE,QAAQ,EAAE;AAChM;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iCAAiC,QAAQ;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0CAA0C,GAAG;AAC7C;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,+DAAc,MAAM,CAAC;AACpC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,+DAAc,wEAAwE,CAAC;AACtG;AACA;AACA;AACA;AACA,0EAA0E,yGAAyG;AACnL,mDAAmD,sEAAsE;AACzH;AACA,KAAK,iBAAiB;AACtB,KAAK,mDAAmD,iBAAiB;AACzE;AACA,4BAA4B;AAC5B;AACA,KAAK,gBAAgB,UAAU,iBAAiB,GAAG;AACnD;AACA,aAAa,GAAG,EAAE,EAAE,QAAQ,EAAE;AAC9B;AACA;AACA,wCAAwC,WAAW,QAAQ,WAAW;AACtE;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY;AACZ;AACA,uCAAuC,MAAM;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA,YAAY;AACZ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,WAAW,MAAM;AACjB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+CAA+C,eAAe;AAC9D,sDAAsD,SAAS;AAC/D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,mBAAmB;AAC1C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,uBAAuB;AAC9C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,uBAAuB;AAC9C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yCAAyC,uBAAuB;AAChE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,YAAY;AAC/B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,2BAA2B;AAClD;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B,8BAA8B;AAC7D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK,4CAA4C;AACjD,KAAK,yCAAyC;AAC9C,KAAK,yCAAyC;AAC9C,KAAK,6BAA6B;AAClC;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL,KAAK,uEAAuE;AAC5E;AACA;AACA;AACA;AACA,KAAK;AACL,KAAK,kDAAkD;AACvD;AACA,KAAK,0EAA0E;AAC/E,KAAK,0EAA0E;AAC/E;AACA;AACA;AACA;AACA,KAAK;AACL,KAAK,iDAAiD;AACtD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yBAAyB;AACzB;AACA,2CAA2C,0BAA0B;AACrE,2CAA2C,iDAAiD,+DAA+D,EAAE,2CAA2C;AACxM;AACA,KAAK;AACL;AACA,4BAA4B;AAC5B;AACA,gBAAgB,0CAA0C;AAC1D,KAAK,gBAAgB,UAAU,uBAAuB,EAAE,EAAE,QAAQ,EAAE;;AAEpE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,WAAW,8CAA8C;AACzD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,WAAW,8CAA8C;AACzD;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,qBAAqB;AACxC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA,mBAAmB,oBAAoB;AACvC;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,wBAAwB;AAC/C;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,wBAAwB;AAC3C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,mBAAmB;AACtC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0BAA0B,wBAAwB;AAClD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0BAA0B;AAC1B;AACA,sBAAsB;AACtB;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAgB,yDAAyD;AACzE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,UAAU;AACjC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,2BAA2B;AAClD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,qBAAqB;AACxC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4BAA4B,eAAe;AAC3C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B,0BAA0B;AACzD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B,2BAA2B;AAC1D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0BAA0B;AAC1B;AACA,sBAAsB;AACtB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAoB;AACpB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,YAAY;AAC/B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,0BAA0B;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0BAA0B;AAC1B;AACA,sBAAsB;AACtB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY;AACZ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,mBAAmB;AACtC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B,mBAAmB;AAClD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,uBAAuB;AAC1C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0BAA0B;AAC1B;AACA,sBAAsB;AACtB;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,wBAAwB;AACvC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY;AACZ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,mBAAmB;AACtC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,mBAAmB;AAC1C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,kBAAkB;AACrC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+GAA+G,eAAe;AAC9H;AACA;AACA;AACA;AACA;AACA,kIAAkI,eAAe;AACjJ;AACA;AACA;AACA;AACA;AACA,8GAA8G,eAAe;AAC7H;AACA;AACA,oGAAoG,eAAe;AACnH;AACA;AACA;AACA;AACA;AACA,mGAAmG,eAAe;AAClH;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,sBAAsB;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gCAAgC;AAChC;AACA;AACA;AACA;AACA;AACA,4BAA4B;AAC5B;AACA;AACA;AACA;AACA;AACA;AACA,gCAAgC;AAChC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,sBAAsB;AACzC;AACA;AACA;AACA;AACA,+BAA+B,2BAA2B;AAC1D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,mBAAmB;AACtC;AACA;AACA;AACA;AACA;AACA,cAAc;AACd;AACA;AACA;AACA;AACA,yHAAyH,iBAAiB,sBAAsB,iBAAiB;AACjL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,6BAA6B;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,SAAS;AAC5B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,CAAC,gCAAgC;AACjC;AACA;AACA;AACA;AACA;AACA,mBAAmB,sBAAsB;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,sBAAsB;AACzC;AACA;AACA;AACA;AACA,2BAA2B,0BAA0B;AACrD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,eAAe;AAClC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B,EAAE;AACjC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,mDAAmD;AACtE;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,sBAAsB;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iCAAiC,0BAA0B;AAC3D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,WAAW,uCAAuC;AAClD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAoB;AACpB;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb,SAAS;AACT,gBAAgB;AAChB;AACA;AACA,uBAAuB,0BAA0B;AACjD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,CAAC,kCAAkC;AACnC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,6BAA6B;AACxD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uDAAuD,uCAAuC;AAC9F;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,2BAA2B;AACtD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,2BAA2B;AACtD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kDAAkD,mDAAmD;AACrG;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kDAAkD,mDAAmD;AACrG;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,gBAAgB;AACnC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2EAA2E;AAC3E;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEk1Y;;AAEl1Y,gC;;;;;;;;;;;;ACzv9BA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AACA;AACA;AACA;AACA;;AAE0H;AAC1C;AACG;AACgJ;AACxL;;AAE3C;AACA;AACA;AACA;AACA;AACA;AACA;AACwC;AACc;AACtD,sCAAsC,oEAAgB;AACtD;AACA;AACA;AACA,0BAA0B,yBAAyB,+DAAiB,0BAA0B,gBAAgB;AAC9G;AACA;AACA;AACA;AACA;AACA,iDAAiD,oEAAQ;AACzD;AACA;AACA;AACA;AACA,4EAA4E,2CAA2C,sDAAe,CAAC,8DAAuB,GAAG,sDAAe,CAAC,wDAAQ,GAAG;AAC5L,gCAAgC,gEAAyB,EAAE,wEAAwE;AACnI;AACA,KAAK,OAAO,8DAAgB,EAAE;AAC9B,KAAK,gCAAgC,OAAO,oDAAM,SAAS,wDAAQ,IAAI;AACvE;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,wDAAU;AACxB,KAAK,gBAAgB,UAAU,OAAO,8DAAuB,EAAE,GAAG;AAClE,sBAAsB,oDAAM;AAC5B,uBAAuB,wDAAQ;AAC/B,aAAa,GAAG,EAAE,EAAE,QAAQ,EAAE;AAC9B,sCAAsC,oEAAgB;AACtD;AACA;AACA;AACA;AACA;AACA;AACA,2EAA2E;AAC3E;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wDAAwD,QAAQ,GAAG,UAAU;AAC7E;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8CAA8C,GAAG,GAAG,QAAQ;AAC5D;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qBAAqB;AACrB;AACA,iBAAiB;AACjB,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8EAA8E,4CAA4C,sDAAe,CAAC,8DAAuB,GAAG,sDAAe,CAAC,4EAAuB,GAAG,sDAAe,CAAC,oDAAa,GAAG;AAC9O,iCAAiC,gEAAyB,EAAE,0EAA0E;AACtI;AACA,KAAK,OAAO,8DAAgB,EAAE;AAC9B,KAAK,OAAO,4EAAgB,EAAE;AAC9B,KAAK,OAAO,oDAAM;AAClB;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,wDAAU;AACxB,KAAK,gBAAgB,UAAU,OAAO,8DAAuB,EAAE,GAAG,OAAO,4EAAuB,EAAE,GAAG,OAAO,oDAAa,EAAE,EAAE,EAAE,QAAQ,EAAE;AACzI;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wCAAwC,4EAAgB;AACxD;AACA;AACA;AACA;AACA,gFAAgF,6CAA6C,sDAAe,CAAC,wDAAQ,GAAG,sDAAe,CAAC,2EAAsB,GAAG,sDAAe,CAAC,qFAAgC,GAAG;AACpP,kCAAkC,gEAAyB,EAAE,4EAA4E;AACzI;AACA,KAAK,gCAAgC,OAAO,oDAAM,SAAS,wDAAQ,IAAI,GAAG;AAC1E,KAAK,OAAO,2EAAe,EAAE;AAC7B,KAAK,OAAO,qFAAyB;AACrC;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,wDAAU;AACxB,KAAK,gBAAgB,UAAU;AAC/B,sBAAsB,oDAAM;AAC5B,uBAAuB,wDAAQ;AAC/B,aAAa,GAAG,GAAG,OAAO,2EAAsB,EAAE,GAAG,OAAO,qFAAgC,EAAE,EAAE,EAAE,QAAQ,EAAE;AAC5G;AACA,WAAW,0FAAsB,SAAS,gFAAoB,SAAS,+EAAmB;AAC1F;AACA;AACA,eAAe,yFAA6B;AAC5C;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kCAAkC,4DAAc;AAChD;AACA,KAAK,UAAU,oEAAgB,qCAAqC;AACpE,KAAK,UAAU,qFAAyB,iDAAiD;AACzF,KAAK,UAAU,4EAAgB,uCAAuC;AACtE,iBAAiB,8DAAgB;AACjC;AACA,eAAe,8EAAoB,EAAE,4EAAgB,EAAE,oDAAM;AAC7D;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK,UAAU,2EAAe,mDAAmD;AACjF,KAAK,gEAAgE;AACrE;AACA;AACA;AACA;AACA;AACA;AACA,KAAK,UAAU,2EAAe,YAAY,gFAAoB,EAAE;AAChE,KAAK,6DAA6D;AAClE;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B,8DAAuB,EAAE,gCAAgC;AACxF,+BAA+B,8DAAuB,EAAE,uDAAuD,6CAA6C,EAAE,qDAAqD,uEAAa,GAAG;AACnO,cAAc,oDAAoD,gEAAyB,2BAA2B,uBAAuB,SAAS,uEAAa,EAAE,EAAE,EAAE,EAAE,EAAE;AAC7K,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,sDAAQ;AACtB;AACA,0BAA0B,uEAAa;AACvC;AACA,aAAa;AACb,KAAK,eAAe,EAAE;AACtB;AACA;AACA;AACA;AACA;AACA;AACA,4BAA4B,8DAAuB,EAAE,6BAA6B;AAClF,4BAA4B,8DAAuB,EAAE,oDAAoD,0CAA0C,EAAE,0DAA0D,uEAAa,GAAG;AAC/N,cAAc,oDAAoD,gEAAyB,wBAAwB,uBAAuB,SAAS,uEAAa,EAAE,EAAE,EAAE,EAAE,EAAE;AAC1K,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,sDAAQ;AACtB;AACA,0BAA0B,uEAAa;AACvC;AACA,aAAa;AACb,KAAK,eAAe,EAAE;;AAEtB;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEm4B;;AAEn4B,sC;;;;;;;;;;;;AC9fA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AACA;AACA;AACA;AACA;;AAE4I;AACpG;AACE;AACuwB;;AAEjzB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uCAAuC,2DAAW;AAClD;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAQ,qDAAO;AACf,eAAe,qDAAO;AACtB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAQ,0EAAkB;AAC1B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,yEAAiB;AAChC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0BAA0B,4DAAc;AACxC;AACA;AACA;AACA;AACA,qBAAqB,mEAAqB;AAC1C,wBAAwB,+DAAO;AAC/B;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA,iBAAiB,6DAAe;AAChC;AACA,8BAA8B,wDAAQ,EAAE,sDAAQ;AAChD;AACA,KAAK;AACL;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAQ,0EAAoB;AAC5B;AACA;AACA,QAAQ,qDAAO;AACf;AACA;AACA;AACA;AACA;AACA;AACA,QAAQ,qDAAO;AACf,QAAQ,qDAAO;AACf;AACA,kCAAkC,qDAAO;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA,aAAa,qDAAO;AACpB,YAAY,qDAAO;AACnB;AACA,QAAQ,qDAAO;AACf;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY,+DAAO;AACnB;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,qDAAO,SAAS,qDAAO;AAC1C;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sBAAsB,4DAAc;AACpC,cAAc,oDAAM;AACpB,CAAC;AACD;AACA;AACA;AACA;AACA,cAAc,mBAAmB;AACjC;AACA;AACA;AACA;AACA,WAAW,qEAAe;AAC1B;AACA;AACA;AACA,uEAAuE;AACvE;AACA;AACA;AACA,wEAAwE;AACxE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB,6DAAe;AAChC;AACA;AACA,aAAa,0DAAY,MAAM,sDAAQ;AACvC;AACA;AACA,KAAK;AACL;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kCAAkC,4DAAc;AAChD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,oBAAoB;AAC3C;AACA;AACA;AACA;AACA;AACA;AACA,mEAAmE,UAAU;AAC7E;AACA;AACA,sDAAsD,gCAAgC,sDAAe,yBAAyB,sDAAe,CAAC,oDAAa,GAAG;AAC9J,qBAAqB,gEAAyB,EAAE,kDAAkD;AAClG;AACA,KAAK,4BAA4B,OAAO,oDAAM,kCAAkC,GAAG;AACnF,KAAK,OAAO,oDAAM;AAClB;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,wDAAU;AACxB,KAAK,gBAAgB,UAAU;AAC/B,sBAAsB,oDAAM;AAC5B;AACA,aAAa,GAAG,GAAG,OAAO,oDAAa,EAAE,EAAE,EAAE,QAAQ,EAAE;AACvD;AACA;AACA;AACA;AACA;AACA,uBAAuB,+DAAO;AAC9B;AACA,wDAAwD,OAAO,aAAa,UAAU;AACtF;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA,8BAA8B;AAC9B;AACA;AACA;AACA;AACA,8DAA8D,sCAAsC;AACpG,yBAAyB,gEAAyB,EAAE,0DAA0D;AAC9G,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,wDAAU;AACxB,KAAK,gBAAgB,WAAW,EAAE,QAAQ,EAAE;AAC5C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8CAA8C,+DAAO;AACrD;AACA;AACA,oEAAoE,uCAAuC,sDAAe,CAAC,wDAAQ,GAAG;AACtI,4BAA4B,gEAAyB,EAAE,gEAAgE;AACvH;AACA,KAAK,gCAAgC,OAAO,oDAAM,SAAS,wDAAQ,IAAI;AACvE;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,wDAAU;AACxB,KAAK,gBAAgB,UAAU;AAC/B,sBAAsB,oDAAM;AAC5B,uBAAuB,wDAAQ;AAC/B,aAAa,GAAG,EAAE,EAAE,QAAQ,EAAE;;AAE9B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6BAA6B,mBAAmB;AAChD,mCAAmC,mBAAmB;AACtD;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,mBAAmB;AACtC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB,+DAAiB;AAClC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB,+DAAiB;AAClC,iBAAiB,+DAAiB;AAClC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb,WAAW;AACX;AACA,oEAAoE,uCAAuC,sDAAe,gBAAgB,sDAAe,uBAAuB,sDAAe,CAAC,oDAAM,GAAG;AACzM,4BAA4B,gEAAyB,EAAE,gEAAgE;AACvH;AACA,KAAK,qBAAqB;AAC1B,KAAK,4BAA4B;AACjC,KAAK,6BAA6B,OAAO,oDAAM,SAAS,oDAAM,IAAI;AAClE;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,wDAAU;AACxB,KAAK,gBAAgB,UAAU,qBAAqB,GAAG,4BAA4B,GAAG;AACtF,sBAAsB,oDAAM;AAC5B,uBAAuB,oDAAM;AAC7B,aAAa,GAAG,EAAE,EAAE,QAAQ,EAAE;AAC9B;AACA;AACA;AACA;AACA;AACA,eAAe;AACf;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6CAA6C,eAAe;AAC5D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sCAAsC,UAAU,GAAG,KAAK;AACxD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAoB,iEAAmB;AACvC,0DAA0D,iEAAmB;AAC7E;AACA;AACA;AACA;AACA;AACA;AACA,oBAAoB,iEAAmB;AACvC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+CAA+C,SAAS,GAAG,KAAK;AAChE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wCAAwC,+DAAiB;AACzD,mDAAmD,eAAe;AAClE;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,mBAAmB;AAC1C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4DAA4D,mCAAmC,sDAAe,CAAC,wDAAQ,GAAG;AAC1H,wBAAwB,gEAAyB,EAAE,wDAAwD;AAC3G;AACA,KAAK,gCAAgC,OAAO,oDAAM,SAAS,wDAAQ,IAAI;AACvE;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,wDAAU;AACxB,KAAK,gBAAgB,UAAU;AAC/B,sBAAsB,oDAAM;AAC5B,uBAAuB,wDAAQ;AAC/B,aAAa,GAAG,EAAE,EAAE,QAAQ,EAAE;;AAE9B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kCAAkC,4DAAc;AAChD;AACA,sCAAsC,mBAAmB;AACzD;AACA;AACA;AACA,0BAA0B,4DAAc;AACxC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAc,WAAW,iBAAiB;AAC1C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6BAA6B,eAAe;AAC5C,8BAA8B,eAAe;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA,oEAAoE,yCAAyC;AAC7G,4BAA4B,gEAAyB,EAAE,gEAAgE;AACvH,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,wDAAU;AACxB,KAAK,gBAAgB,WAAW,EAAE,QAAQ,EAAE;AAC5C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sCAAsC,UAAU;AAChD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wCAAwC;AACxC;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA,0CAA0C,UAAU;AACpD;AACA,oCAAoC;AACpC,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB;AACjB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA,sEAAsE,wCAAwC,sDAAe,CAAC,wDAAQ,GAAG,sDAAe,yBAAyB,sDAAe,CAAC,sDAAe,GAAG,sDAAe,oBAAoB;AACtP,6BAA6B,gEAAyB,EAAE,kEAAkE;AAC1H;AACA,KAAK,gCAAgC,OAAO,oDAAM,SAAS,wDAAQ,IAAI,GAAG;AAC1E,KAAK,0CAA0C,OAAO,oDAAM,kCAAkC,GAAG;AACjG,KAAK,OAAO,sDAAQ,EAAE;AACtB,KAAK,gCAAgC,OAAO,sDAAQ,EAAE,GAAG,OAAO,oDAAM,0BAA0B;AAChG;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,wDAAU;AACxB,KAAK,gBAAgB,UAAU;AAC/B,sBAAsB,oDAAM;AAC5B,uBAAuB,wDAAQ;AAC/B,aAAa,GAAG,GAAG;AACnB,sBAAsB,oDAAM;AAC5B;AACA,aAAa,GAAG,GAAG,OAAO,sDAAe,EAAE,GAAG;AAC9C,sBAAsB,sDAAQ;AAC9B,aAAa;AACb,sBAAsB,oDAAM;AAC5B;AACA,aAAa,GAAG,EAAE,EAAE,QAAQ,EAAE;AAC9B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,wDAAQ,yBAAyB,sDAAQ,OAAO,sDAAQ;AACvE,KAAK;AACL,KAAK,0EAA0E;AAC/E;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAoB,8DAAuB,EAAE,qBAAqB;AAClE,oBAAoB,8DAAuB,EAAE,4CAA4C,kCAAkC,EAAE,yCAAyC;AACtK,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,sDAAQ;AACtB,gBAAgB,wCAAwC;AACxD,KAAK,eAAe,EAAE;;AAEtB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,+DAAO;AAC1B,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0BAA0B;AAC1B;AACA;AACA,wBAAwB;AACxB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4DAA4D,mCAAmC,sDAAe,CAAC,wDAAQ,GAAG;AAC1H,wBAAwB,gEAAyB,EAAE,wDAAwD;AAC3G;AACA,KAAK,gCAAgC,OAAO,oDAAM,SAAS,wDAAQ,IAAI;AACvE;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,wDAAU;AACxB,KAAK,gBAAgB,UAAU;AAC/B,sBAAsB,oDAAM;AAC5B,uBAAuB,wDAAQ;AAC/B,aAAa,GAAG,EAAE,EAAE,QAAQ,EAAE;AAC9B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sDAAsD,kCAAkC;AACxF,qBAAqB,wEAAkB,EAAE,2CAA2C,QAAQ,8DAAQ,mBAAmB,EAAE,2CAA2C;AACpK,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,wDAAU;AACxB,gBAAgB,kCAAkC,gEAAU,0BAA0B;AACtF,KAAK,eAAe,EAAE;AACtB;AACA,6CAA6C,wDAAQ;AACrD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB,6DAAe;AAChC;AACA,iBAAiB,6DAAe;AAChC,oBAAoB,sFAAgC;AACpD,2BAA2B,sEAAgB;AAC3C;AACA,uBAAuB,oEAAc;AACrC,iBAAiB,6DAAe;AAChC,oBAAoB,sFAAgC;AACpD,2BAA2B,sEAAgB;AAC3C;AACA;AACA,iBAAiB,6DAAe;AAChC,oBAAoB,sFAAgC;AACpD,2BAA2B,sEAAgB;AAC3C;AACA;AACA,iBAAiB,6DAAe;AAChC,6BAA6B,gFAA0B;AACvD,oBAAoB,sFAAgC;AACpD,2BAA2B,sEAAgB;AAC3C;AACA,uBAAuB,mEAAa;AACpC,iBAAiB,6DAAe;AAChC,oBAAoB,sFAAgC;AACpD,2BAA2B,sEAAgB;AAC3C;AACA;AACA;AACA,8DAA8D,IAAI;AAClE;AACA;AACA;AACA,eAAe,kFAA4B;AAC3C;AACA;AACA,eAAe,mFAA6B;AAC5C;AACA;AACA,eAAe,oFAA8B;AAC7C;AACA;AACA,eAAe,iFAA2B;AAC1C;AACA;AACA,eAAe,yFAAmC;AAClD;AACA;AACA,8DAA8D,oCAAoC,sDAAe,CAAC,wDAAQ,GAAG;AAC7H,yBAAyB,wEAAkB,EAAE,+CAA+C,gCAAgC,8DAAQ,CAAC,sDAAQ,GAAG,EAAE,+CAA+C;AACjM;AACA,KAAK,gCAAgC,OAAO,oDAAM,SAAS,wDAAQ,IAAI;AACvE;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,wDAAU;AACxB,gBAAgB,iEAAiE,sDAAQ,GAAG;AAC5F,KAAK,gBAAgB,UAAU;AAC/B,sBAAsB,oDAAM;AAC5B,uBAAuB,wDAAQ;AAC/B,aAAa,GAAG,EAAE,EAAE,QAAQ,EAAE;;AAE9B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,0DAAY;AAC3B;AACA;AACA;AACA,IAAI,kEAAY;AAChB;AACA;AACA,aAAa,oEAAoB;AACjC;AACA,KAAK,UAAU,yDAAW,kBAAkB;AAC5C,KAAK,UAAU,kEAAoB,yCAAyC;AAC5E,KAAK,UAAU,wDAAQ,mCAAmC;AAC1D;AACA;AACA,KAAK,UAAU,uDAAS,6BAA6B;AACrD,KAAK,2DAA2D,wDAAQ,GAAG;AAC3E;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wBAAwB,2EAAqB,CAAC,0DAAY;AAC1D;AACA;AACA,KAAK,UAAU,6DAAe,oBAAoB;AAClD,KAAK,UAAU,0DAAY,sCAAsC;AACjE;AACA;AACA;AACA;AACA,eAAe,wDAAQ,EAAE,oDAAM,EAAE,yDAAW;AAC5C,KAAK;AACL,KAAK,gFAAgF,wDAAQ,GAAG;AAChG;AACA;AACA;AACA;AACA,kDAAkD,oDAAM;AACxD,KAAK;AACL,KAAK,UAAU,8DAAgB,oCAAoC;AACnE,KAAK,8DAA8D;AACnE,KAAK,qEAAqE,wDAAQ,GAAG;AACrF,KAAK,UAAU,yDAAW,YAAY,yDAAW,SAAS,oDAAM,GAAG;AACnE,KAAK,8EAA8E,oDAAM,GAAG;AAC5F;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB,UAAU,oDAAM,0BAA0B;AAC3D,iBAAiB,sCAAsC,oDAAM,EAAE;AAC/D;AACA;AACA;AACA;AACA;AACA,qBAAqB,8DAAuB,EAAE,sBAAsB;AACpE,qBAAqB,8DAAuB,EAAE,6CAA6C,iCAAiC,sDAAe,qBAAqB,EAAE,iDAAiD,4DAAY,EAAE,+DAAiB,GAAG;AACrP;AACA,KAAK,oCAAoC,OAAO,sDAAQ,EAAE,GAAG,OAAO,sDAAQ,EAAE,GAAG,OAAO,oDAAM,0BAA0B;AACxH;AACA,cAAc,oDAAoD,gEAAyB,iBAAiB,uBAAuB,SAAS,4DAAY,EAAE,+DAAiB,EAAE,EAAE,EAAE,EAAE,EAAE;AACrL,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,sDAAQ;AACtB,gBAAgB,gDAAgD,4DAAY,EAAE,+DAAiB,GAAG;AAClG,KAAK,gBAAgB,UAAU;AAC/B,sBAAsB,sDAAQ;AAC9B,aAAa;AACb,sBAAsB,sDAAQ;AAC9B,aAAa;AACb,sBAAsB,oDAAM;AAC5B;AACA,aAAa,GAAG,EAAE,EAAE,QAAQ,EAAE;;AAE9B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAoB,8DAAQ,CAAC,wDAAQ;AACrC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wBAAwB,aAAa;AACrC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAoB,+DAAO;AAC3B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+CAA+C,aAAa;AAC5D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qEAAqE,aAAa;AAClF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kBAAkB,KAAK,IAAI,UAAU;AACrC;AACA;AACA;AACA;AACA;AACA,sCAAsC,wBAAwB,sDAAe,CAAC,wDAAQ,GAAG;AACzF,aAAa,wEAAkB,EAAE,uDAAuD;AACxF;AACA,KAAK,gCAAgC,OAAO,oDAAM,SAAS,wDAAQ,IAAI;AACvE;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,wDAAU;AACxB,gBAAgB,uDAAuD;AACvE,KAAK,gBAAgB,UAAU;AAC/B,sBAAsB,oDAAM;AAC5B,uBAAuB,wDAAQ;AAC/B,aAAa,GAAG,EAAE,EAAE,QAAQ,EAAE;;AAE9B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qBAAqB,8DAAQ,CAAC,wDAAQ;AACtC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wCAAwC,yBAAyB,sDAAe,CAAC,wDAAQ,GAAG;AAC5F,cAAc,wEAAkB,EAAE,yDAAyD;AAC3F;AACA,KAAK,gCAAgC,OAAO,oDAAM,SAAS,wDAAQ,IAAI;AACvE;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,wDAAU;AACxB,gBAAgB,wDAAwD;AACxE,KAAK,gBAAgB,UAAU;AAC/B,sBAAsB,oDAAM;AAC5B,uBAAuB,wDAAQ;AAC/B,aAAa,GAAG,EAAE,EAAE,QAAQ,EAAE;;AAE9B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uCAAuC,4DAAc;AACrD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wCAAwC,aAAa;AACrD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sBAAsB,+DAAO;AAC7B;AACA,gCAAgC,+DAAO;AACvC;AACA;AACA;AACA,oBAAoB,+DAAO;AAC3B;AACA;AACA;AACA;AACA,+BAA+B,SAAS;AACxC,2BAA2B,qBAAqB;AAChD;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB;AACjB,iBAAiB;AACjB,kBAAkB;AAClB,iBAAiB;AACjB,iBAAiB;AACjB;AACA;AACA;AACA;AACA;AACA,YAAY;AACZ,YAAY;AACZ,YAAY;AACZ,YAAY;AACZ,YAAY;AACZ;AACA,6BAA6B,GAAG;AAChC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wDAAwD,mCAAmC;AAC3F,sBAAsB,gEAAyB,EAAE,oDAAoD;AACrG,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,wDAAU;AACxB,KAAK,gBAAgB,WAAW,EAAE,QAAQ,EAAE;AAC5C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kCAAkC,8DAAuB,EAAE,mCAAmC;AAC9F,kCAAkC,8DAAuB,EAAE,0DAA0D,gDAAgD,EAAE,eAAe,+DAA+D,wDAAQ,EAAE,oDAAM,GAAG,GAAG;AAC3Q,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,sDAAQ;AACtB;AACA,6BAA6B,+DAA+D,wDAAQ,EAAE,oDAAM,GAAG;AAC/G,aAAa;AACb,KAAK,eAAe,EAAE;;AAEtB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4BAA4B,mBAAmB;AAC/C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAQ;AACR;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAQ;AACR;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAQ;AACR;AACA;AACA;AACA;AACA;AACA;AACA,QAAQ,+DAAO;AACf;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAoB,qDAAO;;AAE3B;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAE88E;;AAE98E,4C;;;;;;;;;;;;AClnEA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AACA;AACA;AACA;AACA;;AAE2L;AACmX;AAC/b;AAC6E;;AAE5L;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAQ;AACR;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACwC;AACE;AAC1C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sCAAsC,QAAQ,UAAU,SAAS;AACjE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oCAAoC,QAAQ,UAAU,SAAS,yBAAyB,uBAAuB;AAC/G;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uCAAuC,QAAQ,UAAU,SAAS;AAClE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sCAAsC,QAAQ,UAAU,SAAS,YAAY,WAAW;AACxF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uCAAuC,QAAQ,UAAU,SAAS,yBAAyB,uBAAuB,YAAY,WAAW;AACzI;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uCAAuC,QAAQ,UAAU,SAAS,yBAAyB,uBAAuB,YAAY,WAAW;AACzI;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qCAAqC,QAAQ,UAAU,SAAS,yBAAyB,uBAAuB,YAAY,WAAW,oBAAoB,oBAAoB;AAC/K;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mCAAmC,QAAQ,UAAU,SAAS,yBAAyB,uBAAuB,YAAY,WAAW;AACrI;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iCAAiC,QAAQ,UAAU,SAAS,yBAAyB,uBAAuB,YAAY,WAAW;AACnI;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6CAA6C,gBAAgB;AAC7D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2CAA2C,gBAAgB;AAC3D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8CAA8C,KAAK;AACnD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4CAA4C,KAAK;AACjD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yCAAyC,KAAK;AAC9C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uCAAuC,KAAK;AAC5C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uCAAuC,iBAAiB,IAAI,iBAAiB;AAC7E,kCAAkC,YAAY,gBAAgB,IAAI;AAClE;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,sBAAsB;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY;AACZ;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,cAAc;AACjC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,eAAe;AAClC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,+CAAE,GAAG;AACpB;AACA;AACA;AACA;AACA;AACA,qCAAqC,0DAAG;AACxC;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;AACA,WAAW,uCAAE;AACb,cAAc,gEAAS,IAAI,2DAAM,IAAI,0DAAG;AACxC;AACA;AACA,QAAQ,mEAAa;AACrB;AACA;AACA,QAAQ,gEAAU;AAClB;AACA;AACA;AACA,eAAe,iDAAI;AACnB;AACA,WAAW,+CAAE;AACb;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iDAAiD,KAAK;AACtD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,4BAA4B;AAC3C;AACA;AACA;AACA;AACA,+BAA+B;AAC/B,kCAAkC,aAAa;AAC/C;AACA,0CAA0C;AAC1C,2CAA2C;AAC3C,sCAAsC;AACtC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,4BAA4B;AAC3C;AACA;AACA,oDAAoD;AACpD;AACA;AACA,iBAAiB;AACjB,uBAAuB,aAAa;AACpC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA,iDAAiD;AACjD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4BAA4B,kCAAkC;AAC9D;AACA,iEAAiE,iCAAiC;AAClG,kBAAkB,QAAQ,EAAE,MAAM,EAAE,SAAS;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iCAAiC,EAAE,GAAG,2BAA2B;AACjE;AACA,SAAS;AACT,wCAAwC,QAAQ,GAAG,oBAAoB;AACvE;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,EAAE,GAAG,2BAA2B;AACvD,SAAS;AACT,kBAAkB,wBAAwB,IAAI,oBAAoB;AAClE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4BAA4B;AAC5B;AACA;AACA,iDAAiD;AACjD;AACA;AACA;AACA;AACA;AACA,4BAA4B;AAC5B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4BAA4B;AAC5B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAc,4BAA4B,EAAE,uCAAuC;AACnF;AACA;AACA;AACA,sBAAsB,EAAE,sBAAsB,GAAG,8BAA8B;AAC/E;AACA;AACA;AACA;AACA;AACA;AACA,8BAA8B,qBAAqB,GAAG,kBAAkB;AACxE,eAAe,qBAAqB,GAAG,sBAAsB;AAC7D,KAAK;AACL,kCAAkC,oBAAoB;AACtD;AACA,6BAA6B;AAC7B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6CAA6C;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAgB,MAAM;AACtB;AACA;AACA,iDAAiD;AACjD,+EAA+E,eAAe;AAC9F;AACA;AACA;AACA;AACA;AACA;AACA,sCAAsC;AACtC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2DAA2D;AAC3D,qDAAqD,SAAS;AAC9D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yCAAyC,IAAI;AAC7C;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,WAAW;AACtC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,4BAA4B;AAC3C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yBAAyB,oDAAe,uBAAuB;AAC/D,4BAA4B,oDAAe,GAAG;AAC9C,0BAA0B,oDAAe,GAAG;AAC5C,iCAAiC,oDAAe,GAAG;AACnD,yBAAyB,oDAAe;AACxC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kKAAkK;AAClK;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8CAA8C,0DAAG;AACjD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sCAAsC,0DAAG;AACzC;AACA;AACA;AACA;AACA,oEAAoE,qBAAqB;AACzF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qDAAqD;AACrD,mDAAmD;AACnD,sDAAsD;AACtD,gBAAgB;AAChB,KAAK,GAAG,WAAW,UAAU,aAAa,EAAE;AAC5C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,kCAAkC;AACjD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6BAA6B,IAAI,WAAW,QAAQ;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,4BAA4B;AAC3C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4CAA4C,GAAG,4CAA4C,EAAE;AAC7F,cAAc,WAAW,EAAE,EAAE;AAC7B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,0BAA0B;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA,kCAAkC,oDAAe,aAAa,oDAAe,gBAAgB,oDAAe,qBAAqB,oDAAe,kBAAkB,oDAAe;AACjL;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4DAA4D;AAC5D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kEAAkE,EAAE,QAAQ,MAAM;AAClF,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8BAA8B,WAAW;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB;AACjB,iCAAiC,UAAU;AAC3C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4DAA4D;AAC5D;AACA;AACA,4CAA4C;AAC5C;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAc,QAAQ;AACtB;AACA;AACA;AACA;AACA;AACA,YAAY;AACZ;AACA;AACA;AACA,iDAAiD;AACjD;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qFAAqF;AACrF;AACA;AACA;AACA;AACA;AACA,4DAA4D;AAC5D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4DAA4D;AAC5D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA,qBAAqB;AACrB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iCAAiC;AACjC;AACA;AACA;AACA;AACA;AACA,YAAY;AACZ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8CAA8C;AAC9C;AACA;AACA;AACA,wCAAwC;AACxC;AACA;AACA;AACA;AACA;AACA,+EAA+E;AAC/E;AACA,KAAK;AACL;AACA;AACA;AACA;AACA,0CAA0C,EAAE;AAC5C;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2EAA2E,0DAAG;AAC9E;AACA;AACA;AACA,CAAC;AACD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iEAAiE,gCAAgC;AACjG;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iCAAiC,GAAG;AACpC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,+CAAU;AACzB;AACA;AACA,eAAe,+CAAU;AACzB;AACA;AACA,eAAe,+CAAU,8FAA8F,WAAW;AAClI;AACA;AACA,eAAe,+CAAU,4GAA4G,WAAW;AAChJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2CAA2C,yDAAW;AACtD;AACA;AACA;AACA,yCAAyC,0DAAG;AAC5C,8BAA8B,iEAAU;AACxC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA,uCAAuC,0DAAG;AAC1C,4BAA4B,iEAAU;AACtC;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA,mEAAmE,eAAe;AAClF;AACA;AACA;AACA,qCAAqC,kCAAkC;AACvE;AACA;AACA;AACA;AACA;AACA;AACA,sBAAsB,0DAAG;AACzB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,+CAAE,iBAAiB,0DAAG;AACrC;AACA,kCAAkC,iEAAU;AAC5C;AACA;AACA;AACA,2BAA2B,+CAAE;AAC7B;AACA;AACA,aAAa;AACb,SAAS,GAAG,gEAAS,IAAI,4DAAK,cAAc,iEAAU;AACtD,6BAA6B,+CAAU;AACvC;AACA,2BAA2B,+CAAE,2BAA2B;AACxD;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2EAA2E;AAC3E;AACA;AACA;AACA,4DAA4D,+DAAQ;AACpE,6DAA6D;AAC7D;AACA,SAAS;AACT;AACA;AACA,eAAe,gEAAgE;AAC/E;AACA;AACA;AACA;AACA;AACA;AACA,4DAA4D,+DAAQ;AACpE;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA,0BAA0B,0DAAG;AAC7B;AACA,2DAA2D;AAC3D,iBAAiB;AACjB;AACA,mBAAmB,+CAAE,iCAAiC;AACtD;AACA,eAAe,uCAAuC;AACtD;AACA;AACA;AACA;AACA,iCAAiC,+DAAQ;AACzC;AACA;AACA,mBAAmB,+BAA+B;AAClD;AACA;AACA,sCAAsC,0DAAG;AACzC;AACA;AACA,uBAAuB,+CAAE,yCAAyC;AAClE;AACA;AACA,kCAAkC,0DAAG;AACrC,SAAS;AACT;AACA;AACA;AACA;AACA,mBAAmB,+CAAE;AACrB;AACA;AACA;AACA;AACA,uBAAuB,+CAAE;AACzB;AACA;AACA,sBAAsB,+DAAQ;AAC9B;AACA;AACA,8BAA8B,0DAAG;AACjC;AACA;AACA,qBAAqB;AACrB;AACA;AACA,aAAa;AACb;AACA,eAAe,+CAAE;AACjB;AACA;AACA;AACA;AACA,mBAAmB,+CAAE;AACrB,oBAAoB,iDAAI,eAAe,0DAAG;AAC1C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT,wBAAwB,gEAAS,IAAI,0DAAG;AACxC;AACA;AACA,sEAAsE,qCAAqC;AAC3G;AACA;AACA,SAAS,GAAG,4DAAK;AACjB;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,+CAAE;AACzB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mDAAmD,WAAW,kBAAkB,0BAA0B;AAC1G;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAoB,gFAAgF;AACpG;AACA,gBAAgB,+EAA+E;AAC/F;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uCAAuC;AACvC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAgB;AAChB;AACA;AACA;AACA;AACA,gBAAgB;AAChB;AACA,YAAY;AACZ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0DAA0D;AAC1D;AACA;AACA,yCAAyC;AACzC;AACA;AACA;AACA;AACA;AACA;AACA,0DAA0D;AAC1D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,gEAAS;AACpC,kBAAkB,0DAAG,qDAAqD,OAAO,oBAAoB;AACrG;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY;AACZ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iCAAiC,GAAG;AACpC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,CAAC;AACD;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA,CAAC;AACD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,WAAW,gEAAS;AACpB,eAAe,0DAAa,wBAAwB,2DAAI,KAAK,gEAAS;AACtE,kBAAkB,2DAAI;AACtB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb,SAAS,kBAAkB,6DAAM,kCAAkC,0DAAG;AACtE,QAAQ,2DAAI;AACZ,KAAK;AACL;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,+DAAQ;AACnC,mBAAmB,2CAA2C,yCAAyC,EAAE;AACzG;AACA,uBAAuB,+CAAE,+BAA+B,OAAO,qBAAqB;AACpF;AACA;AACA,sBAAsB,+DAAQ;AAC9B;AACA;AACA,oBAAoB,+CAAE;AACtB,aAAa,GAAG,0DAAG,gDAAgD,OAAO,eAAe;AACzF,SAAS;AACT;AACA;AACA;AACA,WAAW,iDAAI,cAAc,+DAAQ,+FAA+F,4DAAK;AACzI;AACA,KAAK;AACL;AACA;AACA,WAAW,iDAAI,cAAc,gEAAS;AACtC,eAAe,iDAAI;AACnB;AACA;AACA;AACA;AACA;AACA,kBAAkB,gEAAS,IAAI,4DAAK;AACpC;AACA,SAAS;AACT,KAAK,GAAG,4DAAK;AACb;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,WAAW,+CAAE;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,WAAW,+CAAE;AACb;AACA;AACA;AACA;AACA,eAAe,+CAAE;AACjB;AACA,eAAe,kDAAK;AACpB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mCAAmC,4DAAK;AACxC,SAAS;AACT,KAAK;AACL,WAAW,+CAAE;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,kDAAK;AACpB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uCAAuC,4DAAK;AAC5C,aAAa;AACb,mBAAmB,+CAAE;AACrB,SAAS;AACT,KAAK;AACL,WAAW,+CAAE;AACb;AACA;AACA;AACA;AACA,eAAe,+CAAE;AACjB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B,4DAAK;AACpC,KAAK;AACL,WAAW,+CAAE;AACb;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wEAAwE,iCAAiC,uDAAuD,yEAAyE;AACzO;AACA;AACA;AACA,mBAAmB,+CAAE;AACrB;AACA;AACA,uBAAuB,+CAAU;AACjC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kGAAkG;AAClG;AACA;AACA;AACA;AACA;AACA,qHAAqH;AACrH;AACA;AACA,eAAe,+BAA+B;AAC9C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAgB,mDAAmD;AACnE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL,+EAA+E;AAC/E;AACA,YAAY;AACZ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+EAA+E,EAAE,SAAS,EAAE;AAC5F;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAgB;AAChB;AACA;AACA;AACA;AACA;AACA;AACA,gBAAgB;AAChB;AACA;AACA;AACA;AACA,YAAY;AACZ;AACA;AACA;AACA;AACA;AACA,gDAAgD;AAChD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yCAAyC;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gDAAgD;AAChD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,+DAAQ;AACnC,kBAAkB,0DAAG,kDAAkD,OAAO,iBAAiB;AAC/F;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,+DAAQ;AACnC,mBAAmB,0BAA0B,oBAAoB,EAAE;AACnE;AACA,uBAAuB,+CAAE;AACzB;AACA;AACA,mBAAmB,iDAAI;AACvB,sBAAsB,gEAAS,+FAA+F,0DAAG,qCAAqC,+DAAQ,KAAK,+DAAQ,+DAA+D,+CAAE,MAAM,0CAAK;AACvQ,SAAS;AACT;AACA;AACA;AACA;AACA;AACA,cAAc,0DAAG;AACjB;AACA,uDAAuD;AACvD;AACA,KAAK;AACL;AACA;AACA;AACA;AACA,eAAe,+CAAE,GAAG;AACpB;AACA;AACA,WAAW,iDAAI,YAAY,+DAAQ;AACnC,cAAc,0DAAG;AACjB;AACA,KAAK,KAAK,+DAAQ,KAAK,+DAAQ;AAC/B;AACA;AACA;AACA,mBAAmB,+CAAE;AACrB;AACA,eAAe,0CAAK;AACpB,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,gEAAS;AACpC;AACA;AACA,uBAAuB,iDAAI,kBAAkB,0DAAG;AAChD;AACA,mBAAmB,iDAAI;AACvB,SAAS;AACT;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gCAAgC;AAChC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK,+CAA+C;AACpD;AACA;AACA;AACA;AACA;AACA;AACA,wEAAwE,2CAA2C;AACnH,6BAA6B,+DAAwB,EAAE,4IAA4I;AACnM,QAAQ,uDAAgB;AACxB,KAAK,EAAE,2BAA2B,uBAAuB,EAAE,oBAAoB;AAC/E,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,uDAAS;AACvB,gBAAgB,8CAA8C;AAC9D,KAAK,eAAe,EAAE;;AAEtB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,mBAAmB;AACtC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wCAAwC,SAAS;AACjD;;AAEA;AACA;AACA,SAAS,wDAAwD;AACjE,SAAS,oDAAoD;AAC7D,SAAS;AACT;AACA;AACA;AACA;AACA,2DAA2D,SAAS;AACpE;AACA;AACA;AACA,2DAA2D,SAAS;AACpE;AACA;AACA,2DAA2D,SAAS;AACpE;AACA;AACA,2DAA2D,SAAS;AACpE;AACA;AACA,2DAA2D,SAAS;AACpE;AACA;AACA,2DAA2D,SAAS;AACpE;AACA;AACA,2DAA2D,SAAS;AACpE;AACA;AACA,2DAA2D,SAAS;AACpE;AACA;AACA,2DAA2D,SAAS;AACpE;AACA;AACA,2DAA2D,SAAS;AACpE;AACA;AACA;AACA,0DAA0D,SAAS,SAAS,kBAAkB,iBAAiB,EAAE,iCAAiC,IAAI;AACtJ;AACA;AACA,2DAA2D,SAAS;AACpE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kBAAkB,WAAW;AAC7B;AACA;AACA;AACA;AACA;AACA,kBAAkB,WAAW,GAAG,kBAAkB;AAClD;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uDAAuD,OAAO,WAAW,oBAAoB;AAC7F;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,4DAAc;AACjC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mCAAmC,0DAAG;AACtC;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA,mBAAmB,iDAAI;AACvB;AACA;AACA,2DAA2D,+DAAQ;AACnE,iCAAiC,6DAAe;AAChD,2BAA2B,+CAAE;AAC7B;AACA;AACA,2BAA2B,iDAAI;AAC/B;AACA,aAAa;AACb;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,WAAW,+CAAE;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0BAA0B,4CAAO;AACjC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sBAAsB;AACtB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qCAAqC,yDAAW;AAChD,oCAAoC,sDAAQ;AAC5C,oCAAoC,oDAAM;AAC1C,iDAAiD,oDAAM;AACvD;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B,oDAAe;AAC9C;AACA;AACA;AACA;AACA;AACA;AACA,sBAAsB;AACtB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qBAAqB,iDAAiD;AACtE;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA,gCAAgC,6DAAM;AACtC;AACA,QAAQ,0DAAG,qCAAqC,OAAO,2DAA2D;AAClH;AACA,QAAQ,gEAAS;AACjB;AACA;AACA,mBAAmB,+CAAE;AACrB;AACA,YAAY,0DAAG;AACf;AACA;AACA;AACA;AACA;AACA;AACA,sGAAsG,mCAAmC,2BAA2B;AACpK;AACA;AACA,aAAa,GAAG,gEAAS;AACzB;AACA;AACA;AACA;AACA;AACA,2BAA2B,+CAAE;AAC7B;AACA,oBAAoB,gEAAS;AAC7B;AACA;AACA;AACA,mCAAmC,0CAAK;AACxC;AACA;AACA,qBAAqB;AACrB;AACA;AACA,oBAAoB,gEAAS;AAC7B;AACA;AACA;AACA,oBAAoB,0DAAG;AACvB,+EAA+E,4BAA4B,gCAAgC;AAC3I,qBAAqB;AACrB;AACA;AACA;AACA,oBAAoB,0DAAG;AACvB;AACA;AACA;AACA;AACA;AACA;AACA,qBAAqB;AACrB;AACA,oBAAoB,0DAAG;AACvB;AACA;AACA,qBAAqB;AACrB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B,kDAAkD;AACjF;AACA;AACA;AACA,+BAA+B,+CAAE,+BAA+B,OAAO,wFAAwF,YAAY,+CAA+C,GAAG;AAC7N;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B,0CAAK;AACpC;AACA;AACA,aAAa;AACb;AACA;AACA,uBAAuB,8FAA8F,iCAAiC,EAAE;AACxJ;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB;AACjB,aAAa;AACb;AACA,YAAY,0DAAG;AACf;AACA;AACA,aAAa,GAAG,0DAAG,qCAAqC,OAAO,oFAAoF,2EAA2E,0DAAG;AACjO;AACA,8EAA8E,kCAAkC;AAChH;AACA;AACA;AACA,aAAa,GAAG,0DAAG;AACnB;AACA;AACA,aAAa,GAAG,6DAAM;AACtB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA,2BAA2B,+CAAE,SAAS,0DAAG;AACzC;AACA;AACA,qBAAqB,GAAG,gEAAS;AACjC;AACA,+BAA+B,+CAAE,8EAA8E,0DAAG;AAClH;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yBAAyB;AACzB,qBAAqB,GAAG,0DAAG;AAC3B;AACA;AACA,qBAAqB;AACrB;AACA;AACA,aAAa;AACb;AACA;AACA,uBAAuB,8FAA8F,iCAAiC,EAAE;AACxJ;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB;AACjB,aAAa,GAAG,0DAAG;AACnB;AACA,sDAAsD,OAAO,oBAAoB;AACjF,aAAa;AACb;AACA;AACA;AACA;AACA;AACA,YAAY,0DAAG;AACf;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa,gGAAgG,0DAAG;AAChH;AACA;AACA,iBAAiB;AACjB;AACA;AACA;AACA,aAAa,GAAG,+DAAQ;AACxB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qHAAqH,KAAK,6CAA6C,kBAAkB;AACzL;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa,GAAG,iEAAU;AAC1B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oGAAoG,2DAA2D;AAC/J,yBAAyB;AACzB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,0CAAK;AAC5B,aAAa;AACb;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4DAA4D;AAC5D;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0DAA0D,mBAAmB;AAC7E;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wEAAwE,mBAAmB;AAC3F,iBAAiB;AACjB,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT,WAAW,uCAAuC;AAClD,WAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0BAA0B;AAC1B,2CAA2C,aAAa;AACxD;AACA;AACA;AACA;AACA;AACA;AACA,8BAA8B,wBAAwB;AACtD;AACA;AACA,2CAA2C,UAAU,mCAAmC;AACxF;AACA;AACA,2CAA2C,UAAU,iCAAiC;AACtF;AACA;AACA;AACA;AACA,0CAA0C,kBAAkB;AAC5D;AACA;AACA,wCAAwC,kBAAkB;AAC1D;AACA;AACA,wDAAwD,kBAAkB;AAC1E;AACA;AACA,iDAAiD;AACjD,eAAe,gGAAgG;AAC/G,YAAY,+DAAS;AACrB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sDAAsD;AACtD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iDAAiD,2BAA2B;AAC5E;AACA;AACA;AACA;AACA;AACA,iCAAiC,4BAA4B;AAC7D,YAAY,+DAAS,+BAA+B,oDAAM;AAC1D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kDAAkD,kBAAkB;AACpE;AACA;AACA,kDAAkD,4CAA4C;AAC9F;AACA;AACA;AACA;AACA;AACA,iCAAiC,4BAA4B;AAC7D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS,IAAI;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yCAAyC;AACzC;AACA;AACA;AACA;AACA;AACA;AACA,yCAAyC;AACzC;AACA;AACA;AACA;AACA;AACA;AACA,yCAAyC;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA,+EAA+E,WAAW,mBAAmB;AAC7G;AACA;AACA,qEAAqE,WAAW,mBAAmB;AACnG;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uFAAuF,sCAAsC;AAC7H;AACA;AACA,0CAA0C,0BAA0B,sDAAe,CAAC,kDAAW,GAAG,sDAAe,iBAAiB,sDAAe,0BAA0B,sDAAe,CAAC,wDAAe,GAAG,sDAAe,CAAC,sDAAe,GAAG,sDAAe,CAAC,mEAA4B,GAAG,sDAAe,CAAC,sDAAe,GAAG,sDAAe,aAAa;AAC5V,eAAe,gEAAyB,EAAE,sCAAsC;AAChF;AACA,KAAK,OAAO,kDAAI,EAAE;AAClB,KAAK,sBAAsB;AAC3B,KAAK,+BAA+B;AACpC,KAAK,OAAO,wDAAQ,EAAE;AACtB,KAAK,OAAO,sDAAQ,EAAE;AACtB,KAAK,OAAO,mEAAqB,EAAE;AACnC,KAAK,OAAO,sDAAQ,EAAE;AACtB,KAAK;AACL;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,wDAAU;AACxB,KAAK,gBAAgB,UAAU,OAAO,kDAAW,EAAE,GAAG,sBAAsB,GAAG,+BAA+B,GAAG,OAAO,wDAAe,EAAE,GAAG,OAAO,sDAAe,EAAE,GAAG,OAAO,mEAA4B,EAAE,GAAG,OAAO,sDAAe,EAAE,GAAG,kBAAkB,EAAE,EAAE,QAAQ,EAAE;AAC1Q;AACA,mBAAmB,qBAAqB;AACxC;AACA;AACA,2DAA2D,IAAI,oBAAoB,EAAE;AACrF;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kCAAkC,yCAAyC;AAC3E;AACA;AACA;AACA;AACA;AACA;AACA,sDAAsD,cAAc;AACpE,0CAA0C;AAC1C;AACA;AACA,8CAA8C,cAAc;AAC5D;AACA;AACA;AACA;AACA;AACA,QAAQ,yCAAyC;AACjD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mDAAmD,YAAY;AAC/D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mDAAmD,YAAY;AAC/D;AACA;AACA;AACA;AACA,QAAQ,gFAAgF;AACxF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6CAA6C,eAAe;AAC5D;AACA;AACA;AACA;AACA,QAAQ,gEAAgE;AACxE;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,sCAAsC;AACjE,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4BAA4B,gDAAgD;AAC5E,2CAA2C,gDAAgD;AAC3F;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY,+DAAS;AACrB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA,kDAAkD,8BAA8B,+DAAwB,UAAU,+DAAwB,kBAAkB,+DAAwB,cAAc,+DAAwB,CAAC,uDAAgB,GAAG,+DAAwB,CAAC,wDAAiB,GAAG;AAC3R,kBAAkB,+DAAwB,EAAE,oIAAoI;AAChL,QAAQ,wDAAiB,0DAA0D,sBAAsB,EAAE;AAC3G,KAAK,EAAE,WAAW,+RAA+R,EAAE;AACnT;AACA,KAAK,eAAe;AACpB,KAAK,uBAAuB;AAC5B,KAAK,6BAA6B,OAAO,uDAAS,uBAAuB,GAAG;AAC5E,KAAK,OAAO,uDAAS,EAAE;AACvB,KAAK,OAAO,wDAAU;AACtB;AACA;AACA,mBAAmB,OAAO,mDAAK,EAAE;AACjC,gBAAgB,OAAO,mDAAK,EAAE;AAC9B,2BAA2B,OAAO,mDAAK,EAAE;AACzC,wBAAwB,OAAO,mDAAK,EAAE;AACtC,0BAA0B,OAAO,mDAAK,EAAE;AACxC,kBAAkB,OAAO,mDAAK,EAAE;AAChC,aAAa,OAAO,mDAAK,EAAE;AAC3B,kBAAkB,OAAO,mDAAK,EAAE;AAChC,2BAA2B,OAAO,mDAAK,EAAE;AACzC,eAAe,OAAO,0DAAY,oBAAoB;AACtD;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,uDAAS;AACvB,gBAAgB,4CAA4C;AAC5D,KAAK,gBAAgB,UAAU,eAAe,GAAG,uBAAuB,GAAG;AAC3E,sBAAsB,uDAAS;AAC/B;AACA,aAAa,GAAG,GAAG,OAAO,uDAAgB,EAAE,GAAG,OAAO,wDAAiB,EAAE,EAAE,EAAE,GAAG;AAChF,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,0DAAY;AAC9B;AACA,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS,GAAG,EAAE,EAAE;AAChB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA,4BAA4B,gDAAgD;AAC5E,2CAA2C,gDAAgD;AAC3F;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY,+DAAS;AACrB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA,kEAAkE,sCAAsC,+DAAwB,UAAU,+DAAwB,kBAAkB,+DAAwB,CAAC,gEAAuB,GAAG;AACvO,0BAA0B,+DAAwB,EAAE,2KAA2K;AAC/N,QAAQ,wDAAiB,wEAAwE,oFAAoF,EAAE;AACvL,KAAK;AACL,QAAQ,4DAAqB,mBAAmB,2DAAoB;AACpE,QAAQ,yDAAkB;AAC1B,KAAK,EAAE,WAAW,iTAAiT,aAAa,kEAA2B,GAAG;AAC9W;AACA,KAAK,eAAe;AACpB,KAAK,uBAAuB;AAC5B,KAAK,OAAO,gEAAgB;AAC5B;AACA;AACA,cAAc,OAAO,yDAAW,0BAA0B,GAAG,OAAO,mDAAK,EAAE;AAC3E,mBAAmB,OAAO,mDAAK,EAAE;AACjC,gBAAgB,OAAO,mDAAK,EAAE;AAC9B,2BAA2B,OAAO,mDAAK,EAAE;AACzC,wBAAwB,OAAO,mDAAK,EAAE;AACtC,0BAA0B,OAAO,mDAAK,EAAE;AACxC,kBAAkB,OAAO,mDAAK,EAAE;AAChC,aAAa,OAAO,mDAAK,EAAE;AAC3B,YAAY,OAAO,yDAAW,EAAE;AAChC,kBAAkB,OAAO,mDAAK,EAAE;AAChC,2BAA2B,OAAO,mDAAK,EAAE;AACzC,eAAe,OAAO,0DAAY,8FAA8F;AAChI;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,uDAAS;AACvB,gBAAgB,6CAA6C;AAC7D,KAAK,gBAAgB,UAAU,eAAe,GAAG,uBAAuB,GAAG,OAAO,gEAAuB,EAAE,EAAE,EAAE,GAAG;AAClH,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,0DAAY;AAC9B;AACA,SAAS;AACT,kBAAkB,yDAAW;AAC7B,SAAS;AACT,kBAAkB,yDAAW;AAC7B;AACA,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS,GAAG,EAAE,EAAE;AAChB;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wFAAwF;AACxF,QAAQ;AACR;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,WAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mEAAmE,YAAY;AAC/E;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wCAAwC;AACxC;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB;AACjB;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8DAA8D,oCAAoC,+DAAwB,UAAU,+DAAwB,CAAC,wDAAiB,GAAG,+DAAwB,CAAC,uDAAgB,GAAG,+DAAwB,CAAC,+DAAwB,GAAG,+DAAwB,iBAAiB,+DAAwB,yBAAyB;AAC3W,wBAAwB,+DAAwB,EAAE,iJAAiJ;AACnM,QAAQ,4DAAqB;AAC7B,QAAQ,4DAAqB;AAC7B,KAAK;AACL;AACA,QAAQ,4DAAqB,MAAM,yDAAkB;AACrD,QAAQ,4DAAqB,MAAM,yDAAkB;AACrD,KAAK,EAAE,WAAW,2FAA2F,6CAA6C,kEAA2B,GAAG;AACxL;AACA,KAAK,eAAe;AACpB,KAAK,OAAO,wDAAU,EAAE;AACxB,KAAK,OAAO,uDAAS,EAAE;AACvB,KAAK,OAAO,+DAAiB,EAAE;AAC/B,KAAK,iCAAiC,OAAO,sDAAQ,EAAE,GAAG;AAC1D,KAAK,yCAAyC,OAAO,sDAAQ,EAAE;AAC/D;AACA;AACA,aAAa,OAAO,6DAAe,sBAAsB,oBAAoB,IAAI;AACjF,sBAAsB,OAAO,6DAAe,8BAA8B,oBAAoB,IAAI;AAClG,+BAA+B,OAAO,mDAAK,EAAE;AAC7C,wBAAwB,OAAO,mDAAK,EAAE;AACtC;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,uDAAS;AACvB;AACA;AACA;AACA,aAAa;AACb,KAAK,gBAAgB,UAAU,eAAe,GAAG,OAAO,wDAAiB,EAAE,GAAG,OAAO,uDAAgB,EAAE,GAAG,OAAO,+DAAwB,EAAE,GAAG;AAC9I,sBAAsB,sDAAQ;AAC9B,aAAa,GAAG,GAAG;AACnB,sBAAsB,sDAAQ;AAC9B,aAAa,GAAG,EAAE,EAAE,GAAG;AACvB,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,6DAAe;AACjC,gCAAgC,oBAAoB;AACpD,SAAS;AACT,kBAAkB,6DAAe;AACjC,wCAAwC,oBAAoB;AAC5D,SAAS,GAAG,EAAE,EAAE;;AAEhB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK,wEAAwE;AAC7E;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kCAAkC,0DAAY;AAC9C,oCAAoC,0DAAY;AAChD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sDAAsD,gCAAgC,+DAAwB,0BAA0B,+DAAwB,CAAC,8DAAuB,GAAG,+DAAwB,CAAC,sEAA+B,GAAG,+DAAwB,UAAU,+DAAwB,CAAC,+DAAwB,GAAG;AAC5U,oBAAoB,+DAAwB,EAAE,+DAA+D,6DAA6D,wBAAwB;AAClM;AACA,KAAK,+BAA+B;AACpC,KAAK,OAAO,8DAAgB,EAAE;AAC9B,KAAK,OAAO,sEAAwB,EAAE;AACtC,KAAK,6BAA6B,OAAO,uDAAS,mBAAmB,GAAG;AACxE,KAAK,OAAO,+DAAiB;AAC7B;AACA;AACA,sBAAsB,OAAO,oDAAM,uBAAuB;AAC1D,wBAAwB,OAAO,oDAAM,yBAAyB;AAC9D;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,uDAAS;AACvB,gBAAgB,gDAAgD;AAChE,KAAK,gBAAgB,UAAU,+BAA+B,GAAG,OAAO,8DAAuB,EAAE,GAAG,OAAO,sEAA+B,EAAE,GAAG;AAC/I,sBAAsB,uDAAS;AAC/B;AACA,aAAa,GAAG,GAAG,OAAO,+DAAwB,EAAE,EAAE,EAAE,GAAG;AAC3D,kBAAkB,oDAAM;AACxB;AACA,SAAS;AACT,kBAAkB,oDAAM;AACxB;AACA,SAAS,GAAG,EAAE,EAAE;AAChB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gCAAgC,sCAAsC;AACtE;AACA;AACA;AACA;AACA;AACA;AACA,yBAAyB,iEAAU,OAAO,+CAAE;AAC5C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,+CAAE;AACjB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sBAAsB,6DAAM,qCAAqC,gEAAS;AAC1E,kCAAkC,EAAE;AACpC;AACA;AACA,2CAA2C,yDAAW;AACtD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,iDAAI,WAAW,+DAAQ,IAAI,0DAAG;AAC7C;AACA;AACA;AACA;AACA,gCAAgC,+DAAQ;AACxC;AACA;AACA,aAAa;AACb,SAAS;AACT;AACA;AACA,4DAA4D,mCAAmC,sDAAe,UAAU,sDAAe,CAAC,mEAA4B,GAAG,sDAAe,CAAC,sDAAe,GAAG,sDAAe,CAAC,sDAAe,GAAG,sDAAe,sBAAsB;AAChR,wBAAwB,gEAAyB,EAAE,wDAAwD;AAC3G;AACA,KAAK,eAAe;AACpB,KAAK,OAAO,mEAAqB,EAAE;AACnC,KAAK,OAAO,sDAAQ,EAAE;AACtB,KAAK,OAAO,sDAAQ,EAAE;AACtB,KAAK;AACL;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,wDAAU;AACxB,KAAK,gBAAgB,UAAU,eAAe,GAAG,OAAO,mEAA4B,EAAE,GAAG,OAAO,sDAAe,EAAE,GAAG,OAAO,sDAAe,EAAE,GAAG,2BAA2B,EAAE,EAAE,QAAQ,EAAE;;AAExL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0DAA0D;AAC1D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0DAA0D,kCAAkC,sDAAe,UAAU,sDAAe,CAAC,gEAAuB,GAAG,sDAAe,aAAa;AAC3L,uBAAuB,gEAAyB,EAAE,sDAAsD;AACxG;AACA,KAAK,eAAe;AACpB,KAAK,OAAO,gEAAgB,EAAE;AAC9B,KAAK;AACL;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,wDAAU;AACxB,KAAK,gBAAgB,UAAU,eAAe,GAAG,OAAO,gEAAuB,EAAE,GAAG,kBAAkB,EAAE,EAAE,QAAQ,EAAE;;AAEpH;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iCAAiC,4DAAc;AAC/C;AACA;AACA;AACA,iCAAiC,4DAAc;AAC/C,YAAY;AACZ;AACA,IAAI,wDAAQ;AACZ,KAAK,yDAAyD;AAC9D;AACA;AACA;AACA;AACA,mDAAmD,wDAAQ,EAAE,sDAAQ,EAAE,mEAAqB,EAAE,sDAAQ;AACtG,oEAAoE,sDAAQ;AAC5E,qCAAqC,sDAAQ;AAC7C;AACA,KAAK;AACL;AACA,KAAK,iEAAiE;AACtE,KAAK,UAAU,mEAAqB,YAAY,oEAAsB,EAAE;AACxE;AACA;AACA;AACA,KAAK,8CAA8C;AACnD;AACA;AACA,eAAe,0DAAY;AAC3B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gCAAgC;AAChC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAQ;AACR;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wCAAwC,sDAAQ,QAAQ,sDAAQ;AAChE,iBAAiB;AACjB,iBAAiB,8DAA8D,EAAE;AACjF;AACA,6BAA6B,gEAAgB;AAC7C;AACA,2BAA2B,gEAAgB,OAAO,oDAAM,CAAC,6DAAa,OAAO,sDAAQ;AACrF,iBAAiB;AACjB;AACA;AACA;AACA,mCAAmC,gEAAgB;AACnD,iBAAiB;AACjB;AACA;AACA;AACA;AACA,iBAAiB;AACjB,iBAAiB,UAAU,0DAAY,+CAA+C;AACtF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAQ;AACR;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAgB;AAChB;AACA;AACA,oBAAoB,8DAAuB,EAAE,qBAAqB;AAClE,oBAAoB,8DAAuB,EAAE,4CAA4C,gCAAgC,sDAAe,2BAA2B,sDAAe,aAAa,EAAE,EAAE;AACnM;AACA,KAAK,gCAAgC,OAAO,sDAAQ,EAAE,GAAG,OAAO,oDAAM,iCAAiC,GAAG;AAC1G,KAAK,6BAA6B,OAAO,sDAAQ,EAAE;AACnD;AACA,cAAc,oDAAoD,gEAAyB,gBAAgB,0MAA0M,EAAE,EAAE;AACzT,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,sDAAQ;AACtB;AACA;AACA;AACA;AACA,aAAa;AACb,KAAK,gBAAgB,UAAU;AAC/B,sBAAsB,sDAAQ;AAC9B,aAAa;AACb,sBAAsB,oDAAM;AAC5B;AACA,aAAa,GAAG,GAAG;AACnB,sBAAsB,sDAAQ;AAC9B,aAAa,GAAG,EAAE,EAAE,QAAQ,EAAE;AAC9B;AACA;AACA;AACA;AACA;AACA;AACA,iFAAiF;AACjF,iCAAiC,oEAAoB;AACrD,YAAY,oEAAoB;AAChC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS,UAAU,0EAA4B,iCAAiC;AAChF,SAAS,iDAAiD;AAC1D;AACA;AACA,qGAAqG;AACrG;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAoB,+DAAO;AAC3B;AACA,0CAA0C,mBAAmB;AAC7D;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6CAA6C,4CAAO;AACpD;AACA;AACA,oCAAoC,oEAAoB;AACxD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B,+CAAE;AACjC;AACA;AACA;AACA;AACA;AACA,uEAAuE,uBAAuB;AAC9F;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA,sCAAsC,4DAAc;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gEAAgE,qCAAqC,sDAAe,CAAC,sDAAe,GAAG;AACvI,0BAA0B,gEAAyB,EAAE,4DAA4D;AACjH;AACA,KAAK,OAAO,sDAAQ;AACpB;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,wDAAU;AACxB,KAAK,gBAAgB,UAAU,OAAO,sDAAe,EAAE,EAAE,EAAE,QAAQ,EAAE;AACrE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B,4DAAc;AAC7C;AACA;AACA;AACA;AACA,qBAAqB,6DAAe;AACpC;AACA;AACA;AACA,SAAS;AACT,SAAS,2FAA2F;AACpG,SAAS,UAAU,oEAAsB,gDAAgD;AACzF;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAoB,qDAAO;;AAE3B;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEmqD;;AAEnqD,kC;;;;;;;;;;;;ACjlLA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAsS;AAClN;AACpC;AACS;AACuC;AACxB;AACS;;AAEzC;AACY;AACV;AACA;;AAE1C,+BAA+B,SAAS,gDAAgD;AACxF,oDAAoD;AACpD,IAAI,4DAAqB;AACzB,IAAI,uDAAgB;AACpB,IAAI,0DAAmB;AACvB,CAAC;AACD,mBAAmB,2DAAoB;AACvC,IAAI,uDAAgB;AACpB,IAAI,wDAAiB,iBAAiB,6DAAsB;AAC5D,CAAC;AACD,+BAA+B,SAAS,oCAAoC;AAC5E,mEAAmE;AACnE,gBAAgB,8DAAuB;AACvC,IAAI,4DAAqB;AACzB,IAAI,wDAAiB,2FAA2F,CAAC,2DAAoB,MAAM,8BAA8B,gBAAgB,2DAAoB,IAAI,oCAAoC,EAAE;AACvP,IAAI,uDAAgB;AACpB,IAAI,0DAAmB;AACvB,CAAC;AACD;AACA,IAAI,wDAAiB,YAAY,6DAAsB;AACvD,IAAI,uDAAgB;AACpB,IAAI,wDAAiB,mCAAmC,4DAAqB;AAC7E,CAAC;AACD,2BAA2B,SAAS,kBAAkB;AACtD,6DAA6D;AAC7D,gBAAgB,8DAAuB;AACvC,IAAI,qEAA8B;AAClC,IAAI,4DAAqB;AACzB,IAAI,4DAAqB;AACzB,IAAI,wDAAiB,qFAAqF,CAAC,2DAAoB,MAAM,gBAAgB,2DAAoB,GAAG,sBAAsB,EAAE;AACpM,IAAI,0DAAmB;AACvB,IAAI,4DAAqB;AACzB,IAAI,wDAAiB,qFAAqF,CAAC,2DAAoB,MAAM,gBAAgB,2DAAoB,GAAG,sBAAsB,EAAE;AACpM,IAAI,0DAAmB;AACvB,IAAI,0DAAmB;AACvB,IAAI,4DAAqB;AACzB,IAAI,wDAAiB;AACrB,IAAI,0DAAmB;AACvB,IAAI,mEAA4B;AAChC,CAAC;AACD,mBAAmB,2DAAoB;AACvC,IAAI,uDAAgB;AACpB,IAAI,wDAAiB,YAAY,6DAAsB;AACvD,IAAI,uDAAgB;AACpB,IAAI,wDAAiB,YAAY,6DAAsB,6NAA6N,4DAAqB;AACzS,IAAI,uDAAgB;AACpB,IAAI,wDAAiB,YAAY,6DAAsB,8NAA8N,4DAAqB;AAC1S,IAAI,uDAAgB;AACpB,IAAI,wDAAiB,YAAY,6DAAsB;AACvD,IAAI,uDAAgB;AACpB,IAAI,wDAAiB;AACrB,CAAC;AACD,2CAA2C,SAAS,yFAAyF;AAC7I,0EAA0E;AAC1E,4DAA4D;AAC5D,IAAI,wDAAiB;AACrB,CAAC;AACD,qBAAqB,2DAAoB;AACzC,IAAI,wDAAiB;AACrB,CAAC;AACD,uCAAuC,SAAS,kEAAkE;AAClH,0DAA0D;AAC1D,gBAAgB,8DAAuB;AACvC,IAAI,qEAA8B;AAClC,IAAI,4DAAqB;AACzB,IAAI,wDAAiB,gGAAgG,CAAC,2DAAoB,MAAM,gCAAgC,gBAAgB,2DAAoB,GAAG,kCAAkC,EAAE;AAC3P,IAAI,wDAAiB;AACrB,IAAI,0DAAmB;AACvB,IAAI,mEAA4B;AAChC,CAAC;AACD;AACA,IAAI,uDAAgB;AACpB,IAAI,wDAAiB,yCAAyC,6DAAsB;AACpF,IAAI,uDAAgB;AACpB,IAAI,wDAAiB;AACrB,CAAC;AACD,2CAA2C,SAAS,2FAA2F;AAC/I;AACA;AACA;AACA,iCAAiC,4CAAO;AACxC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wDAAwD,iCAAiC,sDAAe,CAAC,sEAAmB,GAAG;AAC/H,sBAAsB,gEAAyB,EAAE,oDAAoD;AACrG;AACA,KAAK,OAAO,sEAAY;AACxB;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,wDAAU;AACxB,KAAK,gBAAgB,UAAU,OAAO,sEAAmB,EAAE,EAAE,EAAE,QAAQ,EAAE;;AAEzE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yBAAyB,oCAAoC;AAC7D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uCAAuC,oCAAoC;AAC3E;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,YAAY,+DAAS;AACrB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gDAAgD,6BAA6B,sDAAe,CAAC,0DAAmB,GAAG;AACnH,kBAAkB,gEAAyB,EAAE,4CAA4C;AACzF;AACA,KAAK,OAAO,0DAAY;AACxB;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,wDAAU;AACxB,KAAK,gBAAgB,UAAU,OAAO,0DAAmB,EAAE,EAAE,EAAE,QAAQ,EAAE;;AAEzE;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAU;AACV;AACA;AACA;AACA;AACA;AACA,CAAC,oBAAoB;AACrB;AACA;AACA;AACA,UAAU;AACV;AACA;AACA;AACA;AACA;AACA;AACA,CAAC,sBAAsB;AACvB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yCAAyC,4CAAO;AAChD;AACA;AACA;AACA,yCAAyC,4CAAO;AAChD;AACA;AACA;AACA,4CAA4C,4CAAO;AACnD;AACA;AACA;AACA,6CAA6C,4CAAO;AACpD;AACA;AACA;AACA,uCAAuC,4CAAO;AAC9C;AACA;AACA;AACA,wCAAwC,4CAAO;AAC/C;AACA;AACA;AACA,oCAAoC,4CAAO;AAC3C;AACA;AACA;AACA,qCAAqC,4CAAO;AAC5C;AACA;AACA;AACA,qCAAqC,4CAAO;AAC5C;AACA;AACA;AACA,uCAAuC,4CAAO;AAC9C;AACA;AACA;AACA,kCAAkC,4CAAO;AACzC;AACA;AACA;AACA,qCAAqC,4CAAO;AAC5C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yBAAyB;AACzB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB;AACvB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAgB;AAChB;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA,gBAAgB;AAChB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yBAAyB;AACzB;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qBAAqB;AACrB;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oDAAoD;AACpD;AACA,wDAAwD;AACxD;AACA;AACA;AACA,sCAAsC,oBAAoB,EAAE,SAAS;AACrE;AACA;AACA;AACA,qBAAqB;AACrB;AACA,sCAAsC,oBAAoB,EAAE,SAAS;AACrE;AACA;AACA;AACA,qBAAqB;AACrB;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qDAAqD;AACrD;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA,oDAAoD;AACpD;AACA;AACA;AACA;AACA;AACA;AACA,wBAAwB;AACxB;AACA;AACA;AACA;AACA,oBAAoB;AACpB;AACA;AACA;AACA;AACA,oBAAoB;AACpB;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yBAAyB;AACzB;AACA;AACA,6DAA6D,OAAO;AACpE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qBAAqB;AACrB;AACA;AACA,qBAAqB;AACrB;AACA;AACA;AACA;AACA,yBAAyB;AACzB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sDAAsD;AACtD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+CAA+C;AAC/C;AACA;AACA,uCAAuC,IAAI,mBAAmB,MAAM,GAAG,IAAI,GAAG,aAAa,wBAAwB,IAAI,GAAG,mBAAmB;AAC7I;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yBAAyB;AACzB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wCAAwC;AACxC;AACA,iCAAiC,YAAY,yCAAyC,EAAE;AACxF,oCAAoC;AACpC,kCAAkC,YAAY,yCAAyC,EAAE;AACzF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oEAAoE,uCAAuC,+JAA+J;AAC1Q;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4CAA4C;AAC5C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA,sDAAsD;AACtD;AACA;AACA,uBAAuB,wBAAwB;AAC/C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mDAAmD,YAAY,oCAAoC,EAAE;AACrG;AACA;AACA;AACA;AACA;AACA,sCAAsC,YAAY,yCAAyC,EAAE;AAC7F;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA,uBAAuB,SAAS;AAChC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wBAAwB;AACxB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4DAA4D,mCAAmC,sDAAe,aAAa;AAC3H,wBAAwB,gEAAyB,EAAE,wDAAwD;AAC3G;AACA,KAAK;AACL;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,wDAAU;AACxB,KAAK,gBAAgB,UAAU,kBAAkB,EAAE,EAAE,QAAQ,EAAE;;AAE/D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qFAAqF,0DAAG;AACxF;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA,6EAA6E,6DAAM,6CAA6C,0DAAG;AACnI;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT,iFAAiF,0DAAG;AACpF;AACA;AACA;AACA;AACA,SAAS;AACT,0BAA0B,kDAAK;AAC/B,0DAA0D,EAAE;AAC5D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yCAAyC,WAAW;AACpD;AACA;AACA;AACA;AACA,qBAAqB;AACrB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mCAAmC,QAAQ;AAC3C;AACA;AACA,qBAAqB;AACrB,iBAAiB;AACjB;AACA;AACA;AACA,+BAA+B,gBAAgB;AAC/C;AACA;AACA,mCAAmC,WAAW;AAC9C;AACA;AACA,qBAAqB;AACrB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gEAAgE,qCAAqC,sDAAe,mBAAmB;AACvI,0BAA0B,gEAAyB,EAAE,4DAA4D;AACjH;AACA,KAAK;AACL;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,wDAAU;AACxB,KAAK,gBAAgB,UAAU,wBAAwB,EAAE,EAAE,QAAQ,EAAE;;AAErE,WAAW,aAAa;AACxB;AACA;AACA;AACA,mBAAmB,4DAAc;AACjC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8DAA8D,sCAAsC;AACpG,yBAAyB,gEAAyB,EAAE,0DAA0D;AAC9G;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,wDAAU;AACxB,KAAK,gBAAgB,WAAW,EAAE,QAAQ,EAAE;AAC5C;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAQ,yEAAiB;AACzB;AACA;AACA;AACA,qCAAqC,EAAE;AACvC,8BAA8B;AAC9B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sBAAsB,yDAAW;AACjC;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,qBAAqB,4DAAc;AACnC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kEAAkE,wCAAwC;AAC1G,2BAA2B,gEAAyB,EAAE,8DAA8D;AACpH;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,wDAAU;AACxB,KAAK,gBAAgB,WAAW,EAAE,QAAQ,EAAE;AAC5C;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAQ,yEAAiB;AACzB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wBAAwB,yDAAW;AACnC;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qFAAqF,0DAAG;AACxF;AACA;AACA;AACA,SAAS;AACT,6EAA6E,0DAAG;AAChF;AACA,SAAS;AACT,qEAAqE,0DAAG;AACxE;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA,+BAA+B,kDAAK;AACpC,oEAAoE,EAAE;AACtE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAQ,+CAAE,oBAAoB,gEAAS,qDAAqD,4DAAK,IAAI,6DAAM,2CAA2C,0DAAG,sDAAsD,EAAE;AACjN;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4DAA4D,mCAAmC,sDAAe,mBAAmB,sDAAe,UAAU,sDAAe,YAAY;AACrL,wBAAwB,gEAAyB,EAAE,wDAAwD;AAC3G;AACA,KAAK,wBAAwB;AAC7B,KAAK,gCAAgC,OAAO,oDAAM,mBAAmB,GAAG;AACxE,KAAK,gCAAgC,OAAO,oDAAM,qBAAqB;AACvE;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,wDAAU;AACxB,KAAK,gBAAgB,UAAU,wBAAwB,GAAG;AAC1D,sBAAsB,oDAAM;AAC5B;AACA,aAAa,GAAG,GAAG;AACnB,sBAAsB,oDAAM;AAC5B;AACA,aAAa,GAAG,EAAE,EAAE,QAAQ,EAAE;;AAE9B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qFAAqF,0DAAG;AACxF;AACA;AACA,SAAS;AACT;AACA;AACA,+BAA+B,kDAAK,+DAA+D,0DAAG;AACtG,oEAAoE,EAAE;AACtE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8CAA8C,eAAe;AAC7D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4DAA4D,mCAAmC,sDAAe,mBAAmB;AACjI,wBAAwB,gEAAyB,EAAE,wDAAwD;AAC3G;AACA,KAAK;AACL;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,wDAAU;AACxB,KAAK,gBAAgB,UAAU,wBAAwB,EAAE,EAAE,QAAQ,EAAE;;AAErE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2EAA2E,0DAAG;AAC9E;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA,qCAAqC,kDAAK,4DAA4D,0DAAG;AACzG,iFAAiF,0DAAG;AACpF;AACA;AACA;AACA,SAAS;AACT,8BAA8B,kDAAK;AACnC,kEAAkE,EAAE;AACpE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oCAAoC,KAAK;AACzC;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA,0DAA0D,kCAAkC,sDAAe,mBAAmB;AAC9H,uBAAuB,gEAAyB,EAAE,sDAAsD;AACxG;AACA,KAAK;AACL;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,wDAAU;AACxB,KAAK,gBAAgB,UAAU,wBAAwB,EAAE,EAAE,QAAQ,EAAE;;AAErE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qFAAqF,0DAAG;AACxF;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT,6EAA6E,0DAAG;AAChF;AACA;AACA;AACA,SAAS;AACT,iFAAiF,0DAAG;AACpF;AACA;AACA;AACA,SAAS;AACT,4BAA4B,kDAAK;AACjC,mEAAmE,EAAE;AACrE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA,gEAAgE,qCAAqC,sDAAe,mBAAmB;AACvI,0BAA0B,gEAAyB,EAAE,4DAA4D;AACjH;AACA,KAAK;AACL;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,wDAAU;AACxB,KAAK,gBAAgB,UAAU,wBAAwB,EAAE,EAAE,QAAQ,EAAE;;AAErE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0BAA0B,+CAAE,kBAAkB,2DAAI;AAClD;AACA;AACA;AACA;AACA;AACA,iDAAiD,QAAQ;AACzD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qFAAqF,0DAAG;AACxF,6EAA6E,0DAAG;AAChF;AACA;AACA;AACA;AACA;AACA;AACA,8CAA8C,mDAAmD;AACjG;AACA,SAAS;AACT,8BAA8B,kDAAK;AACnC,+DAA+D,EAAE;AACjE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iCAAiC,2DAAI;AACrC;AACA;AACA;AACA,SAAS;AACT;AACA;AACA,oDAAoD,+BAA+B,sDAAe,mBAAmB,sDAAe,CAAC,8DAAqB,MAAM,sDAAe,CAAC,sDAAa,MAAM;AACnM,oBAAoB,gEAAyB,EAAE,gDAAgD;AAC/F;AACA,KAAK,wBAAwB;AAC7B,KAAK,OAAO,8DAAc,gBAAgB,OAAO,sDAAQ,EAAE,GAAG;AAC9D,KAAK,OAAO,sDAAM,gBAAgB,OAAO,sDAAQ,EAAE;AACnD;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,wDAAU;AACxB,KAAK,gBAAgB,UAAU,wBAAwB,GAAG,OAAO,8DAAqB;AACtF,sBAAsB,sDAAQ;AAC9B,aAAa,GAAG,GAAG,OAAO,sDAAa;AACvC,sBAAsB,sDAAQ;AAC9B,aAAa,GAAG,EAAE,EAAE,QAAQ,EAAE;;AAE9B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B,SAAS;AACxC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kDAAkD;AAClD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qBAAqB,wBAAwB;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0EAA0E,0CAA0C,+DAAwB,CAAC,yDAAkB,GAAG;AAClK,8BAA8B,+DAAwB,EAAE,2FAA2F,mGAAmG,EAAE;AACxP;AACA,KAAK,OAAO,yDAAW;AACvB;AACA;AACA,UAAU,OAAO,mDAAK,EAAE;AACxB,iBAAiB,OAAO,mDAAK,EAAE;AAC/B,aAAa,OAAO,mDAAK,EAAE;AAC3B,kBAAkB,OAAO,mDAAK,EAAE;AAChC,gBAAgB,OAAO,mDAAK,EAAE;AAC9B;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,uDAAS;AACvB,gBAAgB,yCAAyC;AACzD,KAAK,gBAAgB,UAAU,OAAO,yDAAkB,EAAE,EAAE,EAAE,GAAG;AACjE,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS,GAAG,EAAE,EAAE;AAChB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8BAA8B,0DAAY;AAC1C,4BAA4B,0DAAY;AACxC,0BAA0B,0DAAY;AACtC,2BAA2B,0DAAY;AACvC,+BAA+B,0DAAY;AAC3C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mEAAmE,0DAAG;AACtE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS,oBAAoB,EAAE;AAC/B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gFAAgF,0DAAG;AACnF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT,qFAAqF,0DAAG;AACxF;AACA;AACA;AACA,SAAS;AACT,mFAAmF,0DAAG;AACtF;AACA;AACA;AACA,SAAS;AACT,2EAA2E,0DAAG;AAC9E;AACA;AACA;AACA,SAAS;AACT,4EAA4E,gEAAS;AACrF,oCAAoC,+CAAE,aAAa,6DAAM,4CAA4C,gEAAS,OAAO,iDAAI,oBAAoB,2DAAI,wBAAwB,2DAAI,uCAAuC,0DAAG;AACvN;AACA;AACA,qDAAqD,WAAW,yBAAyB;AACzF,aAAa,GAAG,8DAAO,IAAI,0DAAG;AAC9B;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kBAAkB;AAClB;AACA,mBAAmB,kDAAK;AACxB,SAAS,GAAG,0DAAG;AACf;AACA;AACA;AACA;AACA,SAAS;AACT,2EAA2E,0DAAG;AAC9E;AACA,gCAAgC,8CAA8C;AAC9E,SAAS,GAAG,gEAAS,mDAAmD,0DAAG,kDAAkD,gEAAS;AACtI;AACA,sEAAsE,4DAAK;AAC3E;AACA;AACA,uBAAuB,+CAAE;AACzB;AACA,SAAS,GAAG,0DAAG;AACf,gCAAgC,+CAA+C;AAC/E,SAAS;AACT,+BAA+B,kDAAK;AACpC,4EAA4E,EAAE;AAC9E;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sBAAsB,6DAAM,uGAAuG,4DAAK;AACxI;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gEAAgE,qCAAqC,+DAAwB,CAAC,wDAAiB,GAAG,+DAAwB,iBAAiB,+DAAwB,mBAAmB,+DAAwB,qBAAqB,+DAAwB,mBAAmB,+DAAwB,mBAAmB,+DAAwB,kBAAkB,+DAAwB,qBAAqB,+DAAwB,eAAe,+DAAwB,aAAa,+DAAwB,CAAC,+DAAwB,GAAG,+DAAwB,YAAY;AACpmB,yBAAyB,+DAAwB,EAAE,yIAAyI;AAC5L,QAAQ,4DAAqB;AAC7B,KAAK;AACL;AACA,QAAQ,4DAAqB,MAAM,yDAAkB;AACrD,KAAK,EAAE,kEAAkE;AACzE,QAAQ,wDAAiB,6FAA6F,uCAAuC,EAAE,SAAS,+DAAwB;AAChM,KAAK,EAAE,WAAW,qBAAqB,YAAY,mHAAmH,aAAa,gEAAyB;AAC5M;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8nBAA8nB;AAC9nB,QAAQ,4DAAqB;AAC7B,QAAQ,wDAAiB,8EAA8E,2BAA2B,EAAE,iFAAiF,0BAA0B,EAAE,iFAAiF,2BAA2B,EAAE,6EAA6E,0BAA0B,EAAE;AACxc,QAAQ,wDAAiB;AACzB,QAAQ,wDAAiB;AACzB,QAAQ,0DAAmB;AAC3B,KAAK;AACL,QAAQ,wDAAiB,YAAY,6DAAsB;AAC3D,QAAQ,uDAAgB;AACxB,QAAQ,wDAAiB;AACzB,QAAQ,uDAAgB;AACxB,QAAQ,wDAAiB;AACzB,KAAK,EAAE,2BAA2B,SAAS,uDAAc,EAAE,oDAAW,kBAAkB,uDAAc,EAAE,EAAE,2CAA2C,gBAAgB,EAAE,IAAI;AAC3K;AACA,KAAK,OAAO,wDAAU,EAAE;AACxB,KAAK,sBAAsB;AAC3B,KAAK,wBAAwB;AAC7B,KAAK,0BAA0B;AAC/B,KAAK,wBAAwB;AAC7B,KAAK,wBAAwB;AAC7B,KAAK,uBAAuB;AAC5B,KAAK,0BAA0B;AAC/B,KAAK,oBAAoB;AACzB,KAAK,kBAAkB;AACvB,KAAK,OAAO,+DAAiB,EAAE;AAC/B,KAAK,gCAAgC,OAAO,oDAAM,qBAAqB;AACvE;AACA;AACA,cAAc,OAAO,6DAAe,mCAAmC;AACvE,kBAAkB,OAAO,oDAAM,EAAE;AACjC,gBAAgB,OAAO,oDAAM,EAAE;AAC/B,cAAc,OAAO,oDAAM,EAAE;AAC7B,eAAe,OAAO,oDAAM,EAAE;AAC9B,mBAAmB,OAAO,oDAAM,EAAE;AAClC,eAAe,OAAO,mDAAK,EAAE;AAC7B,0BAA0B,OAAO,0DAAY,oDAAoD;AACjG;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,uDAAS;AACvB;AACA;AACA;AACA;AACA,kBAAkB;AAClB;AACA;AACA;AACA,iDAAiD;AACjD;AACA;AACA;AACA;;AAEA;AACA,oCAAoC,+FAA+F;AACnI;AACA;AACA;AACA;AACA,yCAAyC,8BAA8B;AACvE,4CAA4C,oCAAoC;AAChF,4CAA4C,oCAAoC;AAChF;AACA,0CAA0C,+BAA+B;AACzE,8EAA8E,2DAA2D;AACzI;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sCAAsC,gBAAgB,EAAE;AACxD,aAAa;AACb,KAAK,gBAAgB,UAAU,OAAO,wDAAiB,EAAE,GAAG,sBAAsB,GAAG,wBAAwB,GAAG,0BAA0B,GAAG,wBAAwB,GAAG,wBAAwB,GAAG,uBAAuB,GAAG,0BAA0B,GAAG,oBAAoB,GAAG,kBAAkB,GAAG,OAAO,+DAAwB,EAAE,GAAG;AAC1U,sBAAsB,oDAAM;AAC5B;AACA,aAAa,GAAG,EAAE,EAAE,GAAG;AACvB,kBAAkB,oDAAM;AACxB,SAAS;AACT,kBAAkB,oDAAM;AACxB,SAAS;AACT,kBAAkB,oDAAM;AACxB,SAAS;AACT,kBAAkB,oDAAM;AACxB,SAAS;AACT,kBAAkB,oDAAM;AACxB,SAAS;AACT,kBAAkB,0DAAY;AAC9B;AACA,SAAS;AACT,kBAAkB,6DAAe;AACjC;AACA,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS,GAAG,EAAE,EAAE;;AAEhB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iCAAiC,4CAAO;AACxC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAgB;AAChB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kBAAkB,4DAAK;AACvB;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA,gEAAgE;AAChE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8FAA8F,WAAW;AACzG;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0DAA0D,kCAAkC,+DAAwB,CAAC,oDAAa,GAAG,+DAAwB,CAAC,wDAAiB,GAAG,+DAAwB,CAAC,uDAAgB,GAAG,+DAAwB,mBAAmB,+DAAwB,kBAAkB;AACnT,sBAAsB,+DAAwB,EAAE,gHAAgH;AAChK,QAAQ,wDAAiB,4EAA4E,gCAAgC,EAAE,+EAA+E,iCAAiC,EAAE,iFAAiF,kCAAkC,EAAE,uEAAuE,0BAA0B,EAAE,2EAA2E,4BAA4B,EAAE;AAC1jB,KAAK,EAAE,WAAW,iFAAiF,8PAA8P;AACjW,QAAQ,4DAAqB;AAC7B,QAAQ,4DAAqB;AAC7B,QAAQ,wDAAiB,mFAAmF,8BAA8B,EAAE;AAC5I,QAAQ,wDAAiB;AACzB,QAAQ,0DAAmB;AAC3B,QAAQ,0DAAmB;AAC3B,KAAK;AACL,QAAQ,uDAAgB;AACxB,QAAQ,wDAAiB,YAAY,6DAAsB;AAC3D,QAAQ,uDAAgB;AACxB,QAAQ,wDAAiB;AACzB,KAAK,EAAE,eAAe,uDAAc,EAAE,uDAAc,EAAE,uDAAc,EAAE,oDAAW,EAAE,gEAAuB,4BAA4B;AACtI,YAAY,mEAAO;AACnB,gBAAgB,iEAAK,WAAW,iEAAK,EAAE,YAAY;AACnD,gBAAgB,iEAAK,SAAS,iEAAK,EAAE,cAAc;AACnD,gBAAgB,sEAAU;AAC1B,8BAA8B,YAAY;AAC1C,oBAAoB,mEAAO;AAC3B;AACA,gBAAgB,sEAAU;AAC1B,8BAA8B,UAAU;AACxC,oBAAoB,mEAAO;AAC3B;AACA;AACA,WAAW,EAAE;AACb;AACA,KAAK,OAAO,oDAAM,EAAE;AACpB,KAAK,OAAO,wDAAU,EAAE;AACxB,KAAK,OAAO,uDAAS,EAAE;AACvB,KAAK,wBAAwB;AAC7B,KAAK;AACL;AACA;AACA,oBAAoB,OAAO,mDAAK,EAAE;AAClC,iBAAiB,OAAO,mDAAK,EAAE;AAC/B,kBAAkB,OAAO,mDAAK,EAAE;AAChC,mBAAmB,OAAO,0DAAY,oCAAoC;AAC1E,oBAAoB,OAAO,0DAAY,qCAAqC;AAC5E,qBAAqB,OAAO,0DAAY,sCAAsC;AAC9E,mBAAmB,OAAO,0DAAY,wBAAwB;AAC9D,qBAAqB,OAAO,0DAAY,0BAA0B;AAClE;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,uDAAS;AACvB;AACA;AACA;AACA;AACA,yCAAyC;AACzC;AACA;AACA;AACA,8GAA8G;AAC9G;AACA,sDAAsD;AACtD;AACA,4CAA4C;AAC5C;AACA;AACA,+DAA+D;AAC/D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAoB,mEAAO;AAC3B,wBAAwB,iEAAK,WAAW,iEAAK,EAAE,YAAY;AAC3D,wBAAwB,iEAAK,SAAS,iEAAK,EAAE,cAAc;AAC3D,wBAAwB,sEAAU;AAClC,sCAAsC,YAAY;AAClD,4BAA4B,mEAAO;AACnC;AACA,wBAAwB,sEAAU;AAClC,sCAAsC,UAAU;AAChD,4BAA4B,mEAAO;AACnC;AACA;AACA;AACA,aAAa;AACb,KAAK,gBAAgB,UAAU,OAAO,oDAAa,EAAE,GAAG,OAAO,wDAAiB,EAAE,GAAG,OAAO,uDAAgB,EAAE,GAAG,wBAAwB,GAAG,uBAAuB,EAAE,EAAE,GAAG;AAC1K,kBAAkB,0DAAY;AAC9B;AACA,SAAS;AACT,kBAAkB,0DAAY;AAC9B;AACA,SAAS;AACT,kBAAkB,0DAAY;AAC9B;AACA,SAAS;AACT,kBAAkB,0DAAY;AAC9B;AACA,SAAS;AACT,kBAAkB,0DAAY;AAC9B;AACA,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS,GAAG,EAAE,EAAE;;AAEhB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY,+DAAS;AACrB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA,0EAA0E,0CAA0C,+DAAwB,CAAC,sDAAa,GAAG,+DAAwB,CAAC,8DAAqB,GAAG,+DAAwB,cAAc,+DAAwB,CAAC,uDAAgB,GAAG,+DAAwB,CAAC,wDAAiB,GAAG;AAC7U,8BAA8B,+DAAwB,EAAE,oJAAoJ;AAC5M,QAAQ,wDAAiB,sEAAsE,sBAAsB,EAAE;AACvH,KAAK,EAAE,WAAW,2SAA2S,EAAE;AAC/T;AACA,KAAK,OAAO,sDAAM,EAAE;AACpB,KAAK,OAAO,8DAAc,EAAE;AAC5B,KAAK,6BAA6B,OAAO,uDAAS,uBAAuB,GAAG;AAC5E,KAAK,OAAO,uDAAS,EAAE;AACvB,KAAK,OAAO,wDAAU;AACtB;AACA;AACA,mBAAmB,OAAO,mDAAK,EAAE;AACjC,gBAAgB,OAAO,mDAAK,EAAE;AAC9B,2BAA2B,OAAO,mDAAK,EAAE;AACzC,wBAAwB,OAAO,mDAAK,EAAE;AACtC,0BAA0B,OAAO,mDAAK,EAAE;AACxC,kBAAkB,OAAO,mDAAK,EAAE;AAChC,gBAAgB,OAAO,mDAAK,EAAE;AAC9B,qBAAqB,OAAO,mDAAK,EAAE;AACnC,2BAA2B,OAAO,mDAAK,EAAE;AACzC,eAAe,OAAO,0DAAY,oBAAoB;AACtD;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,uDAAS;AACvB,gBAAgB,qCAAqC;AACrD,KAAK,gBAAgB,UAAU,OAAO,sDAAa,EAAE,GAAG,OAAO,8DAAqB,EAAE,GAAG;AACzF,sBAAsB,uDAAS;AAC/B;AACA,aAAa,GAAG,GAAG,OAAO,uDAAgB,EAAE,GAAG,OAAO,wDAAiB,EAAE,EAAE,EAAE,GAAG;AAChF,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,0DAAY;AAC9B;AACA,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS,GAAG,EAAE,EAAE;AAChB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6BAA6B,6DAAa;AAC1C;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY,+DAAS;AACrB;AACA;AACA;AACA;AACA,0BAA0B,+BAA+B;AACzD,mBAAmB,iCAAiC;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA,0FAA0F,kDAAkD,+DAAwB,CAAC,sDAAa,GAAG,+DAAwB,CAAC,8DAAqB,GAAG,+DAAwB,CAAC,gEAAuB,GAAG;AACzR,sCAAsC,+DAAwB,EAAE,0KAA0K;AAC1O,QAAQ,wDAAiB,oFAAoF,oFAAoF,EAAE;AACnM,KAAK;AACL,QAAQ,4DAAqB,mBAAmB,2DAAoB;AACpE,QAAQ,yDAAkB;AAC1B,KAAK,EAAE,WAAW,6TAA6T,aAAa,kEAA2B,GAAG;AAC1X;AACA,KAAK,OAAO,sDAAM,EAAE;AACpB,KAAK,OAAO,8DAAc,EAAE;AAC5B,KAAK,OAAO,gEAAgB;AAC5B;AACA;AACA,cAAc,OAAO,yDAAW,0BAA0B,GAAG,OAAO,mDAAK,EAAE;AAC3E,mBAAmB,OAAO,mDAAK,EAAE;AACjC,gBAAgB,OAAO,mDAAK,EAAE;AAC9B,2BAA2B,OAAO,mDAAK,EAAE;AACzC,wBAAwB,OAAO,mDAAK,EAAE;AACtC,0BAA0B,OAAO,mDAAK,EAAE;AACxC,kBAAkB,OAAO,mDAAK,EAAE;AAChC,gBAAgB,OAAO,mDAAK,EAAE;AAC9B,YAAY,OAAO,yDAAW,EAAE;AAChC,qBAAqB,OAAO,mDAAK,EAAE;AACnC,2BAA2B,OAAO,mDAAK,EAAE;AACzC,eAAe,OAAO,0DAAY,8FAA8F;AAChI;AACA,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,uDAAS;AACvB,gBAAgB,+BAA+B;AAC/C,KAAK,gBAAgB,UAAU,OAAO,sDAAa,EAAE,GAAG,OAAO,8DAAqB,EAAE,GAAG,OAAO,gEAAuB,EAAE,EAAE,EAAE,GAAG;AAChI,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,0DAAY;AAC9B;AACA,SAAS;AACT,kBAAkB,yDAAW;AAC7B,SAAS;AACT,kBAAkB,yDAAW;AAC7B;AACA,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS;AACT,kBAAkB,mDAAK;AACvB,SAAS,GAAG,EAAE,EAAE;AAChB;AACA;AACA;;AAEA;AACA;AACA;AACA,sBAAsB,8DAAuB,EAAE,uBAAuB;AACtE,sBAAsB,8DAAuB,EAAE,8CAA8C,oCAAoC,EAAE;AACnI,YAAY,4DAAY;AACxB,YAAY;AACZ,cAAc,oDAAoD,gEAAyB,kBAAkB,4BAA4B,4HAA4H,EAAE,wBAAwB,SAAS,4DAAY,EAAE,EAAE,wBAAwB,4GAA4G,EAAE,EAAE,EAAE,EAAE;AACpc,4BAA4B,CAAC,+DAAwB;AACrD,cAAc,sDAAQ;AACtB;AACA;AACA,oBAAoB,4DAAY;AAChC;AACA;AACA;AACA;AACA,aAAa;AACb,KAAK,eAAe,EAAE;;AAEtB;AACA;AACA;;AAEuqB;;;AAGvqB,8C;;;;;;;;;;;;ACtqHA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAmD;AACiC;AACnB;AACP;AACb;AACgB;AACJ;AACF;AACW;AACG;AACA;AAC2B;AACA;AAC/C;AACM;AACJ;AACsB;AAC7B;AACA;AACQ;AACQ;AACsB;AAC1B;AAC0B;AACR;AACd;AACM;AACQ;AACN;AACd;AACF;AACA;AACM;AACR;AACU;AACc;AAChB;AACV;AACU;AACN;AACA;AACN;AAC8B;AACxB;AACQ;AACV;AACE;AACU;AACV;AACA;AACJ;AACW;AACP;AACA;AACT;AAC3C,iC;;;;;;;;;;;;ACvDA;AAAA;AAAA;AAAA;AAAoC;AACU;AACvC,2BAA2B,gDAAO;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,0DAAY;AAC/B;AACA;AACA;AACA;AACA,mBAAmB,0DAAY;AAC/B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wC;;;;;;;;;;;;ACxCA;AAAA;AAAA;AAAA;AAAoC;AACqC;AAClE,8BAA8B,gDAAO;AAC5C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sBAAsB,qFAAuB;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2C;;;;;;;;;;;;AChCA;AAAA;AAAA;AAA0C;AACnC,8BAA8B,sDAAU;AAC/C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2C;;;;;;;;;;;;ACrBA;AAAA;AAAA;AAAA;AAAA;AAAA;AAA2C;AACN;AACgB;AAC9C;AACP;AACA;AACA;AACA;AACA,CAAC,4CAA4C;AACtC;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,yDAAE;AACzB;AACA,uBAAuB,yEAAU;AACjC;AACA,uBAAuB,+DAAK;AAC5B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wC;;;;;;;;;;;;ACxEA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAuD;AACJ;AACmB;AAC1B;AACV;AAC3B;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,WAAW;AAC1B,qBAAqB,uEAAY;AACjC;AACA;AACA;AACA;AACA,qCAAqC,8CAAM;AAC3C;AACA;AACA;AACA,YAAY,8CAAM;AAClB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAgB,8CAAM;AACtB;AACA;AACA;AACA,gBAAgB,2EAAc;AAC9B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb,SAAS;AACT;AACA;AACA,eAAe,SAAS;AACxB;AACA;AACA,KAAK,6DAAiB;AACtB;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,gEAAa;AAC5B;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sBAAsB,8CAAM;AAC5B;AACA;AACA;AACA;AACA;AACA;AACA,sC;;;;;;;;;;;;AC1GA;AAAA;AAAA;AAAA;AAAkC;AACuB;AAClD;AACP;AACA,iBAAiB,EAAE;AACnB;AACA,YAAY,8CAAM;AAClB;AACA;AACA;AACA,YAAY,6EAAe;AAC3B;AACA,KAAK;AACL,gBAAgB;AAChB;AACA,oC;;;;;;;;;;;;ACfA;AAAA;AAAA;AAA0C;AACnC,8BAA8B,sDAAU;AAC/C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2C;;;;;;;;;;;;ACZA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAoC;AACM;AACI;AACc;AACa;AACb;AACrD,4BAA4B,gDAAO;AAC1C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sBAAsB,qFAAuB;AAC7C;AACA;AACA,2BAA2B,0DAAY;AACvC;AACA;AACA;AACA,+BAA+B,wEAAmB;AAClD;AACA;AACA,4CAA4C,wEAAmB;AAC/D;AACA;AACA,2BAA2B,+BAA+B;AAC1D;AACA;AACA;AACA;AACA,2BAA2B,+BAA+B;AAC1D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kCAAkC,sDAAK;AACvC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yC;;;;;;;;;;;;ACvGA;AAAA;AAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qC;;;;;;;;;;;;ACVA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAA0C;AACA;AACI;AAC2B;AACb;AACyB;AAC9E,gCAAgC,sDAAU;AACjD;AACA;AACA;AACA;AACA;AACO,sBAAsB,sDAAU;AACvC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK,0EAAkB;AACvB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sBAAsB,qFAAuB;AAC7C;AACA;AACA,mBAAmB,YAAY;AAC/B;AACA;AACA,2BAA2B,SAAS;AACpC;AACA;AACA;AACA;AACA;AACA;AACA,sBAAsB,qFAAuB;AAC7C;AACA;AACA;AACA;AACA,eAAe,YAAY;AAC3B;AACA;AACA,uBAAuB,SAAS;AAChC;AACA;AACA;AACA;AACA;AACA;AACA,sBAAsB,qFAAuB;AAC7C;AACA;AACA,eAAe,YAAY;AAC3B;AACA;AACA,uBAAuB,SAAS;AAChC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sBAAsB,qFAAuB;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sBAAsB,qFAAuB;AAC7C;AACA;AACA;AACA,mBAAmB,0DAAY;AAC/B;AACA;AACA;AACA,mBAAmB,0DAAY;AAC/B;AACA;AACA;AACA,uBAAuB,wEAAmB;AAC1C;AACA;AACA;AACA,+BAA+B,sDAAU;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACO;AACP;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,cAAc;AAC7B;AACA;AACA;AACA;AACA;AACA,eAAe,cAAc;AAC7B;AACA;AACA;AACA;AACA;AACA,eAAe,cAAc;AAC7B;AACA;AACA;AACA;AACA;AACA,eAAe,SAAS;AACxB;AACA;AACA;AACA;AACA,mBAAmB,0DAAY;AAC/B;AACA;AACA;AACA,mC;;;;;;;;;;;;AC/IA;AAAA;AAAA;AAA8C;AACvC,kCAAkC,0DAAY;AACrD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+C;;;;;;;;;;;;ACzBA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAA+C;AACK;AACN;AACuC;AACnD;AACuB;AAClD,yBAAyB,0DAAY;AAC5C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mCAAmC,+CAAa;AAChD;AACA;AACA;AACA,uCAAuC,+CAAa;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK,0EAAkB,KAAK,aAAa;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,mBAAmB;AAClC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACO;AACP;AACA;AACA;AACA;AACA;AACA,YAAY,mEAAU;AACtB;AACA;AACA;AACA;AACA;AACA;AACA,mCAAmC,+CAAa;AAChD;AACA,oBAAoB,mEAAU;AAC9B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,oBAAoB;AACvC,iBAAiB,8CAAM;AACvB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,oBAAoB;AACvC,mBAAmB,wCAAwC,GAAG,8CAAM;AACpE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAgB,6EAAe;AAC/B;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAoB,6EAAe;AACnC;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,oBAAoB;AACvC;AACA;AACA,qBAAqB,8CAAM;AAC3B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAgB,8CAAM;AACtB;AACA;AACA;AACA,gBAAgB,6EAAe;AAC/B;AACA;AACA;AACA;AACA,aAAa,8CAAM;AACnB;AACA;AACA;AACA;AACA;AACA;AACA,gBAAgB,8CAAM;AACtB;AACA;AACA;AACA;AACA;AACA,gBAAgB,6EAAe;AAC/B;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,oBAAoB;AACnC;AACA;AACA;AACA;AACA;AACA,sC;;;;;;;;;;;;AC7NA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAyC;AACE;AACI;AACkB;AAC1D;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa,iDAAiD;AAC9D;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B,iCAAiC;AAChE;AACA;AACA;AACA;AACA,YAAY,mEAAU;AACtB;AACA;AACA;AACA;AACA,sCAAsC,6EAAmB;AACzD;AACA;AACA,YAAY,6DAAO;AACnB;AACA;AACA;AACA;AACA,oBAAoB,+DAAQ;AAC5B;AACA;AACA;AACA;AACA;AACA,yCAAyC,6EAAmB;AAC5D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sBAAsB,6EAAmB;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa,mBAAmB;AAChC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,CAAC;AACD;AACA,oEAAoE,6EAAmB;AACvF;AACA,wC;;;;;;;;;;;;ACpIA;AAAA;AAAA;AACO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA,KAAK;AACL;AACA,kC;;;;;;;;;;;;ACjBA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAA+C;AACJ;AACA;AACI;AACyB;AACjE,oCAAoC,sDAAU;AACrD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gDAAgD,0DAAY;AAC5D;AACA;AACA;AACA;AACA,6BAA6B,0DAAY;AACzC;AACA;AACA;AACA;AACA;AACA,eAAe,oEAAmB;AAClC;AACA;AACO;AACP;AACA;AACA,mBAAmB,cAAc;AACjC,oBAAoB,2BAA2B;AAC/C,mBAAmB,8BAA8B;AACjD,sBAAsB,8BAA8B;AACpD,qBAAqB,qCAAqC;AAC1D,sBAAsB,sDAAsD;AAC5E,qBAAqB,qCAAqC;AAC1D,kBAAkB,kCAAkC;AACpD,mBAAmB;AACnB;AACA,CAAC;AACD,oCAAoC,0DAAiB;AACrD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,cAAc;AAC7B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iCAAiC,sDAAU;AAC3C;AACA;AACA;AACA;AACA;AACA,eAAe,cAAc;AAC7B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,aAAa;AAC5B;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iD;;;;;;;;;;;;AChIA;AAAA;AAAA;AAAA;AAAA;AAA2C;AACF;AACK;AACvC,oCAAoC,sDAAU;AACrD,mDAAmD,oDAAI;AACvD;AACA;AACA;AACA;AACA,aAAa,iEAAS;AACtB;AACA;AACA;AACA,6BAA6B,oDAAI;AACjC;AACA;AACA,iDAAiD,oDAAI;AACrD;AACA;AACA;AACA,eAAe,qBAAqB;AACpC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA,iD;;;;;;;;;;;;AChCA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAA2C;AACI;AACR;AACiB;AACd;AACQ;AAC3C;AACP;AACA,YAAY,qEAAW;AACvB;AACA;AACA;AACA,oFAAoF,0DAAG,WAAW,6DAAO;AACzG;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,sDAAU;AAC7B;AACA;AACA,kCAAkC,0DAAY;AAC9C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4BAA4B,2EAAc;AAC1C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA,WAAW,2BAA2B;AACtC,WAAW,mCAAmC;AAC9C,SAAS,UAAU;AACnB;AACA,uCAAuC,0DAAY;AACnD;AACA;AACA,0DAA0D,iBAAiB;AAC3E;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,WAAW,iBAAiB;AAC5B;AACA;AACA;AACA;AACA,WAAW,eAAe;AAC1B;AACA;AACA,wC;;;;;;;;;;;;ACpFA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAA2C;AACI;AACR;AACiB;AACN;AACR;AACnC;AACP;AACA,YAAY,qEAAW;AACvB;AACA;AACA;AACA,wFAAwF,0DAAG,SAAS,6DAAO;AAC3G;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,sDAAU;AAC7B,mBAAmB,UAAU;AAC7B,iBAAiB,UAAU;AAC3B;AACA;AACA,mDAAmD,0DAAY;AAC/D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4BAA4B,2EAAc;AAC1C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wDAAwD,8BAA8B;AACtF;AACA,SAAS;AACT;AACA;AACA;AACA,WAAW,8BAA8B;AACzC,WAAW,gCAAgC;AAC3C;AACA;AACA,uCAAuC,0DAAY;AACnD;AACA;AACA;AACA,+DAA+D,eAAe;AAC9E;AACA;AACA;AACA,8DAA8D,iBAAiB;AAC/E;AACA;AACA;AACA;AACA;AACA;AACA,2DAA2D,eAAe;AAC1E;AACA;AACA;AACA;AACA;AACA,WAAW,iBAAiB;AAC5B;AACA;AACA;AACA;AACA,WAAW,eAAe;AAC1B;AACA;AACA,4C;;;;;;;;;;;;AC5FA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAkD;AACR;AACW;AACS;AACtB;AACxC;AACO;AACP;AACA;AACA,QAAQ,qEAAW;AACnB;AACA;AACA;AACA;AACA;AACA,oCAAoC,6DAAO;AAC3C;AACA;AACA,WAAW,4DAAS;AACpB;AACO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACO,sCAAsC,gEAAe;AAC5D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,SAAS;AACpC;AACA,yBAAyB,iFAAiB;AAC1C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yC;;;;;;;;;;;;ACxFA;AAAA;AAAA;AAAA;AAA0B;AACyB;AAC5C;AACP,WAAW,sEAAS,GAAG,8CAAE;AACzB;AACA,kC;;;;;;;;;;;;ACLA;AAAA;AAAA;AAAA;AAAA;AAA2C;AACb;AACE;AACzB;AACP,eAAe,sDAAU;AACzB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B,kDAAI,UAAU,oDAAK;AAClD;AACA,KAAK;AACL;AACA,iC;;;;;;;;;;;;ACjBA;AAAA;AAAA;AAAA;AAA2C;AACpC,kBAAkB,sDAAU;AAC5B;AACP;AACA;AACA;AACA,eAAe,sDAAU;AACzB;AACA,iC;;;;;;;;;;;;ACRA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAA2C;AACD;AACH;AACK;AACd;AACvB;AACP;AACA;AACA,YAAY,6DAAO;AACnB;AACA;AACA,YAAY,+DAAQ;AACpB;AACA;AACA;AACA;AACA;AACA;AACA,2CAA2C,6DAAO;AAClD,oDAAoD,0DAAG;AACvD;AACA;AACA;AACA;AACA,eAAe,sDAAU;AACzB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,SAAS;AAChC,2BAA2B,kDAAI;AAC/B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAiB;AACjB;AACA;AACA;AACA;AACA;AACA;AACA,qGAAqG;AACrG;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA,KAAK;AACL;AACA,oC;;;;;;;;;;;;AC5DA;AAAA;AAAA;AAAA;AAAA;AAA2C;AACO;AACC;AAC5C;AACP;AACA,6BAA6B,sDAAU;AACvC;AACA;AACA,mBAAmB,sDAAU,CAAC,qEAAW;AACzC;AACA;AACA,eAAe,sEAAS;AACxB;AACA;AACA,gC;;;;;;;;;;;;ACdA;AAAA;AAAA;AAAA;AAAA;AAA2C;AACiB;AACD;AACpD;AACP;AACA,mBAAmB,sDAAU,CAAC,+EAAgB;AAC9C;AACA;AACA,eAAe,8EAAa;AAC5B;AACA;AACA,qC;;;;;;;;;;;;ACXA;AAAA;AAAA;AAAA;AAAA;AAAA;AAA2C;AACD;AACM;AACT;AACvC;AACO;AACP,QAAQ,mEAAU;AAClB;AACA;AACA;AACA;AACA,0DAA0D,0DAAG,SAAS,6DAAO;AAC7E;AACA,eAAe,sDAAU;AACzB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+CAA+C,SAAS;AACxD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qC;;;;;;;;;;;;AC7DA;AAAA;AAAA;AAAA;AAAA;AAAA;AAA2C;AACD;AACM;AACT;AAChC;AACP;AACA,gEAAgE,0DAAG,SAAS,6DAAO;AACnF;AACA,eAAe,sDAAU;AACzB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa,mEAAU;AACvB;AACA;AACA;AACA,KAAK;AACL;AACA,4C;;;;;;;;;;;;ACxBA;AAAA;AAAA;AAAA;AAAA;AAA2C;AACC;AACM;AAC3C;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mDAAmD,uDAAQ;AAC3D;AACA;AACA,yDAAyD,qEAAW;AACpE;AACA,yBAAyB,uDAAQ;AACjC;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,sDAAU;AACzB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA,KAAK;AACL;AACA;AACA,WAAW,wBAAwB;AACnC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oC;;;;;;;;;;;;AC3HA;AAAA;AAAA;AAAA;AAAgC;AACA;AACzB,qCAAqC,4CAAK,gBAAgB,4CAAK;AACtE,WAAW,oDAAK;AAChB;AACA,+B;;;;;;;;;;;;ACLA;AAAA;AAAA;AAAA;AAAA;AAA2C;AACA;AACG;AACvC,0CAA0C,sDAAK;AACtD,SAAS,iEAAS;AAClB;AACA;AACA;AACA,oBAAoB,sDAAK;AACzB;AACA,eAAe,sDAAU;AACzB,6DAA6D,iCAAiC;AAC9F;AACA,KAAK;AACL;AACA;AACA,WAAW,8BAA8B;AACzC;AACA,mBAAmB,2CAA2C;AAC9D;AACA,oC;;;;;;;;;;;;ACpBA;AAAA;AAAA;AAAA;AAAA;AAAA;AAA2C;AACO;AACD;AACT;AACjC;AACP;AACA;AACA;AACA,QAAQ,qEAAW;AACnB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oFAAoF,sDAAU;AAC9F;AACA;AACA,WAAW,oEAAQ,aAAa,4DAAS;AACzC;AACA,iC;;;;;;;;;;;;ACtBA;AAAA;AAAA;AAAA;AAAA;AAA2C;AACP;AAC7B,kBAAkB,sDAAU,CAAC,+CAAI;AACjC;AACP;AACA;AACA,iC;;;;;;;;;;;;ACNA;AAAA;AAAA;AAAA;AAAA;AAAkD;AACV;AACmB;AACpD;AACP;AACA,QAAQ,qEAAW;AACnB;AACA,eAAe,8EAAa;AAC5B;AACA;AACA,eAAe,4DAAS;AACxB;AACA;AACA,8B;;;;;;;;;;;;ACbA;AAAA;AAAA;AAAA;AAAA;AAAA;AAA2C;AACb;AACY;AACV;AACzB;AACP;AACA,eAAe,4CAAK;AACpB;AACA;AACA,gCAAgC,6DAAO;AACvC;AACA;AACA,eAAe,sDAAU;AACzB;AACA,eAAe,kDAAI;AACnB,yBAAyB,wBAAwB,EAAE;AACnD;AACA;AACA,SAAS;AACT,KAAK;AACL;AACA,6C;;;;;;;;;;;;ACrBA;AAAA;AAAA;AAAA;AAAA;AAA2C;AACI;AACxC;AACP;AACA,mBAAmB,sDAAU;AAC7B;AACA,2BAA2B,uCAAuC;AAClE;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA,mBAAmB,sDAAU;AAC7B;AACA,qCAAqC,0DAAY;AACjD,8DAA8D,gDAAgD;AAC9G;AACA,SAAS;AACT;AACA;AACO;AACP,WAAW,6CAA6C;AACxD;AACA;AACA;AACA;AACA,4CAA4C,wDAAwD;AACpG;AACA;AACA;AACA;AACA;AACA;AACA,iC;;;;;;;;;;;;ACrCA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAkC;AACgB;AACL;AACF;AACpC;AACP;AACA,QAAQ,gEAAM,yBAAyB,sDAAU,CAAC,qEAAW;AAC7D,QAAQ,gEAAM,CAAC,qDAAG,0BAA0B,sDAAU,CAAC,qEAAW;AAClE;AACA;AACA,qC;;;;;;;;;;;;ACVA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAA0C;AACF;AACa;AACS;AACvD;AACP;AACA,YAAY,6DAAO;AACnB;AACA;AACA;AACA;AACA;AACA;AACA,WAAW,4DAAS;AACpB;AACO;AACP;AACA;AACA;AACA;AACO,6BAA6B,gEAAe;AACnD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,2BAA2B;AACtD;AACA,mCAAmC,iFAAiB;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,+BAA+B;AAC1D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gC;;;;;;;;;;;;AC/DA;AAAA;AAAA;AAAA;AAA2C;AACpC;AACP,eAAe,sDAAU;AACzB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA,KAAK;AACL;AACO;AACP,WAAW,kCAAkC;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iC;;;;;;;;;;;;AC3CA;AAAA;AAAA;AAA2C;AACpC;AACP;AACA,mBAAmB,sDAAU;AAC7B;AACA;AACA,mBAAmB,sDAAU,gDAAgD,oBAAoB;AACjG;AACA;AACA,mBAAmB,oBAAoB;AACvC;AACA;AACA,sC;;;;;;;;;;;;ACZA;AAAA;AAAA;AAAA;AAAA;AAAA;AAA2C;AACA;AACG;AACI;AAC3C;AACP;AACA,QAAQ,iEAAS;AACjB;AACA;AACA,aAAa,qEAAW;AACxB;AACA;AACA,SAAS,qEAAW;AACpB,oBAAoB,sDAAK;AACzB;AACA,eAAe,sDAAU;AACzB,oBAAoB,iEAAS;AAC7B;AACA;AACA;AACA;AACA,SAAS;AACT,KAAK;AACL;AACA;AACA,WAAW,4BAA4B;AACvC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iC;;;;;;;;;;;;ACpCA;AAAA;AAAA;AAAA;AAAA;AAA2C;AACb;AACE;AACzB;AACP,eAAe,sDAAU;AACzB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gCAAgC,kDAAI,WAAW,4CAAK;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA,iC;;;;;;;;;;;;AC/BA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAwC;AACE;AACC;AACU;AACS;AACe;AACtE;AACP;AACA;AACA;AACA;AACA,WAAW,4DAAS;AACpB;AACO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACO,4BAA4B,sDAAU;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAY,6DAAO;AACnB;AACA;AACA,8BAA8B,kEAAe;AAC7C,oDAAoD,kEAAe;AACnE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,SAAS;AAChC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,SAAS;AAChC;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,SAAS;AAChC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK,kEAAe;AACpB;AACA;AACA;AACA;AACA;AACA,kCAAkC,+BAA+B,IAAI;AACrE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gCAAgC,gEAAe;AAC/C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK,kEAAe;AACpB;AACA;AACA;AACA;AACA;AACA,oBAAoB;AACpB;AACA;AACA,oBAAoB;AACpB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,iFAAiB;AAChC;AACA;AACA,+B;;;;;;;;;;;;ACrMA;AAAA;AAAA;AAAA;AAAqD;AACS;AACvD;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8BAA8B,gEAAe;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,mBAAmB;AAC1C;AACA;AACA;AACA;AACA;AACA,sCAAsC,iFAAiB;AACvD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,6BAA6B;AAC5C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iC;;;;;;;;;;;;AC9DA;AAAA;AAAA;AAAA;AAAA;AAA2C;AACX;AACY;AACrC,yCAAyC,sDAAK;AACrD,WAAW,oDAAK,OAAO,+DAAK;AAC5B;AACA,qC;;;;;;;;;;;;ACNA;AAAA;AAAA;AAAA;AAAqD;AACS;AACvD;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B,gEAAe;AAC9C;AACA;AACA;AACA,iBAAiB,iFAAiB;AAClC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kC;;;;;;;;;;;;AC9BA;AAAA;AAAA;AAA2C;AACpC;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oCAAoC,sDAAU;AAC9C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wCAAwC,sDAAU;AAClD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,+CAA+C;AAC9D;AACA;AACA;AACA;AACA,oCAAoC,KAAK;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,uBAAuB;AACtC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uC;;;;;;;;;;;;AC7EA;AAAA;AAAA;AAAA;AAAA;AAA2C;AACA;AACO;AAC3C;AACP;AACA,oBAAoB,sDAAK;AACzB,QAAQ,qEAAW;AACnB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mCAAmC,sDAAU;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uCAAuC;AACvC;AACA;AACA;AACA,gCAAgC;AAChC,mCAAmC;AACnC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,SAAS;AAChC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,wBAAwB;AACvC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uCAAuC;AACvC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,WAAW,gEAAgE;AAC3E;AACA;AACA;AACA,sGAAsG,sBAAsB;AAC5H;AACA;AACA;AACA;AACA,WAAW,sBAAsB;AACjC;AACA;AACA,sC;;;;;;;;;;;;AC5IA;AAAA;AAAA;AAAA;AAAA;AAA+C;AACe;AACT;AAC9C;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qCAAqC,gEAAe;AACpD;AACA;AACA;AACA;AACA;AACA,iBAAiB,iFAAiB;AAClC;AACA;AACA;AACA;AACA,uBAAuB,SAAS;AAChC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,uBAAuB;AAC1C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iCAAiC,0DAAY;AAC7C,yBAAyB;AACzB;AACA,kCAAkC,iFAAiB;AACnD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wC;;;;;;;;;;;;ACpGA;AAAA;AAAA;AAAA;AAAA;AAA+C;AACM;AACS;AACvD;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mCAAmC,gEAAe;AAClD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa,sBAAsB;AACnC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,kBAAkB;AACrC;AACA;AACA;AACA;AACA;AACA,kCAAkC,0DAAY;AAC9C;AACA;AACA;AACA,gCAAgC,iFAAiB;AACjD;AACA;AACA;AACA,sC;;;;;;;;;;;;AC3EA;AAAA;AAAA;AAAA;AAAA;AAAqD;AACA;AACS;AACvD;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8BAA8B,gEAAe;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wCAAwC,gEAAe;AACvD;AACA,sCAAsC,iFAAiB;AACvD;AACA;AACA;AACA;AACA;AACA;AACA,sC;;;;;;;;;;;;AC5CA;AAAA;AAAA;AAAoE;AAC7D;AACP,uCAAuC,+EAAqB;AAC5D;AACA,sC;;;;;;;;;;;;ACJA;AAAA;AAAA;AAAA;AAAA;AAA0C;AAC0B;AAC1B;AAC1C;AACO;AACP;AACA;AACA;AACA;AACA,oCAAoC,6DAAO;AAC3C;AACA;AACA,wCAAwC,6DAAI,gCAAgC,+EAAqB;AACjG;AACA,yC;;;;;;;;;;;;ACdA;AAAA;AAAA;AAA8D;AACvD;AACP,wCAAwC,iEAAY;AACpD;AACA,kC;;;;;;;;;;;;ACJA;AAAA;AAAA;AAAsC;AAC/B;AACP,WAAW,0DAAQ;AACnB;AACA,qC;;;;;;;;;;;;ACJA;AAAA;AAAA;AAAsC;AAC/B;AACP,WAAW,0DAAQ;AACnB;AACA,qC;;;;;;;;;;;;ACJA;AAAA;AAAA;AAAwC;AACjC;AACP,WAAW,4DAAS;AACpB;AACA,uC;;;;;;;;;;;;ACJA;AAAA;AAAA;AAA2C;AACpC;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8BAA8B,sDAAU;AACxC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iC;;;;;;;;;;;;AC/CA;AAAA;AAAA;AAAA;AAAqD;AACS;AACvD;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iCAAiC,gEAAe;AAChD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,iFAAiB;AACxC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oC;;;;;;;;;;;;ACrEA;AAAA;AAAA;AAAA;AAA2C;AACA;AACpC,2CAA2C,sDAAK;AACvD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qCAAqC,sDAAU;AAC/C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,YAAY;AAC/B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wC;;;;;;;;;;;;ACtDA;AAAA;AAAA;AAA2C;AACpC;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uCAAuC,sDAAU;AACjD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0C;;;;;;;;;;;;AC7BA;AAAA;AAAA;AAAA;AAAA;AAAA;AAA2C;AACH;AACG;AACI;AACxC,kCAAkC,sDAAK;AAC9C,0BAA0B,2DAAM;AAChC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8BAA8B,sDAAU;AACxC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kCAAkC,0DAAY;AAC9C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kCAAkC,0DAAY;AAC9C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iC;;;;;;;;;;;;AClFA;AAAA;AAAA;AAAA;AAAA;AAAA;AAA2C;AACA;AACU;AACS;AACvD;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kCAAkC,gEAAe;AACjD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qCAAqC,iFAAiB;AACtD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0CAA0C,sDAAU;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0CAA0C,sDAAU;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qC;;;;;;;;;;;;ACrHA;AAAA;AAAA;AAA2C;AACpC;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sCAAsC,sDAAU;AAChD;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yC;;;;;;;;;;;;ACnBA;AAAA;AAAA;AAAA;AAAA;AAAqD;AACS;AACvD;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACO,iCAAiC,gEAAe;AACvD;AACA;AACA;AACA;AACA;AACA,qBAAqB,iFAAiB;AACtC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,cAAc;AAC7B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,SAAS;AACxB;AACA;AACA;AACA;AACA;AACA;AACA,oC;;;;;;;;;;;;ACzDA;AAAA;AAAA;AAA2C;AACpC;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6CAA6C,sDAAU;AACvD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,cAAc;AACjC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,UAAU;AACjC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gD;;;;;;;;;;;;ACrDA;AAAA;AAAA;AAA8D;AACvD;AACP,WAAW,kFAAoB;AAC/B;AACA,mD;;;;;;;;;;;;ACJA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAA0E;AACxC;AACY;AACI;AACpB;AACvB;AACP;AACA,kBAAkB,qFAAuB;AACzC;AACA;AACA,mCAAmC,sDAAM,yBAAyB,kDAAI;AACtE,UAAU,sEAAc;AACxB,UAAU,kEAAY,WAAW,qFAAuB;AACxD;AACA,qC;;;;;;;;;;;;ACdA;AAAA;AAAA;AAAA;AAA8C;AACR;AAC/B;AACP,uBAAuB,iEAAM,SAAS,yDAAE;AACxC;AACA,mC;;;;;;;;;;;;ACLA;AAAA;AAAA;AAA2C;AACpC;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8BAA8B,sDAAU;AACxC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iC;;;;;;;;;;;;AC5CA;AAAA;AAAA;AAAA;AAAqD;AACS;AACvD;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oCAAoC,gEAAe;AACnD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qBAAqB,iFAAiB;AACtC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mC;;;;;;;;;;;;ACpCA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAqD;AACA;AACS;AAClC;AACc;AACnC;AACP;AACA,4DAA4D,6DAAI,qBAAqB,gDAAG;AACxF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mCAAmC,gEAAe;AAClD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oCAAoC,gEAAe;AACnD;AACA;AACA,kCAAkC,iFAAiB;AACnD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sC;;;;;;;;;;;;AC5EA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAqD;AACS;AACvD;AACP;AACA;AACA;AACO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACO,+BAA+B,gEAAe;AACrD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,mCAAmC;AAClD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,UAAU;AACjC;AACA;AACA;AACA;AACA;AACA,mCAAmC;AACnC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wBAAwB,iFAAiB;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kC;;;;;;;;;;;;AC1FA;AAAA;AAAA;AAA2C;AACpC;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B,sDAAU;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kC;;;;;;;;;;;;ACpCA;AAAA;AAAA;AAAA;AAA2C;AACI;AACxC;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gCAAgC,sDAAU;AAC1C;AACA;AACA,qBAAqB,0DAAY;AACjC;AACA;AACA,oC;;;;;;;;;;;;ACnBA;AAAA;AAAA;AAAA;AAAA;AAA2C;AACpC;AACP;AACA;AACA;AACA;AACA;AACO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACO,kCAAkC,sDAAU;AACnD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,qBAAqB;AACpC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gC;;;;;;;;;;;;AClDA;AAAA;AAAA;AAAsD;AAC/C;AACP,uCAAuC,iEAAiB;AACxD;AACA,qC;;;;;;;;;;;;ACJA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAgD;AACd;AACJ;AACoB;AACJ;AACF;AACrC;AACP;AACA,+CAA+C,sDAAM,sCAAsC,uDAAQ,EAAE,kDAAI,uBAAuB,sEAAc,iBAAiB,kEAAY,WAAW,2DAAU;AAChM;AACA,iC;;;;;;;;;;;;ACVA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAA2C;AACI;AACJ;AACN;AAC9B;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gCAAgC,sDAAU;AAC1C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yEAAyE,gDAAO;AAChF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sCAAsC,sDAAU;AAChD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,cAAc;AAC7B;AACA;AACA;AACA;AACA;AACA;AACO,gCAAgC,sDAAU;AACjD;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iCAAiC,0DAAY;AAC7C,eAAe,qCAAqC;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wCAAwC,0DAAY;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mC;;;;;;;;;;;;ACnKA;AAAA;AAAA;AAA2C;AACpC;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uCAAuC,sDAAU;AACjD;AACA;AACA;AACA,0C;;;;;;;;;;;;ACfA;AAAA;AAAA;AAA2C;AACpC;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gCAAgC,sDAAU;AAC1C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mC;;;;;;;;;;;;ACzBA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAgD;AACd;AACI;AACQ;AACI;AACN;AACrC;AACP;AACA,+CAA+C,sDAAM,sCAAsC,uDAAQ,EAAE,0DAAQ,uBAAuB,sEAAc,iBAAiB,kEAAY,WAAW,2DAAU;AACpM;AACA,gC;;;;;;;;;;;;ACVA;AAAA;AAAA;AAAA;AAA2C;AACpC;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4BAA4B,sDAAU;AACtC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+B;;;;;;;;;;;;ACrCA;AAAA;AAAA;AAA2C;AACpC;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8BAA8B,sDAAU;AACxC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iC;;;;;;;;;;;;ACrBA;AAAA;AAAA;AAAA;AAA2C;AACI;AACxC;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oCAAoC,sDAAU;AAC9C;AACA;AACA;AACA;AACA,8BAA8B,0DAAY;AAC1C;AACA;AACA;AACA,yBAAyB,0DAAY;AACrC;AACA;AACA;AACA;AACA,yBAAyB,0DAAY;AACrC;AACA;AACA;AACA,uC;;;;;;;;;;;;AC9BA;AAAA;AAAA;AAAkC;AAC3B;AACP;AACA;AACA;AACA,WAAW,sDAAM;AACjB;AACA,+B;;;;;;;;;;;;ACPA;AAAA;AAAA;AAA2D;AACpD;AACP,wCAAwC,+DAAW;AACnD;AACA,iC;;;;;;;;;;;;ACJA;AAAA;AAAA;AAAA;AAAsC;AACM;AACrC;AACP,WAAW,0DAAQ,CAAC,uDAAQ;AAC5B;AACA,oC;;;;;;;;;;;;ACLA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAA8D;AACT;AACA;AACzB;AACc;AACnC;AACP;AACA,0DAA0D,6DAAI,qBAAqB,gDAAG;AACtF;AACA;AACA;AACA;AACA;AACA;AACO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACO,iCAAiC,gEAAe;AACvD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oCAAoC,gEAAe;AACnD;AACA;AACA,kCAAkC,iFAAiB;AACnD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oC;;;;;;;;;;;;ACrFA;AAAA;AAAA;AAAsC;AAC/B;AACP;AACA,eAAe,0DAAQ;AACvB;AACA;AACA;AACA;AACA,WAAW,0DAAQ;AACnB;AACA,sC;;;;;;;;;;;;ACVA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAA8D;AACT;AACA;AAC9C;AACP;AACA;AACO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACO,kCAAkC,gEAAe;AACxD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,cAAc;AACrC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oCAAoC,gEAAe;AACnD;AACA;AACA,kCAAkC,iFAAiB;AACnD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,cAAc;AAC7B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qC;;;;;;;;;;;;ACxFA;AAAA;AAAA;AAAkC;AAC3B;AACP;AACA;AACA;AACA,WAAW,sDAAM;AACjB;AACA,+B;;;;;;;;;;;;ACPA;AAAA;AAAA;AAAA;AAAsF;AAC/E;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kDAAkD,iGAA+B;AACjF;AACA;AACA;AACA;AACA;AACO;AACP;AACA;AACA;AACA;AACA;AACA,eAAe,WAAW;AAC1B;AACA;AACA;AACA;AACA;AACA;AACA,qC;;;;;;;;;;;;AClCA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAA2C;AACI;AACxC;AACP;AACA;AACA;AACA;AACO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACO,kCAAkC,sDAAU;AACnD;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,4BAA4B;AAC3C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6BAA6B,0DAAY;AACzC;AACA;AACA,6BAA6B,0DAAY;AACzC;AACA;AACA;AACA,6BAA6B,0DAAY;AACzC;AACA;AACA;AACO;AACP;AACA;AACA;AACA;AACA;AACA,qC;;;;;;;;;;;;ACjDA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAA0C;AACA;AACW;AACA;AACS;AACvD;AACP,oCAAoC,6DAAO;AAC3C;AACA;AACA;AACA;AACO;AACP;AACA,oCAAoC,6DAAO;AAC3C;AACA;AACA;AACA,WAAW,6DAAI;AACf;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0CAA0C,gEAAe;AACzD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wCAAwC,gEAAe;AACvD;AACA;AACA,sCAAsC,iFAAiB;AACvD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6C;;;;;;;;;;;;AC/DA;AAAA;AAAA;AAA2C;AACpC;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iCAAiC,sDAAU;AAC3C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oC;;;;;;;;;;;;AC5BA;AAAA;AAAA;AAAA;AAAkC;AACA;AAC3B;AACP;AACA,QAAQ,sDAAM;AACd,QAAQ,sDAAM,CAAC,qDAAG;AAClB;AACA;AACA,qC;;;;;;;;;;;;ACRA;AAAA;AAAA;AAA4B;AACrB;AACP;AACA;AACA;AACA;AACA,uBAAuB,gDAAG;AAC1B;AACA;AACA;AACA;AACA,uBAAuB,YAAY;AACnC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iC;;;;;;;;;;;;ACxBA;AAAA;AAAA;AAAA;AAAqC;AACG;AACjC;AACP;AACA,QAAQ,4DAAS,WAAW,gDAAO;AACnC,QAAQ,4DAAS,KAAK,gDAAO;AAC7B;AACA,mC;;;;;;;;;;;;ACPA;AAAA;AAAA;AAAA;AAAqD;AACb;AACjC;AACP,uBAAuB,4DAAS,KAAK,gEAAe;AACpD;AACA,2C;;;;;;;;;;;;ACLA;AAAA;AAAA;AAAA;AAA+C;AACP;AACjC;AACP,uBAAuB,4DAAS,KAAK,0DAAY;AACjD;AACA,uC;;;;;;;;;;;;ACLA;AAAA;AAAA;AAAA;AAAiD;AACT;AACjC;AACP;AACA;AACA;AACA;AACA,wBAAwB,4DAAa;AACrC,uBAAuB,4DAAS;AAChC;AACA,yC;;;;;;;;;;;;ACVA;AAAA;AAAA;AAAA;AAA0C;AACc;AACjD;AACP;AACA,wCAAwC,6DAAO;AAC/C;AACA;AACA,gCAAgC,6DAAU;AAC1C;AACA;AACA,gC;;;;;;;;;;;;ACVA;AAAA;AAAA;AAAA;AAAA;AAAA;AAA8B;AACQ;AACY;AACd;AAC7B;AACP;AACA;AACA,mBAAmB,uDAAI,CAAC,kDAAI,qBAAqB,0DAAQ,KAAK,sEAAc;AAC5E;AACA;AACA;AACA,eAAe,uDAAI,CAAC,kDAAI,6DAA6D,0DAAQ;AAC7F;AACA;AACA,kC;;;;;;;;;;;;ACdA;AAAA;AAAA;AAA2C;AACpC;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,cAAc;AAC7B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iCAAiC,sDAAU;AAC3C;AACA;AACA;AACA;AACA;AACA,eAAe,cAAc;AAC7B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,aAAa;AAC5B;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oC;;;;;;;;;;;;ACnDA;AAAA;AAAA;AAAA;AAA2C;AACC;AACrC;AACP;AACA;AACA,mBAAmB,+DAAK;AACxB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B,sDAAU;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,gBAAgB;AACnC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kC;;;;;;;;;;;;AC3CA;AAAA;AAAA;AAAA;AAAA;AAAqC;AACgB;AACS;AACvD;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mCAAmC,gEAAe;AAClD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,qCAAqC;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,eAAe;AAC9B;AACA;AACA;AACA;AACA;AACA;AACA,iCAAiC,gDAAO;AACxC;AACA;AACA,mBAAmB,WAAW;AAC9B;AACA;AACA;AACA;AACA;AACA;AACA,mCAAmC,iFAAiB;AACpD;AACA;AACA,sC;;;;;;;;;;;;AC5EA;AAAA;AAAA;AAA2C;AACpC;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8BAA8B,sDAAU;AACxC;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,gBAAgB;AACnC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iC;;;;;;;;;;;;AChCA;AAAA;AAAA;AAAA;AAAA;AAAqC;AACgB;AACS;AACvD;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kCAAkC,gEAAe;AACjD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6BAA6B,gDAAO;AACpC;AACA,2BAA2B,WAAW;AACtC;AACA;AACA;AACA;AACA;AACA,sCAAsC,iFAAiB;AACvD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,8BAA8B;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,eAAe;AAC9B;AACA;AACA;AACA;AACA;AACA;AACA,qC;;;;;;;;;;;;ACpEA;AAAA;AAAA;AAAA;AAAqD;AACS;AACvD;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yBAAyB,iFAAiB;AAC1C;AACA;AACA;AACA,+BAA+B,gEAAe;AAC9C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kC;;;;;;;;;;;;ACtCA;AAAA;AAAA;AAAA;AAA2C;AACA;AACpC,wCAAwC,sDAAK;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mCAAmC,sDAAU;AAC7C;AACA;AACA;AACA;AACA;AACA,mEAAmE,2BAA2B;AAC9F;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS,qBAAqB;AAC9B;AACA;AACA;AACA,sC;;;;;;;;;;;;ACtCA;AAAA;AAAA;AAA2C;AACpC;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6BAA6B,sDAAU;AACvC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gC;;;;;;;;;;;;ACzDA;AAAA;AAAA;AAAA;AAAA;AAA2C;AACpC;AACP;AACA;AACO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACO,sCAAsC,sDAAU;AACvD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,qBAAqB;AACpC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,cAAc;AAC7B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+CAA+C,sDAAU;AACzD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yC;;;;;;;;;;;;AClGA;AAAA;AAAA;AAAA;AAAA;AAAwC;AACF;AACD;AACrC;AACA,eAAe,gDAAO;AACtB;AACO;AACP,uBAAuB,0DAAQ,GAAG,4DAAS;AAC3C;AACA,iC;;;;;;;;;;;;ACTA;AAAA;AAAA;AAAiD;AAC1C;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8BAA8B,iHAAiH;AAC/I;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0BAA0B,4DAAa;AACvC;AACA,6BAA6B,qBAAqB,EAAE;AACpD;AACA;AACA;AACA,iBAAiB;AACjB;AACA;AACA;AACA;AACA,iBAAiB;AACjB,aAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA,uC;;;;;;;;;;;;ACpDA;AAAA;AAAA;AAAA;AAA2C;AACK;AACzC;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B,sDAAU;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kCAAkC,2DAAU;AAC5C;AACA;AACA;AACA,kC;;;;;;;;;;;;AC7DA;AAAA;AAAA;AAA2C;AACpC;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6BAA6B,sDAAU;AACvC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gC;;;;;;;;;;;;ACxBA;AAAA;AAAA;AAAA;AAA2C;AAC+B;AACnE;AACP;AACA;AACA;AACA;AACA;AACA;AACA,sBAAsB,qFAAuB;AAC7C;AACA;AACA;AACA;AACA,wCAAwC,sDAAU;AAClD;AACA;AACA;AACA;AACA;AACA;AACA,iCAAiC,sDAAU;AAC3C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oC;;;;;;;;;;;;AC3CA;AAAA;AAAA;AAAA;AAAA;AAAqD;AACA;AACS;AACvD;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kCAAkC,gEAAe;AACjD;AACA;AACA;AACA,oCAAoC,gEAAe;AACnD;AACA;AACA,kCAAkC,iFAAiB;AACnD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qC;;;;;;;;;;;;ACzCA;AAAA;AAAA;AAA2C;AACpC;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kCAAkC,sDAAU;AAC5C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qC;;;;;;;;;;;;ACtCA;AAAA;AAAA;AAAA;AAA8C;AACI;AAC3C;AACP;AACA,QAAQ,qEAAW;AACnB;AACA,2BAA2B,iEAAM;AACjC;AACA;AACA,2BAA2B,iEAAM;AACjC;AACA;AACA,qC;;;;;;;;;;;;ACZA;AAAA;AAAA;AAA4E;AACrE;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAmB,uFAAqB;AACxC;AACA;AACA,uC;;;;;;;;;;;;ACfA;AAAA;AAAA;AAAA;AAAwC;AACI;AACrC;AACP,WAAW,4DAAS,CAAC,uDAAQ;AAC7B;AACA,qC;;;;;;;;;;;;ACLA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAqD;AACA;AACS;AAClC;AACc;AACnC;AACP;AACA,2DAA2D,6DAAI,qBAAqB,gDAAG;AACvF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kCAAkC,gEAAe;AACjD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oCAAoC,gEAAe;AACnD;AACA;AACA,iCAAiC,iFAAiB;AAClD;AACA;AACA;AACA;AACA;AACA,eAAe,oBAAoB;AACnC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qC;;;;;;;;;;;;ACxEA;AAAA;AAAA;AAAwC;AACjC;AACP,4BAA4B,4DAAS,0CAA0C,4DAAS;AACxF;AACA,uC;;;;;;;;;;;;ACJA;AAAA;AAAA;AAAA;AAAA;AAA2C;AAC+B;AAC9B;AACrC;AACP;AACA;AACA,mBAAmB,+DAAK;AACxB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sBAAsB,qFAAuB;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA,6BAA6B,sDAAU;AACvC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gC;;;;;;;;;;;;AC1CA;AAAA;AAAA;AAAA;AAAA;AAA2C;AAC+B;AAC9B;AACrC;AACP;AACA;AACA,mBAAmB,+DAAK;AACxB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sBAAsB,qFAAuB;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA,iCAAiC,sDAAU;AAC3C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA2B,WAAW;AACtC;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oC;;;;;;;;;;;;ACzDA;AAAA;AAAA;AAAA;AAAqD;AACS;AACvD;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qCAAqC,iFAAiB;AACtD;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kCAAkC,gEAAe;AACjD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qC;;;;;;;;;;;;AC/BA;AAAA;AAAA;AAA2C;AACpC;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kCAAkC,sDAAU;AAC5C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qC;;;;;;;;;;;;AC7CA;AAAA;AAAA;AAAA;AAAA;AAA2C;AACP;AACY;AACzC;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4BAA4B,sDAAU;AACtC;AACA;AACA,wBAAwB,+CAAI;AAC5B,yBAAyB,+CAAI;AAC7B,4BAA4B,+CAAI;AAChC,kCAAkC,+CAAI;AACtC,wCAAwC,+CAAI;AAC5C,YAAY,mEAAU;AACtB;AACA;AACA;AACA;AACA;AACA,mDAAmD,+CAAI;AACvD,qDAAqD,+CAAI;AACzD,2DAA2D,+CAAI;AAC/D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+B;;;;;;;;;;;;ACpEA;AAAA;AAAA;AAAA;AAAA;AAAqD;AACS;AACvD;AACP;AACA;AACA;AACO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iCAAiC,gEAAe;AAChD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,wBAAwB;AACvC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uCAAuC,iFAAiB;AACxD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,wBAAwB;AACvC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oC;;;;;;;;;;;;ACjFA;AAAA;AAAA;AAAA;AAAA;AAA2C;AACA;AACQ;AAC5C,4CAA4C,sDAAK,WAAW,+DAAqB;AACxF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qCAAqC,sDAAU;AAC/C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4FAA4F,mBAAmB;AAC/G;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,WAAW,aAAa;AACxB;AACA;AACA,wC;;;;;;;;;;;;ACxEA;AAAA;AAAA;AAAA;AAAgD;AACL;AACpC;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qCAAqC,sDAAU;AAC/C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,2DAAU;AACzB;AACA,wC;;;;;;;;;;;;AC5CA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAA2C;AACb;AACc;AAChB;AACrB,kCAAkC,sDAAK;AAC9C,uBAAuB,+DAAK;AAC5B,2BAA2B,kDAAI,GAAG,UAAU,cAAc,iDAAiD,IAAI,8DAA8D,GAAG,gDAAG,GAAG,uBAAuB;AAC7M,KAAK;AACL;AACO;AACP;AACA;AACA;AACA;AACA;AACA,wC;;;;;;;;;;;;ACfA;AAAA;AAAA;AAAA;AAAA;AAAA;AAA2C;AACS;AACR;AACU;AAC/C,kCAAkC,sDAAK;AAC9C,WAAW,gEAAW,MAAM,yEAAU,KAAK,+DAAY;AACvD;AACA,mC;;;;;;;;;;;;ACPA;AAAA;AAAA;AAAA;AAAA;AAAA;AAA2C;AACH;AACa;AACS;AACvD,sDAAsD,sDAAK;AAClE;AACA,8BAA8B,2DAAM;AACpC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oCAAoC,gEAAe;AACnD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,iBAAiB;AAChC;AACA,uBAAuB,iFAAiB;AACxC;AACA;AACA,eAAe,SAAS;AACxB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uC;;;;;;;;;;;;AC1DA;AAAA;AAAA;AAAA;AAAA;AAA2C;AACf;AACrB,+BAA+B,sDAAK;AAC3C,WAAW,gDAAG;AACd;AACO;AACP;AACA;AACA;AACA;AACA;AACA,qC;;;;;;;;;;;;ACXA;AAAA;AAAA;AAAkC;AAClC;AACA;AACA;AACA;AACA;AACA;AACA;AACO;AACP,WAAW,sDAAM;AACjB;AACA,mC;;;;;;;;;;;;ACXA;AAAA;AAAA;AAAA;AAAA;AAAqC;AACgB;AACS;AACvD;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iCAAiC,iFAAiB;AAClD;AACA;AACA;AACA;AACA,+BAA+B,gEAAe;AAC9C;AACA;AACA,0BAA0B,gDAAO;AACjC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4CAA4C,gDAAO;AACnD;AACA;AACA;AACA,kC;;;;;;;;;;;;AC5DA;AAAA;AAAA;AAAA;AAA2C;AACN;AAC9B;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oCAAoC,sDAAU;AAC9C;AACA;AACA;AACA;AACA;AACA,4BAA4B,gDAAO;AACnC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,yBAAyB;AAChD;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B,gDAAO;AACtC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uC;;;;;;;;;;;;ACpEA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAqC;AACM;AACA;AACG;AACI;AAC3C;AACP,oBAAoB,sDAAK;AACzB;AACA;AACA,QAAQ,qEAAW;AACnB;AACA;AACA,QAAQ,qEAAW;AACnB;AACA;AACA,aAAa,iEAAS;AACtB;AACA;AACA,QAAQ,qEAAW;AACnB;AACA;AACA,aAAa,iEAAS;AACtB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6BAA6B,gDAAO;AACpC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mCAAmC,sDAAU;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gCAAgC;AAChC,mCAAmC;AACnC;AACA;AACA;AACA;AACA,uCAAuC;AACvC;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,SAAS;AAChC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,WAAW,qCAAqC;AAChD;AACA;AACA;AACA;AACA;AACA;AACA;AACA,WAAW,gEAAgE;AAC3E;AACA;AACA,mBAAmB;AACnB,2BAA2B;AAC3B;AACA;AACA;AACA;AACA;AACA,WAAW,8BAA8B;AACzC;AACA;AACA;AACA;AACA;AACA,sC;;;;;;;;;;;;AC7IA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAqC;AACU;AACM;AACS;AACvD;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qCAAqC,gEAAe;AACpD;AACA;AACA;AACA;AACA;AACA,yCAAyC,iFAAiB;AAC1D;AACA;AACA,eAAe,WAAW;AAC1B;AACA;AACA,2BAA2B,SAAS;AACpC;AACA;AACA;AACA;AACA;AACA,eAAe,WAAW;AAC1B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,WAAW;AAC1B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,WAAW;AAC1B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,kBAAkB;AACzC;AACA;AACA;AACA;AACA;AACA,+BAA+B,gDAAO;AACtC,qCAAqC,0DAAY;AACjD,6BAA6B;AAC7B;AACA,sCAAsC,iFAAiB;AACvD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,WAAW;AAC1B;AACA,eAAe,uBAAuB;AACtC;AACA;AACA;AACA;AACA;AACA,wC;;;;;;;;;;;;AC1HA;AAAA;AAAA;AAAA;AAAA;AAAqC;AACgB;AACS;AACvD;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA+B,gEAAe;AAC9C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yCAAyC,gDAAO;AAChD;AACA;AACA;AACA,mBAAmB,kBAAkB;AACrC;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4CAA4C,iFAAiB;AAC7D;AACA;AACA,sC;;;;;;;;;;;;AC1EA;AAAA;AAAA;AAAA;AAAqD;AACS;AACvD;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uCAAuC,gEAAe;AACtD;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAuB,SAAS;AAChC;AACA;AACA,uBAAuB,SAAS;AAChC;AACA,qBAAqB,iFAAiB;AACtC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0C;;;;;;;;;;;;ACxEA;AAAA;AAAA;AAAqD;AAC9C;AACP;AACA,gCAAgC,2DAAS;AACzC;AACA;AACA,+B;;;;;;;;;;;;ACNA;AAAA;AAAA;AAAgD;AACzC;AACP,uCAAuC,2DAAW;AAClD;AACA,kC;;;;;;;;;;;;ACJA;AAAA;AAAA;AAAA;AAA2C;AACI;AACxC;AACP,eAAe,sDAAU;AACzB,wBAAwB,0DAAY;AACpC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA,KAAK;AACL;AACA,yC;;;;;;;;;;;;ACnBA;AAAA;AAAA;AAAA;AAAA;AAA2C;AACI;AACkB;AAC1D;AACP;AACA;AACA;AACA,eAAe,sDAAU;AACzB,wBAAwB,0DAAY;AACpC;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA,6BAA6B,yDAAe;AAC5C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAa;AACb,SAAS;AACT;AACA,KAAK;AACL;AACA,4C;;;;;;;;;;;;AC5CA;AAAA;AAAA;AAAA;AAAA;AAA2C;AACI;AACwB;AAChE;AACP,eAAe,sDAAU;AACzB,wBAAwB,0DAAY;AACpC;AACA,qCAAqC,6DAAiB;AACtD;AACA,6BAA6B,2DAA2D,EAAE;AAC1F,4BAA4B,0DAA0D,EAAE;AACxF,4BAA4B,0DAA0D,EAAE;AACxF,aAAa;AACb,SAAS;AACT;AACA,KAAK;AACL;AACA,8C;;;;;;;;;;;;ACjBA;AAAA;AAAA;AAAA;AAA2C;AACI;AACxC;AACP,eAAe,sDAAU;AACzB,wBAAwB,0DAAY;AACpC;AACA;AACA;AACA;AACA,aAAa;AACb,SAAS;AACT;AACA,SAAS;AACT;AACA,KAAK;AACL;AACA,2C;;;;;;;;;;;;AChBA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAA0D;AACN;AACJ;AACM;AACY;AACpB;AACI;AACF;AACzC;AACP;AACA,YAAY,qFAAmB;AAC/B,mBAAmB,8EAAkB;AACrC;AACA,iBAAiB,iEAAS;AAC1B,mBAAmB,wEAAe;AAClC;AACA,iBAAiB,qEAAW;AAC5B,mBAAmB,oEAAa;AAChC;AACA,iBAAiB,mEAAU;AAC3B,mBAAmB,0EAAgB;AACnC;AACA;AACA;AACA;AACA,qC;;;;;;;;;;;;ACzBA;AAAA;AAAA;AAA+C;AACxC,qBAAqB,0DAAY;AACxC;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kC;;;;;;;;;;;;ACTA;AAAA;AAAA;AAA4C;AACrC,mCAAmC,wDAAW;AACrD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gD;;;;;;;;;;;;ACzBA;AAAA;AAAA;AAAkD;AAC3C,sCAAsC,8DAAc;AAC3D;AACA;AACA;AACA,eAAe,UAAU;AACzB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mD;;;;;;;;;;;;ACxBA;AAAA;AAAA;AAAA;AAA8C;AACF;AACrC,yBAAyB,wDAAW;AAC3C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6DAA6D,yDAAS;AACtE;AACA;AACA;AACA;AACA;AACA;AACA,YAAY,yDAAS;AACrB;AACA;AACA;AACA;AACA;AACA,sC;;;;;;;;;;;;AC1BA;AAAA;AAAA;AAAkD;AAC3C,4BAA4B,8DAAc;AACjD;AACA;AACA;AACA,eAAe,UAAU;AACzB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yC;;;;;;;;;;;;ACxBA;AAAA;AAAA;AAAkC;AAC3B,0BAA0B,8CAAM;AACvC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uC;;;;;;;;;;;;AC/EA;AAAA;AAAA;AAAyC;AAClC,6BAA6B,oDAAS;AAC7C,uCAAuC,oDAAS;AAChD;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,UAAU;AACzB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0C;;;;;;;;;;;;AC7CA;AAAA;AAAA;AAA4C;AACrC,0BAA0B,wDAAW;AAC5C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uC;;;;;;;;;;;;AC5BA;AAAA;AAAA;AAAkD;AAC3C,6BAA6B,8DAAc;AAClD;AACA,0C;;;;;;;;;;;;ACHA;AAAA;AAAA;AAAA;AAAA;AAA4C;AACM;AAC3C,mCAAmC,8DAAc;AACxD;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,qBAAqB;AACpC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACO,4BAA4B,wDAAW;AAC9C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAe,UAAU;AACzB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gD;;;;;;;;;;;;ACjFA;AAAA;AAAA;AAAA;AAA8D;AACM;AAC7D,2BAA2B,gFAAuB,CAAC,0EAAoB;AAC9E,0C;;;;;;;;;;;;ACHA;AAAA;AAAA;AAAA;AAA0C;AACM;AACzC,iBAAiB,4DAAa,CAAC,sDAAU;AAChD,gC;;;;;;;;;;;;ACHA;AAAA;AAAA;AAAA;AAA4C;AACM;AAC3C,kBAAkB,8DAAc,CAAC,wDAAW;AACnD,iC;;;;;;;;;;;;ACHA;AAAA;AAAA;AAAA;AAA4C;AACM;AAC3C,kBAAkB,8DAAc,CAAC,wDAAW;AACnD,iC;;;;;;;;;;;;ACHA;AAAA;AAAA;AAAA;AAAO;AACP;AACA;AACA;AACA;AACA;AACO;AACA;AACP,oC;;;;;;;;;;;;ACRA;AAAA;AAAO;AACP,sC;;;;;;;;;;;;ACDA;AAAA;AAAA;AAAO;AACP;AACA;AACO;AACP,wC;;;;;;;;;;;;ACJA;AAAA;AAAA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,CAAC;AACM;AACP,mD;;;;;;;;;;;;ACXA;AAAA;AAAA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,CAAC;AACM;AACP,sC;;;;;;;;;;;;ACXA;AAAA;AAAA;AAAA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACO;AACP;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA,KAAK;AACL;AACO;AACP;AACA;AACA;AACA;AACA,qC;;;;;;;;;;;;AC1BA;AAAA;AAAA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,CAAC;AACM;AACP,mD;;;;;;;;;;;;ACXA;AAAA;AAAA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,CAAC;AACM;AACP,wC;;;;;;;;;;;;ACXA;AAAA;AAAA;AACA;AACA;AACA;AACA,eAAe,cAAc;AAC7B,EAAE,0BAA0B,MAAM,IAAI,eAAe,gBAAgB;AACrE;AACA;AACA;AACA;AACA;AACA;AACA,CAAC;AACM;AACP,+C;;;;;;;;;;;;ACdA;AAAA;AAAA;AAA2C;AACpC;AACP;AACA,eAAe,iCAAiC;AAChD;AACA;AACA;AACA,uDAAuD,sDAAU;AACjE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0C;;;;;;;;;;;;AChBA;AAAA;AAAO;AACP,sBAAsB,WAAW,EAAE;AACnC;AACA,2C;;;;;;;;;;;;ACHA;AAAA;AAAO;AACP;AACA;AACA,oC;;;;;;;;;;;;ACHA;AAAA;AAAO;AACP,mC;;;;;;;;;;;;ACDA;AAAA;AAAO;AACP,uC;;;;;;;;;;;;ACDA;AAAA;AAAO;AACP;AACA;AACA,kC;;;;;;;;;;;;ACHA;AAAA;AAAO;AACP;AACA;AACA,sC;;;;;;;;;;;;ACHA;AAAA;AAAA;AAAuE;AAChE;AACP,iCAAiC,6DAAiB;AAClD;AACA,+C;;;;;;;;;;;;ACJA;AAAA;AAAA;AAAiE;AAC1D;AACP,iCAAiC,yDAAe;AAChD;AACA,sC;;;;;;;;;;;;ACJA;AAAA;AAAA;AAAoC;AAC7B;AACP,YAAY,wDAAO;AACnB;AACA,qC;;;;;;;;;;;;ACJA;AAAA;AAAO;AACP;AACA;AACA,oC;;;;;;;;;;;;ACHA;AAAA;AAAA;AAA2C;AACpC;AACP,oCAAoC,sDAAU;AAC9C;AACA,wC;;;;;;;;;;;;ACJA;AAAA;AAAO;AACP;AACA;AACA,qC;;;;;;;;;;;;ACHA;AAAA;AAAO;AACP;AACA;AACA,uC;;;;;;;;;;;;ACHA;AAAA;AAAO,iBAAiB;AACxB,gC;;;;;;;;;;;;ACDA;AAAA;AAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+B;;;;;;;;;;;;ACRA;AAAA;AAAA;AAAA;AAAsC;AAC/B;AACP;AACA;AACO;AACP;AACA,eAAe,kDAAQ;AACvB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gC;;;;;;;;;;;;ACfA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAsD;AACI;AACE;AACI;AACpB;AACJ;AACF;AAC2B;AACM;AAChE;AACP,kCAAkC,6DAAiB;AACnD,eAAe,oFAAqB;AACpC;AACA,aAAa,gEAAW;AACxB,eAAe,0EAAgB;AAC/B;AACA,aAAa,4DAAS;AACtB,eAAe,8EAAkB;AACjC;AACA,uCAAuC,yDAAe;AACtD,eAAe,gFAAmB;AAClC;AACA;AACA,sBAAsB,0DAAQ,qCAAqC,OAAO;AAC1E,oCAAoC,MAAM;AAC1C;AACA;AACA;AACA;AACA,uC;;;;;;;;;;;;AC7BA;AAAA;AAAO;AACP,uCAAuC,+BAA+B;AACtE;AACA;AACA;AACA;AACA,4C;;;;;;;;;;;;ACNA;AAAA;AAAA;AAAiE;AAC1D;AACP,8BAA8B,yDAAe;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAK;AACL;AACA;AACA;AACA;AACA;AACA,SAAS;AACT;AACA;AACA;AACA,+C;;;;;;;;;;;;ACvBA;AAAA;AAAA;AAAuE;AAChE;AACP,oBAAoB,6DAAiB;AACrC;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iD;;;;;;;;;;;;ACVA;AAAA;AAAA;AAAoD;AAC7C;AACP;AACA;AACA;AACA;AACA;AACA,KAAK;AACL,oBAAoB,gEAAe;AACnC;AACA;AACA,8C;;;;;;;;;;;;ACXA;AAAA;AAAA;AAAA;AAAA;AAAqD;AACT;AACD;AACpC,kGAAkG,gEAAe;AACxH;AACA;AACA;AACA,0BAA0B,sDAAU;AACpC;AACA;AACA,WAAW,gEAAW;AACtB;AACA,6C;;;;;;;;;;;;ACZA;AAAA;AAAA;AAAA;AAAA;AAA2C;AACiC;AACvB;AAC9C;AACP;AACA,sCAAsC,sDAAU;AAChD;AACA;AACA,2BAA2B,iEAAkB;AAC7C,kCAAkC,iEAAkB;AACpD;AACA;AACA;AACA,mBAAmB,sDAAU,CAAC,+CAAa;AAC3C;AACA,eAAe,sDAAU;AACzB;AACA,wC;;;;;;;;;;;;ACjBA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAoD;AACQ;AACN;AACU;AACF;AACI;AACJ;AACA;AACA;AACM;AACd;AACM;AACA;AACI;AACZ;AACM;AACQ;AACI;AAClB;AACQ;AACQ;AACV;AACwB;AACM;AAC5B;AACJ;AACJ;AACI;AACM;AACR;AACA;AACI;AACR;AACU;AACR;AACI;AACc;AACd;AACN;AACF;AACI;AACY;AAChB;AACI;AACM;AACA;AACW;AACP;AACF;AACZ;AACY;AACA;AACgB;AAClB;AACE;AACR;AACI;AACgB;AACR;AACI;AAClB;AACI;AACA;AACQ;AACV;AACQ;AACF;AACJ;AACQ;AACZ;AACkB;AAChB;AACY;AACV;AACJ;AACQ;AACE;AACA;AACA;AACI;AACJ;AACA;AACI;AACd;AACQ;AACE;AACA;AACZ;AACU;AACQ;AACA;AACA;AACV;AACQ;AACJ;AACJ;AACF;AACU;AACF;AACI;AACJ;AACQ;AACtB;AACM;AACtD,iC","file":"vendor.js","sourcesContent":["/**\n * @license Angular v10.0.7\n * (c) 2010-2020 Google LLC. https://angular.io/\n * License: MIT\n */\n\n/**\n * An injectable service that produces an animation sequence programmatically within an\n * Angular component or directive.\n * Provided by the `BrowserAnimationsModule` or `NoopAnimationsModule`.\n *\n * @usageNotes\n *\n * To use this service, add it to your component or directive as a dependency.\n * The service is instantiated along with your component.\n *\n * Apps do not typically need to create their own animation players, but if you\n * do need to, follow these steps:\n *\n * 1. Use the `build()` method to create a programmatic animation using the\n * `animate()` function. The method returns an `AnimationFactory` instance.\n *\n * 2. Use the factory object to create an `AnimationPlayer` and attach it to a DOM element.\n *\n * 3. Use the player object to control the animation programmatically.\n *\n * For example:\n *\n * ```ts\n * // import the service from BrowserAnimationsModule\n * import {AnimationBuilder} from '@angular/animations';\n * // require the service as a dependency\n * class MyCmp {\n * constructor(private _builder: AnimationBuilder) {}\n *\n * makeAnimation(element: any) {\n * // first define a reusable animation\n * const myAnimation = this._builder.build([\n * style({ width: 0 }),\n * animate(1000, style({ width: '100px' }))\n * ]);\n *\n * // use the returned factory object to create a player\n * const player = myAnimation.create(element);\n *\n * player.play();\n * }\n * }\n * ```\n *\n * @publicApi\n */\nclass AnimationBuilder {\n}\n/**\n * A factory object returned from the `AnimationBuilder`.`build()` method.\n *\n * @publicApi\n */\nclass AnimationFactory {\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Specifies automatic styling.\n *\n * @publicApi\n */\nconst AUTO_STYLE = '*';\n/**\n * Creates a named animation trigger, containing a list of `state()`\n * and `transition()` entries to be evaluated when the expression\n * bound to the trigger changes.\n *\n * @param name An identifying string.\n * @param definitions An animation definition object, containing an array of `state()`\n * and `transition()` declarations.\n *\n * @return An object that encapsulates the trigger data.\n *\n * @usageNotes\n * Define an animation trigger in the `animations` section of `@Component` metadata.\n * In the template, reference the trigger by name and bind it to a trigger expression that\n * evaluates to a defined animation state, using the following format:\n *\n * `[@triggerName]=\"expression\"`\n *\n * Animation trigger bindings convert all values to strings, and then match the\n * previous and current values against any linked transitions.\n * Booleans can be specified as `1` or `true` and `0` or `false`.\n *\n * ### Usage Example\n *\n * The following example creates an animation trigger reference based on the provided\n * name value.\n * The provided animation value is expected to be an array consisting of state and\n * transition declarations.\n *\n * ```typescript\n * @Component({\n * selector: \"my-component\",\n * templateUrl: \"my-component-tpl.html\",\n * animations: [\n * trigger(\"myAnimationTrigger\", [\n * state(...),\n * state(...),\n * transition(...),\n * transition(...)\n * ])\n * ]\n * })\n * class MyComponent {\n * myStatusExp = \"something\";\n * }\n * ```\n *\n * The template associated with this component makes use of the defined trigger\n * by binding to an element within its template code.\n *\n * ```html\n * \n *
...
\n * ```\n *\n * ### Using an inline function\n * The `transition` animation method also supports reading an inline function which can decide\n * if its associated animation should be run.\n *\n * ```typescript\n * // this method is run each time the `myAnimationTrigger` trigger value changes.\n * function myInlineMatcherFn(fromState: string, toState: string, element: any, params: {[key:\n string]: any}): boolean {\n * // notice that `element` and `params` are also available here\n * return toState == 'yes-please-animate';\n * }\n *\n * @Component({\n * selector: 'my-component',\n * templateUrl: 'my-component-tpl.html',\n * animations: [\n * trigger('myAnimationTrigger', [\n * transition(myInlineMatcherFn, [\n * // the animation sequence code\n * ]),\n * ])\n * ]\n * })\n * class MyComponent {\n * myStatusExp = \"yes-please-animate\";\n * }\n * ```\n *\n * ### Disabling Animations\n * When true, the special animation control binding `@.disabled` binding prevents\n * all animations from rendering.\n * Place the `@.disabled` binding on an element to disable\n * animations on the element itself, as well as any inner animation triggers\n * within the element.\n *\n * The following example shows how to use this feature:\n *\n * ```typescript\n * @Component({\n * selector: 'my-component',\n * template: `\n *
\n *
\n *
\n * `,\n * animations: [\n * trigger(\"childAnimation\", [\n * // ...\n * ])\n * ]\n * })\n * class MyComponent {\n * isDisabled = true;\n * exp = '...';\n * }\n * ```\n *\n * When `@.disabled` is true, it prevents the `@childAnimation` trigger from animating,\n * along with any inner animations.\n *\n * ### Disable animations application-wide\n * When an area of the template is set to have animations disabled,\n * **all** inner components have their animations disabled as well.\n * This means that you can disable all animations for an app\n * by placing a host binding set on `@.disabled` on the topmost Angular component.\n *\n * ```typescript\n * import {Component, HostBinding} from '@angular/core';\n *\n * @Component({\n * selector: 'app-component',\n * templateUrl: 'app.component.html',\n * })\n * class AppComponent {\n * @HostBinding('@.disabled')\n * public animationsDisabled = true;\n * }\n * ```\n *\n * ### Overriding disablement of inner animations\n * Despite inner animations being disabled, a parent animation can `query()`\n * for inner elements located in disabled areas of the template and still animate\n * them if needed. This is also the case for when a sub animation is\n * queried by a parent and then later animated using `animateChild()`.\n *\n * ### Detecting when an animation is disabled\n * If a region of the DOM (or the entire application) has its animations disabled, the animation\n * trigger callbacks still fire, but for zero seconds. When the callback fires, it provides\n * an instance of an `AnimationEvent`. If animations are disabled,\n * the `.disabled` flag on the event is true.\n *\n * @publicApi\n */\nfunction trigger(name, definitions) {\n return { type: 7 /* Trigger */, name, definitions, options: {} };\n}\n/**\n * Defines an animation step that combines styling information with timing information.\n *\n * @param timings Sets `AnimateTimings` for the parent animation.\n * A string in the format \"duration [delay] [easing]\".\n * - Duration and delay are expressed as a number and optional time unit,\n * such as \"1s\" or \"10ms\" for one second and 10 milliseconds, respectively.\n * The default unit is milliseconds.\n * - The easing value controls how the animation accelerates and decelerates\n * during its runtime. Value is one of `ease`, `ease-in`, `ease-out`,\n * `ease-in-out`, or a `cubic-bezier()` function call.\n * If not supplied, no easing is applied.\n *\n * For example, the string \"1s 100ms ease-out\" specifies a duration of\n * 1000 milliseconds, and delay of 100 ms, and the \"ease-out\" easing style,\n * which decelerates near the end of the duration.\n * @param styles Sets AnimationStyles for the parent animation.\n * A function call to either `style()` or `keyframes()`\n * that returns a collection of CSS style entries to be applied to the parent animation.\n * When null, uses the styles from the destination state.\n * This is useful when describing an animation step that will complete an animation;\n * see \"Animating to the final state\" in `transitions()`.\n * @returns An object that encapsulates the animation step.\n *\n * @usageNotes\n * Call within an animation `sequence()`, `{@link animations/group group()}`, or\n * `transition()` call to specify an animation step\n * that applies given style data to the parent animation for a given amount of time.\n *\n * ### Syntax Examples\n * **Timing examples**\n *\n * The following examples show various `timings` specifications.\n * - `animate(500)` : Duration is 500 milliseconds.\n * - `animate(\"1s\")` : Duration is 1000 milliseconds.\n * - `animate(\"100ms 0.5s\")` : Duration is 100 milliseconds, delay is 500 milliseconds.\n * - `animate(\"5s ease-in\")` : Duration is 5000 milliseconds, easing in.\n * - `animate(\"5s 10ms cubic-bezier(.17,.67,.88,.1)\")` : Duration is 5000 milliseconds, delay is 10\n * milliseconds, easing according to a bezier curve.\n *\n * **Style examples**\n *\n * The following example calls `style()` to set a single CSS style.\n * ```typescript\n * animate(500, style({ background: \"red\" }))\n * ```\n * The following example calls `keyframes()` to set a CSS style\n * to different values for successive keyframes.\n * ```typescript\n * animate(500, keyframes(\n * [\n * style({ background: \"blue\" })),\n * style({ background: \"red\" }))\n * ])\n * ```\n *\n * @publicApi\n */\nfunction animate(timings, styles = null) {\n return { type: 4 /* Animate */, styles, timings };\n}\n/**\n * @description Defines a list of animation steps to be run in parallel.\n *\n * @param steps An array of animation step objects.\n * - When steps are defined by `style()` or `animate()`\n * function calls, each call within the group is executed instantly.\n * - To specify offset styles to be applied at a later time, define steps with\n * `keyframes()`, or use `animate()` calls with a delay value.\n * For example:\n *\n * ```typescript\n * group([\n * animate(\"1s\", style({ background: \"black\" })),\n * animate(\"2s\", style({ color: \"white\" }))\n * ])\n * ```\n *\n * @param options An options object containing a delay and\n * developer-defined parameters that provide styling defaults and\n * can be overridden on invocation.\n *\n * @return An object that encapsulates the group data.\n *\n * @usageNotes\n * Grouped animations are useful when a series of styles must be\n * animated at different starting times and closed off at different ending times.\n *\n * When called within a `sequence()` or a\n * `transition()` call, does not continue to the next\n * instruction until all of the inner animation steps have completed.\n *\n * @publicApi\n */\nfunction group(steps, options = null) {\n return { type: 3 /* Group */, steps, options };\n}\n/**\n * Defines a list of animation steps to be run sequentially, one by one.\n *\n * @param steps An array of animation step objects.\n * - Steps defined by `style()` calls apply the styling data immediately.\n * - Steps defined by `animate()` calls apply the styling data over time\n * as specified by the timing data.\n *\n * ```typescript\n * sequence([\n * style({ opacity: 0 }),\n * animate(\"1s\", style({ opacity: 1 }))\n * ])\n * ```\n *\n * @param options An options object containing a delay and\n * developer-defined parameters that provide styling defaults and\n * can be overridden on invocation.\n *\n * @return An object that encapsulates the sequence data.\n *\n * @usageNotes\n * When you pass an array of steps to a\n * `transition()` call, the steps run sequentially by default.\n * Compare this to the `{@link animations/group group()}` call, which runs animation steps in\n *parallel.\n *\n * When a sequence is used within a `{@link animations/group group()}` or a `transition()` call,\n * execution continues to the next instruction only after each of the inner animation\n * steps have completed.\n *\n * @publicApi\n **/\nfunction sequence(steps, options = null) {\n return { type: 2 /* Sequence */, steps, options };\n}\n/**\n * Declares a key/value object containing CSS properties/styles that\n * can then be used for an animation `state`, within an animation `sequence`,\n * or as styling data for calls to `animate()` and `keyframes()`.\n *\n * @param tokens A set of CSS styles or HTML styles associated with an animation state.\n * The value can be any of the following:\n * - A key-value style pair associating a CSS property with a value.\n * - An array of key-value style pairs.\n * - An asterisk (*), to use auto-styling, where styles are derived from the element\n * being animated and applied to the animation when it starts.\n *\n * Auto-styling can be used to define a state that depends on layout or other\n * environmental factors.\n *\n * @return An object that encapsulates the style data.\n *\n * @usageNotes\n * The following examples create animation styles that collect a set of\n * CSS property values:\n *\n * ```typescript\n * // string values for CSS properties\n * style({ background: \"red\", color: \"blue\" })\n *\n * // numerical pixel values\n * style({ width: 100, height: 0 })\n * ```\n *\n * The following example uses auto-styling to allow a component to animate from\n * a height of 0 up to the height of the parent element:\n *\n * ```\n * style({ height: 0 }),\n * animate(\"1s\", style({ height: \"*\" }))\n * ```\n *\n * @publicApi\n **/\nfunction style(tokens) {\n return { type: 6 /* Style */, styles: tokens, offset: null };\n}\n/**\n * Declares an animation state within a trigger attached to an element.\n *\n * @param name One or more names for the defined state in a comma-separated string.\n * The following reserved state names can be supplied to define a style for specific use\n * cases:\n *\n * - `void` You can associate styles with this name to be used when\n * the element is detached from the application. For example, when an `ngIf` evaluates\n * to false, the state of the associated element is void.\n * - `*` (asterisk) Indicates the default state. You can associate styles with this name\n * to be used as the fallback when the state that is being animated is not declared\n * within the trigger.\n *\n * @param styles A set of CSS styles associated with this state, created using the\n * `style()` function.\n * This set of styles persists on the element once the state has been reached.\n * @param options Parameters that can be passed to the state when it is invoked.\n * 0 or more key-value pairs.\n * @return An object that encapsulates the new state data.\n *\n * @usageNotes\n * Use the `trigger()` function to register states to an animation trigger.\n * Use the `transition()` function to animate between states.\n * When a state is active within a component, its associated styles persist on the element,\n * even when the animation ends.\n *\n * @publicApi\n **/\nfunction state(name, styles, options) {\n return { type: 0 /* State */, name, styles, options };\n}\n/**\n * Defines a set of animation styles, associating each style with an optional `offset` value.\n *\n * @param steps A set of animation styles with optional offset data.\n * The optional `offset` value for a style specifies a percentage of the total animation\n * time at which that style is applied.\n * @returns An object that encapsulates the keyframes data.\n *\n * @usageNotes\n * Use with the `animate()` call. Instead of applying animations\n * from the current state\n * to the destination state, keyframes describe how each style entry is applied and at what point\n * within the animation arc.\n * Compare [CSS Keyframe Animations](https://www.w3schools.com/css/css3_animations.asp).\n *\n * ### Usage\n *\n * In the following example, the offset values describe\n * when each `backgroundColor` value is applied. The color is red at the start, and changes to\n * blue when 20% of the total time has elapsed.\n *\n * ```typescript\n * // the provided offset values\n * animate(\"5s\", keyframes([\n * style({ backgroundColor: \"red\", offset: 0 }),\n * style({ backgroundColor: \"blue\", offset: 0.2 }),\n * style({ backgroundColor: \"orange\", offset: 0.3 }),\n * style({ backgroundColor: \"black\", offset: 1 })\n * ]))\n * ```\n *\n * If there are no `offset` values specified in the style entries, the offsets\n * are calculated automatically.\n *\n * ```typescript\n * animate(\"5s\", keyframes([\n * style({ backgroundColor: \"red\" }) // offset = 0\n * style({ backgroundColor: \"blue\" }) // offset = 0.33\n * style({ backgroundColor: \"orange\" }) // offset = 0.66\n * style({ backgroundColor: \"black\" }) // offset = 1\n * ]))\n *```\n\n * @publicApi\n */\nfunction keyframes(steps) {\n return { type: 5 /* Keyframes */, steps };\n}\n/**\n * Declares an animation transition as a sequence of animation steps to run when a given\n * condition is satisfied. The condition is a Boolean expression or function that compares\n * the previous and current animation states, and returns true if this transition should occur.\n * When the state criteria of a defined transition are met, the associated animation is\n * triggered.\n *\n * @param stateChangeExpr A Boolean expression or function that compares the previous and current\n * animation states, and returns true if this transition should occur. Note that \"true\" and \"false\"\n * match 1 and 0, respectively. An expression is evaluated each time a state change occurs in the\n * animation trigger element.\n * The animation steps run when the expression evaluates to true.\n *\n * - A state-change string takes the form \"state1 => state2\", where each side is a defined animation\n * state, or an asterix (*) to refer to a dynamic start or end state.\n * - The expression string can contain multiple comma-separated statements;\n * for example \"state1 => state2, state3 => state4\".\n * - Special values `:enter` and `:leave` initiate a transition on the entry and exit states,\n * equivalent to \"void => *\" and \"* => void\".\n * - Special values `:increment` and `:decrement` initiate a transition when a numeric value has\n * increased or decreased in value.\n * - A function is executed each time a state change occurs in the animation trigger element.\n * The animation steps run when the function returns true.\n *\n * @param steps One or more animation objects, as returned by the `animate()` or\n * `sequence()` function, that form a transformation from one state to another.\n * A sequence is used by default when you pass an array.\n * @param options An options object that can contain a delay value for the start of the animation,\n * and additional developer-defined parameters. Provided values for additional parameters are used\n * as defaults, and override values can be passed to the caller on invocation.\n * @returns An object that encapsulates the transition data.\n *\n * @usageNotes\n * The template associated with a component binds an animation trigger to an element.\n *\n * ```HTML\n * \n *
...
\n * ```\n *\n * All transitions are defined within an animation trigger,\n * along with named states that the transitions change to and from.\n *\n * ```typescript\n * trigger(\"myAnimationTrigger\", [\n * // define states\n * state(\"on\", style({ background: \"green\" })),\n * state(\"off\", style({ background: \"grey\" })),\n * ...]\n * ```\n *\n * Note that when you call the `sequence()` function within a `{@link animations/group group()}`\n * or a `transition()` call, execution does not continue to the next instruction\n * until each of the inner animation steps have completed.\n *\n * ### Syntax examples\n *\n * The following examples define transitions between the two defined states (and default states),\n * using various options:\n *\n * ```typescript\n * // Transition occurs when the state value\n * // bound to \"myAnimationTrigger\" changes from \"on\" to \"off\"\n * transition(\"on => off\", animate(500))\n * // Run the same animation for both directions\n * transition(\"on <=> off\", animate(500))\n * // Define multiple state-change pairs separated by commas\n * transition(\"on => off, off => void\", animate(500))\n * ```\n *\n * ### Special values for state-change expressions\n *\n * - Catch-all state change for when an element is inserted into the page and the\n * destination state is unknown:\n *\n * ```typescript\n * transition(\"void => *\", [\n * style({ opacity: 0 }),\n * animate(500)\n * ])\n * ```\n *\n * - Capture a state change between any states:\n *\n * `transition(\"* => *\", animate(\"1s 0s\"))`\n *\n * - Entry and exit transitions:\n *\n * ```typescript\n * transition(\":enter\", [\n * style({ opacity: 0 }),\n * animate(500, style({ opacity: 1 }))\n * ]),\n * transition(\":leave\", [\n * animate(500, style({ opacity: 0 }))\n * ])\n * ```\n *\n * - Use `:increment` and `:decrement` to initiate transitions:\n *\n * ```typescript\n * transition(\":increment\", group([\n * query(':enter', [\n * style({ left: '100%' }),\n * animate('0.5s ease-out', style('*'))\n * ]),\n * query(':leave', [\n * animate('0.5s ease-out', style({ left: '-100%' }))\n * ])\n * ]))\n *\n * transition(\":decrement\", group([\n * query(':enter', [\n * style({ left: '100%' }),\n * animate('0.5s ease-out', style('*'))\n * ]),\n * query(':leave', [\n * animate('0.5s ease-out', style({ left: '-100%' }))\n * ])\n * ]))\n * ```\n *\n * ### State-change functions\n *\n * Here is an example of a `fromState` specified as a state-change function that invokes an\n * animation when true:\n *\n * ```typescript\n * transition((fromState, toState) =>\n * {\n * return fromState == \"off\" && toState == \"on\";\n * },\n * animate(\"1s 0s\"))\n * ```\n *\n * ### Animating to the final state\n *\n * If the final step in a transition is a call to `animate()` that uses a timing value\n * with no style data, that step is automatically considered the final animation arc,\n * for the element to reach the final state. Angular automatically adds or removes\n * CSS styles to ensure that the element is in the correct final state.\n *\n * The following example defines a transition that starts by hiding the element,\n * then makes sure that it animates properly to whatever state is currently active for trigger:\n *\n * ```typescript\n * transition(\"void => *\", [\n * style({ opacity: 0 }),\n * animate(500)\n * ])\n * ```\n * ### Boolean value matching\n * If a trigger binding value is a Boolean, it can be matched using a transition expression\n * that compares true and false or 1 and 0. For example:\n *\n * ```\n * // in the template\n *
...
\n * // in the component metadata\n * trigger('openClose', [\n * state('true', style({ height: '*' })),\n * state('false', style({ height: '0px' })),\n * transition('false <=> true', animate(500))\n * ])\n * ```\n *\n * @publicApi\n **/\nfunction transition(stateChangeExpr, steps, options = null) {\n return { type: 1 /* Transition */, expr: stateChangeExpr, animation: steps, options };\n}\n/**\n * Produces a reusable animation that can be invoked in another animation or sequence,\n * by calling the `useAnimation()` function.\n *\n * @param steps One or more animation objects, as returned by the `animate()`\n * or `sequence()` function, that form a transformation from one state to another.\n * A sequence is used by default when you pass an array.\n * @param options An options object that can contain a delay value for the start of the\n * animation, and additional developer-defined parameters.\n * Provided values for additional parameters are used as defaults,\n * and override values can be passed to the caller on invocation.\n * @returns An object that encapsulates the animation data.\n *\n * @usageNotes\n * The following example defines a reusable animation, providing some default parameter\n * values.\n *\n * ```typescript\n * var fadeAnimation = animation([\n * style({ opacity: '{{ start }}' }),\n * animate('{{ time }}',\n * style({ opacity: '{{ end }}'}))\n * ],\n * { params: { time: '1000ms', start: 0, end: 1 }});\n * ```\n *\n * The following invokes the defined animation with a call to `useAnimation()`,\n * passing in override parameter values.\n *\n * ```js\n * useAnimation(fadeAnimation, {\n * params: {\n * time: '2s',\n * start: 1,\n * end: 0\n * }\n * })\n * ```\n *\n * If any of the passed-in parameter values are missing from this call,\n * the default values are used. If one or more parameter values are missing before a step is\n * animated, `useAnimation()` throws an error.\n *\n * @publicApi\n */\nfunction animation(steps, options = null) {\n return { type: 8 /* Reference */, animation: steps, options };\n}\n/**\n * Executes a queried inner animation element within an animation sequence.\n *\n * @param options An options object that can contain a delay value for the start of the\n * animation, and additional override values for developer-defined parameters.\n * @return An object that encapsulates the child animation data.\n *\n * @usageNotes\n * Each time an animation is triggered in Angular, the parent animation\n * has priority and any child animations are blocked. In order\n * for a child animation to run, the parent animation must query each of the elements\n * containing child animations, and run them using this function.\n *\n * Note that this feature is designed to be used with `query()` and it will only work\n * with animations that are assigned using the Angular animation library. CSS keyframes\n * and transitions are not handled by this API.\n *\n * @publicApi\n */\nfunction animateChild(options = null) {\n return { type: 9 /* AnimateChild */, options };\n}\n/**\n * Starts a reusable animation that is created using the `animation()` function.\n *\n * @param animation The reusable animation to start.\n * @param options An options object that can contain a delay value for the start of\n * the animation, and additional override values for developer-defined parameters.\n * @return An object that contains the animation parameters.\n *\n * @publicApi\n */\nfunction useAnimation(animation, options = null) {\n return { type: 10 /* AnimateRef */, animation, options };\n}\n/**\n * Finds one or more inner elements within the current element that is\n * being animated within a sequence. Use with `animate()`.\n *\n * @param selector The element to query, or a set of elements that contain Angular-specific\n * characteristics, specified with one or more of the following tokens.\n * - `query(\":enter\")` or `query(\":leave\")` : Query for newly inserted/removed elements.\n * - `query(\":animating\")` : Query all currently animating elements.\n * - `query(\"@triggerName\")` : Query elements that contain an animation trigger.\n * - `query(\"@*\")` : Query all elements that contain an animation triggers.\n * - `query(\":self\")` : Include the current element into the animation sequence.\n *\n * @param animation One or more animation steps to apply to the queried element or elements.\n * An array is treated as an animation sequence.\n * @param options An options object. Use the 'limit' field to limit the total number of\n * items to collect.\n * @return An object that encapsulates the query data.\n *\n * @usageNotes\n * Tokens can be merged into a combined query selector string. For example:\n *\n * ```typescript\n * query(':self, .record:enter, .record:leave, @subTrigger', [...])\n * ```\n *\n * The `query()` function collects multiple elements and works internally by using\n * `element.querySelectorAll`. Use the `limit` field of an options object to limit\n * the total number of items to be collected. For example:\n *\n * ```js\n * query('div', [\n * animate(...),\n * animate(...)\n * ], { limit: 1 })\n * ```\n *\n * By default, throws an error when zero items are found. Set the\n * `optional` flag to ignore this error. For example:\n *\n * ```js\n * query('.some-element-that-may-not-be-there', [\n * animate(...),\n * animate(...)\n * ], { optional: true })\n * ```\n *\n * ### Usage Example\n *\n * The following example queries for inner elements and animates them\n * individually using `animate()`.\n *\n * ```typescript\n * @Component({\n * selector: 'inner',\n * template: `\n *
\n *

Title

\n *
\n * Blah blah blah\n *
\n *
\n * `,\n * animations: [\n * trigger('queryAnimation', [\n * transition('* => goAnimate', [\n * // hide the inner elements\n * query('h1', style({ opacity: 0 })),\n * query('.content', style({ opacity: 0 })),\n *\n * // animate the inner elements in, one by one\n * query('h1', animate(1000, style({ opacity: 1 }))),\n * query('.content', animate(1000, style({ opacity: 1 }))),\n * ])\n * ])\n * ]\n * })\n * class Cmp {\n * exp = '';\n *\n * goAnimate() {\n * this.exp = 'goAnimate';\n * }\n * }\n * ```\n *\n * @publicApi\n */\nfunction query(selector, animation, options = null) {\n return { type: 11 /* Query */, selector, animation, options };\n}\n/**\n * Use within an animation `query()` call to issue a timing gap after\n * each queried item is animated.\n *\n * @param timings A delay value.\n * @param animation One ore more animation steps.\n * @returns An object that encapsulates the stagger data.\n *\n * @usageNotes\n * In the following example, a container element wraps a list of items stamped out\n * by an `ngFor`. The container element contains an animation trigger that will later be set\n * to query for each of the inner items.\n *\n * Each time items are added, the opacity fade-in animation runs,\n * and each removed item is faded out.\n * When either of these animations occur, the stagger effect is\n * applied after each item's animation is started.\n *\n * ```html\n * \n * \n *
\n *
\n *
\n * {{ item }}\n *
\n *
\n * ```\n *\n * Here is the component code:\n *\n * ```typescript\n * import {trigger, transition, style, animate, query, stagger} from '@angular/animations';\n * @Component({\n * templateUrl: 'list.component.html',\n * animations: [\n * trigger('listAnimation', [\n * ...\n * ])\n * ]\n * })\n * class ListComponent {\n * items = [];\n *\n * showItems() {\n * this.items = [0,1,2,3,4];\n * }\n *\n * hideItems() {\n * this.items = [];\n * }\n *\n * toggle() {\n * this.items.length ? this.hideItems() : this.showItems();\n * }\n * }\n * ```\n *\n * Here is the animation trigger code:\n *\n * ```typescript\n * trigger('listAnimation', [\n * transition('* => *', [ // each time the binding value changes\n * query(':leave', [\n * stagger(100, [\n * animate('0.5s', style({ opacity: 0 }))\n * ])\n * ]),\n * query(':enter', [\n * style({ opacity: 0 }),\n * stagger(100, [\n * animate('0.5s', style({ opacity: 1 }))\n * ])\n * ])\n * ])\n * ])\n * ```\n *\n * @publicApi\n */\nfunction stagger(timings, animation) {\n return { type: 12 /* Stagger */, timings, animation };\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction scheduleMicroTask(cb) {\n Promise.resolve(null).then(cb);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * An empty programmatic controller for reusable animations.\n * Used internally when animations are disabled, to avoid\n * checking for the null case when an animation player is expected.\n *\n * @see `animate()`\n * @see `AnimationPlayer`\n * @see `GroupPlayer`\n *\n * @publicApi\n */\nclass NoopAnimationPlayer {\n constructor(duration = 0, delay = 0) {\n this._onDoneFns = [];\n this._onStartFns = [];\n this._onDestroyFns = [];\n this._started = false;\n this._destroyed = false;\n this._finished = false;\n this.parentPlayer = null;\n this.totalTime = duration + delay;\n }\n _onFinish() {\n if (!this._finished) {\n this._finished = true;\n this._onDoneFns.forEach(fn => fn());\n this._onDoneFns = [];\n }\n }\n onStart(fn) {\n this._onStartFns.push(fn);\n }\n onDone(fn) {\n this._onDoneFns.push(fn);\n }\n onDestroy(fn) {\n this._onDestroyFns.push(fn);\n }\n hasStarted() {\n return this._started;\n }\n init() { }\n play() {\n if (!this.hasStarted()) {\n this._onStart();\n this.triggerMicrotask();\n }\n this._started = true;\n }\n /** @internal */\n triggerMicrotask() {\n scheduleMicroTask(() => this._onFinish());\n }\n _onStart() {\n this._onStartFns.forEach(fn => fn());\n this._onStartFns = [];\n }\n pause() { }\n restart() { }\n finish() {\n this._onFinish();\n }\n destroy() {\n if (!this._destroyed) {\n this._destroyed = true;\n if (!this.hasStarted()) {\n this._onStart();\n }\n this.finish();\n this._onDestroyFns.forEach(fn => fn());\n this._onDestroyFns = [];\n }\n }\n reset() { }\n setPosition(position) { }\n getPosition() {\n return 0;\n }\n /** @internal */\n triggerCallback(phaseName) {\n const methods = phaseName == 'start' ? this._onStartFns : this._onDoneFns;\n methods.forEach(fn => fn());\n methods.length = 0;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A programmatic controller for a group of reusable animations.\n * Used internally to control animations.\n *\n * @see `AnimationPlayer`\n * @see `{@link animations/group group()}`\n *\n */\nclass AnimationGroupPlayer {\n constructor(_players) {\n this._onDoneFns = [];\n this._onStartFns = [];\n this._finished = false;\n this._started = false;\n this._destroyed = false;\n this._onDestroyFns = [];\n this.parentPlayer = null;\n this.totalTime = 0;\n this.players = _players;\n let doneCount = 0;\n let destroyCount = 0;\n let startCount = 0;\n const total = this.players.length;\n if (total == 0) {\n scheduleMicroTask(() => this._onFinish());\n }\n else {\n this.players.forEach(player => {\n player.onDone(() => {\n if (++doneCount == total) {\n this._onFinish();\n }\n });\n player.onDestroy(() => {\n if (++destroyCount == total) {\n this._onDestroy();\n }\n });\n player.onStart(() => {\n if (++startCount == total) {\n this._onStart();\n }\n });\n });\n }\n this.totalTime = this.players.reduce((time, player) => Math.max(time, player.totalTime), 0);\n }\n _onFinish() {\n if (!this._finished) {\n this._finished = true;\n this._onDoneFns.forEach(fn => fn());\n this._onDoneFns = [];\n }\n }\n init() {\n this.players.forEach(player => player.init());\n }\n onStart(fn) {\n this._onStartFns.push(fn);\n }\n _onStart() {\n if (!this.hasStarted()) {\n this._started = true;\n this._onStartFns.forEach(fn => fn());\n this._onStartFns = [];\n }\n }\n onDone(fn) {\n this._onDoneFns.push(fn);\n }\n onDestroy(fn) {\n this._onDestroyFns.push(fn);\n }\n hasStarted() {\n return this._started;\n }\n play() {\n if (!this.parentPlayer) {\n this.init();\n }\n this._onStart();\n this.players.forEach(player => player.play());\n }\n pause() {\n this.players.forEach(player => player.pause());\n }\n restart() {\n this.players.forEach(player => player.restart());\n }\n finish() {\n this._onFinish();\n this.players.forEach(player => player.finish());\n }\n destroy() {\n this._onDestroy();\n }\n _onDestroy() {\n if (!this._destroyed) {\n this._destroyed = true;\n this._onFinish();\n this.players.forEach(player => player.destroy());\n this._onDestroyFns.forEach(fn => fn());\n this._onDestroyFns = [];\n }\n }\n reset() {\n this.players.forEach(player => player.reset());\n this._destroyed = false;\n this._finished = false;\n this._started = false;\n }\n setPosition(p) {\n const timeAtPosition = p * this.totalTime;\n this.players.forEach(player => {\n const position = player.totalTime ? Math.min(1, timeAtPosition / player.totalTime) : 1;\n player.setPosition(position);\n });\n }\n getPosition() {\n let min = 0;\n this.players.forEach(player => {\n const p = player.getPosition();\n min = Math.min(p, min);\n });\n return min;\n }\n beforeDestroy() {\n this.players.forEach(player => {\n if (player.beforeDestroy) {\n player.beforeDestroy();\n }\n });\n }\n /** @internal */\n triggerCallback(phaseName) {\n const methods = phaseName == 'start' ? this._onStartFns : this._onDoneFns;\n methods.forEach(fn => fn());\n methods.length = 0;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst ɵPRE_STYLE = '!';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { AUTO_STYLE, AnimationBuilder, AnimationFactory, NoopAnimationPlayer, animate, animateChild, animation, group, keyframes, query, sequence, stagger, state, style, transition, trigger, useAnimation, AnimationGroupPlayer as ɵAnimationGroupPlayer, ɵPRE_STYLE };\n\n//# sourceMappingURL=animations.js.map","/**\n * @license Angular v10.0.7\n * (c) 2010-2020 Google LLC. https://angular.io/\n * License: MIT\n */\n\nimport { ɵAnimationGroupPlayer, NoopAnimationPlayer, AUTO_STYLE, ɵPRE_STYLE, sequence, style } from '@angular/animations';\nimport { Injectable } from '@angular/core';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nimport * as ɵngcc0 from '@angular/core';\nfunction isBrowser() {\n return (typeof window !== 'undefined' && typeof window.document !== 'undefined');\n}\nfunction isNode() {\n // Checking only for `process` isn't enough to identify whether or not we're in a Node\n // environment, because Webpack by default will polyfill the `process`. While we can discern\n // that Webpack polyfilled it by looking at `process.browser`, it's very Webpack-specific and\n // might not be future-proof. Instead we look at the stringified version of `process` which\n // is `[object process]` in Node and `[object Object]` when polyfilled.\n return typeof process !== 'undefined' && {}.toString.call(process) === '[object process]';\n}\nfunction optimizeGroupPlayer(players) {\n switch (players.length) {\n case 0:\n return new NoopAnimationPlayer();\n case 1:\n return players[0];\n default:\n return new ɵAnimationGroupPlayer(players);\n }\n}\nfunction normalizeKeyframes(driver, normalizer, element, keyframes, preStyles = {}, postStyles = {}) {\n const errors = [];\n const normalizedKeyframes = [];\n let previousOffset = -1;\n let previousKeyframe = null;\n keyframes.forEach(kf => {\n const offset = kf['offset'];\n const isSameOffset = offset == previousOffset;\n const normalizedKeyframe = (isSameOffset && previousKeyframe) || {};\n Object.keys(kf).forEach(prop => {\n let normalizedProp = prop;\n let normalizedValue = kf[prop];\n if (prop !== 'offset') {\n normalizedProp = normalizer.normalizePropertyName(normalizedProp, errors);\n switch (normalizedValue) {\n case ɵPRE_STYLE:\n normalizedValue = preStyles[prop];\n break;\n case AUTO_STYLE:\n normalizedValue = postStyles[prop];\n break;\n default:\n normalizedValue =\n normalizer.normalizeStyleValue(prop, normalizedProp, normalizedValue, errors);\n break;\n }\n }\n normalizedKeyframe[normalizedProp] = normalizedValue;\n });\n if (!isSameOffset) {\n normalizedKeyframes.push(normalizedKeyframe);\n }\n previousKeyframe = normalizedKeyframe;\n previousOffset = offset;\n });\n if (errors.length) {\n const LINE_START = '\\n - ';\n throw new Error(`Unable to animate due to the following errors:${LINE_START}${errors.join(LINE_START)}`);\n }\n return normalizedKeyframes;\n}\nfunction listenOnPlayer(player, eventName, event, callback) {\n switch (eventName) {\n case 'start':\n player.onStart(() => callback(event && copyAnimationEvent(event, 'start', player)));\n break;\n case 'done':\n player.onDone(() => callback(event && copyAnimationEvent(event, 'done', player)));\n break;\n case 'destroy':\n player.onDestroy(() => callback(event && copyAnimationEvent(event, 'destroy', player)));\n break;\n }\n}\nfunction copyAnimationEvent(e, phaseName, player) {\n const totalTime = player.totalTime;\n const disabled = player.disabled ? true : false;\n const event = makeAnimationEvent(e.element, e.triggerName, e.fromState, e.toState, phaseName || e.phaseName, totalTime == undefined ? e.totalTime : totalTime, disabled);\n const data = e['_data'];\n if (data != null) {\n event['_data'] = data;\n }\n return event;\n}\nfunction makeAnimationEvent(element, triggerName, fromState, toState, phaseName = '', totalTime = 0, disabled) {\n return { element, triggerName, fromState, toState, phaseName, totalTime, disabled: !!disabled };\n}\nfunction getOrSetAsInMap(map, key, defaultValue) {\n let value;\n if (map instanceof Map) {\n value = map.get(key);\n if (!value) {\n map.set(key, value = defaultValue);\n }\n }\n else {\n value = map[key];\n if (!value) {\n value = map[key] = defaultValue;\n }\n }\n return value;\n}\nfunction parseTimelineCommand(command) {\n const separatorPos = command.indexOf(':');\n const id = command.substring(1, separatorPos);\n const action = command.substr(separatorPos + 1);\n return [id, action];\n}\nlet _contains = (elm1, elm2) => false;\nconst ɵ0 = _contains;\nlet _matches = (element, selector) => false;\nconst ɵ1 = _matches;\nlet _query = (element, selector, multi) => {\n return [];\n};\nconst ɵ2 = _query;\n// Define utility methods for browsers and platform-server(domino) where Element\n// and utility methods exist.\nconst _isNode = isNode();\nif (_isNode || typeof Element !== 'undefined') {\n // this is well supported in all browsers\n _contains = (elm1, elm2) => {\n return elm1.contains(elm2);\n };\n _matches = (() => {\n if (_isNode || Element.prototype.matches) {\n return (element, selector) => element.matches(selector);\n }\n else {\n const proto = Element.prototype;\n const fn = proto.matchesSelector || proto.mozMatchesSelector || proto.msMatchesSelector ||\n proto.oMatchesSelector || proto.webkitMatchesSelector;\n if (fn) {\n return (element, selector) => fn.apply(element, [selector]);\n }\n else {\n return _matches;\n }\n }\n })();\n _query = (element, selector, multi) => {\n let results = [];\n if (multi) {\n results.push(...element.querySelectorAll(selector));\n }\n else {\n const elm = element.querySelector(selector);\n if (elm) {\n results.push(elm);\n }\n }\n return results;\n };\n}\nfunction containsVendorPrefix(prop) {\n // Webkit is the only real popular vendor prefix nowadays\n // cc: http://shouldiprefix.com/\n return prop.substring(1, 6) == 'ebkit'; // webkit or Webkit\n}\nlet _CACHED_BODY = null;\nlet _IS_WEBKIT = false;\nfunction validateStyleProperty(prop) {\n if (!_CACHED_BODY) {\n _CACHED_BODY = getBodyNode() || {};\n _IS_WEBKIT = _CACHED_BODY.style ? ('WebkitAppearance' in _CACHED_BODY.style) : false;\n }\n let result = true;\n if (_CACHED_BODY.style && !containsVendorPrefix(prop)) {\n result = prop in _CACHED_BODY.style;\n if (!result && _IS_WEBKIT) {\n const camelProp = 'Webkit' + prop.charAt(0).toUpperCase() + prop.substr(1);\n result = camelProp in _CACHED_BODY.style;\n }\n }\n return result;\n}\nfunction getBodyNode() {\n if (typeof document != 'undefined') {\n return document.body;\n }\n return null;\n}\nconst matchesElement = _matches;\nconst containsElement = _contains;\nconst invokeQuery = _query;\nfunction hypenatePropsObject(object) {\n const newObj = {};\n Object.keys(object).forEach(prop => {\n const newProp = prop.replace(/([a-z])([A-Z])/g, '$1-$2');\n newObj[newProp] = object[prop];\n });\n return newObj;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @publicApi\n */\nclass NoopAnimationDriver {\n validateStyleProperty(prop) {\n return validateStyleProperty(prop);\n }\n matchesElement(element, selector) {\n return matchesElement(element, selector);\n }\n containsElement(elm1, elm2) {\n return containsElement(elm1, elm2);\n }\n query(element, selector, multi) {\n return invokeQuery(element, selector, multi);\n }\n computeStyle(element, prop, defaultValue) {\n return defaultValue || '';\n }\n animate(element, keyframes, duration, delay, easing, previousPlayers = [], scrubberAccessRequested) {\n return new NoopAnimationPlayer(duration, delay);\n }\n}\nNoopAnimationDriver.ɵfac = function NoopAnimationDriver_Factory(t) { return new (t || NoopAnimationDriver)(); };\nNoopAnimationDriver.ɵprov = ɵngcc0.ɵɵdefineInjectable({ token: NoopAnimationDriver, factory: NoopAnimationDriver.ɵfac });\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(NoopAnimationDriver, [{\n type: Injectable\n }], null, null); })();\n/**\n * @publicApi\n */\nclass AnimationDriver {\n}\nAnimationDriver.NOOP = new NoopAnimationDriver();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst ONE_SECOND = 1000;\nconst SUBSTITUTION_EXPR_START = '{{';\nconst SUBSTITUTION_EXPR_END = '}}';\nconst ENTER_CLASSNAME = 'ng-enter';\nconst LEAVE_CLASSNAME = 'ng-leave';\nconst ENTER_SELECTOR = '.ng-enter';\nconst LEAVE_SELECTOR = '.ng-leave';\nconst NG_TRIGGER_CLASSNAME = 'ng-trigger';\nconst NG_TRIGGER_SELECTOR = '.ng-trigger';\nconst NG_ANIMATING_CLASSNAME = 'ng-animating';\nconst NG_ANIMATING_SELECTOR = '.ng-animating';\nfunction resolveTimingValue(value) {\n if (typeof value == 'number')\n return value;\n const matches = value.match(/^(-?[\\.\\d]+)(m?s)/);\n if (!matches || matches.length < 2)\n return 0;\n return _convertTimeValueToMS(parseFloat(matches[1]), matches[2]);\n}\nfunction _convertTimeValueToMS(value, unit) {\n switch (unit) {\n case 's':\n return value * ONE_SECOND;\n default: // ms or something else\n return value;\n }\n}\nfunction resolveTiming(timings, errors, allowNegativeValues) {\n return timings.hasOwnProperty('duration') ?\n timings :\n parseTimeExpression(timings, errors, allowNegativeValues);\n}\nfunction parseTimeExpression(exp, errors, allowNegativeValues) {\n const regex = /^(-?[\\.\\d]+)(m?s)(?:\\s+(-?[\\.\\d]+)(m?s))?(?:\\s+([-a-z]+(?:\\(.+?\\))?))?$/i;\n let duration;\n let delay = 0;\n let easing = '';\n if (typeof exp === 'string') {\n const matches = exp.match(regex);\n if (matches === null) {\n errors.push(`The provided timing value \"${exp}\" is invalid.`);\n return { duration: 0, delay: 0, easing: '' };\n }\n duration = _convertTimeValueToMS(parseFloat(matches[1]), matches[2]);\n const delayMatch = matches[3];\n if (delayMatch != null) {\n delay = _convertTimeValueToMS(parseFloat(delayMatch), matches[4]);\n }\n const easingVal = matches[5];\n if (easingVal) {\n easing = easingVal;\n }\n }\n else {\n duration = exp;\n }\n if (!allowNegativeValues) {\n let containsErrors = false;\n let startIndex = errors.length;\n if (duration < 0) {\n errors.push(`Duration values below 0 are not allowed for this animation step.`);\n containsErrors = true;\n }\n if (delay < 0) {\n errors.push(`Delay values below 0 are not allowed for this animation step.`);\n containsErrors = true;\n }\n if (containsErrors) {\n errors.splice(startIndex, 0, `The provided timing value \"${exp}\" is invalid.`);\n }\n }\n return { duration, delay, easing };\n}\nfunction copyObj(obj, destination = {}) {\n Object.keys(obj).forEach(prop => {\n destination[prop] = obj[prop];\n });\n return destination;\n}\nfunction normalizeStyles(styles) {\n const normalizedStyles = {};\n if (Array.isArray(styles)) {\n styles.forEach(data => copyStyles(data, false, normalizedStyles));\n }\n else {\n copyStyles(styles, false, normalizedStyles);\n }\n return normalizedStyles;\n}\nfunction copyStyles(styles, readPrototype, destination = {}) {\n if (readPrototype) {\n // we make use of a for-in loop so that the\n // prototypically inherited properties are\n // revealed from the backFill map\n for (let prop in styles) {\n destination[prop] = styles[prop];\n }\n }\n else {\n copyObj(styles, destination);\n }\n return destination;\n}\nfunction getStyleAttributeString(element, key, value) {\n // Return the key-value pair string to be added to the style attribute for the\n // given CSS style key.\n if (value) {\n return key + ':' + value + ';';\n }\n else {\n return '';\n }\n}\nfunction writeStyleAttribute(element) {\n // Read the style property of the element and manually reflect it to the\n // style attribute. This is needed because Domino on platform-server doesn't\n // understand the full set of allowed CSS properties and doesn't reflect some\n // of them automatically.\n let styleAttrValue = '';\n for (let i = 0; i < element.style.length; i++) {\n const key = element.style.item(i);\n styleAttrValue += getStyleAttributeString(element, key, element.style.getPropertyValue(key));\n }\n for (const key in element.style) {\n // Skip internal Domino properties that don't need to be reflected.\n if (!element.style.hasOwnProperty(key) || key.startsWith('_')) {\n continue;\n }\n const dashKey = camelCaseToDashCase(key);\n styleAttrValue += getStyleAttributeString(element, dashKey, element.style[key]);\n }\n element.setAttribute('style', styleAttrValue);\n}\nfunction setStyles(element, styles, formerStyles) {\n if (element['style']) {\n Object.keys(styles).forEach(prop => {\n const camelProp = dashCaseToCamelCase(prop);\n if (formerStyles && !formerStyles.hasOwnProperty(prop)) {\n formerStyles[prop] = element.style[camelProp];\n }\n element.style[camelProp] = styles[prop];\n });\n // On the server set the 'style' attribute since it's not automatically reflected.\n if (isNode()) {\n writeStyleAttribute(element);\n }\n }\n}\nfunction eraseStyles(element, styles) {\n if (element['style']) {\n Object.keys(styles).forEach(prop => {\n const camelProp = dashCaseToCamelCase(prop);\n element.style[camelProp] = '';\n });\n // On the server set the 'style' attribute since it's not automatically reflected.\n if (isNode()) {\n writeStyleAttribute(element);\n }\n }\n}\nfunction normalizeAnimationEntry(steps) {\n if (Array.isArray(steps)) {\n if (steps.length == 1)\n return steps[0];\n return sequence(steps);\n }\n return steps;\n}\nfunction validateStyleParams(value, options, errors) {\n const params = options.params || {};\n const matches = extractStyleParams(value);\n if (matches.length) {\n matches.forEach(varName => {\n if (!params.hasOwnProperty(varName)) {\n errors.push(`Unable to resolve the local animation param ${varName} in the given list of values`);\n }\n });\n }\n}\nconst PARAM_REGEX = new RegExp(`${SUBSTITUTION_EXPR_START}\\\\s*(.+?)\\\\s*${SUBSTITUTION_EXPR_END}`, 'g');\nfunction extractStyleParams(value) {\n let params = [];\n if (typeof value === 'string') {\n let match;\n while (match = PARAM_REGEX.exec(value)) {\n params.push(match[1]);\n }\n PARAM_REGEX.lastIndex = 0;\n }\n return params;\n}\nfunction interpolateParams(value, params, errors) {\n const original = value.toString();\n const str = original.replace(PARAM_REGEX, (_, varName) => {\n let localVal = params[varName];\n // this means that the value was never overridden by the data passed in by the user\n if (!params.hasOwnProperty(varName)) {\n errors.push(`Please provide a value for the animation param ${varName}`);\n localVal = '';\n }\n return localVal.toString();\n });\n // we do this to assert that numeric values stay as they are\n return str == original ? value : str;\n}\nfunction iteratorToArray(iterator) {\n const arr = [];\n let item = iterator.next();\n while (!item.done) {\n arr.push(item.value);\n item = iterator.next();\n }\n return arr;\n}\nfunction mergeAnimationOptions(source, destination) {\n if (source.params) {\n const p0 = source.params;\n if (!destination.params) {\n destination.params = {};\n }\n const p1 = destination.params;\n Object.keys(p0).forEach(param => {\n if (!p1.hasOwnProperty(param)) {\n p1[param] = p0[param];\n }\n });\n }\n return destination;\n}\nconst DASH_CASE_REGEXP = /-+([a-z0-9])/g;\nfunction dashCaseToCamelCase(input) {\n return input.replace(DASH_CASE_REGEXP, (...m) => m[1].toUpperCase());\n}\nfunction camelCaseToDashCase(input) {\n return input.replace(/([a-z])([A-Z])/g, '$1-$2').toLowerCase();\n}\nfunction allowPreviousPlayerStylesMerge(duration, delay) {\n return duration === 0 || delay === 0;\n}\nfunction balancePreviousStylesIntoKeyframes(element, keyframes, previousStyles) {\n const previousStyleProps = Object.keys(previousStyles);\n if (previousStyleProps.length && keyframes.length) {\n let startingKeyframe = keyframes[0];\n let missingStyleProps = [];\n previousStyleProps.forEach(prop => {\n if (!startingKeyframe.hasOwnProperty(prop)) {\n missingStyleProps.push(prop);\n }\n startingKeyframe[prop] = previousStyles[prop];\n });\n if (missingStyleProps.length) {\n // tslint:disable-next-line\n for (var i = 1; i < keyframes.length; i++) {\n let kf = keyframes[i];\n missingStyleProps.forEach(function (prop) {\n kf[prop] = computeStyle(element, prop);\n });\n }\n }\n }\n return keyframes;\n}\nfunction visitDslNode(visitor, node, context) {\n switch (node.type) {\n case 7 /* Trigger */:\n return visitor.visitTrigger(node, context);\n case 0 /* State */:\n return visitor.visitState(node, context);\n case 1 /* Transition */:\n return visitor.visitTransition(node, context);\n case 2 /* Sequence */:\n return visitor.visitSequence(node, context);\n case 3 /* Group */:\n return visitor.visitGroup(node, context);\n case 4 /* Animate */:\n return visitor.visitAnimate(node, context);\n case 5 /* Keyframes */:\n return visitor.visitKeyframes(node, context);\n case 6 /* Style */:\n return visitor.visitStyle(node, context);\n case 8 /* Reference */:\n return visitor.visitReference(node, context);\n case 9 /* AnimateChild */:\n return visitor.visitAnimateChild(node, context);\n case 10 /* AnimateRef */:\n return visitor.visitAnimateRef(node, context);\n case 11 /* Query */:\n return visitor.visitQuery(node, context);\n case 12 /* Stagger */:\n return visitor.visitStagger(node, context);\n default:\n throw new Error(`Unable to resolve animation metadata node #${node.type}`);\n }\n}\nfunction computeStyle(element, prop) {\n return window.getComputedStyle(element)[prop];\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst ANY_STATE = '*';\nfunction parseTransitionExpr(transitionValue, errors) {\n const expressions = [];\n if (typeof transitionValue == 'string') {\n transitionValue.split(/\\s*,\\s*/).forEach(str => parseInnerTransitionStr(str, expressions, errors));\n }\n else {\n expressions.push(transitionValue);\n }\n return expressions;\n}\nfunction parseInnerTransitionStr(eventStr, expressions, errors) {\n if (eventStr[0] == ':') {\n const result = parseAnimationAlias(eventStr, errors);\n if (typeof result == 'function') {\n expressions.push(result);\n return;\n }\n eventStr = result;\n }\n const match = eventStr.match(/^(\\*|[-\\w]+)\\s*()\\s*(\\*|[-\\w]+)$/);\n if (match == null || match.length < 4) {\n errors.push(`The provided transition expression \"${eventStr}\" is not supported`);\n return expressions;\n }\n const fromState = match[1];\n const separator = match[2];\n const toState = match[3];\n expressions.push(makeLambdaFromStates(fromState, toState));\n const isFullAnyStateExpr = fromState == ANY_STATE && toState == ANY_STATE;\n if (separator[0] == '<' && !isFullAnyStateExpr) {\n expressions.push(makeLambdaFromStates(toState, fromState));\n }\n}\nfunction parseAnimationAlias(alias, errors) {\n switch (alias) {\n case ':enter':\n return 'void => *';\n case ':leave':\n return '* => void';\n case ':increment':\n return (fromState, toState) => parseFloat(toState) > parseFloat(fromState);\n case ':decrement':\n return (fromState, toState) => parseFloat(toState) < parseFloat(fromState);\n default:\n errors.push(`The transition alias value \"${alias}\" is not supported`);\n return '* => *';\n }\n}\n// DO NOT REFACTOR ... keep the follow set instantiations\n// with the values intact (closure compiler for some reason\n// removes follow-up lines that add the values outside of\n// the constructor...\nconst TRUE_BOOLEAN_VALUES = new Set(['true', '1']);\nconst FALSE_BOOLEAN_VALUES = new Set(['false', '0']);\nfunction makeLambdaFromStates(lhs, rhs) {\n const LHS_MATCH_BOOLEAN = TRUE_BOOLEAN_VALUES.has(lhs) || FALSE_BOOLEAN_VALUES.has(lhs);\n const RHS_MATCH_BOOLEAN = TRUE_BOOLEAN_VALUES.has(rhs) || FALSE_BOOLEAN_VALUES.has(rhs);\n return (fromState, toState) => {\n let lhsMatch = lhs == ANY_STATE || lhs == fromState;\n let rhsMatch = rhs == ANY_STATE || rhs == toState;\n if (!lhsMatch && LHS_MATCH_BOOLEAN && typeof fromState === 'boolean') {\n lhsMatch = fromState ? TRUE_BOOLEAN_VALUES.has(lhs) : FALSE_BOOLEAN_VALUES.has(lhs);\n }\n if (!rhsMatch && RHS_MATCH_BOOLEAN && typeof toState === 'boolean') {\n rhsMatch = toState ? TRUE_BOOLEAN_VALUES.has(rhs) : FALSE_BOOLEAN_VALUES.has(rhs);\n }\n return lhsMatch && rhsMatch;\n };\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst SELF_TOKEN = ':self';\nconst SELF_TOKEN_REGEX = new RegExp(`\\s*${SELF_TOKEN}\\s*,?`, 'g');\n/*\n * [Validation]\n * The visitor code below will traverse the animation AST generated by the animation verb functions\n * (the output is a tree of objects) and attempt to perform a series of validations on the data. The\n * following corner-cases will be validated:\n *\n * 1. Overlap of animations\n * Given that a CSS property cannot be animated in more than one place at the same time, it's\n * important that this behavior is detected and validated. The way in which this occurs is that\n * each time a style property is examined, a string-map containing the property will be updated with\n * the start and end times for when the property is used within an animation step.\n *\n * If there are two or more parallel animations that are currently running (these are invoked by the\n * group()) on the same element then the validator will throw an error. Since the start/end timing\n * values are collected for each property then if the current animation step is animating the same\n * property and its timing values fall anywhere into the window of time that the property is\n * currently being animated within then this is what causes an error.\n *\n * 2. Timing values\n * The validator will validate to see if a timing value of `duration delay easing` or\n * `durationNumber` is valid or not.\n *\n * (note that upon validation the code below will replace the timing data with an object containing\n * {duration,delay,easing}.\n *\n * 3. Offset Validation\n * Each of the style() calls are allowed to have an offset value when placed inside of keyframes().\n * Offsets within keyframes() are considered valid when:\n *\n * - No offsets are used at all\n * - Each style() entry contains an offset value\n * - Each offset is between 0 and 1\n * - Each offset is greater to or equal than the previous one\n *\n * Otherwise an error will be thrown.\n */\nfunction buildAnimationAst(driver, metadata, errors) {\n return new AnimationAstBuilderVisitor(driver).build(metadata, errors);\n}\nconst ROOT_SELECTOR = '';\nclass AnimationAstBuilderVisitor {\n constructor(_driver) {\n this._driver = _driver;\n }\n build(metadata, errors) {\n const context = new AnimationAstBuilderContext(errors);\n this._resetContextStyleTimingState(context);\n return visitDslNode(this, normalizeAnimationEntry(metadata), context);\n }\n _resetContextStyleTimingState(context) {\n context.currentQuerySelector = ROOT_SELECTOR;\n context.collectedStyles = {};\n context.collectedStyles[ROOT_SELECTOR] = {};\n context.currentTime = 0;\n }\n visitTrigger(metadata, context) {\n let queryCount = context.queryCount = 0;\n let depCount = context.depCount = 0;\n const states = [];\n const transitions = [];\n if (metadata.name.charAt(0) == '@') {\n context.errors.push('animation triggers cannot be prefixed with an `@` sign (e.g. trigger(\\'@foo\\', [...]))');\n }\n metadata.definitions.forEach(def => {\n this._resetContextStyleTimingState(context);\n if (def.type == 0 /* State */) {\n const stateDef = def;\n const name = stateDef.name;\n name.toString().split(/\\s*,\\s*/).forEach(n => {\n stateDef.name = n;\n states.push(this.visitState(stateDef, context));\n });\n stateDef.name = name;\n }\n else if (def.type == 1 /* Transition */) {\n const transition = this.visitTransition(def, context);\n queryCount += transition.queryCount;\n depCount += transition.depCount;\n transitions.push(transition);\n }\n else {\n context.errors.push('only state() and transition() definitions can sit inside of a trigger()');\n }\n });\n return {\n type: 7 /* Trigger */,\n name: metadata.name,\n states,\n transitions,\n queryCount,\n depCount,\n options: null\n };\n }\n visitState(metadata, context) {\n const styleAst = this.visitStyle(metadata.styles, context);\n const astParams = (metadata.options && metadata.options.params) || null;\n if (styleAst.containsDynamicStyles) {\n const missingSubs = new Set();\n const params = astParams || {};\n styleAst.styles.forEach(value => {\n if (isObject(value)) {\n const stylesObj = value;\n Object.keys(stylesObj).forEach(prop => {\n extractStyleParams(stylesObj[prop]).forEach(sub => {\n if (!params.hasOwnProperty(sub)) {\n missingSubs.add(sub);\n }\n });\n });\n }\n });\n if (missingSubs.size) {\n const missingSubsArr = iteratorToArray(missingSubs.values());\n context.errors.push(`state(\"${metadata\n .name}\", ...) must define default values for all the following style substitutions: ${missingSubsArr.join(', ')}`);\n }\n }\n return {\n type: 0 /* State */,\n name: metadata.name,\n style: styleAst,\n options: astParams ? { params: astParams } : null\n };\n }\n visitTransition(metadata, context) {\n context.queryCount = 0;\n context.depCount = 0;\n const animation = visitDslNode(this, normalizeAnimationEntry(metadata.animation), context);\n const matchers = parseTransitionExpr(metadata.expr, context.errors);\n return {\n type: 1 /* Transition */,\n matchers,\n animation,\n queryCount: context.queryCount,\n depCount: context.depCount,\n options: normalizeAnimationOptions(metadata.options)\n };\n }\n visitSequence(metadata, context) {\n return {\n type: 2 /* Sequence */,\n steps: metadata.steps.map(s => visitDslNode(this, s, context)),\n options: normalizeAnimationOptions(metadata.options)\n };\n }\n visitGroup(metadata, context) {\n const currentTime = context.currentTime;\n let furthestTime = 0;\n const steps = metadata.steps.map(step => {\n context.currentTime = currentTime;\n const innerAst = visitDslNode(this, step, context);\n furthestTime = Math.max(furthestTime, context.currentTime);\n return innerAst;\n });\n context.currentTime = furthestTime;\n return {\n type: 3 /* Group */,\n steps,\n options: normalizeAnimationOptions(metadata.options)\n };\n }\n visitAnimate(metadata, context) {\n const timingAst = constructTimingAst(metadata.timings, context.errors);\n context.currentAnimateTimings = timingAst;\n let styleAst;\n let styleMetadata = metadata.styles ? metadata.styles : style({});\n if (styleMetadata.type == 5 /* Keyframes */) {\n styleAst = this.visitKeyframes(styleMetadata, context);\n }\n else {\n let styleMetadata = metadata.styles;\n let isEmpty = false;\n if (!styleMetadata) {\n isEmpty = true;\n const newStyleData = {};\n if (timingAst.easing) {\n newStyleData['easing'] = timingAst.easing;\n }\n styleMetadata = style(newStyleData);\n }\n context.currentTime += timingAst.duration + timingAst.delay;\n const _styleAst = this.visitStyle(styleMetadata, context);\n _styleAst.isEmptyStep = isEmpty;\n styleAst = _styleAst;\n }\n context.currentAnimateTimings = null;\n return {\n type: 4 /* Animate */,\n timings: timingAst,\n style: styleAst,\n options: null\n };\n }\n visitStyle(metadata, context) {\n const ast = this._makeStyleAst(metadata, context);\n this._validateStyleAst(ast, context);\n return ast;\n }\n _makeStyleAst(metadata, context) {\n const styles = [];\n if (Array.isArray(metadata.styles)) {\n metadata.styles.forEach(styleTuple => {\n if (typeof styleTuple == 'string') {\n if (styleTuple == AUTO_STYLE) {\n styles.push(styleTuple);\n }\n else {\n context.errors.push(`The provided style string value ${styleTuple} is not allowed.`);\n }\n }\n else {\n styles.push(styleTuple);\n }\n });\n }\n else {\n styles.push(metadata.styles);\n }\n let containsDynamicStyles = false;\n let collectedEasing = null;\n styles.forEach(styleData => {\n if (isObject(styleData)) {\n const styleMap = styleData;\n const easing = styleMap['easing'];\n if (easing) {\n collectedEasing = easing;\n delete styleMap['easing'];\n }\n if (!containsDynamicStyles) {\n for (let prop in styleMap) {\n const value = styleMap[prop];\n if (value.toString().indexOf(SUBSTITUTION_EXPR_START) >= 0) {\n containsDynamicStyles = true;\n break;\n }\n }\n }\n }\n });\n return {\n type: 6 /* Style */,\n styles,\n easing: collectedEasing,\n offset: metadata.offset,\n containsDynamicStyles,\n options: null\n };\n }\n _validateStyleAst(ast, context) {\n const timings = context.currentAnimateTimings;\n let endTime = context.currentTime;\n let startTime = context.currentTime;\n if (timings && startTime > 0) {\n startTime -= timings.duration + timings.delay;\n }\n ast.styles.forEach(tuple => {\n if (typeof tuple == 'string')\n return;\n Object.keys(tuple).forEach(prop => {\n if (!this._driver.validateStyleProperty(prop)) {\n context.errors.push(`The provided animation property \"${prop}\" is not a supported CSS property for animations`);\n return;\n }\n const collectedStyles = context.collectedStyles[context.currentQuerySelector];\n const collectedEntry = collectedStyles[prop];\n let updateCollectedStyle = true;\n if (collectedEntry) {\n if (startTime != endTime && startTime >= collectedEntry.startTime &&\n endTime <= collectedEntry.endTime) {\n context.errors.push(`The CSS property \"${prop}\" that exists between the times of \"${collectedEntry.startTime}ms\" and \"${collectedEntry\n .endTime}ms\" is also being animated in a parallel animation between the times of \"${startTime}ms\" and \"${endTime}ms\"`);\n updateCollectedStyle = false;\n }\n // we always choose the smaller start time value since we\n // want to have a record of the entire animation window where\n // the style property is being animated in between\n startTime = collectedEntry.startTime;\n }\n if (updateCollectedStyle) {\n collectedStyles[prop] = { startTime, endTime };\n }\n if (context.options) {\n validateStyleParams(tuple[prop], context.options, context.errors);\n }\n });\n });\n }\n visitKeyframes(metadata, context) {\n const ast = { type: 5 /* Keyframes */, styles: [], options: null };\n if (!context.currentAnimateTimings) {\n context.errors.push(`keyframes() must be placed inside of a call to animate()`);\n return ast;\n }\n const MAX_KEYFRAME_OFFSET = 1;\n let totalKeyframesWithOffsets = 0;\n const offsets = [];\n let offsetsOutOfOrder = false;\n let keyframesOutOfRange = false;\n let previousOffset = 0;\n const keyframes = metadata.steps.map(styles => {\n const style = this._makeStyleAst(styles, context);\n let offsetVal = style.offset != null ? style.offset : consumeOffset(style.styles);\n let offset = 0;\n if (offsetVal != null) {\n totalKeyframesWithOffsets++;\n offset = style.offset = offsetVal;\n }\n keyframesOutOfRange = keyframesOutOfRange || offset < 0 || offset > 1;\n offsetsOutOfOrder = offsetsOutOfOrder || offset < previousOffset;\n previousOffset = offset;\n offsets.push(offset);\n return style;\n });\n if (keyframesOutOfRange) {\n context.errors.push(`Please ensure that all keyframe offsets are between 0 and 1`);\n }\n if (offsetsOutOfOrder) {\n context.errors.push(`Please ensure that all keyframe offsets are in order`);\n }\n const length = metadata.steps.length;\n let generatedOffset = 0;\n if (totalKeyframesWithOffsets > 0 && totalKeyframesWithOffsets < length) {\n context.errors.push(`Not all style() steps within the declared keyframes() contain offsets`);\n }\n else if (totalKeyframesWithOffsets == 0) {\n generatedOffset = MAX_KEYFRAME_OFFSET / (length - 1);\n }\n const limit = length - 1;\n const currentTime = context.currentTime;\n const currentAnimateTimings = context.currentAnimateTimings;\n const animateDuration = currentAnimateTimings.duration;\n keyframes.forEach((kf, i) => {\n const offset = generatedOffset > 0 ? (i == limit ? 1 : (generatedOffset * i)) : offsets[i];\n const durationUpToThisFrame = offset * animateDuration;\n context.currentTime = currentTime + currentAnimateTimings.delay + durationUpToThisFrame;\n currentAnimateTimings.duration = durationUpToThisFrame;\n this._validateStyleAst(kf, context);\n kf.offset = offset;\n ast.styles.push(kf);\n });\n return ast;\n }\n visitReference(metadata, context) {\n return {\n type: 8 /* Reference */,\n animation: visitDslNode(this, normalizeAnimationEntry(metadata.animation), context),\n options: normalizeAnimationOptions(metadata.options)\n };\n }\n visitAnimateChild(metadata, context) {\n context.depCount++;\n return {\n type: 9 /* AnimateChild */,\n options: normalizeAnimationOptions(metadata.options)\n };\n }\n visitAnimateRef(metadata, context) {\n return {\n type: 10 /* AnimateRef */,\n animation: this.visitReference(metadata.animation, context),\n options: normalizeAnimationOptions(metadata.options)\n };\n }\n visitQuery(metadata, context) {\n const parentSelector = context.currentQuerySelector;\n const options = (metadata.options || {});\n context.queryCount++;\n context.currentQuery = metadata;\n const [selector, includeSelf] = normalizeSelector(metadata.selector);\n context.currentQuerySelector =\n parentSelector.length ? (parentSelector + ' ' + selector) : selector;\n getOrSetAsInMap(context.collectedStyles, context.currentQuerySelector, {});\n const animation = visitDslNode(this, normalizeAnimationEntry(metadata.animation), context);\n context.currentQuery = null;\n context.currentQuerySelector = parentSelector;\n return {\n type: 11 /* Query */,\n selector,\n limit: options.limit || 0,\n optional: !!options.optional,\n includeSelf,\n animation,\n originalSelector: metadata.selector,\n options: normalizeAnimationOptions(metadata.options)\n };\n }\n visitStagger(metadata, context) {\n if (!context.currentQuery) {\n context.errors.push(`stagger() can only be used inside of query()`);\n }\n const timings = metadata.timings === 'full' ?\n { duration: 0, delay: 0, easing: 'full' } :\n resolveTiming(metadata.timings, context.errors, true);\n return {\n type: 12 /* Stagger */,\n animation: visitDslNode(this, normalizeAnimationEntry(metadata.animation), context),\n timings,\n options: null\n };\n }\n}\nfunction normalizeSelector(selector) {\n const hasAmpersand = selector.split(/\\s*,\\s*/).find(token => token == SELF_TOKEN) ? true : false;\n if (hasAmpersand) {\n selector = selector.replace(SELF_TOKEN_REGEX, '');\n }\n // the :enter and :leave selectors are filled in at runtime during timeline building\n selector = selector.replace(/@\\*/g, NG_TRIGGER_SELECTOR)\n .replace(/@\\w+/g, match => NG_TRIGGER_SELECTOR + '-' + match.substr(1))\n .replace(/:animating/g, NG_ANIMATING_SELECTOR);\n return [selector, hasAmpersand];\n}\nfunction normalizeParams(obj) {\n return obj ? copyObj(obj) : null;\n}\nclass AnimationAstBuilderContext {\n constructor(errors) {\n this.errors = errors;\n this.queryCount = 0;\n this.depCount = 0;\n this.currentTransition = null;\n this.currentQuery = null;\n this.currentQuerySelector = null;\n this.currentAnimateTimings = null;\n this.currentTime = 0;\n this.collectedStyles = {};\n this.options = null;\n }\n}\nfunction consumeOffset(styles) {\n if (typeof styles == 'string')\n return null;\n let offset = null;\n if (Array.isArray(styles)) {\n styles.forEach(styleTuple => {\n if (isObject(styleTuple) && styleTuple.hasOwnProperty('offset')) {\n const obj = styleTuple;\n offset = parseFloat(obj['offset']);\n delete obj['offset'];\n }\n });\n }\n else if (isObject(styles) && styles.hasOwnProperty('offset')) {\n const obj = styles;\n offset = parseFloat(obj['offset']);\n delete obj['offset'];\n }\n return offset;\n}\nfunction isObject(value) {\n return !Array.isArray(value) && typeof value == 'object';\n}\nfunction constructTimingAst(value, errors) {\n let timings = null;\n if (value.hasOwnProperty('duration')) {\n timings = value;\n }\n else if (typeof value == 'number') {\n const duration = resolveTiming(value, errors).duration;\n return makeTimingAst(duration, 0, '');\n }\n const strValue = value;\n const isDynamic = strValue.split(/\\s+/).some(v => v.charAt(0) == '{' && v.charAt(1) == '{');\n if (isDynamic) {\n const ast = makeTimingAst(0, 0, '');\n ast.dynamic = true;\n ast.strValue = strValue;\n return ast;\n }\n timings = timings || resolveTiming(strValue, errors);\n return makeTimingAst(timings.duration, timings.delay, timings.easing);\n}\nfunction normalizeAnimationOptions(options) {\n if (options) {\n options = copyObj(options);\n if (options['params']) {\n options['params'] = normalizeParams(options['params']);\n }\n }\n else {\n options = {};\n }\n return options;\n}\nfunction makeTimingAst(duration, delay, easing) {\n return { duration, delay, easing };\n}\n\nfunction createTimelineInstruction(element, keyframes, preStyleProps, postStyleProps, duration, delay, easing = null, subTimeline = false) {\n return {\n type: 1 /* TimelineAnimation */,\n element,\n keyframes,\n preStyleProps,\n postStyleProps,\n duration,\n delay,\n totalTime: duration + delay,\n easing,\n subTimeline\n };\n}\n\nclass ElementInstructionMap {\n constructor() {\n this._map = new Map();\n }\n consume(element) {\n let instructions = this._map.get(element);\n if (instructions) {\n this._map.delete(element);\n }\n else {\n instructions = [];\n }\n return instructions;\n }\n append(element, instructions) {\n let existingInstructions = this._map.get(element);\n if (!existingInstructions) {\n this._map.set(element, existingInstructions = []);\n }\n existingInstructions.push(...instructions);\n }\n has(element) {\n return this._map.has(element);\n }\n clear() {\n this._map.clear();\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst ONE_FRAME_IN_MILLISECONDS = 1;\nconst ENTER_TOKEN = ':enter';\nconst ENTER_TOKEN_REGEX = new RegExp(ENTER_TOKEN, 'g');\nconst LEAVE_TOKEN = ':leave';\nconst LEAVE_TOKEN_REGEX = new RegExp(LEAVE_TOKEN, 'g');\n/*\n * The code within this file aims to generate web-animations-compatible keyframes from Angular's\n * animation DSL code.\n *\n * The code below will be converted from:\n *\n * ```\n * sequence([\n * style({ opacity: 0 }),\n * animate(1000, style({ opacity: 0 }))\n * ])\n * ```\n *\n * To:\n * ```\n * keyframes = [{ opacity: 0, offset: 0 }, { opacity: 1, offset: 1 }]\n * duration = 1000\n * delay = 0\n * easing = ''\n * ```\n *\n * For this operation to cover the combination of animation verbs (style, animate, group, etc...) a\n * combination of prototypical inheritance, AST traversal and merge-sort-like algorithms are used.\n *\n * [AST Traversal]\n * Each of the animation verbs, when executed, will return an string-map object representing what\n * type of action it is (style, animate, group, etc...) and the data associated with it. This means\n * that when functional composition mix of these functions is evaluated (like in the example above)\n * then it will end up producing a tree of objects representing the animation itself.\n *\n * When this animation object tree is processed by the visitor code below it will visit each of the\n * verb statements within the visitor. And during each visit it will build the context of the\n * animation keyframes by interacting with the `TimelineBuilder`.\n *\n * [TimelineBuilder]\n * This class is responsible for tracking the styles and building a series of keyframe objects for a\n * timeline between a start and end time. The builder starts off with an initial timeline and each\n * time the AST comes across a `group()`, `keyframes()` or a combination of the two wihtin a\n * `sequence()` then it will generate a sub timeline for each step as well as a new one after\n * they are complete.\n *\n * As the AST is traversed, the timing state on each of the timelines will be incremented. If a sub\n * timeline was created (based on one of the cases above) then the parent timeline will attempt to\n * merge the styles used within the sub timelines into itself (only with group() this will happen).\n * This happens with a merge operation (much like how the merge works in mergesort) and it will only\n * copy the most recently used styles from the sub timelines into the parent timeline. This ensures\n * that if the styles are used later on in another phase of the animation then they will be the most\n * up-to-date values.\n *\n * [How Missing Styles Are Updated]\n * Each timeline has a `backFill` property which is responsible for filling in new styles into\n * already processed keyframes if a new style shows up later within the animation sequence.\n *\n * ```\n * sequence([\n * style({ width: 0 }),\n * animate(1000, style({ width: 100 })),\n * animate(1000, style({ width: 200 })),\n * animate(1000, style({ width: 300 }))\n * animate(1000, style({ width: 400, height: 400 })) // notice how `height` doesn't exist anywhere\n * else\n * ])\n * ```\n *\n * What is happening here is that the `height` value is added later in the sequence, but is missing\n * from all previous animation steps. Therefore when a keyframe is created it would also be missing\n * from all previous keyframes up until where it is first used. For the timeline keyframe generation\n * to properly fill in the style it will place the previous value (the value from the parent\n * timeline) or a default value of `*` into the backFill object. Given that each of the keyframe\n * styles are objects that prototypically inhert from the backFill object, this means that if a\n * value is added into the backFill then it will automatically propagate any missing values to all\n * keyframes. Therefore the missing `height` value will be properly filled into the already\n * processed keyframes.\n *\n * When a sub-timeline is created it will have its own backFill property. This is done so that\n * styles present within the sub-timeline do not accidentally seep into the previous/future timeline\n * keyframes\n *\n * (For prototypically-inherited contents to be detected a `for(i in obj)` loop must be used.)\n *\n * [Validation]\n * The code in this file is not responsible for validation. That functionality happens with within\n * the `AnimationValidatorVisitor` code.\n */\nfunction buildAnimationTimelines(driver, rootElement, ast, enterClassName, leaveClassName, startingStyles = {}, finalStyles = {}, options, subInstructions, errors = []) {\n return new AnimationTimelineBuilderVisitor().buildKeyframes(driver, rootElement, ast, enterClassName, leaveClassName, startingStyles, finalStyles, options, subInstructions, errors);\n}\nclass AnimationTimelineBuilderVisitor {\n buildKeyframes(driver, rootElement, ast, enterClassName, leaveClassName, startingStyles, finalStyles, options, subInstructions, errors = []) {\n subInstructions = subInstructions || new ElementInstructionMap();\n const context = new AnimationTimelineContext(driver, rootElement, subInstructions, enterClassName, leaveClassName, errors, []);\n context.options = options;\n context.currentTimeline.setStyles([startingStyles], null, context.errors, options);\n visitDslNode(this, ast, context);\n // this checks to see if an actual animation happened\n const timelines = context.timelines.filter(timeline => timeline.containsAnimation());\n if (timelines.length && Object.keys(finalStyles).length) {\n const tl = timelines[timelines.length - 1];\n if (!tl.allowOnlyTimelineStyles()) {\n tl.setStyles([finalStyles], null, context.errors, options);\n }\n }\n return timelines.length ? timelines.map(timeline => timeline.buildKeyframes()) :\n [createTimelineInstruction(rootElement, [], [], [], 0, 0, '', false)];\n }\n visitTrigger(ast, context) {\n // these values are not visited in this AST\n }\n visitState(ast, context) {\n // these values are not visited in this AST\n }\n visitTransition(ast, context) {\n // these values are not visited in this AST\n }\n visitAnimateChild(ast, context) {\n const elementInstructions = context.subInstructions.consume(context.element);\n if (elementInstructions) {\n const innerContext = context.createSubContext(ast.options);\n const startTime = context.currentTimeline.currentTime;\n const endTime = this._visitSubInstructions(elementInstructions, innerContext, innerContext.options);\n if (startTime != endTime) {\n // we do this on the upper context because we created a sub context for\n // the sub child animations\n context.transformIntoNewTimeline(endTime);\n }\n }\n context.previousNode = ast;\n }\n visitAnimateRef(ast, context) {\n const innerContext = context.createSubContext(ast.options);\n innerContext.transformIntoNewTimeline();\n this.visitReference(ast.animation, innerContext);\n context.transformIntoNewTimeline(innerContext.currentTimeline.currentTime);\n context.previousNode = ast;\n }\n _visitSubInstructions(instructions, context, options) {\n const startTime = context.currentTimeline.currentTime;\n let furthestTime = startTime;\n // this is a special-case for when a user wants to skip a sub\n // animation from being fired entirely.\n const duration = options.duration != null ? resolveTimingValue(options.duration) : null;\n const delay = options.delay != null ? resolveTimingValue(options.delay) : null;\n if (duration !== 0) {\n instructions.forEach(instruction => {\n const instructionTimings = context.appendInstructionToTimeline(instruction, duration, delay);\n furthestTime =\n Math.max(furthestTime, instructionTimings.duration + instructionTimings.delay);\n });\n }\n return furthestTime;\n }\n visitReference(ast, context) {\n context.updateOptions(ast.options, true);\n visitDslNode(this, ast.animation, context);\n context.previousNode = ast;\n }\n visitSequence(ast, context) {\n const subContextCount = context.subContextCount;\n let ctx = context;\n const options = ast.options;\n if (options && (options.params || options.delay)) {\n ctx = context.createSubContext(options);\n ctx.transformIntoNewTimeline();\n if (options.delay != null) {\n if (ctx.previousNode.type == 6 /* Style */) {\n ctx.currentTimeline.snapshotCurrentStyles();\n ctx.previousNode = DEFAULT_NOOP_PREVIOUS_NODE;\n }\n const delay = resolveTimingValue(options.delay);\n ctx.delayNextStep(delay);\n }\n }\n if (ast.steps.length) {\n ast.steps.forEach(s => visitDslNode(this, s, ctx));\n // this is here just incase the inner steps only contain or end with a style() call\n ctx.currentTimeline.applyStylesToKeyframe();\n // this means that some animation function within the sequence\n // ended up creating a sub timeline (which means the current\n // timeline cannot overlap with the contents of the sequence)\n if (ctx.subContextCount > subContextCount) {\n ctx.transformIntoNewTimeline();\n }\n }\n context.previousNode = ast;\n }\n visitGroup(ast, context) {\n const innerTimelines = [];\n let furthestTime = context.currentTimeline.currentTime;\n const delay = ast.options && ast.options.delay ? resolveTimingValue(ast.options.delay) : 0;\n ast.steps.forEach(s => {\n const innerContext = context.createSubContext(ast.options);\n if (delay) {\n innerContext.delayNextStep(delay);\n }\n visitDslNode(this, s, innerContext);\n furthestTime = Math.max(furthestTime, innerContext.currentTimeline.currentTime);\n innerTimelines.push(innerContext.currentTimeline);\n });\n // this operation is run after the AST loop because otherwise\n // if the parent timeline's collected styles were updated then\n // it would pass in invalid data into the new-to-be forked items\n innerTimelines.forEach(timeline => context.currentTimeline.mergeTimelineCollectedStyles(timeline));\n context.transformIntoNewTimeline(furthestTime);\n context.previousNode = ast;\n }\n _visitTiming(ast, context) {\n if (ast.dynamic) {\n const strValue = ast.strValue;\n const timingValue = context.params ? interpolateParams(strValue, context.params, context.errors) : strValue;\n return resolveTiming(timingValue, context.errors);\n }\n else {\n return { duration: ast.duration, delay: ast.delay, easing: ast.easing };\n }\n }\n visitAnimate(ast, context) {\n const timings = context.currentAnimateTimings = this._visitTiming(ast.timings, context);\n const timeline = context.currentTimeline;\n if (timings.delay) {\n context.incrementTime(timings.delay);\n timeline.snapshotCurrentStyles();\n }\n const style = ast.style;\n if (style.type == 5 /* Keyframes */) {\n this.visitKeyframes(style, context);\n }\n else {\n context.incrementTime(timings.duration);\n this.visitStyle(style, context);\n timeline.applyStylesToKeyframe();\n }\n context.currentAnimateTimings = null;\n context.previousNode = ast;\n }\n visitStyle(ast, context) {\n const timeline = context.currentTimeline;\n const timings = context.currentAnimateTimings;\n // this is a special case for when a style() call\n // directly follows an animate() call (but not inside of an animate() call)\n if (!timings && timeline.getCurrentStyleProperties().length) {\n timeline.forwardFrame();\n }\n const easing = (timings && timings.easing) || ast.easing;\n if (ast.isEmptyStep) {\n timeline.applyEmptyStep(easing);\n }\n else {\n timeline.setStyles(ast.styles, easing, context.errors, context.options);\n }\n context.previousNode = ast;\n }\n visitKeyframes(ast, context) {\n const currentAnimateTimings = context.currentAnimateTimings;\n const startTime = (context.currentTimeline).duration;\n const duration = currentAnimateTimings.duration;\n const innerContext = context.createSubContext();\n const innerTimeline = innerContext.currentTimeline;\n innerTimeline.easing = currentAnimateTimings.easing;\n ast.styles.forEach(step => {\n const offset = step.offset || 0;\n innerTimeline.forwardTime(offset * duration);\n innerTimeline.setStyles(step.styles, step.easing, context.errors, context.options);\n innerTimeline.applyStylesToKeyframe();\n });\n // this will ensure that the parent timeline gets all the styles from\n // the child even if the new timeline below is not used\n context.currentTimeline.mergeTimelineCollectedStyles(innerTimeline);\n // we do this because the window between this timeline and the sub timeline\n // should ensure that the styles within are exactly the same as they were before\n context.transformIntoNewTimeline(startTime + duration);\n context.previousNode = ast;\n }\n visitQuery(ast, context) {\n // in the event that the first step before this is a style step we need\n // to ensure the styles are applied before the children are animated\n const startTime = context.currentTimeline.currentTime;\n const options = (ast.options || {});\n const delay = options.delay ? resolveTimingValue(options.delay) : 0;\n if (delay &&\n (context.previousNode.type === 6 /* Style */ ||\n (startTime == 0 && context.currentTimeline.getCurrentStyleProperties().length))) {\n context.currentTimeline.snapshotCurrentStyles();\n context.previousNode = DEFAULT_NOOP_PREVIOUS_NODE;\n }\n let furthestTime = startTime;\n const elms = context.invokeQuery(ast.selector, ast.originalSelector, ast.limit, ast.includeSelf, options.optional ? true : false, context.errors);\n context.currentQueryTotal = elms.length;\n let sameElementTimeline = null;\n elms.forEach((element, i) => {\n context.currentQueryIndex = i;\n const innerContext = context.createSubContext(ast.options, element);\n if (delay) {\n innerContext.delayNextStep(delay);\n }\n if (element === context.element) {\n sameElementTimeline = innerContext.currentTimeline;\n }\n visitDslNode(this, ast.animation, innerContext);\n // this is here just incase the inner steps only contain or end\n // with a style() call (which is here to signal that this is a preparatory\n // call to style an element before it is animated again)\n innerContext.currentTimeline.applyStylesToKeyframe();\n const endTime = innerContext.currentTimeline.currentTime;\n furthestTime = Math.max(furthestTime, endTime);\n });\n context.currentQueryIndex = 0;\n context.currentQueryTotal = 0;\n context.transformIntoNewTimeline(furthestTime);\n if (sameElementTimeline) {\n context.currentTimeline.mergeTimelineCollectedStyles(sameElementTimeline);\n context.currentTimeline.snapshotCurrentStyles();\n }\n context.previousNode = ast;\n }\n visitStagger(ast, context) {\n const parentContext = context.parentContext;\n const tl = context.currentTimeline;\n const timings = ast.timings;\n const duration = Math.abs(timings.duration);\n const maxTime = duration * (context.currentQueryTotal - 1);\n let delay = duration * context.currentQueryIndex;\n let staggerTransformer = timings.duration < 0 ? 'reverse' : timings.easing;\n switch (staggerTransformer) {\n case 'reverse':\n delay = maxTime - delay;\n break;\n case 'full':\n delay = parentContext.currentStaggerTime;\n break;\n }\n const timeline = context.currentTimeline;\n if (delay) {\n timeline.delayNextStep(delay);\n }\n const startingTime = timeline.currentTime;\n visitDslNode(this, ast.animation, context);\n context.previousNode = ast;\n // time = duration + delay\n // the reason why this computation is so complex is because\n // the inner timeline may either have a delay value or a stretched\n // keyframe depending on if a subtimeline is not used or is used.\n parentContext.currentStaggerTime =\n (tl.currentTime - startingTime) + (tl.startTime - parentContext.currentTimeline.startTime);\n }\n}\nconst DEFAULT_NOOP_PREVIOUS_NODE = {};\nclass AnimationTimelineContext {\n constructor(_driver, element, subInstructions, _enterClassName, _leaveClassName, errors, timelines, initialTimeline) {\n this._driver = _driver;\n this.element = element;\n this.subInstructions = subInstructions;\n this._enterClassName = _enterClassName;\n this._leaveClassName = _leaveClassName;\n this.errors = errors;\n this.timelines = timelines;\n this.parentContext = null;\n this.currentAnimateTimings = null;\n this.previousNode = DEFAULT_NOOP_PREVIOUS_NODE;\n this.subContextCount = 0;\n this.options = {};\n this.currentQueryIndex = 0;\n this.currentQueryTotal = 0;\n this.currentStaggerTime = 0;\n this.currentTimeline = initialTimeline || new TimelineBuilder(this._driver, element, 0);\n timelines.push(this.currentTimeline);\n }\n get params() {\n return this.options.params;\n }\n updateOptions(options, skipIfExists) {\n if (!options)\n return;\n const newOptions = options;\n let optionsToUpdate = this.options;\n // NOTE: this will get patched up when other animation methods support duration overrides\n if (newOptions.duration != null) {\n optionsToUpdate.duration = resolveTimingValue(newOptions.duration);\n }\n if (newOptions.delay != null) {\n optionsToUpdate.delay = resolveTimingValue(newOptions.delay);\n }\n const newParams = newOptions.params;\n if (newParams) {\n let paramsToUpdate = optionsToUpdate.params;\n if (!paramsToUpdate) {\n paramsToUpdate = this.options.params = {};\n }\n Object.keys(newParams).forEach(name => {\n if (!skipIfExists || !paramsToUpdate.hasOwnProperty(name)) {\n paramsToUpdate[name] = interpolateParams(newParams[name], paramsToUpdate, this.errors);\n }\n });\n }\n }\n _copyOptions() {\n const options = {};\n if (this.options) {\n const oldParams = this.options.params;\n if (oldParams) {\n const params = options['params'] = {};\n Object.keys(oldParams).forEach(name => {\n params[name] = oldParams[name];\n });\n }\n }\n return options;\n }\n createSubContext(options = null, element, newTime) {\n const target = element || this.element;\n const context = new AnimationTimelineContext(this._driver, target, this.subInstructions, this._enterClassName, this._leaveClassName, this.errors, this.timelines, this.currentTimeline.fork(target, newTime || 0));\n context.previousNode = this.previousNode;\n context.currentAnimateTimings = this.currentAnimateTimings;\n context.options = this._copyOptions();\n context.updateOptions(options);\n context.currentQueryIndex = this.currentQueryIndex;\n context.currentQueryTotal = this.currentQueryTotal;\n context.parentContext = this;\n this.subContextCount++;\n return context;\n }\n transformIntoNewTimeline(newTime) {\n this.previousNode = DEFAULT_NOOP_PREVIOUS_NODE;\n this.currentTimeline = this.currentTimeline.fork(this.element, newTime);\n this.timelines.push(this.currentTimeline);\n return this.currentTimeline;\n }\n appendInstructionToTimeline(instruction, duration, delay) {\n const updatedTimings = {\n duration: duration != null ? duration : instruction.duration,\n delay: this.currentTimeline.currentTime + (delay != null ? delay : 0) + instruction.delay,\n easing: ''\n };\n const builder = new SubTimelineBuilder(this._driver, instruction.element, instruction.keyframes, instruction.preStyleProps, instruction.postStyleProps, updatedTimings, instruction.stretchStartingKeyframe);\n this.timelines.push(builder);\n return updatedTimings;\n }\n incrementTime(time) {\n this.currentTimeline.forwardTime(this.currentTimeline.duration + time);\n }\n delayNextStep(delay) {\n // negative delays are not yet supported\n if (delay > 0) {\n this.currentTimeline.delayNextStep(delay);\n }\n }\n invokeQuery(selector, originalSelector, limit, includeSelf, optional, errors) {\n let results = [];\n if (includeSelf) {\n results.push(this.element);\n }\n if (selector.length > 0) { // if :self is only used then the selector is empty\n selector = selector.replace(ENTER_TOKEN_REGEX, '.' + this._enterClassName);\n selector = selector.replace(LEAVE_TOKEN_REGEX, '.' + this._leaveClassName);\n const multi = limit != 1;\n let elements = this._driver.query(this.element, selector, multi);\n if (limit !== 0) {\n elements = limit < 0 ? elements.slice(elements.length + limit, elements.length) :\n elements.slice(0, limit);\n }\n results.push(...elements);\n }\n if (!optional && results.length == 0) {\n errors.push(`\\`query(\"${originalSelector}\")\\` returned zero elements. (Use \\`query(\"${originalSelector}\", { optional: true })\\` if you wish to allow this.)`);\n }\n return results;\n }\n}\nclass TimelineBuilder {\n constructor(_driver, element, startTime, _elementTimelineStylesLookup) {\n this._driver = _driver;\n this.element = element;\n this.startTime = startTime;\n this._elementTimelineStylesLookup = _elementTimelineStylesLookup;\n this.duration = 0;\n this._previousKeyframe = {};\n this._currentKeyframe = {};\n this._keyframes = new Map();\n this._styleSummary = {};\n this._pendingStyles = {};\n this._backFill = {};\n this._currentEmptyStepKeyframe = null;\n if (!this._elementTimelineStylesLookup) {\n this._elementTimelineStylesLookup = new Map();\n }\n this._localTimelineStyles = Object.create(this._backFill, {});\n this._globalTimelineStyles = this._elementTimelineStylesLookup.get(element);\n if (!this._globalTimelineStyles) {\n this._globalTimelineStyles = this._localTimelineStyles;\n this._elementTimelineStylesLookup.set(element, this._localTimelineStyles);\n }\n this._loadKeyframe();\n }\n containsAnimation() {\n switch (this._keyframes.size) {\n case 0:\n return false;\n case 1:\n return this.getCurrentStyleProperties().length > 0;\n default:\n return true;\n }\n }\n getCurrentStyleProperties() {\n return Object.keys(this._currentKeyframe);\n }\n get currentTime() {\n return this.startTime + this.duration;\n }\n delayNextStep(delay) {\n // in the event that a style() step is placed right before a stagger()\n // and that style() step is the very first style() value in the animation\n // then we need to make a copy of the keyframe [0, copy, 1] so that the delay\n // properly applies the style() values to work with the stagger...\n const hasPreStyleStep = this._keyframes.size == 1 && Object.keys(this._pendingStyles).length;\n if (this.duration || hasPreStyleStep) {\n this.forwardTime(this.currentTime + delay);\n if (hasPreStyleStep) {\n this.snapshotCurrentStyles();\n }\n }\n else {\n this.startTime += delay;\n }\n }\n fork(element, currentTime) {\n this.applyStylesToKeyframe();\n return new TimelineBuilder(this._driver, element, currentTime || this.currentTime, this._elementTimelineStylesLookup);\n }\n _loadKeyframe() {\n if (this._currentKeyframe) {\n this._previousKeyframe = this._currentKeyframe;\n }\n this._currentKeyframe = this._keyframes.get(this.duration);\n if (!this._currentKeyframe) {\n this._currentKeyframe = Object.create(this._backFill, {});\n this._keyframes.set(this.duration, this._currentKeyframe);\n }\n }\n forwardFrame() {\n this.duration += ONE_FRAME_IN_MILLISECONDS;\n this._loadKeyframe();\n }\n forwardTime(time) {\n this.applyStylesToKeyframe();\n this.duration = time;\n this._loadKeyframe();\n }\n _updateStyle(prop, value) {\n this._localTimelineStyles[prop] = value;\n this._globalTimelineStyles[prop] = value;\n this._styleSummary[prop] = { time: this.currentTime, value };\n }\n allowOnlyTimelineStyles() {\n return this._currentEmptyStepKeyframe !== this._currentKeyframe;\n }\n applyEmptyStep(easing) {\n if (easing) {\n this._previousKeyframe['easing'] = easing;\n }\n // special case for animate(duration):\n // all missing styles are filled with a `*` value then\n // if any destination styles are filled in later on the same\n // keyframe then they will override the overridden styles\n // We use `_globalTimelineStyles` here because there may be\n // styles in previous keyframes that are not present in this timeline\n Object.keys(this._globalTimelineStyles).forEach(prop => {\n this._backFill[prop] = this._globalTimelineStyles[prop] || AUTO_STYLE;\n this._currentKeyframe[prop] = AUTO_STYLE;\n });\n this._currentEmptyStepKeyframe = this._currentKeyframe;\n }\n setStyles(input, easing, errors, options) {\n if (easing) {\n this._previousKeyframe['easing'] = easing;\n }\n const params = (options && options.params) || {};\n const styles = flattenStyles(input, this._globalTimelineStyles);\n Object.keys(styles).forEach(prop => {\n const val = interpolateParams(styles[prop], params, errors);\n this._pendingStyles[prop] = val;\n if (!this._localTimelineStyles.hasOwnProperty(prop)) {\n this._backFill[prop] = this._globalTimelineStyles.hasOwnProperty(prop) ?\n this._globalTimelineStyles[prop] :\n AUTO_STYLE;\n }\n this._updateStyle(prop, val);\n });\n }\n applyStylesToKeyframe() {\n const styles = this._pendingStyles;\n const props = Object.keys(styles);\n if (props.length == 0)\n return;\n this._pendingStyles = {};\n props.forEach(prop => {\n const val = styles[prop];\n this._currentKeyframe[prop] = val;\n });\n Object.keys(this._localTimelineStyles).forEach(prop => {\n if (!this._currentKeyframe.hasOwnProperty(prop)) {\n this._currentKeyframe[prop] = this._localTimelineStyles[prop];\n }\n });\n }\n snapshotCurrentStyles() {\n Object.keys(this._localTimelineStyles).forEach(prop => {\n const val = this._localTimelineStyles[prop];\n this._pendingStyles[prop] = val;\n this._updateStyle(prop, val);\n });\n }\n getFinalKeyframe() {\n return this._keyframes.get(this.duration);\n }\n get properties() {\n const properties = [];\n for (let prop in this._currentKeyframe) {\n properties.push(prop);\n }\n return properties;\n }\n mergeTimelineCollectedStyles(timeline) {\n Object.keys(timeline._styleSummary).forEach(prop => {\n const details0 = this._styleSummary[prop];\n const details1 = timeline._styleSummary[prop];\n if (!details0 || details1.time > details0.time) {\n this._updateStyle(prop, details1.value);\n }\n });\n }\n buildKeyframes() {\n this.applyStylesToKeyframe();\n const preStyleProps = new Set();\n const postStyleProps = new Set();\n const isEmpty = this._keyframes.size === 1 && this.duration === 0;\n let finalKeyframes = [];\n this._keyframes.forEach((keyframe, time) => {\n const finalKeyframe = copyStyles(keyframe, true);\n Object.keys(finalKeyframe).forEach(prop => {\n const value = finalKeyframe[prop];\n if (value == ɵPRE_STYLE) {\n preStyleProps.add(prop);\n }\n else if (value == AUTO_STYLE) {\n postStyleProps.add(prop);\n }\n });\n if (!isEmpty) {\n finalKeyframe['offset'] = time / this.duration;\n }\n finalKeyframes.push(finalKeyframe);\n });\n const preProps = preStyleProps.size ? iteratorToArray(preStyleProps.values()) : [];\n const postProps = postStyleProps.size ? iteratorToArray(postStyleProps.values()) : [];\n // special case for a 0-second animation (which is designed just to place styles onscreen)\n if (isEmpty) {\n const kf0 = finalKeyframes[0];\n const kf1 = copyObj(kf0);\n kf0['offset'] = 0;\n kf1['offset'] = 1;\n finalKeyframes = [kf0, kf1];\n }\n return createTimelineInstruction(this.element, finalKeyframes, preProps, postProps, this.duration, this.startTime, this.easing, false);\n }\n}\nclass SubTimelineBuilder extends TimelineBuilder {\n constructor(driver, element, keyframes, preStyleProps, postStyleProps, timings, _stretchStartingKeyframe = false) {\n super(driver, element, timings.delay);\n this.element = element;\n this.keyframes = keyframes;\n this.preStyleProps = preStyleProps;\n this.postStyleProps = postStyleProps;\n this._stretchStartingKeyframe = _stretchStartingKeyframe;\n this.timings = { duration: timings.duration, delay: timings.delay, easing: timings.easing };\n }\n containsAnimation() {\n return this.keyframes.length > 1;\n }\n buildKeyframes() {\n let keyframes = this.keyframes;\n let { delay, duration, easing } = this.timings;\n if (this._stretchStartingKeyframe && delay) {\n const newKeyframes = [];\n const totalTime = duration + delay;\n const startingGap = delay / totalTime;\n // the original starting keyframe now starts once the delay is done\n const newFirstKeyframe = copyStyles(keyframes[0], false);\n newFirstKeyframe['offset'] = 0;\n newKeyframes.push(newFirstKeyframe);\n const oldFirstKeyframe = copyStyles(keyframes[0], false);\n oldFirstKeyframe['offset'] = roundOffset(startingGap);\n newKeyframes.push(oldFirstKeyframe);\n /*\n When the keyframe is stretched then it means that the delay before the animation\n starts is gone. Instead the first keyframe is placed at the start of the animation\n and it is then copied to where it starts when the original delay is over. This basically\n means nothing animates during that delay, but the styles are still renderered. For this\n to work the original offset values that exist in the original keyframes must be \"warped\"\n so that they can take the new keyframe + delay into account.\n \n delay=1000, duration=1000, keyframes = 0 .5 1\n \n turns into\n \n delay=0, duration=2000, keyframes = 0 .33 .66 1\n */\n // offsets between 1 ... n -1 are all warped by the keyframe stretch\n const limit = keyframes.length - 1;\n for (let i = 1; i <= limit; i++) {\n let kf = copyStyles(keyframes[i], false);\n const oldOffset = kf['offset'];\n const timeAtKeyframe = delay + oldOffset * duration;\n kf['offset'] = roundOffset(timeAtKeyframe / totalTime);\n newKeyframes.push(kf);\n }\n // the new starting keyframe should be added at the start\n duration = totalTime;\n delay = 0;\n easing = '';\n keyframes = newKeyframes;\n }\n return createTimelineInstruction(this.element, keyframes, this.preStyleProps, this.postStyleProps, duration, delay, easing, true);\n }\n}\nfunction roundOffset(offset, decimalPoints = 3) {\n const mult = Math.pow(10, decimalPoints - 1);\n return Math.round(offset * mult) / mult;\n}\nfunction flattenStyles(input, allStyles) {\n const styles = {};\n let allProperties;\n input.forEach(token => {\n if (token === '*') {\n allProperties = allProperties || Object.keys(allStyles);\n allProperties.forEach(prop => {\n styles[prop] = AUTO_STYLE;\n });\n }\n else {\n copyStyles(token, false, styles);\n }\n });\n return styles;\n}\n\nclass Animation {\n constructor(_driver, input) {\n this._driver = _driver;\n const errors = [];\n const ast = buildAnimationAst(_driver, input, errors);\n if (errors.length) {\n const errorMessage = `animation validation failed:\\n${errors.join('\\n')}`;\n throw new Error(errorMessage);\n }\n this._animationAst = ast;\n }\n buildTimelines(element, startingStyles, destinationStyles, options, subInstructions) {\n const start = Array.isArray(startingStyles) ? normalizeStyles(startingStyles) :\n startingStyles;\n const dest = Array.isArray(destinationStyles) ? normalizeStyles(destinationStyles) :\n destinationStyles;\n const errors = [];\n subInstructions = subInstructions || new ElementInstructionMap();\n const result = buildAnimationTimelines(this._driver, element, this._animationAst, ENTER_CLASSNAME, LEAVE_CLASSNAME, start, dest, options, subInstructions, errors);\n if (errors.length) {\n const errorMessage = `animation building failed:\\n${errors.join('\\n')}`;\n throw new Error(errorMessage);\n }\n return result;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @publicApi\n */\nclass AnimationStyleNormalizer {\n}\n/**\n * @publicApi\n */\nclass NoopAnimationStyleNormalizer {\n normalizePropertyName(propertyName, errors) {\n return propertyName;\n }\n normalizeStyleValue(userProvidedProperty, normalizedProperty, value, errors) {\n return value;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass WebAnimationsStyleNormalizer extends AnimationStyleNormalizer {\n normalizePropertyName(propertyName, errors) {\n return dashCaseToCamelCase(propertyName);\n }\n normalizeStyleValue(userProvidedProperty, normalizedProperty, value, errors) {\n let unit = '';\n const strVal = value.toString().trim();\n if (DIMENSIONAL_PROP_MAP[normalizedProperty] && value !== 0 && value !== '0') {\n if (typeof value === 'number') {\n unit = 'px';\n }\n else {\n const valAndSuffixMatch = value.match(/^[+-]?[\\d\\.]+([a-z]*)$/);\n if (valAndSuffixMatch && valAndSuffixMatch[1].length == 0) {\n errors.push(`Please provide a CSS unit value for ${userProvidedProperty}:${value}`);\n }\n }\n }\n return strVal + unit;\n }\n}\nconst ɵ0$1 = () => makeBooleanMap('width,height,minWidth,minHeight,maxWidth,maxHeight,left,top,bottom,right,fontSize,outlineWidth,outlineOffset,paddingTop,paddingLeft,paddingBottom,paddingRight,marginTop,marginLeft,marginBottom,marginRight,borderRadius,borderWidth,borderTopWidth,borderLeftWidth,borderRightWidth,borderBottomWidth,textIndent,perspective'\n .split(','));\nconst DIMENSIONAL_PROP_MAP = (ɵ0$1)();\nfunction makeBooleanMap(keys) {\n const map = {};\n keys.forEach(key => map[key] = true);\n return map;\n}\n\nfunction createTransitionInstruction(element, triggerName, fromState, toState, isRemovalTransition, fromStyles, toStyles, timelines, queriedElements, preStyleProps, postStyleProps, totalTime, errors) {\n return {\n type: 0 /* TransitionAnimation */,\n element,\n triggerName,\n isRemovalTransition,\n fromState,\n fromStyles,\n toState,\n toStyles,\n timelines,\n queriedElements,\n preStyleProps,\n postStyleProps,\n totalTime,\n errors\n };\n}\n\nconst EMPTY_OBJECT = {};\nclass AnimationTransitionFactory {\n constructor(_triggerName, ast, _stateStyles) {\n this._triggerName = _triggerName;\n this.ast = ast;\n this._stateStyles = _stateStyles;\n }\n match(currentState, nextState, element, params) {\n return oneOrMoreTransitionsMatch(this.ast.matchers, currentState, nextState, element, params);\n }\n buildStyles(stateName, params, errors) {\n const backupStateStyler = this._stateStyles['*'];\n const stateStyler = this._stateStyles[stateName];\n const backupStyles = backupStateStyler ? backupStateStyler.buildStyles(params, errors) : {};\n return stateStyler ? stateStyler.buildStyles(params, errors) : backupStyles;\n }\n build(driver, element, currentState, nextState, enterClassName, leaveClassName, currentOptions, nextOptions, subInstructions, skipAstBuild) {\n const errors = [];\n const transitionAnimationParams = this.ast.options && this.ast.options.params || EMPTY_OBJECT;\n const currentAnimationParams = currentOptions && currentOptions.params || EMPTY_OBJECT;\n const currentStateStyles = this.buildStyles(currentState, currentAnimationParams, errors);\n const nextAnimationParams = nextOptions && nextOptions.params || EMPTY_OBJECT;\n const nextStateStyles = this.buildStyles(nextState, nextAnimationParams, errors);\n const queriedElements = new Set();\n const preStyleMap = new Map();\n const postStyleMap = new Map();\n const isRemoval = nextState === 'void';\n const animationOptions = { params: Object.assign(Object.assign({}, transitionAnimationParams), nextAnimationParams) };\n const timelines = skipAstBuild ?\n [] :\n buildAnimationTimelines(driver, element, this.ast.animation, enterClassName, leaveClassName, currentStateStyles, nextStateStyles, animationOptions, subInstructions, errors);\n let totalTime = 0;\n timelines.forEach(tl => {\n totalTime = Math.max(tl.duration + tl.delay, totalTime);\n });\n if (errors.length) {\n return createTransitionInstruction(element, this._triggerName, currentState, nextState, isRemoval, currentStateStyles, nextStateStyles, [], [], preStyleMap, postStyleMap, totalTime, errors);\n }\n timelines.forEach(tl => {\n const elm = tl.element;\n const preProps = getOrSetAsInMap(preStyleMap, elm, {});\n tl.preStyleProps.forEach(prop => preProps[prop] = true);\n const postProps = getOrSetAsInMap(postStyleMap, elm, {});\n tl.postStyleProps.forEach(prop => postProps[prop] = true);\n if (elm !== element) {\n queriedElements.add(elm);\n }\n });\n const queriedElementsList = iteratorToArray(queriedElements.values());\n return createTransitionInstruction(element, this._triggerName, currentState, nextState, isRemoval, currentStateStyles, nextStateStyles, timelines, queriedElementsList, preStyleMap, postStyleMap, totalTime);\n }\n}\nfunction oneOrMoreTransitionsMatch(matchFns, currentState, nextState, element, params) {\n return matchFns.some(fn => fn(currentState, nextState, element, params));\n}\nclass AnimationStateStyles {\n constructor(styles, defaultParams) {\n this.styles = styles;\n this.defaultParams = defaultParams;\n }\n buildStyles(params, errors) {\n const finalStyles = {};\n const combinedParams = copyObj(this.defaultParams);\n Object.keys(params).forEach(key => {\n const value = params[key];\n if (value != null) {\n combinedParams[key] = value;\n }\n });\n this.styles.styles.forEach(value => {\n if (typeof value !== 'string') {\n const styleObj = value;\n Object.keys(styleObj).forEach(prop => {\n let val = styleObj[prop];\n if (val.length > 1) {\n val = interpolateParams(val, combinedParams, errors);\n }\n finalStyles[prop] = val;\n });\n }\n });\n return finalStyles;\n }\n}\n\n/**\n * @publicApi\n */\nfunction buildTrigger(name, ast) {\n return new AnimationTrigger(name, ast);\n}\n/**\n * @publicApi\n */\nclass AnimationTrigger {\n constructor(name, ast) {\n this.name = name;\n this.ast = ast;\n this.transitionFactories = [];\n this.states = {};\n ast.states.forEach(ast => {\n const defaultParams = (ast.options && ast.options.params) || {};\n this.states[ast.name] = new AnimationStateStyles(ast.style, defaultParams);\n });\n balanceProperties(this.states, 'true', '1');\n balanceProperties(this.states, 'false', '0');\n ast.transitions.forEach(ast => {\n this.transitionFactories.push(new AnimationTransitionFactory(name, ast, this.states));\n });\n this.fallbackTransition = createFallbackTransition(name, this.states);\n }\n get containsQueries() {\n return this.ast.queryCount > 0;\n }\n matchTransition(currentState, nextState, element, params) {\n const entry = this.transitionFactories.find(f => f.match(currentState, nextState, element, params));\n return entry || null;\n }\n matchStyles(currentState, params, errors) {\n return this.fallbackTransition.buildStyles(currentState, params, errors);\n }\n}\nfunction createFallbackTransition(triggerName, states) {\n const matchers = [(fromState, toState) => true];\n const animation = { type: 2 /* Sequence */, steps: [], options: null };\n const transition = {\n type: 1 /* Transition */,\n animation,\n matchers,\n options: null,\n queryCount: 0,\n depCount: 0\n };\n return new AnimationTransitionFactory(triggerName, transition, states);\n}\nfunction balanceProperties(obj, key1, key2) {\n if (obj.hasOwnProperty(key1)) {\n if (!obj.hasOwnProperty(key2)) {\n obj[key2] = obj[key1];\n }\n }\n else if (obj.hasOwnProperty(key2)) {\n obj[key1] = obj[key2];\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst EMPTY_INSTRUCTION_MAP = new ElementInstructionMap();\nclass TimelineAnimationEngine {\n constructor(bodyNode, _driver, _normalizer) {\n this.bodyNode = bodyNode;\n this._driver = _driver;\n this._normalizer = _normalizer;\n this._animations = {};\n this._playersById = {};\n this.players = [];\n }\n register(id, metadata) {\n const errors = [];\n const ast = buildAnimationAst(this._driver, metadata, errors);\n if (errors.length) {\n throw new Error(`Unable to build the animation due to the following errors: ${errors.join('\\n')}`);\n }\n else {\n this._animations[id] = ast;\n }\n }\n _buildPlayer(i, preStyles, postStyles) {\n const element = i.element;\n const keyframes = normalizeKeyframes(this._driver, this._normalizer, element, i.keyframes, preStyles, postStyles);\n return this._driver.animate(element, keyframes, i.duration, i.delay, i.easing, [], true);\n }\n create(id, element, options = {}) {\n const errors = [];\n const ast = this._animations[id];\n let instructions;\n const autoStylesMap = new Map();\n if (ast) {\n instructions = buildAnimationTimelines(this._driver, element, ast, ENTER_CLASSNAME, LEAVE_CLASSNAME, {}, {}, options, EMPTY_INSTRUCTION_MAP, errors);\n instructions.forEach(inst => {\n const styles = getOrSetAsInMap(autoStylesMap, inst.element, {});\n inst.postStyleProps.forEach(prop => styles[prop] = null);\n });\n }\n else {\n errors.push('The requested animation doesn\\'t exist or has already been destroyed');\n instructions = [];\n }\n if (errors.length) {\n throw new Error(`Unable to create the animation due to the following errors: ${errors.join('\\n')}`);\n }\n autoStylesMap.forEach((styles, element) => {\n Object.keys(styles).forEach(prop => {\n styles[prop] = this._driver.computeStyle(element, prop, AUTO_STYLE);\n });\n });\n const players = instructions.map(i => {\n const styles = autoStylesMap.get(i.element);\n return this._buildPlayer(i, {}, styles);\n });\n const player = optimizeGroupPlayer(players);\n this._playersById[id] = player;\n player.onDestroy(() => this.destroy(id));\n this.players.push(player);\n return player;\n }\n destroy(id) {\n const player = this._getPlayer(id);\n player.destroy();\n delete this._playersById[id];\n const index = this.players.indexOf(player);\n if (index >= 0) {\n this.players.splice(index, 1);\n }\n }\n _getPlayer(id) {\n const player = this._playersById[id];\n if (!player) {\n throw new Error(`Unable to find the timeline player referenced by ${id}`);\n }\n return player;\n }\n listen(id, element, eventName, callback) {\n // triggerName, fromState, toState are all ignored for timeline animations\n const baseEvent = makeAnimationEvent(element, '', '', '');\n listenOnPlayer(this._getPlayer(id), eventName, baseEvent, callback);\n return () => { };\n }\n command(id, element, command, args) {\n if (command == 'register') {\n this.register(id, args[0]);\n return;\n }\n if (command == 'create') {\n const options = (args[0] || {});\n this.create(id, element, options);\n return;\n }\n const player = this._getPlayer(id);\n switch (command) {\n case 'play':\n player.play();\n break;\n case 'pause':\n player.pause();\n break;\n case 'reset':\n player.reset();\n break;\n case 'restart':\n player.restart();\n break;\n case 'finish':\n player.finish();\n break;\n case 'init':\n player.init();\n break;\n case 'setPosition':\n player.setPosition(parseFloat(args[0]));\n break;\n case 'destroy':\n this.destroy(id);\n break;\n }\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst QUEUED_CLASSNAME = 'ng-animate-queued';\nconst QUEUED_SELECTOR = '.ng-animate-queued';\nconst DISABLED_CLASSNAME = 'ng-animate-disabled';\nconst DISABLED_SELECTOR = '.ng-animate-disabled';\nconst STAR_CLASSNAME = 'ng-star-inserted';\nconst STAR_SELECTOR = '.ng-star-inserted';\nconst EMPTY_PLAYER_ARRAY = [];\nconst NULL_REMOVAL_STATE = {\n namespaceId: '',\n setForRemoval: false,\n setForMove: false,\n hasAnimation: false,\n removedBeforeQueried: false\n};\nconst NULL_REMOVED_QUERIED_STATE = {\n namespaceId: '',\n setForMove: false,\n setForRemoval: false,\n hasAnimation: false,\n removedBeforeQueried: true\n};\nconst REMOVAL_FLAG = '__ng_removed';\nclass StateValue {\n constructor(input, namespaceId = '') {\n this.namespaceId = namespaceId;\n const isObj = input && input.hasOwnProperty('value');\n const value = isObj ? input['value'] : input;\n this.value = normalizeTriggerValue(value);\n if (isObj) {\n const options = copyObj(input);\n delete options['value'];\n this.options = options;\n }\n else {\n this.options = {};\n }\n if (!this.options.params) {\n this.options.params = {};\n }\n }\n get params() {\n return this.options.params;\n }\n absorbOptions(options) {\n const newParams = options.params;\n if (newParams) {\n const oldParams = this.options.params;\n Object.keys(newParams).forEach(prop => {\n if (oldParams[prop] == null) {\n oldParams[prop] = newParams[prop];\n }\n });\n }\n }\n}\nconst VOID_VALUE = 'void';\nconst DEFAULT_STATE_VALUE = new StateValue(VOID_VALUE);\nclass AnimationTransitionNamespace {\n constructor(id, hostElement, _engine) {\n this.id = id;\n this.hostElement = hostElement;\n this._engine = _engine;\n this.players = [];\n this._triggers = {};\n this._queue = [];\n this._elementListeners = new Map();\n this._hostClassName = 'ng-tns-' + id;\n addClass(hostElement, this._hostClassName);\n }\n listen(element, name, phase, callback) {\n if (!this._triggers.hasOwnProperty(name)) {\n throw new Error(`Unable to listen on the animation trigger event \"${phase}\" because the animation trigger \"${name}\" doesn\\'t exist!`);\n }\n if (phase == null || phase.length == 0) {\n throw new Error(`Unable to listen on the animation trigger \"${name}\" because the provided event is undefined!`);\n }\n if (!isTriggerEventValid(phase)) {\n throw new Error(`The provided animation trigger event \"${phase}\" for the animation trigger \"${name}\" is not supported!`);\n }\n const listeners = getOrSetAsInMap(this._elementListeners, element, []);\n const data = { name, phase, callback };\n listeners.push(data);\n const triggersWithStates = getOrSetAsInMap(this._engine.statesByElement, element, {});\n if (!triggersWithStates.hasOwnProperty(name)) {\n addClass(element, NG_TRIGGER_CLASSNAME);\n addClass(element, NG_TRIGGER_CLASSNAME + '-' + name);\n triggersWithStates[name] = DEFAULT_STATE_VALUE;\n }\n return () => {\n // the event listener is removed AFTER the flush has occurred such\n // that leave animations callbacks can fire (otherwise if the node\n // is removed in between then the listeners would be deregistered)\n this._engine.afterFlush(() => {\n const index = listeners.indexOf(data);\n if (index >= 0) {\n listeners.splice(index, 1);\n }\n if (!this._triggers[name]) {\n delete triggersWithStates[name];\n }\n });\n };\n }\n register(name, ast) {\n if (this._triggers[name]) {\n // throw\n return false;\n }\n else {\n this._triggers[name] = ast;\n return true;\n }\n }\n _getTrigger(name) {\n const trigger = this._triggers[name];\n if (!trigger) {\n throw new Error(`The provided animation trigger \"${name}\" has not been registered!`);\n }\n return trigger;\n }\n trigger(element, triggerName, value, defaultToFallback = true) {\n const trigger = this._getTrigger(triggerName);\n const player = new TransitionAnimationPlayer(this.id, triggerName, element);\n let triggersWithStates = this._engine.statesByElement.get(element);\n if (!triggersWithStates) {\n addClass(element, NG_TRIGGER_CLASSNAME);\n addClass(element, NG_TRIGGER_CLASSNAME + '-' + triggerName);\n this._engine.statesByElement.set(element, triggersWithStates = {});\n }\n let fromState = triggersWithStates[triggerName];\n const toState = new StateValue(value, this.id);\n const isObj = value && value.hasOwnProperty('value');\n if (!isObj && fromState) {\n toState.absorbOptions(fromState.options);\n }\n triggersWithStates[triggerName] = toState;\n if (!fromState) {\n fromState = DEFAULT_STATE_VALUE;\n }\n const isRemoval = toState.value === VOID_VALUE;\n // normally this isn't reached by here, however, if an object expression\n // is passed in then it may be a new object each time. Comparing the value\n // is important since that will stay the same despite there being a new object.\n // The removal arc here is special cased because the same element is triggered\n // twice in the event that it contains animations on the outer/inner portions\n // of the host container\n if (!isRemoval && fromState.value === toState.value) {\n // this means that despite the value not changing, some inner params\n // have changed which means that the animation final styles need to be applied\n if (!objEquals(fromState.params, toState.params)) {\n const errors = [];\n const fromStyles = trigger.matchStyles(fromState.value, fromState.params, errors);\n const toStyles = trigger.matchStyles(toState.value, toState.params, errors);\n if (errors.length) {\n this._engine.reportError(errors);\n }\n else {\n this._engine.afterFlush(() => {\n eraseStyles(element, fromStyles);\n setStyles(element, toStyles);\n });\n }\n }\n return;\n }\n const playersOnElement = getOrSetAsInMap(this._engine.playersByElement, element, []);\n playersOnElement.forEach(player => {\n // only remove the player if it is queued on the EXACT same trigger/namespace\n // we only also deal with queued players here because if the animation has\n // started then we want to keep the player alive until the flush happens\n // (which is where the previousPlayers are passed into the new palyer)\n if (player.namespaceId == this.id && player.triggerName == triggerName && player.queued) {\n player.destroy();\n }\n });\n let transition = trigger.matchTransition(fromState.value, toState.value, element, toState.params);\n let isFallbackTransition = false;\n if (!transition) {\n if (!defaultToFallback)\n return;\n transition = trigger.fallbackTransition;\n isFallbackTransition = true;\n }\n this._engine.totalQueuedPlayers++;\n this._queue.push({ element, triggerName, transition, fromState, toState, player, isFallbackTransition });\n if (!isFallbackTransition) {\n addClass(element, QUEUED_CLASSNAME);\n player.onStart(() => {\n removeClass(element, QUEUED_CLASSNAME);\n });\n }\n player.onDone(() => {\n let index = this.players.indexOf(player);\n if (index >= 0) {\n this.players.splice(index, 1);\n }\n const players = this._engine.playersByElement.get(element);\n if (players) {\n let index = players.indexOf(player);\n if (index >= 0) {\n players.splice(index, 1);\n }\n }\n });\n this.players.push(player);\n playersOnElement.push(player);\n return player;\n }\n deregister(name) {\n delete this._triggers[name];\n this._engine.statesByElement.forEach((stateMap, element) => {\n delete stateMap[name];\n });\n this._elementListeners.forEach((listeners, element) => {\n this._elementListeners.set(element, listeners.filter(entry => {\n return entry.name != name;\n }));\n });\n }\n clearElementCache(element) {\n this._engine.statesByElement.delete(element);\n this._elementListeners.delete(element);\n const elementPlayers = this._engine.playersByElement.get(element);\n if (elementPlayers) {\n elementPlayers.forEach(player => player.destroy());\n this._engine.playersByElement.delete(element);\n }\n }\n _signalRemovalForInnerTriggers(rootElement, context) {\n const elements = this._engine.driver.query(rootElement, NG_TRIGGER_SELECTOR, true);\n // emulate a leave animation for all inner nodes within this node.\n // If there are no animations found for any of the nodes then clear the cache\n // for the element.\n elements.forEach(elm => {\n // this means that an inner remove() operation has already kicked off\n // the animation on this element...\n if (elm[REMOVAL_FLAG])\n return;\n const namespaces = this._engine.fetchNamespacesByElement(elm);\n if (namespaces.size) {\n namespaces.forEach(ns => ns.triggerLeaveAnimation(elm, context, false, true));\n }\n else {\n this.clearElementCache(elm);\n }\n });\n // If the child elements were removed along with the parent, their animations might not\n // have completed. Clear all the elements from the cache so we don't end up with a memory leak.\n this._engine.afterFlushAnimationsDone(() => elements.forEach(elm => this.clearElementCache(elm)));\n }\n triggerLeaveAnimation(element, context, destroyAfterComplete, defaultToFallback) {\n const triggerStates = this._engine.statesByElement.get(element);\n if (triggerStates) {\n const players = [];\n Object.keys(triggerStates).forEach(triggerName => {\n // this check is here in the event that an element is removed\n // twice (both on the host level and the component level)\n if (this._triggers[triggerName]) {\n const player = this.trigger(element, triggerName, VOID_VALUE, defaultToFallback);\n if (player) {\n players.push(player);\n }\n }\n });\n if (players.length) {\n this._engine.markElementAsRemoved(this.id, element, true, context);\n if (destroyAfterComplete) {\n optimizeGroupPlayer(players).onDone(() => this._engine.processLeaveNode(element));\n }\n return true;\n }\n }\n return false;\n }\n prepareLeaveAnimationListeners(element) {\n const listeners = this._elementListeners.get(element);\n if (listeners) {\n const visitedTriggers = new Set();\n listeners.forEach(listener => {\n const triggerName = listener.name;\n if (visitedTriggers.has(triggerName))\n return;\n visitedTriggers.add(triggerName);\n const trigger = this._triggers[triggerName];\n const transition = trigger.fallbackTransition;\n const elementStates = this._engine.statesByElement.get(element);\n const fromState = elementStates[triggerName] || DEFAULT_STATE_VALUE;\n const toState = new StateValue(VOID_VALUE);\n const player = new TransitionAnimationPlayer(this.id, triggerName, element);\n this._engine.totalQueuedPlayers++;\n this._queue.push({\n element,\n triggerName,\n transition,\n fromState,\n toState,\n player,\n isFallbackTransition: true\n });\n });\n }\n }\n removeNode(element, context) {\n const engine = this._engine;\n if (element.childElementCount) {\n this._signalRemovalForInnerTriggers(element, context);\n }\n // this means that a * => VOID animation was detected and kicked off\n if (this.triggerLeaveAnimation(element, context, true))\n return;\n // find the player that is animating and make sure that the\n // removal is delayed until that player has completed\n let containsPotentialParentTransition = false;\n if (engine.totalAnimations) {\n const currentPlayers = engine.players.length ? engine.playersByQueriedElement.get(element) : [];\n // when this `if statement` does not continue forward it means that\n // a previous animation query has selected the current element and\n // is animating it. In this situation want to continue forwards and\n // allow the element to be queued up for animation later.\n if (currentPlayers && currentPlayers.length) {\n containsPotentialParentTransition = true;\n }\n else {\n let parent = element;\n while (parent = parent.parentNode) {\n const triggers = engine.statesByElement.get(parent);\n if (triggers) {\n containsPotentialParentTransition = true;\n break;\n }\n }\n }\n }\n // at this stage we know that the element will either get removed\n // during flush or will be picked up by a parent query. Either way\n // we need to fire the listeners for this element when it DOES get\n // removed (once the query parent animation is done or after flush)\n this.prepareLeaveAnimationListeners(element);\n // whether or not a parent has an animation we need to delay the deferral of the leave\n // operation until we have more information (which we do after flush() has been called)\n if (containsPotentialParentTransition) {\n engine.markElementAsRemoved(this.id, element, false, context);\n }\n else {\n const removalFlag = element[REMOVAL_FLAG];\n if (!removalFlag || removalFlag === NULL_REMOVAL_STATE) {\n // we do this after the flush has occurred such\n // that the callbacks can be fired\n engine.afterFlush(() => this.clearElementCache(element));\n engine.destroyInnerAnimations(element);\n engine._onRemovalComplete(element, context);\n }\n }\n }\n insertNode(element, parent) {\n addClass(element, this._hostClassName);\n }\n drainQueuedTransitions(microtaskId) {\n const instructions = [];\n this._queue.forEach(entry => {\n const player = entry.player;\n if (player.destroyed)\n return;\n const element = entry.element;\n const listeners = this._elementListeners.get(element);\n if (listeners) {\n listeners.forEach((listener) => {\n if (listener.name == entry.triggerName) {\n const baseEvent = makeAnimationEvent(element, entry.triggerName, entry.fromState.value, entry.toState.value);\n baseEvent['_data'] = microtaskId;\n listenOnPlayer(entry.player, listener.phase, baseEvent, listener.callback);\n }\n });\n }\n if (player.markedForDestroy) {\n this._engine.afterFlush(() => {\n // now we can destroy the element properly since the event listeners have\n // been bound to the player\n player.destroy();\n });\n }\n else {\n instructions.push(entry);\n }\n });\n this._queue = [];\n return instructions.sort((a, b) => {\n // if depCount == 0 them move to front\n // otherwise if a contains b then move back\n const d0 = a.transition.ast.depCount;\n const d1 = b.transition.ast.depCount;\n if (d0 == 0 || d1 == 0) {\n return d0 - d1;\n }\n return this._engine.driver.containsElement(a.element, b.element) ? 1 : -1;\n });\n }\n destroy(context) {\n this.players.forEach(p => p.destroy());\n this._signalRemovalForInnerTriggers(this.hostElement, context);\n }\n elementContainsData(element) {\n let containsData = false;\n if (this._elementListeners.has(element))\n containsData = true;\n containsData =\n (this._queue.find(entry => entry.element === element) ? true : false) || containsData;\n return containsData;\n }\n}\nclass TransitionAnimationEngine {\n constructor(bodyNode, driver, _normalizer) {\n this.bodyNode = bodyNode;\n this.driver = driver;\n this._normalizer = _normalizer;\n this.players = [];\n this.newHostElements = new Map();\n this.playersByElement = new Map();\n this.playersByQueriedElement = new Map();\n this.statesByElement = new Map();\n this.disabledNodes = new Set();\n this.totalAnimations = 0;\n this.totalQueuedPlayers = 0;\n this._namespaceLookup = {};\n this._namespaceList = [];\n this._flushFns = [];\n this._whenQuietFns = [];\n this.namespacesByHostElement = new Map();\n this.collectedEnterElements = [];\n this.collectedLeaveElements = [];\n // this method is designed to be overridden by the code that uses this engine\n this.onRemovalComplete = (element, context) => { };\n }\n /** @internal */\n _onRemovalComplete(element, context) {\n this.onRemovalComplete(element, context);\n }\n get queuedPlayers() {\n const players = [];\n this._namespaceList.forEach(ns => {\n ns.players.forEach(player => {\n if (player.queued) {\n players.push(player);\n }\n });\n });\n return players;\n }\n createNamespace(namespaceId, hostElement) {\n const ns = new AnimationTransitionNamespace(namespaceId, hostElement, this);\n if (hostElement.parentNode) {\n this._balanceNamespaceList(ns, hostElement);\n }\n else {\n // defer this later until flush during when the host element has\n // been inserted so that we know exactly where to place it in\n // the namespace list\n this.newHostElements.set(hostElement, ns);\n // given that this host element is apart of the animation code, it\n // may or may not be inserted by a parent node that is an of an\n // animation renderer type. If this happens then we can still have\n // access to this item when we query for :enter nodes. If the parent\n // is a renderer then the set data-structure will normalize the entry\n this.collectEnterElement(hostElement);\n }\n return this._namespaceLookup[namespaceId] = ns;\n }\n _balanceNamespaceList(ns, hostElement) {\n const limit = this._namespaceList.length - 1;\n if (limit >= 0) {\n let found = false;\n for (let i = limit; i >= 0; i--) {\n const nextNamespace = this._namespaceList[i];\n if (this.driver.containsElement(nextNamespace.hostElement, hostElement)) {\n this._namespaceList.splice(i + 1, 0, ns);\n found = true;\n break;\n }\n }\n if (!found) {\n this._namespaceList.splice(0, 0, ns);\n }\n }\n else {\n this._namespaceList.push(ns);\n }\n this.namespacesByHostElement.set(hostElement, ns);\n return ns;\n }\n register(namespaceId, hostElement) {\n let ns = this._namespaceLookup[namespaceId];\n if (!ns) {\n ns = this.createNamespace(namespaceId, hostElement);\n }\n return ns;\n }\n registerTrigger(namespaceId, name, trigger) {\n let ns = this._namespaceLookup[namespaceId];\n if (ns && ns.register(name, trigger)) {\n this.totalAnimations++;\n }\n }\n destroy(namespaceId, context) {\n if (!namespaceId)\n return;\n const ns = this._fetchNamespace(namespaceId);\n this.afterFlush(() => {\n this.namespacesByHostElement.delete(ns.hostElement);\n delete this._namespaceLookup[namespaceId];\n const index = this._namespaceList.indexOf(ns);\n if (index >= 0) {\n this._namespaceList.splice(index, 1);\n }\n });\n this.afterFlushAnimationsDone(() => ns.destroy(context));\n }\n _fetchNamespace(id) {\n return this._namespaceLookup[id];\n }\n fetchNamespacesByElement(element) {\n // normally there should only be one namespace per element, however\n // if @triggers are placed on both the component element and then\n // its host element (within the component code) then there will be\n // two namespaces returned. We use a set here to simply the dedupe\n // of namespaces incase there are multiple triggers both the elm and host\n const namespaces = new Set();\n const elementStates = this.statesByElement.get(element);\n if (elementStates) {\n const keys = Object.keys(elementStates);\n for (let i = 0; i < keys.length; i++) {\n const nsId = elementStates[keys[i]].namespaceId;\n if (nsId) {\n const ns = this._fetchNamespace(nsId);\n if (ns) {\n namespaces.add(ns);\n }\n }\n }\n }\n return namespaces;\n }\n trigger(namespaceId, element, name, value) {\n if (isElementNode(element)) {\n const ns = this._fetchNamespace(namespaceId);\n if (ns) {\n ns.trigger(element, name, value);\n return true;\n }\n }\n return false;\n }\n insertNode(namespaceId, element, parent, insertBefore) {\n if (!isElementNode(element))\n return;\n // special case for when an element is removed and reinserted (move operation)\n // when this occurs we do not want to use the element for deletion later\n const details = element[REMOVAL_FLAG];\n if (details && details.setForRemoval) {\n details.setForRemoval = false;\n details.setForMove = true;\n const index = this.collectedLeaveElements.indexOf(element);\n if (index >= 0) {\n this.collectedLeaveElements.splice(index, 1);\n }\n }\n // in the event that the namespaceId is blank then the caller\n // code does not contain any animation code in it, but it is\n // just being called so that the node is marked as being inserted\n if (namespaceId) {\n const ns = this._fetchNamespace(namespaceId);\n // This if-statement is a workaround for router issue #21947.\n // The router sometimes hits a race condition where while a route\n // is being instantiated a new navigation arrives, triggering leave\n // animation of DOM that has not been fully initialized, until this\n // is resolved, we need to handle the scenario when DOM is not in a\n // consistent state during the animation.\n if (ns) {\n ns.insertNode(element, parent);\n }\n }\n // only *directives and host elements are inserted before\n if (insertBefore) {\n this.collectEnterElement(element);\n }\n }\n collectEnterElement(element) {\n this.collectedEnterElements.push(element);\n }\n markElementAsDisabled(element, value) {\n if (value) {\n if (!this.disabledNodes.has(element)) {\n this.disabledNodes.add(element);\n addClass(element, DISABLED_CLASSNAME);\n }\n }\n else if (this.disabledNodes.has(element)) {\n this.disabledNodes.delete(element);\n removeClass(element, DISABLED_CLASSNAME);\n }\n }\n removeNode(namespaceId, element, isHostElement, context) {\n if (isElementNode(element)) {\n const ns = namespaceId ? this._fetchNamespace(namespaceId) : null;\n if (ns) {\n ns.removeNode(element, context);\n }\n else {\n this.markElementAsRemoved(namespaceId, element, false, context);\n }\n if (isHostElement) {\n const hostNS = this.namespacesByHostElement.get(element);\n if (hostNS && hostNS.id !== namespaceId) {\n hostNS.removeNode(element, context);\n }\n }\n }\n else {\n this._onRemovalComplete(element, context);\n }\n }\n markElementAsRemoved(namespaceId, element, hasAnimation, context) {\n this.collectedLeaveElements.push(element);\n element[REMOVAL_FLAG] =\n { namespaceId, setForRemoval: context, hasAnimation, removedBeforeQueried: false };\n }\n listen(namespaceId, element, name, phase, callback) {\n if (isElementNode(element)) {\n return this._fetchNamespace(namespaceId).listen(element, name, phase, callback);\n }\n return () => { };\n }\n _buildInstruction(entry, subTimelines, enterClassName, leaveClassName, skipBuildAst) {\n return entry.transition.build(this.driver, entry.element, entry.fromState.value, entry.toState.value, enterClassName, leaveClassName, entry.fromState.options, entry.toState.options, subTimelines, skipBuildAst);\n }\n destroyInnerAnimations(containerElement) {\n let elements = this.driver.query(containerElement, NG_TRIGGER_SELECTOR, true);\n elements.forEach(element => this.destroyActiveAnimationsForElement(element));\n if (this.playersByQueriedElement.size == 0)\n return;\n elements = this.driver.query(containerElement, NG_ANIMATING_SELECTOR, true);\n elements.forEach(element => this.finishActiveQueriedAnimationOnElement(element));\n }\n destroyActiveAnimationsForElement(element) {\n const players = this.playersByElement.get(element);\n if (players) {\n players.forEach(player => {\n // special case for when an element is set for destruction, but hasn't started.\n // in this situation we want to delay the destruction until the flush occurs\n // so that any event listeners attached to the player are triggered.\n if (player.queued) {\n player.markedForDestroy = true;\n }\n else {\n player.destroy();\n }\n });\n }\n }\n finishActiveQueriedAnimationOnElement(element) {\n const players = this.playersByQueriedElement.get(element);\n if (players) {\n players.forEach(player => player.finish());\n }\n }\n whenRenderingDone() {\n return new Promise(resolve => {\n if (this.players.length) {\n return optimizeGroupPlayer(this.players).onDone(() => resolve());\n }\n else {\n resolve();\n }\n });\n }\n processLeaveNode(element) {\n const details = element[REMOVAL_FLAG];\n if (details && details.setForRemoval) {\n // this will prevent it from removing it twice\n element[REMOVAL_FLAG] = NULL_REMOVAL_STATE;\n if (details.namespaceId) {\n this.destroyInnerAnimations(element);\n const ns = this._fetchNamespace(details.namespaceId);\n if (ns) {\n ns.clearElementCache(element);\n }\n }\n this._onRemovalComplete(element, details.setForRemoval);\n }\n if (this.driver.matchesElement(element, DISABLED_SELECTOR)) {\n this.markElementAsDisabled(element, false);\n }\n this.driver.query(element, DISABLED_SELECTOR, true).forEach(node => {\n this.markElementAsDisabled(node, false);\n });\n }\n flush(microtaskId = -1) {\n let players = [];\n if (this.newHostElements.size) {\n this.newHostElements.forEach((ns, element) => this._balanceNamespaceList(ns, element));\n this.newHostElements.clear();\n }\n if (this.totalAnimations && this.collectedEnterElements.length) {\n for (let i = 0; i < this.collectedEnterElements.length; i++) {\n const elm = this.collectedEnterElements[i];\n addClass(elm, STAR_CLASSNAME);\n }\n }\n if (this._namespaceList.length &&\n (this.totalQueuedPlayers || this.collectedLeaveElements.length)) {\n const cleanupFns = [];\n try {\n players = this._flushAnimations(cleanupFns, microtaskId);\n }\n finally {\n for (let i = 0; i < cleanupFns.length; i++) {\n cleanupFns[i]();\n }\n }\n }\n else {\n for (let i = 0; i < this.collectedLeaveElements.length; i++) {\n const element = this.collectedLeaveElements[i];\n this.processLeaveNode(element);\n }\n }\n this.totalQueuedPlayers = 0;\n this.collectedEnterElements.length = 0;\n this.collectedLeaveElements.length = 0;\n this._flushFns.forEach(fn => fn());\n this._flushFns = [];\n if (this._whenQuietFns.length) {\n // we move these over to a variable so that\n // if any new callbacks are registered in another\n // flush they do not populate the existing set\n const quietFns = this._whenQuietFns;\n this._whenQuietFns = [];\n if (players.length) {\n optimizeGroupPlayer(players).onDone(() => {\n quietFns.forEach(fn => fn());\n });\n }\n else {\n quietFns.forEach(fn => fn());\n }\n }\n }\n reportError(errors) {\n throw new Error(`Unable to process animations due to the following failed trigger transitions\\n ${errors.join('\\n')}`);\n }\n _flushAnimations(cleanupFns, microtaskId) {\n const subTimelines = new ElementInstructionMap();\n const skippedPlayers = [];\n const skippedPlayersMap = new Map();\n const queuedInstructions = [];\n const queriedElements = new Map();\n const allPreStyleElements = new Map();\n const allPostStyleElements = new Map();\n const disabledElementsSet = new Set();\n this.disabledNodes.forEach(node => {\n disabledElementsSet.add(node);\n const nodesThatAreDisabled = this.driver.query(node, QUEUED_SELECTOR, true);\n for (let i = 0; i < nodesThatAreDisabled.length; i++) {\n disabledElementsSet.add(nodesThatAreDisabled[i]);\n }\n });\n const bodyNode = this.bodyNode;\n const allTriggerElements = Array.from(this.statesByElement.keys());\n const enterNodeMap = buildRootMap(allTriggerElements, this.collectedEnterElements);\n // this must occur before the instructions are built below such that\n // the :enter queries match the elements (since the timeline queries\n // are fired during instruction building).\n const enterNodeMapIds = new Map();\n let i = 0;\n enterNodeMap.forEach((nodes, root) => {\n const className = ENTER_CLASSNAME + i++;\n enterNodeMapIds.set(root, className);\n nodes.forEach(node => addClass(node, className));\n });\n const allLeaveNodes = [];\n const mergedLeaveNodes = new Set();\n const leaveNodesWithoutAnimations = new Set();\n for (let i = 0; i < this.collectedLeaveElements.length; i++) {\n const element = this.collectedLeaveElements[i];\n const details = element[REMOVAL_FLAG];\n if (details && details.setForRemoval) {\n allLeaveNodes.push(element);\n mergedLeaveNodes.add(element);\n if (details.hasAnimation) {\n this.driver.query(element, STAR_SELECTOR, true).forEach(elm => mergedLeaveNodes.add(elm));\n }\n else {\n leaveNodesWithoutAnimations.add(element);\n }\n }\n }\n const leaveNodeMapIds = new Map();\n const leaveNodeMap = buildRootMap(allTriggerElements, Array.from(mergedLeaveNodes));\n leaveNodeMap.forEach((nodes, root) => {\n const className = LEAVE_CLASSNAME + i++;\n leaveNodeMapIds.set(root, className);\n nodes.forEach(node => addClass(node, className));\n });\n cleanupFns.push(() => {\n enterNodeMap.forEach((nodes, root) => {\n const className = enterNodeMapIds.get(root);\n nodes.forEach(node => removeClass(node, className));\n });\n leaveNodeMap.forEach((nodes, root) => {\n const className = leaveNodeMapIds.get(root);\n nodes.forEach(node => removeClass(node, className));\n });\n allLeaveNodes.forEach(element => {\n this.processLeaveNode(element);\n });\n });\n const allPlayers = [];\n const erroneousTransitions = [];\n for (let i = this._namespaceList.length - 1; i >= 0; i--) {\n const ns = this._namespaceList[i];\n ns.drainQueuedTransitions(microtaskId).forEach(entry => {\n const player = entry.player;\n const element = entry.element;\n allPlayers.push(player);\n if (this.collectedEnterElements.length) {\n const details = element[REMOVAL_FLAG];\n // move animations are currently not supported...\n if (details && details.setForMove) {\n player.destroy();\n return;\n }\n }\n const nodeIsOrphaned = !bodyNode || !this.driver.containsElement(bodyNode, element);\n const leaveClassName = leaveNodeMapIds.get(element);\n const enterClassName = enterNodeMapIds.get(element);\n const instruction = this._buildInstruction(entry, subTimelines, enterClassName, leaveClassName, nodeIsOrphaned);\n if (instruction.errors && instruction.errors.length) {\n erroneousTransitions.push(instruction);\n return;\n }\n // even though the element may not be apart of the DOM, it may\n // still be added at a later point (due to the mechanics of content\n // projection and/or dynamic component insertion) therefore it's\n // important we still style the element.\n if (nodeIsOrphaned) {\n player.onStart(() => eraseStyles(element, instruction.fromStyles));\n player.onDestroy(() => setStyles(element, instruction.toStyles));\n skippedPlayers.push(player);\n return;\n }\n // if a unmatched transition is queued to go then it SHOULD NOT render\n // an animation and cancel the previously running animations.\n if (entry.isFallbackTransition) {\n player.onStart(() => eraseStyles(element, instruction.fromStyles));\n player.onDestroy(() => setStyles(element, instruction.toStyles));\n skippedPlayers.push(player);\n return;\n }\n // this means that if a parent animation uses this animation as a sub trigger\n // then it will instruct the timeline builder to not add a player delay, but\n // instead stretch the first keyframe gap up until the animation starts. The\n // reason this is important is to prevent extra initialization styles from being\n // required by the user in the animation.\n instruction.timelines.forEach(tl => tl.stretchStartingKeyframe = true);\n subTimelines.append(element, instruction.timelines);\n const tuple = { instruction, player, element };\n queuedInstructions.push(tuple);\n instruction.queriedElements.forEach(element => getOrSetAsInMap(queriedElements, element, []).push(player));\n instruction.preStyleProps.forEach((stringMap, element) => {\n const props = Object.keys(stringMap);\n if (props.length) {\n let setVal = allPreStyleElements.get(element);\n if (!setVal) {\n allPreStyleElements.set(element, setVal = new Set());\n }\n props.forEach(prop => setVal.add(prop));\n }\n });\n instruction.postStyleProps.forEach((stringMap, element) => {\n const props = Object.keys(stringMap);\n let setVal = allPostStyleElements.get(element);\n if (!setVal) {\n allPostStyleElements.set(element, setVal = new Set());\n }\n props.forEach(prop => setVal.add(prop));\n });\n });\n }\n if (erroneousTransitions.length) {\n const errors = [];\n erroneousTransitions.forEach(instruction => {\n errors.push(`@${instruction.triggerName} has failed due to:\\n`);\n instruction.errors.forEach(error => errors.push(`- ${error}\\n`));\n });\n allPlayers.forEach(player => player.destroy());\n this.reportError(errors);\n }\n const allPreviousPlayersMap = new Map();\n // this map works to tell which element in the DOM tree is contained by\n // which animation. Further down below this map will get populated once\n // the players are built and in doing so it can efficiently figure out\n // if a sub player is skipped due to a parent player having priority.\n const animationElementMap = new Map();\n queuedInstructions.forEach(entry => {\n const element = entry.element;\n if (subTimelines.has(element)) {\n animationElementMap.set(element, element);\n this._beforeAnimationBuild(entry.player.namespaceId, entry.instruction, allPreviousPlayersMap);\n }\n });\n skippedPlayers.forEach(player => {\n const element = player.element;\n const previousPlayers = this._getPreviousPlayers(element, false, player.namespaceId, player.triggerName, null);\n previousPlayers.forEach(prevPlayer => {\n getOrSetAsInMap(allPreviousPlayersMap, element, []).push(prevPlayer);\n prevPlayer.destroy();\n });\n });\n // this is a special case for nodes that will be removed (either by)\n // having their own leave animations or by being queried in a container\n // that will be removed once a parent animation is complete. The idea\n // here is that * styles must be identical to ! styles because of\n // backwards compatibility (* is also filled in by default in many places).\n // Otherwise * styles will return an empty value or auto since the element\n // that is being getComputedStyle'd will not be visible (since * = destination)\n const replaceNodes = allLeaveNodes.filter(node => {\n return replacePostStylesAsPre(node, allPreStyleElements, allPostStyleElements);\n });\n // POST STAGE: fill the * styles\n const postStylesMap = new Map();\n const allLeaveQueriedNodes = cloakAndComputeStyles(postStylesMap, this.driver, leaveNodesWithoutAnimations, allPostStyleElements, AUTO_STYLE);\n allLeaveQueriedNodes.forEach(node => {\n if (replacePostStylesAsPre(node, allPreStyleElements, allPostStyleElements)) {\n replaceNodes.push(node);\n }\n });\n // PRE STAGE: fill the ! styles\n const preStylesMap = new Map();\n enterNodeMap.forEach((nodes, root) => {\n cloakAndComputeStyles(preStylesMap, this.driver, new Set(nodes), allPreStyleElements, ɵPRE_STYLE);\n });\n replaceNodes.forEach(node => {\n const post = postStylesMap.get(node);\n const pre = preStylesMap.get(node);\n postStylesMap.set(node, Object.assign(Object.assign({}, post), pre));\n });\n const rootPlayers = [];\n const subPlayers = [];\n const NO_PARENT_ANIMATION_ELEMENT_DETECTED = {};\n queuedInstructions.forEach(entry => {\n const { element, player, instruction } = entry;\n // this means that it was never consumed by a parent animation which\n // means that it is independent and therefore should be set for animation\n if (subTimelines.has(element)) {\n if (disabledElementsSet.has(element)) {\n player.onDestroy(() => setStyles(element, instruction.toStyles));\n player.disabled = true;\n player.overrideTotalTime(instruction.totalTime);\n skippedPlayers.push(player);\n return;\n }\n // this will flow up the DOM and query the map to figure out\n // if a parent animation has priority over it. In the situation\n // that a parent is detected then it will cancel the loop. If\n // nothing is detected, or it takes a few hops to find a parent,\n // then it will fill in the missing nodes and signal them as having\n // a detected parent (or a NO_PARENT value via a special constant).\n let parentWithAnimation = NO_PARENT_ANIMATION_ELEMENT_DETECTED;\n if (animationElementMap.size > 1) {\n let elm = element;\n const parentsToAdd = [];\n while (elm = elm.parentNode) {\n const detectedParent = animationElementMap.get(elm);\n if (detectedParent) {\n parentWithAnimation = detectedParent;\n break;\n }\n parentsToAdd.push(elm);\n }\n parentsToAdd.forEach(parent => animationElementMap.set(parent, parentWithAnimation));\n }\n const innerPlayer = this._buildAnimation(player.namespaceId, instruction, allPreviousPlayersMap, skippedPlayersMap, preStylesMap, postStylesMap);\n player.setRealPlayer(innerPlayer);\n if (parentWithAnimation === NO_PARENT_ANIMATION_ELEMENT_DETECTED) {\n rootPlayers.push(player);\n }\n else {\n const parentPlayers = this.playersByElement.get(parentWithAnimation);\n if (parentPlayers && parentPlayers.length) {\n player.parentPlayer = optimizeGroupPlayer(parentPlayers);\n }\n skippedPlayers.push(player);\n }\n }\n else {\n eraseStyles(element, instruction.fromStyles);\n player.onDestroy(() => setStyles(element, instruction.toStyles));\n // there still might be a ancestor player animating this\n // element therefore we will still add it as a sub player\n // even if its animation may be disabled\n subPlayers.push(player);\n if (disabledElementsSet.has(element)) {\n skippedPlayers.push(player);\n }\n }\n });\n // find all of the sub players' corresponding inner animation player\n subPlayers.forEach(player => {\n // even if any players are not found for a sub animation then it\n // will still complete itself after the next tick since it's Noop\n const playersForElement = skippedPlayersMap.get(player.element);\n if (playersForElement && playersForElement.length) {\n const innerPlayer = optimizeGroupPlayer(playersForElement);\n player.setRealPlayer(innerPlayer);\n }\n });\n // the reason why we don't actually play the animation is\n // because all that a skipped player is designed to do is to\n // fire the start/done transition callback events\n skippedPlayers.forEach(player => {\n if (player.parentPlayer) {\n player.syncPlayerEvents(player.parentPlayer);\n }\n else {\n player.destroy();\n }\n });\n // run through all of the queued removals and see if they\n // were picked up by a query. If not then perform the removal\n // operation right away unless a parent animation is ongoing.\n for (let i = 0; i < allLeaveNodes.length; i++) {\n const element = allLeaveNodes[i];\n const details = element[REMOVAL_FLAG];\n removeClass(element, LEAVE_CLASSNAME);\n // this means the element has a removal animation that is being\n // taken care of and therefore the inner elements will hang around\n // until that animation is over (or the parent queried animation)\n if (details && details.hasAnimation)\n continue;\n let players = [];\n // if this element is queried or if it contains queried children\n // then we want for the element not to be removed from the page\n // until the queried animations have finished\n if (queriedElements.size) {\n let queriedPlayerResults = queriedElements.get(element);\n if (queriedPlayerResults && queriedPlayerResults.length) {\n players.push(...queriedPlayerResults);\n }\n let queriedInnerElements = this.driver.query(element, NG_ANIMATING_SELECTOR, true);\n for (let j = 0; j < queriedInnerElements.length; j++) {\n let queriedPlayers = queriedElements.get(queriedInnerElements[j]);\n if (queriedPlayers && queriedPlayers.length) {\n players.push(...queriedPlayers);\n }\n }\n }\n const activePlayers = players.filter(p => !p.destroyed);\n if (activePlayers.length) {\n removeNodesAfterAnimationDone(this, element, activePlayers);\n }\n else {\n this.processLeaveNode(element);\n }\n }\n // this is required so the cleanup method doesn't remove them\n allLeaveNodes.length = 0;\n rootPlayers.forEach(player => {\n this.players.push(player);\n player.onDone(() => {\n player.destroy();\n const index = this.players.indexOf(player);\n this.players.splice(index, 1);\n });\n player.play();\n });\n return rootPlayers;\n }\n elementContainsData(namespaceId, element) {\n let containsData = false;\n const details = element[REMOVAL_FLAG];\n if (details && details.setForRemoval)\n containsData = true;\n if (this.playersByElement.has(element))\n containsData = true;\n if (this.playersByQueriedElement.has(element))\n containsData = true;\n if (this.statesByElement.has(element))\n containsData = true;\n return this._fetchNamespace(namespaceId).elementContainsData(element) || containsData;\n }\n afterFlush(callback) {\n this._flushFns.push(callback);\n }\n afterFlushAnimationsDone(callback) {\n this._whenQuietFns.push(callback);\n }\n _getPreviousPlayers(element, isQueriedElement, namespaceId, triggerName, toStateValue) {\n let players = [];\n if (isQueriedElement) {\n const queriedElementPlayers = this.playersByQueriedElement.get(element);\n if (queriedElementPlayers) {\n players = queriedElementPlayers;\n }\n }\n else {\n const elementPlayers = this.playersByElement.get(element);\n if (elementPlayers) {\n const isRemovalAnimation = !toStateValue || toStateValue == VOID_VALUE;\n elementPlayers.forEach(player => {\n if (player.queued)\n return;\n if (!isRemovalAnimation && player.triggerName != triggerName)\n return;\n players.push(player);\n });\n }\n }\n if (namespaceId || triggerName) {\n players = players.filter(player => {\n if (namespaceId && namespaceId != player.namespaceId)\n return false;\n if (triggerName && triggerName != player.triggerName)\n return false;\n return true;\n });\n }\n return players;\n }\n _beforeAnimationBuild(namespaceId, instruction, allPreviousPlayersMap) {\n const triggerName = instruction.triggerName;\n const rootElement = instruction.element;\n // when a removal animation occurs, ALL previous players are collected\n // and destroyed (even if they are outside of the current namespace)\n const targetNameSpaceId = instruction.isRemovalTransition ? undefined : namespaceId;\n const targetTriggerName = instruction.isRemovalTransition ? undefined : triggerName;\n for (const timelineInstruction of instruction.timelines) {\n const element = timelineInstruction.element;\n const isQueriedElement = element !== rootElement;\n const players = getOrSetAsInMap(allPreviousPlayersMap, element, []);\n const previousPlayers = this._getPreviousPlayers(element, isQueriedElement, targetNameSpaceId, targetTriggerName, instruction.toState);\n previousPlayers.forEach(player => {\n const realPlayer = player.getRealPlayer();\n if (realPlayer.beforeDestroy) {\n realPlayer.beforeDestroy();\n }\n player.destroy();\n players.push(player);\n });\n }\n // this needs to be done so that the PRE/POST styles can be\n // computed properly without interfering with the previous animation\n eraseStyles(rootElement, instruction.fromStyles);\n }\n _buildAnimation(namespaceId, instruction, allPreviousPlayersMap, skippedPlayersMap, preStylesMap, postStylesMap) {\n const triggerName = instruction.triggerName;\n const rootElement = instruction.element;\n // we first run this so that the previous animation player\n // data can be passed into the successive animation players\n const allQueriedPlayers = [];\n const allConsumedElements = new Set();\n const allSubElements = new Set();\n const allNewPlayers = instruction.timelines.map(timelineInstruction => {\n const element = timelineInstruction.element;\n allConsumedElements.add(element);\n // FIXME (matsko): make sure to-be-removed animations are removed properly\n const details = element[REMOVAL_FLAG];\n if (details && details.removedBeforeQueried)\n return new NoopAnimationPlayer(timelineInstruction.duration, timelineInstruction.delay);\n const isQueriedElement = element !== rootElement;\n const previousPlayers = flattenGroupPlayers((allPreviousPlayersMap.get(element) || EMPTY_PLAYER_ARRAY)\n .map(p => p.getRealPlayer()))\n .filter(p => {\n // the `element` is not apart of the AnimationPlayer definition, but\n // Mock/WebAnimations\n // use the element within their implementation. This will be added in Angular5 to\n // AnimationPlayer\n const pp = p;\n return pp.element ? pp.element === element : false;\n });\n const preStyles = preStylesMap.get(element);\n const postStyles = postStylesMap.get(element);\n const keyframes = normalizeKeyframes(this.driver, this._normalizer, element, timelineInstruction.keyframes, preStyles, postStyles);\n const player = this._buildPlayer(timelineInstruction, keyframes, previousPlayers);\n // this means that this particular player belongs to a sub trigger. It is\n // important that we match this player up with the corresponding (@trigger.listener)\n if (timelineInstruction.subTimeline && skippedPlayersMap) {\n allSubElements.add(element);\n }\n if (isQueriedElement) {\n const wrappedPlayer = new TransitionAnimationPlayer(namespaceId, triggerName, element);\n wrappedPlayer.setRealPlayer(player);\n allQueriedPlayers.push(wrappedPlayer);\n }\n return player;\n });\n allQueriedPlayers.forEach(player => {\n getOrSetAsInMap(this.playersByQueriedElement, player.element, []).push(player);\n player.onDone(() => deleteOrUnsetInMap(this.playersByQueriedElement, player.element, player));\n });\n allConsumedElements.forEach(element => addClass(element, NG_ANIMATING_CLASSNAME));\n const player = optimizeGroupPlayer(allNewPlayers);\n player.onDestroy(() => {\n allConsumedElements.forEach(element => removeClass(element, NG_ANIMATING_CLASSNAME));\n setStyles(rootElement, instruction.toStyles);\n });\n // this basically makes all of the callbacks for sub element animations\n // be dependent on the upper players for when they finish\n allSubElements.forEach(element => {\n getOrSetAsInMap(skippedPlayersMap, element, []).push(player);\n });\n return player;\n }\n _buildPlayer(instruction, keyframes, previousPlayers) {\n if (keyframes.length > 0) {\n return this.driver.animate(instruction.element, keyframes, instruction.duration, instruction.delay, instruction.easing, previousPlayers);\n }\n // special case for when an empty transition|definition is provided\n // ... there is no point in rendering an empty animation\n return new NoopAnimationPlayer(instruction.duration, instruction.delay);\n }\n}\nclass TransitionAnimationPlayer {\n constructor(namespaceId, triggerName, element) {\n this.namespaceId = namespaceId;\n this.triggerName = triggerName;\n this.element = element;\n this._player = new NoopAnimationPlayer();\n this._containsRealPlayer = false;\n this._queuedCallbacks = {};\n this.destroyed = false;\n this.markedForDestroy = false;\n this.disabled = false;\n this.queued = true;\n this.totalTime = 0;\n }\n setRealPlayer(player) {\n if (this._containsRealPlayer)\n return;\n this._player = player;\n Object.keys(this._queuedCallbacks).forEach(phase => {\n this._queuedCallbacks[phase].forEach(callback => listenOnPlayer(player, phase, undefined, callback));\n });\n this._queuedCallbacks = {};\n this._containsRealPlayer = true;\n this.overrideTotalTime(player.totalTime);\n this.queued = false;\n }\n getRealPlayer() {\n return this._player;\n }\n overrideTotalTime(totalTime) {\n this.totalTime = totalTime;\n }\n syncPlayerEvents(player) {\n const p = this._player;\n if (p.triggerCallback) {\n player.onStart(() => p.triggerCallback('start'));\n }\n player.onDone(() => this.finish());\n player.onDestroy(() => this.destroy());\n }\n _queueEvent(name, callback) {\n getOrSetAsInMap(this._queuedCallbacks, name, []).push(callback);\n }\n onDone(fn) {\n if (this.queued) {\n this._queueEvent('done', fn);\n }\n this._player.onDone(fn);\n }\n onStart(fn) {\n if (this.queued) {\n this._queueEvent('start', fn);\n }\n this._player.onStart(fn);\n }\n onDestroy(fn) {\n if (this.queued) {\n this._queueEvent('destroy', fn);\n }\n this._player.onDestroy(fn);\n }\n init() {\n this._player.init();\n }\n hasStarted() {\n return this.queued ? false : this._player.hasStarted();\n }\n play() {\n !this.queued && this._player.play();\n }\n pause() {\n !this.queued && this._player.pause();\n }\n restart() {\n !this.queued && this._player.restart();\n }\n finish() {\n this._player.finish();\n }\n destroy() {\n this.destroyed = true;\n this._player.destroy();\n }\n reset() {\n !this.queued && this._player.reset();\n }\n setPosition(p) {\n if (!this.queued) {\n this._player.setPosition(p);\n }\n }\n getPosition() {\n return this.queued ? 0 : this._player.getPosition();\n }\n /** @internal */\n triggerCallback(phaseName) {\n const p = this._player;\n if (p.triggerCallback) {\n p.triggerCallback(phaseName);\n }\n }\n}\nfunction deleteOrUnsetInMap(map, key, value) {\n let currentValues;\n if (map instanceof Map) {\n currentValues = map.get(key);\n if (currentValues) {\n if (currentValues.length) {\n const index = currentValues.indexOf(value);\n currentValues.splice(index, 1);\n }\n if (currentValues.length == 0) {\n map.delete(key);\n }\n }\n }\n else {\n currentValues = map[key];\n if (currentValues) {\n if (currentValues.length) {\n const index = currentValues.indexOf(value);\n currentValues.splice(index, 1);\n }\n if (currentValues.length == 0) {\n delete map[key];\n }\n }\n }\n return currentValues;\n}\nfunction normalizeTriggerValue(value) {\n // we use `!= null` here because it's the most simple\n // way to test against a \"falsy\" value without mixing\n // in empty strings or a zero value. DO NOT OPTIMIZE.\n return value != null ? value : null;\n}\nfunction isElementNode(node) {\n return node && node['nodeType'] === 1;\n}\nfunction isTriggerEventValid(eventName) {\n return eventName == 'start' || eventName == 'done';\n}\nfunction cloakElement(element, value) {\n const oldValue = element.style.display;\n element.style.display = value != null ? value : 'none';\n return oldValue;\n}\nfunction cloakAndComputeStyles(valuesMap, driver, elements, elementPropsMap, defaultStyle) {\n const cloakVals = [];\n elements.forEach(element => cloakVals.push(cloakElement(element)));\n const failedElements = [];\n elementPropsMap.forEach((props, element) => {\n const styles = {};\n props.forEach(prop => {\n const value = styles[prop] = driver.computeStyle(element, prop, defaultStyle);\n // there is no easy way to detect this because a sub element could be removed\n // by a parent animation element being detached.\n if (!value || value.length == 0) {\n element[REMOVAL_FLAG] = NULL_REMOVED_QUERIED_STATE;\n failedElements.push(element);\n }\n });\n valuesMap.set(element, styles);\n });\n // we use a index variable here since Set.forEach(a, i) does not return\n // an index value for the closure (but instead just the value)\n let i = 0;\n elements.forEach(element => cloakElement(element, cloakVals[i++]));\n return failedElements;\n}\n/*\nSince the Angular renderer code will return a collection of inserted\nnodes in all areas of a DOM tree, it's up to this algorithm to figure\nout which nodes are roots for each animation @trigger.\n\nBy placing each inserted node into a Set and traversing upwards, it\nis possible to find the @trigger elements and well any direct *star\ninsertion nodes, if a @trigger root is found then the enter element\nis placed into the Map[@trigger] spot.\n */\nfunction buildRootMap(roots, nodes) {\n const rootMap = new Map();\n roots.forEach(root => rootMap.set(root, []));\n if (nodes.length == 0)\n return rootMap;\n const NULL_NODE = 1;\n const nodeSet = new Set(nodes);\n const localRootMap = new Map();\n function getRoot(node) {\n if (!node)\n return NULL_NODE;\n let root = localRootMap.get(node);\n if (root)\n return root;\n const parent = node.parentNode;\n if (rootMap.has(parent)) { // ngIf inside @trigger\n root = parent;\n }\n else if (nodeSet.has(parent)) { // ngIf inside ngIf\n root = NULL_NODE;\n }\n else { // recurse upwards\n root = getRoot(parent);\n }\n localRootMap.set(node, root);\n return root;\n }\n nodes.forEach(node => {\n const root = getRoot(node);\n if (root !== NULL_NODE) {\n rootMap.get(root).push(node);\n }\n });\n return rootMap;\n}\nconst CLASSES_CACHE_KEY = '$$classes';\nfunction containsClass(element, className) {\n if (element.classList) {\n return element.classList.contains(className);\n }\n else {\n const classes = element[CLASSES_CACHE_KEY];\n return classes && classes[className];\n }\n}\nfunction addClass(element, className) {\n if (element.classList) {\n element.classList.add(className);\n }\n else {\n let classes = element[CLASSES_CACHE_KEY];\n if (!classes) {\n classes = element[CLASSES_CACHE_KEY] = {};\n }\n classes[className] = true;\n }\n}\nfunction removeClass(element, className) {\n if (element.classList) {\n element.classList.remove(className);\n }\n else {\n let classes = element[CLASSES_CACHE_KEY];\n if (classes) {\n delete classes[className];\n }\n }\n}\nfunction removeNodesAfterAnimationDone(engine, element, players) {\n optimizeGroupPlayer(players).onDone(() => engine.processLeaveNode(element));\n}\nfunction flattenGroupPlayers(players) {\n const finalPlayers = [];\n _flattenGroupPlayersRecur(players, finalPlayers);\n return finalPlayers;\n}\nfunction _flattenGroupPlayersRecur(players, finalPlayers) {\n for (let i = 0; i < players.length; i++) {\n const player = players[i];\n if (player instanceof ɵAnimationGroupPlayer) {\n _flattenGroupPlayersRecur(player.players, finalPlayers);\n }\n else {\n finalPlayers.push(player);\n }\n }\n}\nfunction objEquals(a, b) {\n const k1 = Object.keys(a);\n const k2 = Object.keys(b);\n if (k1.length != k2.length)\n return false;\n for (let i = 0; i < k1.length; i++) {\n const prop = k1[i];\n if (!b.hasOwnProperty(prop) || a[prop] !== b[prop])\n return false;\n }\n return true;\n}\nfunction replacePostStylesAsPre(element, allPreStyleElements, allPostStyleElements) {\n const postEntry = allPostStyleElements.get(element);\n if (!postEntry)\n return false;\n let preEntry = allPreStyleElements.get(element);\n if (preEntry) {\n postEntry.forEach(data => preEntry.add(data));\n }\n else {\n allPreStyleElements.set(element, postEntry);\n }\n allPostStyleElements.delete(element);\n return true;\n}\n\nclass AnimationEngine {\n constructor(bodyNode, _driver, normalizer) {\n this.bodyNode = bodyNode;\n this._driver = _driver;\n this._triggerCache = {};\n // this method is designed to be overridden by the code that uses this engine\n this.onRemovalComplete = (element, context) => { };\n this._transitionEngine = new TransitionAnimationEngine(bodyNode, _driver, normalizer);\n this._timelineEngine = new TimelineAnimationEngine(bodyNode, _driver, normalizer);\n this._transitionEngine.onRemovalComplete = (element, context) => this.onRemovalComplete(element, context);\n }\n registerTrigger(componentId, namespaceId, hostElement, name, metadata) {\n const cacheKey = componentId + '-' + name;\n let trigger = this._triggerCache[cacheKey];\n if (!trigger) {\n const errors = [];\n const ast = buildAnimationAst(this._driver, metadata, errors);\n if (errors.length) {\n throw new Error(`The animation trigger \"${name}\" has failed to build due to the following errors:\\n - ${errors.join('\\n - ')}`);\n }\n trigger = buildTrigger(name, ast);\n this._triggerCache[cacheKey] = trigger;\n }\n this._transitionEngine.registerTrigger(namespaceId, name, trigger);\n }\n register(namespaceId, hostElement) {\n this._transitionEngine.register(namespaceId, hostElement);\n }\n destroy(namespaceId, context) {\n this._transitionEngine.destroy(namespaceId, context);\n }\n onInsert(namespaceId, element, parent, insertBefore) {\n this._transitionEngine.insertNode(namespaceId, element, parent, insertBefore);\n }\n onRemove(namespaceId, element, context, isHostElement) {\n this._transitionEngine.removeNode(namespaceId, element, isHostElement || false, context);\n }\n disableAnimations(element, disable) {\n this._transitionEngine.markElementAsDisabled(element, disable);\n }\n process(namespaceId, element, property, value) {\n if (property.charAt(0) == '@') {\n const [id, action] = parseTimelineCommand(property);\n const args = value;\n this._timelineEngine.command(id, element, action, args);\n }\n else {\n this._transitionEngine.trigger(namespaceId, element, property, value);\n }\n }\n listen(namespaceId, element, eventName, eventPhase, callback) {\n // @@listen\n if (eventName.charAt(0) == '@') {\n const [id, action] = parseTimelineCommand(eventName);\n return this._timelineEngine.listen(id, element, action, callback);\n }\n return this._transitionEngine.listen(namespaceId, element, eventName, eventPhase, callback);\n }\n flush(microtaskId = -1) {\n this._transitionEngine.flush(microtaskId);\n }\n get players() {\n return this._transitionEngine.players\n .concat(this._timelineEngine.players);\n }\n whenRenderingDone() {\n return this._transitionEngine.whenRenderingDone();\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Returns an instance of `SpecialCasedStyles` if and when any special (non animateable) styles are\n * detected.\n *\n * In CSS there exist properties that cannot be animated within a keyframe animation\n * (whether it be via CSS keyframes or web-animations) and the animation implementation\n * will ignore them. This function is designed to detect those special cased styles and\n * return a container that will be executed at the start and end of the animation.\n *\n * @returns an instance of `SpecialCasedStyles` if any special styles are detected otherwise `null`\n */\nfunction packageNonAnimatableStyles(element, styles) {\n let startStyles = null;\n let endStyles = null;\n if (Array.isArray(styles) && styles.length) {\n startStyles = filterNonAnimatableStyles(styles[0]);\n if (styles.length > 1) {\n endStyles = filterNonAnimatableStyles(styles[styles.length - 1]);\n }\n }\n else if (styles) {\n startStyles = filterNonAnimatableStyles(styles);\n }\n return (startStyles || endStyles) ? new SpecialCasedStyles(element, startStyles, endStyles) :\n null;\n}\n/**\n * Designed to be executed during a keyframe-based animation to apply any special-cased styles.\n *\n * When started (when the `start()` method is run) then the provided `startStyles`\n * will be applied. When finished (when the `finish()` method is called) the\n * `endStyles` will be applied as well any any starting styles. Finally when\n * `destroy()` is called then all styles will be removed.\n */\nclass SpecialCasedStyles {\n constructor(_element, _startStyles, _endStyles) {\n this._element = _element;\n this._startStyles = _startStyles;\n this._endStyles = _endStyles;\n this._state = 0 /* Pending */;\n let initialStyles = SpecialCasedStyles.initialStylesByElement.get(_element);\n if (!initialStyles) {\n SpecialCasedStyles.initialStylesByElement.set(_element, initialStyles = {});\n }\n this._initialStyles = initialStyles;\n }\n start() {\n if (this._state < 1 /* Started */) {\n if (this._startStyles) {\n setStyles(this._element, this._startStyles, this._initialStyles);\n }\n this._state = 1 /* Started */;\n }\n }\n finish() {\n this.start();\n if (this._state < 2 /* Finished */) {\n setStyles(this._element, this._initialStyles);\n if (this._endStyles) {\n setStyles(this._element, this._endStyles);\n this._endStyles = null;\n }\n this._state = 1 /* Started */;\n }\n }\n destroy() {\n this.finish();\n if (this._state < 3 /* Destroyed */) {\n SpecialCasedStyles.initialStylesByElement.delete(this._element);\n if (this._startStyles) {\n eraseStyles(this._element, this._startStyles);\n this._endStyles = null;\n }\n if (this._endStyles) {\n eraseStyles(this._element, this._endStyles);\n this._endStyles = null;\n }\n setStyles(this._element, this._initialStyles);\n this._state = 3 /* Destroyed */;\n }\n }\n}\nSpecialCasedStyles.initialStylesByElement = new WeakMap();\nfunction filterNonAnimatableStyles(styles) {\n let result = null;\n const props = Object.keys(styles);\n for (let i = 0; i < props.length; i++) {\n const prop = props[i];\n if (isNonAnimatableStyle(prop)) {\n result = result || {};\n result[prop] = styles[prop];\n }\n }\n return result;\n}\nfunction isNonAnimatableStyle(prop) {\n return prop === 'display' || prop === 'position';\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst ELAPSED_TIME_MAX_DECIMAL_PLACES = 3;\nconst ANIMATION_PROP = 'animation';\nconst ANIMATIONEND_EVENT = 'animationend';\nconst ONE_SECOND$1 = 1000;\nclass ElementAnimationStyleHandler {\n constructor(_element, _name, _duration, _delay, _easing, _fillMode, _onDoneFn) {\n this._element = _element;\n this._name = _name;\n this._duration = _duration;\n this._delay = _delay;\n this._easing = _easing;\n this._fillMode = _fillMode;\n this._onDoneFn = _onDoneFn;\n this._finished = false;\n this._destroyed = false;\n this._startTime = 0;\n this._position = 0;\n this._eventFn = (e) => this._handleCallback(e);\n }\n apply() {\n applyKeyframeAnimation(this._element, `${this._duration}ms ${this._easing} ${this._delay}ms 1 normal ${this._fillMode} ${this._name}`);\n addRemoveAnimationEvent(this._element, this._eventFn, false);\n this._startTime = Date.now();\n }\n pause() {\n playPauseAnimation(this._element, this._name, 'paused');\n }\n resume() {\n playPauseAnimation(this._element, this._name, 'running');\n }\n setPosition(position) {\n const index = findIndexForAnimation(this._element, this._name);\n this._position = position * this._duration;\n setAnimationStyle(this._element, 'Delay', `-${this._position}ms`, index);\n }\n getPosition() {\n return this._position;\n }\n _handleCallback(event) {\n const timestamp = event._ngTestManualTimestamp || Date.now();\n const elapsedTime = parseFloat(event.elapsedTime.toFixed(ELAPSED_TIME_MAX_DECIMAL_PLACES)) * ONE_SECOND$1;\n if (event.animationName == this._name &&\n Math.max(timestamp - this._startTime, 0) >= this._delay && elapsedTime >= this._duration) {\n this.finish();\n }\n }\n finish() {\n if (this._finished)\n return;\n this._finished = true;\n this._onDoneFn();\n addRemoveAnimationEvent(this._element, this._eventFn, true);\n }\n destroy() {\n if (this._destroyed)\n return;\n this._destroyed = true;\n this.finish();\n removeKeyframeAnimation(this._element, this._name);\n }\n}\nfunction playPauseAnimation(element, name, status) {\n const index = findIndexForAnimation(element, name);\n setAnimationStyle(element, 'PlayState', status, index);\n}\nfunction applyKeyframeAnimation(element, value) {\n const anim = getAnimationStyle(element, '').trim();\n let index = 0;\n if (anim.length) {\n index = countChars(anim, ',') + 1;\n value = `${anim}, ${value}`;\n }\n setAnimationStyle(element, '', value);\n return index;\n}\nfunction removeKeyframeAnimation(element, name) {\n const anim = getAnimationStyle(element, '');\n const tokens = anim.split(',');\n const index = findMatchingTokenIndex(tokens, name);\n if (index >= 0) {\n tokens.splice(index, 1);\n const newValue = tokens.join(',');\n setAnimationStyle(element, '', newValue);\n }\n}\nfunction findIndexForAnimation(element, value) {\n const anim = getAnimationStyle(element, '');\n if (anim.indexOf(',') > 0) {\n const tokens = anim.split(',');\n return findMatchingTokenIndex(tokens, value);\n }\n return findMatchingTokenIndex([anim], value);\n}\nfunction findMatchingTokenIndex(tokens, searchToken) {\n for (let i = 0; i < tokens.length; i++) {\n if (tokens[i].indexOf(searchToken) >= 0) {\n return i;\n }\n }\n return -1;\n}\nfunction addRemoveAnimationEvent(element, fn, doRemove) {\n doRemove ? element.removeEventListener(ANIMATIONEND_EVENT, fn) :\n element.addEventListener(ANIMATIONEND_EVENT, fn);\n}\nfunction setAnimationStyle(element, name, value, index) {\n const prop = ANIMATION_PROP + name;\n if (index != null) {\n const oldValue = element.style[prop];\n if (oldValue.length) {\n const tokens = oldValue.split(',');\n tokens[index] = value;\n value = tokens.join(',');\n }\n }\n element.style[prop] = value;\n}\nfunction getAnimationStyle(element, name) {\n return element.style[ANIMATION_PROP + name];\n}\nfunction countChars(value, char) {\n let count = 0;\n for (let i = 0; i < value.length; i++) {\n const c = value.charAt(i);\n if (c === char)\n count++;\n }\n return count;\n}\n\nconst DEFAULT_FILL_MODE = 'forwards';\nconst DEFAULT_EASING = 'linear';\nclass CssKeyframesPlayer {\n constructor(element, keyframes, animationName, _duration, _delay, easing, _finalStyles, _specialStyles) {\n this.element = element;\n this.keyframes = keyframes;\n this.animationName = animationName;\n this._duration = _duration;\n this._delay = _delay;\n this._finalStyles = _finalStyles;\n this._specialStyles = _specialStyles;\n this._onDoneFns = [];\n this._onStartFns = [];\n this._onDestroyFns = [];\n this._started = false;\n this.currentSnapshot = {};\n this._state = 0;\n this.easing = easing || DEFAULT_EASING;\n this.totalTime = _duration + _delay;\n this._buildStyler();\n }\n onStart(fn) {\n this._onStartFns.push(fn);\n }\n onDone(fn) {\n this._onDoneFns.push(fn);\n }\n onDestroy(fn) {\n this._onDestroyFns.push(fn);\n }\n destroy() {\n this.init();\n if (this._state >= 4 /* DESTROYED */)\n return;\n this._state = 4 /* DESTROYED */;\n this._styler.destroy();\n this._flushStartFns();\n this._flushDoneFns();\n if (this._specialStyles) {\n this._specialStyles.destroy();\n }\n this._onDestroyFns.forEach(fn => fn());\n this._onDestroyFns = [];\n }\n _flushDoneFns() {\n this._onDoneFns.forEach(fn => fn());\n this._onDoneFns = [];\n }\n _flushStartFns() {\n this._onStartFns.forEach(fn => fn());\n this._onStartFns = [];\n }\n finish() {\n this.init();\n if (this._state >= 3 /* FINISHED */)\n return;\n this._state = 3 /* FINISHED */;\n this._styler.finish();\n this._flushStartFns();\n if (this._specialStyles) {\n this._specialStyles.finish();\n }\n this._flushDoneFns();\n }\n setPosition(value) {\n this._styler.setPosition(value);\n }\n getPosition() {\n return this._styler.getPosition();\n }\n hasStarted() {\n return this._state >= 2 /* STARTED */;\n }\n init() {\n if (this._state >= 1 /* INITIALIZED */)\n return;\n this._state = 1 /* INITIALIZED */;\n const elm = this.element;\n this._styler.apply();\n if (this._delay) {\n this._styler.pause();\n }\n }\n play() {\n this.init();\n if (!this.hasStarted()) {\n this._flushStartFns();\n this._state = 2 /* STARTED */;\n if (this._specialStyles) {\n this._specialStyles.start();\n }\n }\n this._styler.resume();\n }\n pause() {\n this.init();\n this._styler.pause();\n }\n restart() {\n this.reset();\n this.play();\n }\n reset() {\n this._styler.destroy();\n this._buildStyler();\n this._styler.apply();\n }\n _buildStyler() {\n this._styler = new ElementAnimationStyleHandler(this.element, this.animationName, this._duration, this._delay, this.easing, DEFAULT_FILL_MODE, () => this.finish());\n }\n /** @internal */\n triggerCallback(phaseName) {\n const methods = phaseName == 'start' ? this._onStartFns : this._onDoneFns;\n methods.forEach(fn => fn());\n methods.length = 0;\n }\n beforeDestroy() {\n this.init();\n const styles = {};\n if (this.hasStarted()) {\n const finished = this._state >= 3 /* FINISHED */;\n Object.keys(this._finalStyles).forEach(prop => {\n if (prop != 'offset') {\n styles[prop] = finished ? this._finalStyles[prop] : computeStyle(this.element, prop);\n }\n });\n }\n this.currentSnapshot = styles;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass DirectStylePlayer extends NoopAnimationPlayer {\n constructor(element, styles) {\n super();\n this.element = element;\n this._startingStyles = {};\n this.__initialized = false;\n this._styles = hypenatePropsObject(styles);\n }\n init() {\n if (this.__initialized || !this._startingStyles)\n return;\n this.__initialized = true;\n Object.keys(this._styles).forEach(prop => {\n this._startingStyles[prop] = this.element.style[prop];\n });\n super.init();\n }\n play() {\n if (!this._startingStyles)\n return;\n this.init();\n Object.keys(this._styles)\n .forEach(prop => this.element.style.setProperty(prop, this._styles[prop]));\n super.play();\n }\n destroy() {\n if (!this._startingStyles)\n return;\n Object.keys(this._startingStyles).forEach(prop => {\n const value = this._startingStyles[prop];\n if (value) {\n this.element.style.setProperty(prop, value);\n }\n else {\n this.element.style.removeProperty(prop);\n }\n });\n this._startingStyles = null;\n super.destroy();\n }\n}\n\nconst KEYFRAMES_NAME_PREFIX = 'gen_css_kf_';\nconst TAB_SPACE = ' ';\nclass CssKeyframesDriver {\n constructor() {\n this._count = 0;\n this._head = document.querySelector('head');\n this._warningIssued = false;\n }\n validateStyleProperty(prop) {\n return validateStyleProperty(prop);\n }\n matchesElement(element, selector) {\n return matchesElement(element, selector);\n }\n containsElement(elm1, elm2) {\n return containsElement(elm1, elm2);\n }\n query(element, selector, multi) {\n return invokeQuery(element, selector, multi);\n }\n computeStyle(element, prop, defaultValue) {\n return window.getComputedStyle(element)[prop];\n }\n buildKeyframeElement(element, name, keyframes) {\n keyframes = keyframes.map(kf => hypenatePropsObject(kf));\n let keyframeStr = `@keyframes ${name} {\\n`;\n let tab = '';\n keyframes.forEach(kf => {\n tab = TAB_SPACE;\n const offset = parseFloat(kf['offset']);\n keyframeStr += `${tab}${offset * 100}% {\\n`;\n tab += TAB_SPACE;\n Object.keys(kf).forEach(prop => {\n const value = kf[prop];\n switch (prop) {\n case 'offset':\n return;\n case 'easing':\n if (value) {\n keyframeStr += `${tab}animation-timing-function: ${value};\\n`;\n }\n return;\n default:\n keyframeStr += `${tab}${prop}: ${value};\\n`;\n return;\n }\n });\n keyframeStr += `${tab}}\\n`;\n });\n keyframeStr += `}\\n`;\n const kfElm = document.createElement('style');\n kfElm.innerHTML = keyframeStr;\n return kfElm;\n }\n animate(element, keyframes, duration, delay, easing, previousPlayers = [], scrubberAccessRequested) {\n if (scrubberAccessRequested) {\n this._notifyFaultyScrubber();\n }\n const previousCssKeyframePlayers = previousPlayers.filter(player => player instanceof CssKeyframesPlayer);\n const previousStyles = {};\n if (allowPreviousPlayerStylesMerge(duration, delay)) {\n previousCssKeyframePlayers.forEach(player => {\n let styles = player.currentSnapshot;\n Object.keys(styles).forEach(prop => previousStyles[prop] = styles[prop]);\n });\n }\n keyframes = balancePreviousStylesIntoKeyframes(element, keyframes, previousStyles);\n const finalStyles = flattenKeyframesIntoStyles(keyframes);\n // if there is no animation then there is no point in applying\n // styles and waiting for an event to get fired. This causes lag.\n // It's better to just directly apply the styles to the element\n // via the direct styling animation player.\n if (duration == 0) {\n return new DirectStylePlayer(element, finalStyles);\n }\n const animationName = `${KEYFRAMES_NAME_PREFIX}${this._count++}`;\n const kfElm = this.buildKeyframeElement(element, animationName, keyframes);\n document.querySelector('head').appendChild(kfElm);\n const specialStyles = packageNonAnimatableStyles(element, keyframes);\n const player = new CssKeyframesPlayer(element, keyframes, animationName, duration, delay, easing, finalStyles, specialStyles);\n player.onDestroy(() => removeElement(kfElm));\n return player;\n }\n _notifyFaultyScrubber() {\n if (!this._warningIssued) {\n console.warn('@angular/animations: please load the web-animations.js polyfill to allow programmatic access...\\n', ' visit http://bit.ly/IWukam to learn more about using the web-animation-js polyfill.');\n this._warningIssued = true;\n }\n }\n}\nfunction flattenKeyframesIntoStyles(keyframes) {\n let flatKeyframes = {};\n if (keyframes) {\n const kfs = Array.isArray(keyframes) ? keyframes : [keyframes];\n kfs.forEach(kf => {\n Object.keys(kf).forEach(prop => {\n if (prop == 'offset' || prop == 'easing')\n return;\n flatKeyframes[prop] = kf[prop];\n });\n });\n }\n return flatKeyframes;\n}\nfunction removeElement(node) {\n node.parentNode.removeChild(node);\n}\n\nclass WebAnimationsPlayer {\n constructor(element, keyframes, options, _specialStyles) {\n this.element = element;\n this.keyframes = keyframes;\n this.options = options;\n this._specialStyles = _specialStyles;\n this._onDoneFns = [];\n this._onStartFns = [];\n this._onDestroyFns = [];\n this._initialized = false;\n this._finished = false;\n this._started = false;\n this._destroyed = false;\n this.time = 0;\n this.parentPlayer = null;\n this.currentSnapshot = {};\n this._duration = options['duration'];\n this._delay = options['delay'] || 0;\n this.time = this._duration + this._delay;\n }\n _onFinish() {\n if (!this._finished) {\n this._finished = true;\n this._onDoneFns.forEach(fn => fn());\n this._onDoneFns = [];\n }\n }\n init() {\n this._buildPlayer();\n this._preparePlayerBeforeStart();\n }\n _buildPlayer() {\n if (this._initialized)\n return;\n this._initialized = true;\n const keyframes = this.keyframes;\n this.domPlayer =\n this._triggerWebAnimation(this.element, keyframes, this.options);\n this._finalKeyframe = keyframes.length ? keyframes[keyframes.length - 1] : {};\n this.domPlayer.addEventListener('finish', () => this._onFinish());\n }\n _preparePlayerBeforeStart() {\n // this is required so that the player doesn't start to animate right away\n if (this._delay) {\n this._resetDomPlayerState();\n }\n else {\n this.domPlayer.pause();\n }\n }\n /** @internal */\n _triggerWebAnimation(element, keyframes, options) {\n // jscompiler doesn't seem to know animate is a native property because it's not fully\n // supported yet across common browsers (we polyfill it for Edge/Safari) [CL #143630929]\n return element['animate'](keyframes, options);\n }\n onStart(fn) {\n this._onStartFns.push(fn);\n }\n onDone(fn) {\n this._onDoneFns.push(fn);\n }\n onDestroy(fn) {\n this._onDestroyFns.push(fn);\n }\n play() {\n this._buildPlayer();\n if (!this.hasStarted()) {\n this._onStartFns.forEach(fn => fn());\n this._onStartFns = [];\n this._started = true;\n if (this._specialStyles) {\n this._specialStyles.start();\n }\n }\n this.domPlayer.play();\n }\n pause() {\n this.init();\n this.domPlayer.pause();\n }\n finish() {\n this.init();\n if (this._specialStyles) {\n this._specialStyles.finish();\n }\n this._onFinish();\n this.domPlayer.finish();\n }\n reset() {\n this._resetDomPlayerState();\n this._destroyed = false;\n this._finished = false;\n this._started = false;\n }\n _resetDomPlayerState() {\n if (this.domPlayer) {\n this.domPlayer.cancel();\n }\n }\n restart() {\n this.reset();\n this.play();\n }\n hasStarted() {\n return this._started;\n }\n destroy() {\n if (!this._destroyed) {\n this._destroyed = true;\n this._resetDomPlayerState();\n this._onFinish();\n if (this._specialStyles) {\n this._specialStyles.destroy();\n }\n this._onDestroyFns.forEach(fn => fn());\n this._onDestroyFns = [];\n }\n }\n setPosition(p) {\n this.domPlayer.currentTime = p * this.time;\n }\n getPosition() {\n return this.domPlayer.currentTime / this.time;\n }\n get totalTime() {\n return this._delay + this._duration;\n }\n beforeDestroy() {\n const styles = {};\n if (this.hasStarted()) {\n Object.keys(this._finalKeyframe).forEach(prop => {\n if (prop != 'offset') {\n styles[prop] =\n this._finished ? this._finalKeyframe[prop] : computeStyle(this.element, prop);\n }\n });\n }\n this.currentSnapshot = styles;\n }\n /** @internal */\n triggerCallback(phaseName) {\n const methods = phaseName == 'start' ? this._onStartFns : this._onDoneFns;\n methods.forEach(fn => fn());\n methods.length = 0;\n }\n}\n\nclass WebAnimationsDriver {\n constructor() {\n this._isNativeImpl = /\\{\\s*\\[native\\s+code\\]\\s*\\}/.test(getElementAnimateFn().toString());\n this._cssKeyframesDriver = new CssKeyframesDriver();\n }\n validateStyleProperty(prop) {\n return validateStyleProperty(prop);\n }\n matchesElement(element, selector) {\n return matchesElement(element, selector);\n }\n containsElement(elm1, elm2) {\n return containsElement(elm1, elm2);\n }\n query(element, selector, multi) {\n return invokeQuery(element, selector, multi);\n }\n computeStyle(element, prop, defaultValue) {\n return window.getComputedStyle(element)[prop];\n }\n overrideWebAnimationsSupport(supported) {\n this._isNativeImpl = supported;\n }\n animate(element, keyframes, duration, delay, easing, previousPlayers = [], scrubberAccessRequested) {\n const useKeyframes = !scrubberAccessRequested && !this._isNativeImpl;\n if (useKeyframes) {\n return this._cssKeyframesDriver.animate(element, keyframes, duration, delay, easing, previousPlayers);\n }\n const fill = delay == 0 ? 'both' : 'forwards';\n const playerOptions = { duration, delay, fill };\n // we check for this to avoid having a null|undefined value be present\n // for the easing (which results in an error for certain browsers #9752)\n if (easing) {\n playerOptions['easing'] = easing;\n }\n const previousStyles = {};\n const previousWebAnimationPlayers = previousPlayers.filter(player => player instanceof WebAnimationsPlayer);\n if (allowPreviousPlayerStylesMerge(duration, delay)) {\n previousWebAnimationPlayers.forEach(player => {\n let styles = player.currentSnapshot;\n Object.keys(styles).forEach(prop => previousStyles[prop] = styles[prop]);\n });\n }\n keyframes = keyframes.map(styles => copyStyles(styles, false));\n keyframes = balancePreviousStylesIntoKeyframes(element, keyframes, previousStyles);\n const specialStyles = packageNonAnimatableStyles(element, keyframes);\n return new WebAnimationsPlayer(element, keyframes, playerOptions, specialStyles);\n }\n}\nfunction supportsWebAnimations() {\n return typeof getElementAnimateFn() === 'function';\n}\nfunction getElementAnimateFn() {\n return (isBrowser() && Element.prototype['animate']) || {};\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { AnimationDriver, Animation as ɵAnimation, AnimationEngine as ɵAnimationEngine, AnimationStyleNormalizer as ɵAnimationStyleNormalizer, CssKeyframesDriver as ɵCssKeyframesDriver, CssKeyframesPlayer as ɵCssKeyframesPlayer, NoopAnimationDriver as ɵNoopAnimationDriver, NoopAnimationStyleNormalizer as ɵNoopAnimationStyleNormalizer, WebAnimationsDriver as ɵWebAnimationsDriver, WebAnimationsPlayer as ɵWebAnimationsPlayer, WebAnimationsStyleNormalizer as ɵWebAnimationsStyleNormalizer, allowPreviousPlayerStylesMerge as ɵallowPreviousPlayerStylesMerge, SpecialCasedStyles as ɵangular_packages_animations_browser_browser_a, containsElement as ɵcontainsElement, invokeQuery as ɵinvokeQuery, matchesElement as ɵmatchesElement, supportsWebAnimations as ɵsupportsWebAnimations, validateStyleProperty as ɵvalidateStyleProperty };\n\n//# sourceMappingURL=browser.js.map","/**\n * @license Angular v10.0.7\n * (c) 2010-2020 Google LLC. https://angular.io/\n * License: MIT\n */\n\nimport { InjectionToken, ɵɵdefineInjectable, Injectable, ɵɵinject, Inject, Optional, EventEmitter, ɵfindLocaleData, ɵLocaleDataIndex, ɵgetLocaleCurrencyCode, ɵgetLocalePluralCase, LOCALE_ID, ɵregisterLocaleData, ɵisListLikeIterable, ɵstringify, Directive, IterableDiffers, KeyValueDiffers, ElementRef, Renderer2, Input, NgModuleRef, ComponentFactoryResolver, ViewContainerRef, isDevMode, TemplateRef, Host, Attribute, ɵisPromise, ɵisObservable, Pipe, ChangeDetectorRef, DEFAULT_CURRENCY_CODE, NgModule, Version, ErrorHandler } from '@angular/core';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nimport * as ɵngcc0 from '@angular/core';\nlet _DOM = null;\nfunction getDOM() {\n return _DOM;\n}\nfunction setDOM(adapter) {\n _DOM = adapter;\n}\nfunction setRootDomAdapter(adapter) {\n if (!_DOM) {\n _DOM = adapter;\n }\n}\n/* tslint:disable:requireParameterType */\n/**\n * Provides DOM operations in an environment-agnostic way.\n *\n * @security Tread carefully! Interacting with the DOM directly is dangerous and\n * can introduce XSS risks.\n */\nclass DomAdapter {\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A DI Token representing the main rendering context. In a browser this is the DOM Document.\n *\n * Note: Document might not be available in the Application Context when Application and Rendering\n * Contexts are not the same (e.g. when running the application in a Web Worker).\n *\n * @publicApi\n */\nconst DOCUMENT = new InjectionToken('DocumentToken');\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * This class should not be used directly by an application developer. Instead, use\n * {@link Location}.\n *\n * `PlatformLocation` encapsulates all calls to DOM APIs, which allows the Router to be\n * platform-agnostic.\n * This means that we can have different implementation of `PlatformLocation` for the different\n * platforms that Angular supports. For example, `@angular/platform-browser` provides an\n * implementation specific to the browser environment, while `@angular/platform-server` provides\n * one suitable for use with server-side rendering.\n *\n * The `PlatformLocation` class is used directly by all implementations of {@link LocationStrategy}\n * when they need to interact with the DOM APIs like pushState, popState, etc.\n *\n * {@link LocationStrategy} in turn is used by the {@link Location} service which is used directly\n * by the {@link Router} in order to navigate between routes. Since all interactions between {@link\n * Router} /\n * {@link Location} / {@link LocationStrategy} and DOM APIs flow through the `PlatformLocation`\n * class, they are all platform-agnostic.\n *\n * @publicApi\n */\nclass PlatformLocation {\n}\nPlatformLocation.ɵfac = function PlatformLocation_Factory(t) { return new (t || PlatformLocation)(); };\nPlatformLocation.ɵprov = ɵɵdefineInjectable({ factory: useBrowserPlatformLocation, token: PlatformLocation, providedIn: \"platform\" });\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(PlatformLocation, [{\n type: Injectable,\n args: [{\n providedIn: 'platform',\n // See #23917\n useFactory: useBrowserPlatformLocation\n }]\n }], null, null); })();\nfunction useBrowserPlatformLocation() {\n return ɵɵinject(BrowserPlatformLocation);\n}\n/**\n * @description\n * Indicates when a location is initialized.\n *\n * @publicApi\n */\nconst LOCATION_INITIALIZED = new InjectionToken('Location Initialized');\n/**\n * `PlatformLocation` encapsulates all of the direct calls to platform APIs.\n * This class should not be used directly by an application developer. Instead, use\n * {@link Location}.\n */\nclass BrowserPlatformLocation extends PlatformLocation {\n constructor(_doc) {\n super();\n this._doc = _doc;\n this._init();\n }\n // This is moved to its own method so that `MockPlatformLocationStrategy` can overwrite it\n /** @internal */\n _init() {\n this.location = getDOM().getLocation();\n this._history = getDOM().getHistory();\n }\n getBaseHrefFromDOM() {\n return getDOM().getBaseHref(this._doc);\n }\n onPopState(fn) {\n getDOM().getGlobalEventTarget(this._doc, 'window').addEventListener('popstate', fn, false);\n }\n onHashChange(fn) {\n getDOM().getGlobalEventTarget(this._doc, 'window').addEventListener('hashchange', fn, false);\n }\n get href() {\n return this.location.href;\n }\n get protocol() {\n return this.location.protocol;\n }\n get hostname() {\n return this.location.hostname;\n }\n get port() {\n return this.location.port;\n }\n get pathname() {\n return this.location.pathname;\n }\n get search() {\n return this.location.search;\n }\n get hash() {\n return this.location.hash;\n }\n set pathname(newPath) {\n this.location.pathname = newPath;\n }\n pushState(state, title, url) {\n if (supportsState()) {\n this._history.pushState(state, title, url);\n }\n else {\n this.location.hash = url;\n }\n }\n replaceState(state, title, url) {\n if (supportsState()) {\n this._history.replaceState(state, title, url);\n }\n else {\n this.location.hash = url;\n }\n }\n forward() {\n this._history.forward();\n }\n back() {\n this._history.back();\n }\n getState() {\n return this._history.state;\n }\n}\nBrowserPlatformLocation.ɵfac = function BrowserPlatformLocation_Factory(t) { return new (t || BrowserPlatformLocation)(ɵngcc0.ɵɵinject(DOCUMENT)); };\nBrowserPlatformLocation.ɵprov = ɵɵdefineInjectable({ factory: createBrowserPlatformLocation, token: BrowserPlatformLocation, providedIn: \"platform\" });\nBrowserPlatformLocation.ctorParameters = () => [\n { type: undefined, decorators: [{ type: Inject, args: [DOCUMENT,] }] }\n];\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(BrowserPlatformLocation, [{\n type: Injectable,\n args: [{\n providedIn: 'platform',\n // See #23917\n useFactory: createBrowserPlatformLocation\n }]\n }], function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }]; }, null); })();\nfunction supportsState() {\n return !!window.history.pushState;\n}\nfunction createBrowserPlatformLocation() {\n return new BrowserPlatformLocation(ɵɵinject(DOCUMENT));\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Joins two parts of a URL with a slash if needed.\n *\n * @param start URL string\n * @param end URL string\n *\n *\n * @returns The joined URL string.\n */\nfunction joinWithSlash(start, end) {\n if (start.length == 0) {\n return end;\n }\n if (end.length == 0) {\n return start;\n }\n let slashes = 0;\n if (start.endsWith('/')) {\n slashes++;\n }\n if (end.startsWith('/')) {\n slashes++;\n }\n if (slashes == 2) {\n return start + end.substring(1);\n }\n if (slashes == 1) {\n return start + end;\n }\n return start + '/' + end;\n}\n/**\n * Removes a trailing slash from a URL string if needed.\n * Looks for the first occurrence of either `#`, `?`, or the end of the\n * line as `/` characters and removes the trailing slash if one exists.\n *\n * @param url URL string.\n *\n * @returns The URL string, modified if needed.\n */\nfunction stripTrailingSlash(url) {\n const match = url.match(/#|\\?|$/);\n const pathEndIdx = match && match.index || url.length;\n const droppedSlashIdx = pathEndIdx - (url[pathEndIdx - 1] === '/' ? 1 : 0);\n return url.slice(0, droppedSlashIdx) + url.slice(pathEndIdx);\n}\n/**\n * Normalizes URL parameters by prepending with `?` if needed.\n *\n * @param params String of URL parameters.\n *\n * @returns The normalized URL parameters string.\n */\nfunction normalizeQueryParams(params) {\n return params && params[0] !== '?' ? '?' + params : params;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Enables the `Location` service to read route state from the browser's URL.\n * Angular provides two strategies:\n * `HashLocationStrategy` and `PathLocationStrategy`.\n *\n * Applications should use the `Router` or `Location` services to\n * interact with application route state.\n *\n * For instance, `HashLocationStrategy` produces URLs like\n * http://example.com#/foo,\n * and `PathLocationStrategy` produces\n * http://example.com/foo as an equivalent URL.\n *\n * See these two classes for more.\n *\n * @publicApi\n */\nclass LocationStrategy {\n}\nLocationStrategy.ɵfac = function LocationStrategy_Factory(t) { return new (t || LocationStrategy)(); };\nLocationStrategy.ɵprov = ɵɵdefineInjectable({ factory: provideLocationStrategy, token: LocationStrategy, providedIn: \"root\" });\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(LocationStrategy, [{\n type: Injectable,\n args: [{ providedIn: 'root', useFactory: provideLocationStrategy }]\n }], null, null); })();\nfunction provideLocationStrategy(platformLocation) {\n // See #23917\n const location = ɵɵinject(DOCUMENT).location;\n return new PathLocationStrategy(ɵɵinject(PlatformLocation), location && location.origin || '');\n}\n/**\n * A predefined [DI token](guide/glossary#di-token) for the base href\n * to be used with the `PathLocationStrategy`.\n * The base href is the URL prefix that should be preserved when generating\n * and recognizing URLs.\n *\n * @usageNotes\n *\n * The following example shows how to use this token to configure the root app injector\n * with a base href value, so that the DI framework can supply the dependency anywhere in the app.\n *\n * ```typescript\n * import {Component, NgModule} from '@angular/core';\n * import {APP_BASE_HREF} from '@angular/common';\n *\n * @NgModule({\n * providers: [{provide: APP_BASE_HREF, useValue: '/my/app'}]\n * })\n * class AppModule {}\n * ```\n *\n * @publicApi\n */\nconst APP_BASE_HREF = new InjectionToken('appBaseHref');\n/**\n * @description\n * A {@link LocationStrategy} used to configure the {@link Location} service to\n * represent its state in the\n * [path](https://en.wikipedia.org/wiki/Uniform_Resource_Locator#Syntax) of the\n * browser's URL.\n *\n * If you're using `PathLocationStrategy`, you must provide a {@link APP_BASE_HREF}\n * or add a `` element to the document.\n *\n * For instance, if you provide an `APP_BASE_HREF` of `'/my/app/'` and call\n * `location.go('/foo')`, the browser's URL will become\n * `example.com/my/app/foo`. To ensure all relative URIs resolve correctly,\n * the `` and/or `APP_BASE_HREF` should end with a `/`.\n *\n * Similarly, if you add `` to the document and call\n * `location.go('/foo')`, the browser's URL will become\n * `example.com/my/app/foo`.\n *\n * Note that when using `PathLocationStrategy`, neither the query nor\n * the fragment in the `` will be preserved, as outlined\n * by the [RFC](https://tools.ietf.org/html/rfc3986#section-5.2.2).\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example common/location/ts/path_location_component.ts region='LocationComponent'}\n *\n * @publicApi\n */\nclass PathLocationStrategy extends LocationStrategy {\n constructor(_platformLocation, href) {\n super();\n this._platformLocation = _platformLocation;\n if (href == null) {\n href = this._platformLocation.getBaseHrefFromDOM();\n }\n if (href == null) {\n throw new Error(`No base href set. Please provide a value for the APP_BASE_HREF token or add a base element to the document.`);\n }\n this._baseHref = href;\n }\n onPopState(fn) {\n this._platformLocation.onPopState(fn);\n this._platformLocation.onHashChange(fn);\n }\n getBaseHref() {\n return this._baseHref;\n }\n prepareExternalUrl(internal) {\n return joinWithSlash(this._baseHref, internal);\n }\n path(includeHash = false) {\n const pathname = this._platformLocation.pathname + normalizeQueryParams(this._platformLocation.search);\n const hash = this._platformLocation.hash;\n return hash && includeHash ? `${pathname}${hash}` : pathname;\n }\n pushState(state, title, url, queryParams) {\n const externalUrl = this.prepareExternalUrl(url + normalizeQueryParams(queryParams));\n this._platformLocation.pushState(state, title, externalUrl);\n }\n replaceState(state, title, url, queryParams) {\n const externalUrl = this.prepareExternalUrl(url + normalizeQueryParams(queryParams));\n this._platformLocation.replaceState(state, title, externalUrl);\n }\n forward() {\n this._platformLocation.forward();\n }\n back() {\n this._platformLocation.back();\n }\n}\nPathLocationStrategy.ɵfac = function PathLocationStrategy_Factory(t) { return new (t || PathLocationStrategy)(ɵngcc0.ɵɵinject(PlatformLocation), ɵngcc0.ɵɵinject(APP_BASE_HREF, 8)); };\nPathLocationStrategy.ɵprov = ɵngcc0.ɵɵdefineInjectable({ token: PathLocationStrategy, factory: PathLocationStrategy.ɵfac });\nPathLocationStrategy.ctorParameters = () => [\n { type: PlatformLocation },\n { type: String, decorators: [{ type: Optional }, { type: Inject, args: [APP_BASE_HREF,] }] }\n];\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(PathLocationStrategy, [{\n type: Injectable\n }], function () { return [{ type: PlatformLocation }, { type: String, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [APP_BASE_HREF]\n }] }]; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @description\n * A {@link LocationStrategy} used to configure the {@link Location} service to\n * represent its state in the\n * [hash fragment](https://en.wikipedia.org/wiki/Uniform_Resource_Locator#Syntax)\n * of the browser's URL.\n *\n * For instance, if you call `location.go('/foo')`, the browser's URL will become\n * `example.com#/foo`.\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example common/location/ts/hash_location_component.ts region='LocationComponent'}\n *\n * @publicApi\n */\nclass HashLocationStrategy extends LocationStrategy {\n constructor(_platformLocation, _baseHref) {\n super();\n this._platformLocation = _platformLocation;\n this._baseHref = '';\n if (_baseHref != null) {\n this._baseHref = _baseHref;\n }\n }\n onPopState(fn) {\n this._platformLocation.onPopState(fn);\n this._platformLocation.onHashChange(fn);\n }\n getBaseHref() {\n return this._baseHref;\n }\n path(includeHash = false) {\n // the hash value is always prefixed with a `#`\n // and if it is empty then it will stay empty\n let path = this._platformLocation.hash;\n if (path == null)\n path = '#';\n return path.length > 0 ? path.substring(1) : path;\n }\n prepareExternalUrl(internal) {\n const url = joinWithSlash(this._baseHref, internal);\n return url.length > 0 ? ('#' + url) : url;\n }\n pushState(state, title, path, queryParams) {\n let url = this.prepareExternalUrl(path + normalizeQueryParams(queryParams));\n if (url.length == 0) {\n url = this._platformLocation.pathname;\n }\n this._platformLocation.pushState(state, title, url);\n }\n replaceState(state, title, path, queryParams) {\n let url = this.prepareExternalUrl(path + normalizeQueryParams(queryParams));\n if (url.length == 0) {\n url = this._platformLocation.pathname;\n }\n this._platformLocation.replaceState(state, title, url);\n }\n forward() {\n this._platformLocation.forward();\n }\n back() {\n this._platformLocation.back();\n }\n}\nHashLocationStrategy.ɵfac = function HashLocationStrategy_Factory(t) { return new (t || HashLocationStrategy)(ɵngcc0.ɵɵinject(PlatformLocation), ɵngcc0.ɵɵinject(APP_BASE_HREF, 8)); };\nHashLocationStrategy.ɵprov = ɵngcc0.ɵɵdefineInjectable({ token: HashLocationStrategy, factory: HashLocationStrategy.ɵfac });\nHashLocationStrategy.ctorParameters = () => [\n { type: PlatformLocation },\n { type: String, decorators: [{ type: Optional }, { type: Inject, args: [APP_BASE_HREF,] }] }\n];\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(HashLocationStrategy, [{\n type: Injectable\n }], function () { return [{ type: PlatformLocation }, { type: String, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [APP_BASE_HREF]\n }] }]; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @description\n *\n * A service that applications can use to interact with a browser's URL.\n *\n * Depending on the `LocationStrategy` used, `Location` persists\n * to the URL's path or the URL's hash segment.\n *\n * @usageNotes\n *\n * It's better to use the `Router#navigate` service to trigger route changes. Use\n * `Location` only if you need to interact with or create normalized URLs outside of\n * routing.\n *\n * `Location` is responsible for normalizing the URL against the application's base href.\n * A normalized URL is absolute from the URL host, includes the application's base href, and has no\n * trailing slash:\n * - `/my/app/user/123` is normalized\n * - `my/app/user/123` **is not** normalized\n * - `/my/app/user/123/` **is not** normalized\n *\n * ### Example\n *\n * \n *\n * @publicApi\n */\nclass Location {\n constructor(platformStrategy, platformLocation) {\n /** @internal */\n this._subject = new EventEmitter();\n /** @internal */\n this._urlChangeListeners = [];\n this._platformStrategy = platformStrategy;\n const browserBaseHref = this._platformStrategy.getBaseHref();\n this._platformLocation = platformLocation;\n this._baseHref = stripTrailingSlash(_stripIndexHtml(browserBaseHref));\n this._platformStrategy.onPopState((ev) => {\n this._subject.emit({\n 'url': this.path(true),\n 'pop': true,\n 'state': ev.state,\n 'type': ev.type,\n });\n });\n }\n /**\n * Normalizes the URL path for this location.\n *\n * @param includeHash True to include an anchor fragment in the path.\n *\n * @returns The normalized URL path.\n */\n // TODO: vsavkin. Remove the boolean flag and always include hash once the deprecated router is\n // removed.\n path(includeHash = false) {\n return this.normalize(this._platformStrategy.path(includeHash));\n }\n /**\n * Reports the current state of the location history.\n * @returns The current value of the `history.state` object.\n */\n getState() {\n return this._platformLocation.getState();\n }\n /**\n * Normalizes the given path and compares to the current normalized path.\n *\n * @param path The given URL path.\n * @param query Query parameters.\n *\n * @returns True if the given URL path is equal to the current normalized path, false\n * otherwise.\n */\n isCurrentPathEqualTo(path, query = '') {\n return this.path() == this.normalize(path + normalizeQueryParams(query));\n }\n /**\n * Normalizes a URL path by stripping any trailing slashes.\n *\n * @param url String representing a URL.\n *\n * @returns The normalized URL string.\n */\n normalize(url) {\n return Location.stripTrailingSlash(_stripBaseHref(this._baseHref, _stripIndexHtml(url)));\n }\n /**\n * Normalizes an external URL path.\n * If the given URL doesn't begin with a leading slash (`'/'`), adds one\n * before normalizing. Adds a hash if `HashLocationStrategy` is\n * in use, or the `APP_BASE_HREF` if the `PathLocationStrategy` is in use.\n *\n * @param url String representing a URL.\n *\n * @returns A normalized platform-specific URL.\n */\n prepareExternalUrl(url) {\n if (url && url[0] !== '/') {\n url = '/' + url;\n }\n return this._platformStrategy.prepareExternalUrl(url);\n }\n // TODO: rename this method to pushState\n /**\n * Changes the browser's URL to a normalized version of a given URL, and pushes a\n * new item onto the platform's history.\n *\n * @param path URL path to normalize.\n * @param query Query parameters.\n * @param state Location history state.\n *\n */\n go(path, query = '', state = null) {\n this._platformStrategy.pushState(state, '', path, query);\n this._notifyUrlChangeListeners(this.prepareExternalUrl(path + normalizeQueryParams(query)), state);\n }\n /**\n * Changes the browser's URL to a normalized version of the given URL, and replaces\n * the top item on the platform's history stack.\n *\n * @param path URL path to normalize.\n * @param query Query parameters.\n * @param state Location history state.\n */\n replaceState(path, query = '', state = null) {\n this._platformStrategy.replaceState(state, '', path, query);\n this._notifyUrlChangeListeners(this.prepareExternalUrl(path + normalizeQueryParams(query)), state);\n }\n /**\n * Navigates forward in the platform's history.\n */\n forward() {\n this._platformStrategy.forward();\n }\n /**\n * Navigates back in the platform's history.\n */\n back() {\n this._platformStrategy.back();\n }\n /**\n * Registers a URL change listener. Use to catch updates performed by the Angular\n * framework that are not detectible through \"popstate\" or \"hashchange\" events.\n *\n * @param fn The change handler function, which take a URL and a location history state.\n */\n onUrlChange(fn) {\n this._urlChangeListeners.push(fn);\n if (!this._urlChangeSubscription) {\n this._urlChangeSubscription = this.subscribe(v => {\n this._notifyUrlChangeListeners(v.url, v.state);\n });\n }\n }\n /** @internal */\n _notifyUrlChangeListeners(url = '', state) {\n this._urlChangeListeners.forEach(fn => fn(url, state));\n }\n /**\n * Subscribes to the platform's `popState` events.\n *\n * @param value Event that is triggered when the state history changes.\n * @param exception The exception to throw.\n *\n * @returns Subscribed events.\n */\n subscribe(onNext, onThrow, onReturn) {\n return this._subject.subscribe({ next: onNext, error: onThrow, complete: onReturn });\n }\n}\nLocation.ɵfac = function Location_Factory(t) { return new (t || Location)(ɵngcc0.ɵɵinject(LocationStrategy), ɵngcc0.ɵɵinject(PlatformLocation)); };\n/**\n * Normalizes URL parameters by prepending with `?` if needed.\n *\n * @param params String of URL parameters.\n *\n * @returns The normalized URL parameters string.\n */\nLocation.normalizeQueryParams = normalizeQueryParams;\n/**\n * Joins two parts of a URL with a slash if needed.\n *\n * @param start URL string\n * @param end URL string\n *\n *\n * @returns The joined URL string.\n */\nLocation.joinWithSlash = joinWithSlash;\n/**\n * Removes a trailing slash from a URL string if needed.\n * Looks for the first occurrence of either `#`, `?`, or the end of the\n * line as `/` characters and removes the trailing slash if one exists.\n *\n * @param url URL string.\n *\n * @returns The URL string, modified if needed.\n */\nLocation.stripTrailingSlash = stripTrailingSlash;\nLocation.ɵprov = ɵɵdefineInjectable({ factory: createLocation, token: Location, providedIn: \"root\" });\nLocation.ctorParameters = () => [\n { type: LocationStrategy },\n { type: PlatformLocation }\n];\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(Location, [{\n type: Injectable,\n args: [{\n providedIn: 'root',\n // See #23917\n useFactory: createLocation\n }]\n }], function () { return [{ type: LocationStrategy }, { type: PlatformLocation }]; }, null); })();\nfunction createLocation() {\n return new Location(ɵɵinject(LocationStrategy), ɵɵinject(PlatformLocation));\n}\nfunction _stripBaseHref(baseHref, url) {\n return baseHref && url.startsWith(baseHref) ? url.substring(baseHref.length) : url;\n}\nfunction _stripIndexHtml(url) {\n return url.replace(/\\/index.html$/, '');\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** @internal */\nconst CURRENCIES_EN = {\n 'ADP': [undefined, undefined, 0],\n 'AFN': [undefined, undefined, 0],\n 'ALL': [undefined, undefined, 0],\n 'AMD': [undefined, undefined, 2],\n 'AOA': [undefined, 'Kz'],\n 'ARS': [undefined, '$'],\n 'AUD': ['A$', '$'],\n 'BAM': [undefined, 'KM'],\n 'BBD': [undefined, '$'],\n 'BDT': [undefined, '৳'],\n 'BHD': [undefined, undefined, 3],\n 'BIF': [undefined, undefined, 0],\n 'BMD': [undefined, '$'],\n 'BND': [undefined, '$'],\n 'BOB': [undefined, 'Bs'],\n 'BRL': ['R$'],\n 'BSD': [undefined, '$'],\n 'BWP': [undefined, 'P'],\n 'BYN': [undefined, 'р.', 2],\n 'BYR': [undefined, undefined, 0],\n 'BZD': [undefined, '$'],\n 'CAD': ['CA$', '$', 2],\n 'CHF': [undefined, undefined, 2],\n 'CLF': [undefined, undefined, 4],\n 'CLP': [undefined, '$', 0],\n 'CNY': ['CN¥', '¥'],\n 'COP': [undefined, '$', 2],\n 'CRC': [undefined, '₡', 2],\n 'CUC': [undefined, '$'],\n 'CUP': [undefined, '$'],\n 'CZK': [undefined, 'Kč', 2],\n 'DJF': [undefined, undefined, 0],\n 'DKK': [undefined, 'kr', 2],\n 'DOP': [undefined, '$'],\n 'EGP': [undefined, 'E£'],\n 'ESP': [undefined, '₧', 0],\n 'EUR': ['€'],\n 'FJD': [undefined, '$'],\n 'FKP': [undefined, '£'],\n 'GBP': ['£'],\n 'GEL': [undefined, '₾'],\n 'GIP': [undefined, '£'],\n 'GNF': [undefined, 'FG', 0],\n 'GTQ': [undefined, 'Q'],\n 'GYD': [undefined, '$', 2],\n 'HKD': ['HK$', '$'],\n 'HNL': [undefined, 'L'],\n 'HRK': [undefined, 'kn'],\n 'HUF': [undefined, 'Ft', 2],\n 'IDR': [undefined, 'Rp', 2],\n 'ILS': ['₪'],\n 'INR': ['₹'],\n 'IQD': [undefined, undefined, 0],\n 'IRR': [undefined, undefined, 0],\n 'ISK': [undefined, 'kr', 0],\n 'ITL': [undefined, undefined, 0],\n 'JMD': [undefined, '$'],\n 'JOD': [undefined, undefined, 3],\n 'JPY': ['¥', undefined, 0],\n 'KHR': [undefined, '៛'],\n 'KMF': [undefined, 'CF', 0],\n 'KPW': [undefined, '₩', 0],\n 'KRW': ['₩', undefined, 0],\n 'KWD': [undefined, undefined, 3],\n 'KYD': [undefined, '$'],\n 'KZT': [undefined, '₸'],\n 'LAK': [undefined, '₭', 0],\n 'LBP': [undefined, 'L£', 0],\n 'LKR': [undefined, 'Rs'],\n 'LRD': [undefined, '$'],\n 'LTL': [undefined, 'Lt'],\n 'LUF': [undefined, undefined, 0],\n 'LVL': [undefined, 'Ls'],\n 'LYD': [undefined, undefined, 3],\n 'MGA': [undefined, 'Ar', 0],\n 'MGF': [undefined, undefined, 0],\n 'MMK': [undefined, 'K', 0],\n 'MNT': [undefined, '₮', 2],\n 'MRO': [undefined, undefined, 0],\n 'MUR': [undefined, 'Rs', 2],\n 'MXN': ['MX$', '$'],\n 'MYR': [undefined, 'RM'],\n 'NAD': [undefined, '$'],\n 'NGN': [undefined, '₦'],\n 'NIO': [undefined, 'C$'],\n 'NOK': [undefined, 'kr', 2],\n 'NPR': [undefined, 'Rs'],\n 'NZD': ['NZ$', '$'],\n 'OMR': [undefined, undefined, 3],\n 'PHP': [undefined, '₱'],\n 'PKR': [undefined, 'Rs', 2],\n 'PLN': [undefined, 'zł'],\n 'PYG': [undefined, '₲', 0],\n 'RON': [undefined, 'lei'],\n 'RSD': [undefined, undefined, 0],\n 'RUB': [undefined, '₽'],\n 'RUR': [undefined, 'р.'],\n 'RWF': [undefined, 'RF', 0],\n 'SBD': [undefined, '$'],\n 'SEK': [undefined, 'kr', 2],\n 'SGD': [undefined, '$'],\n 'SHP': [undefined, '£'],\n 'SLL': [undefined, undefined, 0],\n 'SOS': [undefined, undefined, 0],\n 'SRD': [undefined, '$'],\n 'SSP': [undefined, '£'],\n 'STD': [undefined, undefined, 0],\n 'STN': [undefined, 'Db'],\n 'SYP': [undefined, '£', 0],\n 'THB': [undefined, '฿'],\n 'TMM': [undefined, undefined, 0],\n 'TND': [undefined, undefined, 3],\n 'TOP': [undefined, 'T$'],\n 'TRL': [undefined, undefined, 0],\n 'TRY': [undefined, '₺'],\n 'TTD': [undefined, '$'],\n 'TWD': ['NT$', '$', 2],\n 'TZS': [undefined, undefined, 2],\n 'UAH': [undefined, '₴'],\n 'UGX': [undefined, undefined, 0],\n 'USD': ['$'],\n 'UYI': [undefined, undefined, 0],\n 'UYU': [undefined, '$'],\n 'UYW': [undefined, undefined, 4],\n 'UZS': [undefined, undefined, 2],\n 'VEF': [undefined, 'Bs', 2],\n 'VND': ['₫', undefined, 0],\n 'VUV': [undefined, undefined, 0],\n 'XAF': ['FCFA', undefined, 0],\n 'XCD': ['EC$', '$'],\n 'XOF': ['CFA', undefined, 0],\n 'XPF': ['CFPF', undefined, 0],\n 'XXX': ['¤'],\n 'YER': [undefined, undefined, 0],\n 'ZAR': [undefined, 'R'],\n 'ZMK': [undefined, undefined, 0],\n 'ZMW': [undefined, 'ZK'],\n 'ZWD': [undefined, undefined, 0]\n};\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Format styles that can be used to represent numbers.\n * @see `getLocaleNumberFormat()`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nvar NumberFormatStyle;\n(function (NumberFormatStyle) {\n NumberFormatStyle[NumberFormatStyle[\"Decimal\"] = 0] = \"Decimal\";\n NumberFormatStyle[NumberFormatStyle[\"Percent\"] = 1] = \"Percent\";\n NumberFormatStyle[NumberFormatStyle[\"Currency\"] = 2] = \"Currency\";\n NumberFormatStyle[NumberFormatStyle[\"Scientific\"] = 3] = \"Scientific\";\n})(NumberFormatStyle || (NumberFormatStyle = {}));\n/**\n * Plurality cases used for translating plurals to different languages.\n *\n * @see `NgPlural`\n * @see `NgPluralCase`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nvar Plural;\n(function (Plural) {\n Plural[Plural[\"Zero\"] = 0] = \"Zero\";\n Plural[Plural[\"One\"] = 1] = \"One\";\n Plural[Plural[\"Two\"] = 2] = \"Two\";\n Plural[Plural[\"Few\"] = 3] = \"Few\";\n Plural[Plural[\"Many\"] = 4] = \"Many\";\n Plural[Plural[\"Other\"] = 5] = \"Other\";\n})(Plural || (Plural = {}));\n/**\n * Context-dependant translation forms for strings.\n * Typically the standalone version is for the nominative form of the word,\n * and the format version is used for the genitive case.\n * @see [CLDR website](http://cldr.unicode.org/translation/date-time-1/date-time#TOC-Standalone-vs.-Format-Styles)\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nvar FormStyle;\n(function (FormStyle) {\n FormStyle[FormStyle[\"Format\"] = 0] = \"Format\";\n FormStyle[FormStyle[\"Standalone\"] = 1] = \"Standalone\";\n})(FormStyle || (FormStyle = {}));\n/**\n * String widths available for translations.\n * The specific character widths are locale-specific.\n * Examples are given for the word \"Sunday\" in English.\n *\n * @publicApi\n */\nvar TranslationWidth;\n(function (TranslationWidth) {\n /** 1 character for `en-US`. For example: 'S' */\n TranslationWidth[TranslationWidth[\"Narrow\"] = 0] = \"Narrow\";\n /** 3 characters for `en-US`. For example: 'Sun' */\n TranslationWidth[TranslationWidth[\"Abbreviated\"] = 1] = \"Abbreviated\";\n /** Full length for `en-US`. For example: \"Sunday\" */\n TranslationWidth[TranslationWidth[\"Wide\"] = 2] = \"Wide\";\n /** 2 characters for `en-US`, For example: \"Su\" */\n TranslationWidth[TranslationWidth[\"Short\"] = 3] = \"Short\";\n})(TranslationWidth || (TranslationWidth = {}));\n/**\n * String widths available for date-time formats.\n * The specific character widths are locale-specific.\n * Examples are given for `en-US`.\n *\n * @see `getLocaleDateFormat()`\n * @see `getLocaleTimeFormat()``\n * @see `getLocaleDateTimeFormat()`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n * @publicApi\n */\nvar FormatWidth;\n(function (FormatWidth) {\n /**\n * For `en-US`, 'M/d/yy, h:mm a'`\n * (Example: `6/15/15, 9:03 AM`)\n */\n FormatWidth[FormatWidth[\"Short\"] = 0] = \"Short\";\n /**\n * For `en-US`, `'MMM d, y, h:mm:ss a'`\n * (Example: `Jun 15, 2015, 9:03:01 AM`)\n */\n FormatWidth[FormatWidth[\"Medium\"] = 1] = \"Medium\";\n /**\n * For `en-US`, `'MMMM d, y, h:mm:ss a z'`\n * (Example: `June 15, 2015 at 9:03:01 AM GMT+1`)\n */\n FormatWidth[FormatWidth[\"Long\"] = 2] = \"Long\";\n /**\n * For `en-US`, `'EEEE, MMMM d, y, h:mm:ss a zzzz'`\n * (Example: `Monday, June 15, 2015 at 9:03:01 AM GMT+01:00`)\n */\n FormatWidth[FormatWidth[\"Full\"] = 3] = \"Full\";\n})(FormatWidth || (FormatWidth = {}));\n/**\n * Symbols that can be used to replace placeholders in number patterns.\n * Examples are based on `en-US` values.\n *\n * @see `getLocaleNumberSymbol()`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nvar NumberSymbol;\n(function (NumberSymbol) {\n /**\n * Decimal separator.\n * For `en-US`, the dot character.\n * Example : 2,345`.`67\n */\n NumberSymbol[NumberSymbol[\"Decimal\"] = 0] = \"Decimal\";\n /**\n * Grouping separator, typically for thousands.\n * For `en-US`, the comma character.\n * Example: 2`,`345.67\n */\n NumberSymbol[NumberSymbol[\"Group\"] = 1] = \"Group\";\n /**\n * List-item separator.\n * Example: \"one, two, and three\"\n */\n NumberSymbol[NumberSymbol[\"List\"] = 2] = \"List\";\n /**\n * Sign for percentage (out of 100).\n * Example: 23.4%\n */\n NumberSymbol[NumberSymbol[\"PercentSign\"] = 3] = \"PercentSign\";\n /**\n * Sign for positive numbers.\n * Example: +23\n */\n NumberSymbol[NumberSymbol[\"PlusSign\"] = 4] = \"PlusSign\";\n /**\n * Sign for negative numbers.\n * Example: -23\n */\n NumberSymbol[NumberSymbol[\"MinusSign\"] = 5] = \"MinusSign\";\n /**\n * Computer notation for exponential value (n times a power of 10).\n * Example: 1.2E3\n */\n NumberSymbol[NumberSymbol[\"Exponential\"] = 6] = \"Exponential\";\n /**\n * Human-readable format of exponential.\n * Example: 1.2x103\n */\n NumberSymbol[NumberSymbol[\"SuperscriptingExponent\"] = 7] = \"SuperscriptingExponent\";\n /**\n * Sign for permille (out of 1000).\n * Example: 23.4‰\n */\n NumberSymbol[NumberSymbol[\"PerMille\"] = 8] = \"PerMille\";\n /**\n * Infinity, can be used with plus and minus.\n * Example: ∞, +∞, -∞\n */\n NumberSymbol[NumberSymbol[\"Infinity\"] = 9] = \"Infinity\";\n /**\n * Not a number.\n * Example: NaN\n */\n NumberSymbol[NumberSymbol[\"NaN\"] = 10] = \"NaN\";\n /**\n * Symbol used between time units.\n * Example: 10:52\n */\n NumberSymbol[NumberSymbol[\"TimeSeparator\"] = 11] = \"TimeSeparator\";\n /**\n * Decimal separator for currency values (fallback to `Decimal`).\n * Example: $2,345.67\n */\n NumberSymbol[NumberSymbol[\"CurrencyDecimal\"] = 12] = \"CurrencyDecimal\";\n /**\n * Group separator for currency values (fallback to `Group`).\n * Example: $2,345.67\n */\n NumberSymbol[NumberSymbol[\"CurrencyGroup\"] = 13] = \"CurrencyGroup\";\n})(NumberSymbol || (NumberSymbol = {}));\n/**\n * The value for each day of the week, based on the `en-US` locale\n *\n * @publicApi\n */\nvar WeekDay;\n(function (WeekDay) {\n WeekDay[WeekDay[\"Sunday\"] = 0] = \"Sunday\";\n WeekDay[WeekDay[\"Monday\"] = 1] = \"Monday\";\n WeekDay[WeekDay[\"Tuesday\"] = 2] = \"Tuesday\";\n WeekDay[WeekDay[\"Wednesday\"] = 3] = \"Wednesday\";\n WeekDay[WeekDay[\"Thursday\"] = 4] = \"Thursday\";\n WeekDay[WeekDay[\"Friday\"] = 5] = \"Friday\";\n WeekDay[WeekDay[\"Saturday\"] = 6] = \"Saturday\";\n})(WeekDay || (WeekDay = {}));\n/**\n * Retrieves the locale ID from the currently loaded locale.\n * The loaded locale could be, for example, a global one rather than a regional one.\n * @param locale A locale code, such as `fr-FR`.\n * @returns The locale code. For example, `fr`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nfunction getLocaleId(locale) {\n return ɵfindLocaleData(locale)[ɵLocaleDataIndex.LocaleId];\n}\n/**\n * Retrieves day period strings for the given locale.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns An array of localized period strings. For example, `[AM, PM]` for `en-US`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nfunction getLocaleDayPeriods(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n const amPmData = [\n data[ɵLocaleDataIndex.DayPeriodsFormat], data[ɵLocaleDataIndex.DayPeriodsStandalone]\n ];\n const amPm = getLastDefinedValue(amPmData, formStyle);\n return getLastDefinedValue(amPm, width);\n}\n/**\n * Retrieves days of the week for the given locale, using the Gregorian calendar.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns An array of localized name strings.\n * For example,`[Sunday, Monday, ... Saturday]` for `en-US`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nfunction getLocaleDayNames(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n const daysData = [data[ɵLocaleDataIndex.DaysFormat], data[ɵLocaleDataIndex.DaysStandalone]];\n const days = getLastDefinedValue(daysData, formStyle);\n return getLastDefinedValue(days, width);\n}\n/**\n * Retrieves months of the year for the given locale, using the Gregorian calendar.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns An array of localized name strings.\n * For example, `[January, February, ...]` for `en-US`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nfunction getLocaleMonthNames(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n const monthsData = [data[ɵLocaleDataIndex.MonthsFormat], data[ɵLocaleDataIndex.MonthsStandalone]];\n const months = getLastDefinedValue(monthsData, formStyle);\n return getLastDefinedValue(months, width);\n}\n/**\n * Retrieves Gregorian-calendar eras for the given locale.\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n\n * @returns An array of localized era strings.\n * For example, `[AD, BC]` for `en-US`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nfunction getLocaleEraNames(locale, width) {\n const data = ɵfindLocaleData(locale);\n const erasData = data[ɵLocaleDataIndex.Eras];\n return getLastDefinedValue(erasData, width);\n}\n/**\n * Retrieves the first day of the week for the given locale.\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns A day index number, using the 0-based week-day index for `en-US`\n * (Sunday = 0, Monday = 1, ...).\n * For example, for `fr-FR`, returns 1 to indicate that the first day is Monday.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nfunction getLocaleFirstDayOfWeek(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.FirstDayOfWeek];\n}\n/**\n * Range of week days that are considered the week-end for the given locale.\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns The range of day values, `[startDay, endDay]`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nfunction getLocaleWeekEndRange(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.WeekendRange];\n}\n/**\n * Retrieves a localized date-value formating string.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param width The format type.\n * @returns The localized formating string.\n * @see `FormatWidth`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nfunction getLocaleDateFormat(locale, width) {\n const data = ɵfindLocaleData(locale);\n return getLastDefinedValue(data[ɵLocaleDataIndex.DateFormat], width);\n}\n/**\n * Retrieves a localized time-value formatting string.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param width The format type.\n * @returns The localized formatting string.\n * @see `FormatWidth`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n\n * @publicApi\n */\nfunction getLocaleTimeFormat(locale, width) {\n const data = ɵfindLocaleData(locale);\n return getLastDefinedValue(data[ɵLocaleDataIndex.TimeFormat], width);\n}\n/**\n * Retrieves a localized date-time formatting string.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param width The format type.\n * @returns The localized formatting string.\n * @see `FormatWidth`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nfunction getLocaleDateTimeFormat(locale, width) {\n const data = ɵfindLocaleData(locale);\n const dateTimeFormatData = data[ɵLocaleDataIndex.DateTimeFormat];\n return getLastDefinedValue(dateTimeFormatData, width);\n}\n/**\n * Retrieves a localized number symbol that can be used to replace placeholders in number formats.\n * @param locale The locale code.\n * @param symbol The symbol to localize.\n * @returns The character for the localized symbol.\n * @see `NumberSymbol`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nfunction getLocaleNumberSymbol(locale, symbol) {\n const data = ɵfindLocaleData(locale);\n const res = data[ɵLocaleDataIndex.NumberSymbols][symbol];\n if (typeof res === 'undefined') {\n if (symbol === NumberSymbol.CurrencyDecimal) {\n return data[ɵLocaleDataIndex.NumberSymbols][NumberSymbol.Decimal];\n }\n else if (symbol === NumberSymbol.CurrencyGroup) {\n return data[ɵLocaleDataIndex.NumberSymbols][NumberSymbol.Group];\n }\n }\n return res;\n}\n/**\n * Retrieves a number format for a given locale.\n *\n * Numbers are formatted using patterns, like `#,###.00`. For example, the pattern `#,###.00`\n * when used to format the number 12345.678 could result in \"12'345,678\". That would happen if the\n * grouping separator for your language is an apostrophe, and the decimal separator is a comma.\n *\n * Important: The characters `.` `,` `0` `#` (and others below) are special placeholders\n * that stand for the decimal separator, and so on, and are NOT real characters.\n * You must NOT \"translate\" the placeholders. For example, don't change `.` to `,` even though in\n * your language the decimal point is written with a comma. The symbols should be replaced by the\n * local equivalents, using the appropriate `NumberSymbol` for your language.\n *\n * Here are the special characters used in number patterns:\n *\n * | Symbol | Meaning |\n * |--------|---------|\n * | . | Replaced automatically by the character used for the decimal point. |\n * | , | Replaced by the \"grouping\" (thousands) separator. |\n * | 0 | Replaced by a digit (or zero if there aren't enough digits). |\n * | # | Replaced by a digit (or nothing if there aren't enough). |\n * | ¤ | Replaced by a currency symbol, such as $ or USD. |\n * | % | Marks a percent format. The % symbol may change position, but must be retained. |\n * | E | Marks a scientific format. The E symbol may change position, but must be retained. |\n * | ' | Special characters used as literal characters are quoted with ASCII single quotes. |\n *\n * @param locale A locale code for the locale format rules to use.\n * @param type The type of numeric value to be formatted (such as `Decimal` or `Currency`.)\n * @returns The localized format string.\n * @see `NumberFormatStyle`\n * @see [CLDR website](http://cldr.unicode.org/translation/number-patterns)\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nfunction getLocaleNumberFormat(locale, type) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.NumberFormats][type];\n}\n/**\n * Retrieves the symbol used to represent the currency for the main country\n * corresponding to a given locale. For example, '$' for `en-US`.\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns The localized symbol character,\n * or `null` if the main country cannot be determined.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nfunction getLocaleCurrencySymbol(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.CurrencySymbol] || null;\n}\n/**\n * Retrieves the name of the currency for the main country corresponding\n * to a given locale. For example, 'US Dollar' for `en-US`.\n * @param locale A locale code for the locale format rules to use.\n * @returns The currency name,\n * or `null` if the main country cannot be determined.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nfunction getLocaleCurrencyName(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.CurrencyName] || null;\n}\n/**\n * Retrieves the default currency code for the given locale.\n *\n * The default is defined as the first currency which is still in use.\n *\n * @param locale The code of the locale whose currency code we want.\n * @returns The code of the default currency for the given locale.\n *\n * @publicApi\n */\nfunction getLocaleCurrencyCode(locale) {\n return ɵgetLocaleCurrencyCode(locale);\n}\n/**\n * Retrieves the currency values for a given locale.\n * @param locale A locale code for the locale format rules to use.\n * @returns The currency values.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n */\nfunction getLocaleCurrencies(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.Currencies];\n}\n/**\n * @alias core/ɵgetLocalePluralCase\n * @publicApi\n */\nconst getLocalePluralCase = ɵgetLocalePluralCase;\nfunction checkFullData(data) {\n if (!data[ɵLocaleDataIndex.ExtraData]) {\n throw new Error(`Missing extra locale data for the locale \"${data[ɵLocaleDataIndex\n .LocaleId]}\". Use \"registerLocaleData\" to load new data. See the \"I18n guide\" on angular.io to know more.`);\n }\n}\n/**\n * Retrieves locale-specific rules used to determine which day period to use\n * when more than one period is defined for a locale.\n *\n * There is a rule for each defined day period. The\n * first rule is applied to the first day period and so on.\n * Fall back to AM/PM when no rules are available.\n *\n * A rule can specify a period as time range, or as a single time value.\n *\n * This functionality is only available when you have loaded the full locale data.\n * See the [\"I18n guide\"](guide/i18n#i18n-pipes).\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns The rules for the locale, a single time value or array of *from-time, to-time*,\n * or null if no periods are available.\n *\n * @see `getLocaleExtraDayPeriods()`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nfunction getLocaleExtraDayPeriodRules(locale) {\n const data = ɵfindLocaleData(locale);\n checkFullData(data);\n const rules = data[ɵLocaleDataIndex.ExtraData][2 /* ExtraDayPeriodsRules */] || [];\n return rules.map((rule) => {\n if (typeof rule === 'string') {\n return extractTime(rule);\n }\n return [extractTime(rule[0]), extractTime(rule[1])];\n });\n}\n/**\n * Retrieves locale-specific day periods, which indicate roughly how a day is broken up\n * in different languages.\n * For example, for `en-US`, periods are morning, noon, afternoon, evening, and midnight.\n *\n * This functionality is only available when you have loaded the full locale data.\n * See the [\"I18n guide\"](guide/i18n#i18n-pipes).\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns The translated day-period strings.\n * @see `getLocaleExtraDayPeriodRules()`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nfunction getLocaleExtraDayPeriods(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n checkFullData(data);\n const dayPeriodsData = [\n data[ɵLocaleDataIndex.ExtraData][0 /* ExtraDayPeriodFormats */],\n data[ɵLocaleDataIndex.ExtraData][1 /* ExtraDayPeriodStandalone */]\n ];\n const dayPeriods = getLastDefinedValue(dayPeriodsData, formStyle) || [];\n return getLastDefinedValue(dayPeriods, width) || [];\n}\n/**\n * Retrieves the writing direction of a specified locale\n * @param locale A locale code for the locale format rules to use.\n * @publicApi\n * @returns 'rtl' or 'ltr'\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n */\nfunction getLocaleDirection(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.Directionality];\n}\n/**\n * Retrieves the first value that is defined in an array, going backwards from an index position.\n *\n * To avoid repeating the same data (as when the \"format\" and \"standalone\" forms are the same)\n * add the first value to the locale data arrays, and add other values only if they are different.\n *\n * @param data The data array to retrieve from.\n * @param index A 0-based index into the array to start from.\n * @returns The value immediately before the given index position.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nfunction getLastDefinedValue(data, index) {\n for (let i = index; i > -1; i--) {\n if (typeof data[i] !== 'undefined') {\n return data[i];\n }\n }\n throw new Error('Locale data API: locale data undefined');\n}\n/**\n * Extracts the hours and minutes from a string like \"15:45\"\n */\nfunction extractTime(time) {\n const [h, m] = time.split(':');\n return { hours: +h, minutes: +m };\n}\n/**\n * Retrieves the currency symbol for a given currency code.\n *\n * For example, for the default `en-US` locale, the code `USD` can\n * be represented by the narrow symbol `$` or the wide symbol `US$`.\n *\n * @param code The currency code.\n * @param format The format, `wide` or `narrow`.\n * @param locale A locale code for the locale format rules to use.\n *\n * @returns The symbol, or the currency code if no symbol is available.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nfunction getCurrencySymbol(code, format, locale = 'en') {\n const currency = getLocaleCurrencies(locale)[code] || CURRENCIES_EN[code] || [];\n const symbolNarrow = currency[1 /* SymbolNarrow */];\n if (format === 'narrow' && typeof symbolNarrow === 'string') {\n return symbolNarrow;\n }\n return currency[0 /* Symbol */] || code;\n}\n// Most currencies have cents, that's why the default is 2\nconst DEFAULT_NB_OF_CURRENCY_DIGITS = 2;\n/**\n * Reports the number of decimal digits for a given currency.\n * The value depends upon the presence of cents in that particular currency.\n *\n * @param code The currency code.\n * @returns The number of decimal digits, typically 0 or 2.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nfunction getNumberOfCurrencyDigits(code) {\n let digits;\n const currency = CURRENCIES_EN[code];\n if (currency) {\n digits = currency[2 /* NbOfDigits */];\n }\n return typeof digits === 'number' ? digits : DEFAULT_NB_OF_CURRENCY_DIGITS;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst ISO8601_DATE_REGEX = /^(\\d{4})-?(\\d\\d)-?(\\d\\d)(?:T(\\d\\d)(?::?(\\d\\d)(?::?(\\d\\d)(?:\\.(\\d+))?)?)?(Z|([+-])(\\d\\d):?(\\d\\d))?)?$/;\n// 1 2 3 4 5 6 7 8 9 10 11\nconst NAMED_FORMATS = {};\nconst DATE_FORMATS_SPLIT = /((?:[^GyMLwWdEabBhHmsSzZO']+)|(?:'(?:[^']|'')*')|(?:G{1,5}|y{1,4}|M{1,5}|L{1,5}|w{1,2}|W{1}|d{1,2}|E{1,6}|a{1,5}|b{1,5}|B{1,5}|h{1,2}|H{1,2}|m{1,2}|s{1,2}|S{1,3}|z{1,4}|Z{1,5}|O{1,4}))([\\s\\S]*)/;\nvar ZoneWidth;\n(function (ZoneWidth) {\n ZoneWidth[ZoneWidth[\"Short\"] = 0] = \"Short\";\n ZoneWidth[ZoneWidth[\"ShortGMT\"] = 1] = \"ShortGMT\";\n ZoneWidth[ZoneWidth[\"Long\"] = 2] = \"Long\";\n ZoneWidth[ZoneWidth[\"Extended\"] = 3] = \"Extended\";\n})(ZoneWidth || (ZoneWidth = {}));\nvar DateType;\n(function (DateType) {\n DateType[DateType[\"FullYear\"] = 0] = \"FullYear\";\n DateType[DateType[\"Month\"] = 1] = \"Month\";\n DateType[DateType[\"Date\"] = 2] = \"Date\";\n DateType[DateType[\"Hours\"] = 3] = \"Hours\";\n DateType[DateType[\"Minutes\"] = 4] = \"Minutes\";\n DateType[DateType[\"Seconds\"] = 5] = \"Seconds\";\n DateType[DateType[\"FractionalSeconds\"] = 6] = \"FractionalSeconds\";\n DateType[DateType[\"Day\"] = 7] = \"Day\";\n})(DateType || (DateType = {}));\nvar TranslationType;\n(function (TranslationType) {\n TranslationType[TranslationType[\"DayPeriods\"] = 0] = \"DayPeriods\";\n TranslationType[TranslationType[\"Days\"] = 1] = \"Days\";\n TranslationType[TranslationType[\"Months\"] = 2] = \"Months\";\n TranslationType[TranslationType[\"Eras\"] = 3] = \"Eras\";\n})(TranslationType || (TranslationType = {}));\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a date according to locale rules.\n *\n * @param value The date to format, as a Date, or a number (milliseconds since UTC epoch)\n * or an [ISO date-time string](https://www.w3.org/TR/NOTE-datetime).\n * @param format The date-time components to include. See `DatePipe` for details.\n * @param locale A locale code for the locale format rules to use.\n * @param timezone The time zone. A time zone offset from GMT (such as `'+0430'`),\n * or a standard UTC/GMT or continental US time zone abbreviation.\n * If not specified, uses host system settings.\n *\n * @returns The formatted date string.\n *\n * @see `DatePipe`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nfunction formatDate(value, format, locale, timezone) {\n let date = toDate(value);\n const namedFormat = getNamedFormat(locale, format);\n format = namedFormat || format;\n let parts = [];\n let match;\n while (format) {\n match = DATE_FORMATS_SPLIT.exec(format);\n if (match) {\n parts = parts.concat(match.slice(1));\n const part = parts.pop();\n if (!part) {\n break;\n }\n format = part;\n }\n else {\n parts.push(format);\n break;\n }\n }\n let dateTimezoneOffset = date.getTimezoneOffset();\n if (timezone) {\n dateTimezoneOffset = timezoneToOffset(timezone, dateTimezoneOffset);\n date = convertTimezoneToLocal(date, timezone, true);\n }\n let text = '';\n parts.forEach(value => {\n const dateFormatter = getDateFormatter(value);\n text += dateFormatter ?\n dateFormatter(date, locale, dateTimezoneOffset) :\n value === '\\'\\'' ? '\\'' : value.replace(/(^'|'$)/g, '').replace(/''/g, '\\'');\n });\n return text;\n}\nfunction getNamedFormat(locale, format) {\n const localeId = getLocaleId(locale);\n NAMED_FORMATS[localeId] = NAMED_FORMATS[localeId] || {};\n if (NAMED_FORMATS[localeId][format]) {\n return NAMED_FORMATS[localeId][format];\n }\n let formatValue = '';\n switch (format) {\n case 'shortDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Short);\n break;\n case 'mediumDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Medium);\n break;\n case 'longDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Long);\n break;\n case 'fullDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Full);\n break;\n case 'shortTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Short);\n break;\n case 'mediumTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Medium);\n break;\n case 'longTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Long);\n break;\n case 'fullTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Full);\n break;\n case 'short':\n const shortTime = getNamedFormat(locale, 'shortTime');\n const shortDate = getNamedFormat(locale, 'shortDate');\n formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Short), [shortTime, shortDate]);\n break;\n case 'medium':\n const mediumTime = getNamedFormat(locale, 'mediumTime');\n const mediumDate = getNamedFormat(locale, 'mediumDate');\n formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Medium), [mediumTime, mediumDate]);\n break;\n case 'long':\n const longTime = getNamedFormat(locale, 'longTime');\n const longDate = getNamedFormat(locale, 'longDate');\n formatValue =\n formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Long), [longTime, longDate]);\n break;\n case 'full':\n const fullTime = getNamedFormat(locale, 'fullTime');\n const fullDate = getNamedFormat(locale, 'fullDate');\n formatValue =\n formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Full), [fullTime, fullDate]);\n break;\n }\n if (formatValue) {\n NAMED_FORMATS[localeId][format] = formatValue;\n }\n return formatValue;\n}\nfunction formatDateTime(str, opt_values) {\n if (opt_values) {\n str = str.replace(/\\{([^}]+)}/g, function (match, key) {\n return (opt_values != null && key in opt_values) ? opt_values[key] : match;\n });\n }\n return str;\n}\nfunction padNumber(num, digits, minusSign = '-', trim, negWrap) {\n let neg = '';\n if (num < 0 || (negWrap && num <= 0)) {\n if (negWrap) {\n num = -num + 1;\n }\n else {\n num = -num;\n neg = minusSign;\n }\n }\n let strNum = String(num);\n while (strNum.length < digits) {\n strNum = '0' + strNum;\n }\n if (trim) {\n strNum = strNum.substr(strNum.length - digits);\n }\n return neg + strNum;\n}\nfunction formatFractionalSeconds(milliseconds, digits) {\n const strMs = padNumber(milliseconds, 3);\n return strMs.substr(0, digits);\n}\n/**\n * Returns a date formatter that transforms a date into its locale digit representation\n */\nfunction dateGetter(name, size, offset = 0, trim = false, negWrap = false) {\n return function (date, locale) {\n let part = getDatePart(name, date);\n if (offset > 0 || part > -offset) {\n part += offset;\n }\n if (name === DateType.Hours) {\n if (part === 0 && offset === -12) {\n part = 12;\n }\n }\n else if (name === DateType.FractionalSeconds) {\n return formatFractionalSeconds(part, size);\n }\n const localeMinus = getLocaleNumberSymbol(locale, NumberSymbol.MinusSign);\n return padNumber(part, size, localeMinus, trim, negWrap);\n };\n}\nfunction getDatePart(part, date) {\n switch (part) {\n case DateType.FullYear:\n return date.getFullYear();\n case DateType.Month:\n return date.getMonth();\n case DateType.Date:\n return date.getDate();\n case DateType.Hours:\n return date.getHours();\n case DateType.Minutes:\n return date.getMinutes();\n case DateType.Seconds:\n return date.getSeconds();\n case DateType.FractionalSeconds:\n return date.getMilliseconds();\n case DateType.Day:\n return date.getDay();\n default:\n throw new Error(`Unknown DateType value \"${part}\".`);\n }\n}\n/**\n * Returns a date formatter that transforms a date into its locale string representation\n */\nfunction dateStrGetter(name, width, form = FormStyle.Format, extended = false) {\n return function (date, locale) {\n return getDateTranslation(date, locale, name, width, form, extended);\n };\n}\n/**\n * Returns the locale translation of a date for a given form, type and width\n */\nfunction getDateTranslation(date, locale, name, width, form, extended) {\n switch (name) {\n case TranslationType.Months:\n return getLocaleMonthNames(locale, form, width)[date.getMonth()];\n case TranslationType.Days:\n return getLocaleDayNames(locale, form, width)[date.getDay()];\n case TranslationType.DayPeriods:\n const currentHours = date.getHours();\n const currentMinutes = date.getMinutes();\n if (extended) {\n const rules = getLocaleExtraDayPeriodRules(locale);\n const dayPeriods = getLocaleExtraDayPeriods(locale, form, width);\n const index = rules.findIndex(rule => {\n if (Array.isArray(rule)) {\n // morning, afternoon, evening, night\n const [from, to] = rule;\n const afterFrom = currentHours >= from.hours && currentMinutes >= from.minutes;\n const beforeTo = (currentHours < to.hours ||\n (currentHours === to.hours && currentMinutes < to.minutes));\n // We must account for normal rules that span a period during the day (e.g. 6am-9am)\n // where `from` is less (earlier) than `to`. But also rules that span midnight (e.g.\n // 10pm - 5am) where `from` is greater (later!) than `to`.\n //\n // In the first case the current time must be BOTH after `from` AND before `to`\n // (e.g. 8am is after 6am AND before 10am).\n //\n // In the second case the current time must be EITHER after `from` OR before `to`\n // (e.g. 4am is before 5am but not after 10pm; and 11pm is not before 5am but it is\n // after 10pm).\n if (from.hours < to.hours) {\n if (afterFrom && beforeTo) {\n return true;\n }\n }\n else if (afterFrom || beforeTo) {\n return true;\n }\n }\n else { // noon or midnight\n if (rule.hours === currentHours && rule.minutes === currentMinutes) {\n return true;\n }\n }\n return false;\n });\n if (index !== -1) {\n return dayPeriods[index];\n }\n }\n // if no rules for the day periods, we use am/pm by default\n return getLocaleDayPeriods(locale, form, width)[currentHours < 12 ? 0 : 1];\n case TranslationType.Eras:\n return getLocaleEraNames(locale, width)[date.getFullYear() <= 0 ? 0 : 1];\n default:\n // This default case is not needed by TypeScript compiler, as the switch is exhaustive.\n // However Closure Compiler does not understand that and reports an error in typed mode.\n // The `throw new Error` below works around the problem, and the unexpected: never variable\n // makes sure tsc still checks this code is unreachable.\n const unexpected = name;\n throw new Error(`unexpected translation type ${unexpected}`);\n }\n}\n/**\n * Returns a date formatter that transforms a date and an offset into a timezone with ISO8601 or\n * GMT format depending on the width (eg: short = +0430, short:GMT = GMT+4, long = GMT+04:30,\n * extended = +04:30)\n */\nfunction timeZoneGetter(width) {\n return function (date, locale, offset) {\n const zone = -1 * offset;\n const minusSign = getLocaleNumberSymbol(locale, NumberSymbol.MinusSign);\n const hours = zone > 0 ? Math.floor(zone / 60) : Math.ceil(zone / 60);\n switch (width) {\n case ZoneWidth.Short:\n return ((zone >= 0) ? '+' : '') + padNumber(hours, 2, minusSign) +\n padNumber(Math.abs(zone % 60), 2, minusSign);\n case ZoneWidth.ShortGMT:\n return 'GMT' + ((zone >= 0) ? '+' : '') + padNumber(hours, 1, minusSign);\n case ZoneWidth.Long:\n return 'GMT' + ((zone >= 0) ? '+' : '') + padNumber(hours, 2, minusSign) + ':' +\n padNumber(Math.abs(zone % 60), 2, minusSign);\n case ZoneWidth.Extended:\n if (offset === 0) {\n return 'Z';\n }\n else {\n return ((zone >= 0) ? '+' : '') + padNumber(hours, 2, minusSign) + ':' +\n padNumber(Math.abs(zone % 60), 2, minusSign);\n }\n default:\n throw new Error(`Unknown zone width \"${width}\"`);\n }\n };\n}\nconst JANUARY = 0;\nconst THURSDAY = 4;\nfunction getFirstThursdayOfYear(year) {\n const firstDayOfYear = (new Date(year, JANUARY, 1)).getDay();\n return new Date(year, 0, 1 + ((firstDayOfYear <= THURSDAY) ? THURSDAY : THURSDAY + 7) - firstDayOfYear);\n}\nfunction getThursdayThisWeek(datetime) {\n return new Date(datetime.getFullYear(), datetime.getMonth(), datetime.getDate() + (THURSDAY - datetime.getDay()));\n}\nfunction weekGetter(size, monthBased = false) {\n return function (date, locale) {\n let result;\n if (monthBased) {\n const nbDaysBefore1stDayOfMonth = new Date(date.getFullYear(), date.getMonth(), 1).getDay() - 1;\n const today = date.getDate();\n result = 1 + Math.floor((today + nbDaysBefore1stDayOfMonth) / 7);\n }\n else {\n const firstThurs = getFirstThursdayOfYear(date.getFullYear());\n const thisThurs = getThursdayThisWeek(date);\n const diff = thisThurs.getTime() - firstThurs.getTime();\n result = 1 + Math.round(diff / 6.048e8); // 6.048e8 ms per week\n }\n return padNumber(result, size, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n };\n}\nconst DATE_FORMATS = {};\n// Based on CLDR formats:\n// See complete list: http://www.unicode.org/reports/tr35/tr35-dates.html#Date_Field_Symbol_Table\n// See also explanations: http://cldr.unicode.org/translation/date-time\n// TODO(ocombe): support all missing cldr formats: Y, U, Q, D, F, e, c, j, J, C, A, v, V, X, x\nfunction getDateFormatter(format) {\n if (DATE_FORMATS[format]) {\n return DATE_FORMATS[format];\n }\n let formatter;\n switch (format) {\n // Era name (AD/BC)\n case 'G':\n case 'GG':\n case 'GGG':\n formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Abbreviated);\n break;\n case 'GGGG':\n formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Wide);\n break;\n case 'GGGGG':\n formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Narrow);\n break;\n // 1 digit representation of the year, e.g. (AD 1 => 1, AD 199 => 199)\n case 'y':\n formatter = dateGetter(DateType.FullYear, 1, 0, false, true);\n break;\n // 2 digit representation of the year, padded (00-99). (e.g. AD 2001 => 01, AD 2010 => 10)\n case 'yy':\n formatter = dateGetter(DateType.FullYear, 2, 0, true, true);\n break;\n // 3 digit representation of the year, padded (000-999). (e.g. AD 2001 => 01, AD 2010 => 10)\n case 'yyy':\n formatter = dateGetter(DateType.FullYear, 3, 0, false, true);\n break;\n // 4 digit representation of the year (e.g. AD 1 => 0001, AD 2010 => 2010)\n case 'yyyy':\n formatter = dateGetter(DateType.FullYear, 4, 0, false, true);\n break;\n // Month of the year (1-12), numeric\n case 'M':\n case 'L':\n formatter = dateGetter(DateType.Month, 1, 1);\n break;\n case 'MM':\n case 'LL':\n formatter = dateGetter(DateType.Month, 2, 1);\n break;\n // Month of the year (January, ...), string, format\n case 'MMM':\n formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Abbreviated);\n break;\n case 'MMMM':\n formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Wide);\n break;\n case 'MMMMM':\n formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Narrow);\n break;\n // Month of the year (January, ...), string, standalone\n case 'LLL':\n formatter =\n dateStrGetter(TranslationType.Months, TranslationWidth.Abbreviated, FormStyle.Standalone);\n break;\n case 'LLLL':\n formatter =\n dateStrGetter(TranslationType.Months, TranslationWidth.Wide, FormStyle.Standalone);\n break;\n case 'LLLLL':\n formatter =\n dateStrGetter(TranslationType.Months, TranslationWidth.Narrow, FormStyle.Standalone);\n break;\n // Week of the year (1, ... 52)\n case 'w':\n formatter = weekGetter(1);\n break;\n case 'ww':\n formatter = weekGetter(2);\n break;\n // Week of the month (1, ...)\n case 'W':\n formatter = weekGetter(1, true);\n break;\n // Day of the month (1-31)\n case 'd':\n formatter = dateGetter(DateType.Date, 1);\n break;\n case 'dd':\n formatter = dateGetter(DateType.Date, 2);\n break;\n // Day of the Week\n case 'E':\n case 'EE':\n case 'EEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Abbreviated);\n break;\n case 'EEEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Wide);\n break;\n case 'EEEEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Narrow);\n break;\n case 'EEEEEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Short);\n break;\n // Generic period of the day (am-pm)\n case 'a':\n case 'aa':\n case 'aaa':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated);\n break;\n case 'aaaa':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide);\n break;\n case 'aaaaa':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow);\n break;\n // Extended period of the day (midnight, at night, ...), standalone\n case 'b':\n case 'bb':\n case 'bbb':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated, FormStyle.Standalone, true);\n break;\n case 'bbbb':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide, FormStyle.Standalone, true);\n break;\n case 'bbbbb':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow, FormStyle.Standalone, true);\n break;\n // Extended period of the day (midnight, night, ...), standalone\n case 'B':\n case 'BB':\n case 'BBB':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated, FormStyle.Format, true);\n break;\n case 'BBBB':\n formatter =\n dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide, FormStyle.Format, true);\n break;\n case 'BBBBB':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow, FormStyle.Format, true);\n break;\n // Hour in AM/PM, (1-12)\n case 'h':\n formatter = dateGetter(DateType.Hours, 1, -12);\n break;\n case 'hh':\n formatter = dateGetter(DateType.Hours, 2, -12);\n break;\n // Hour of the day (0-23)\n case 'H':\n formatter = dateGetter(DateType.Hours, 1);\n break;\n // Hour in day, padded (00-23)\n case 'HH':\n formatter = dateGetter(DateType.Hours, 2);\n break;\n // Minute of the hour (0-59)\n case 'm':\n formatter = dateGetter(DateType.Minutes, 1);\n break;\n case 'mm':\n formatter = dateGetter(DateType.Minutes, 2);\n break;\n // Second of the minute (0-59)\n case 's':\n formatter = dateGetter(DateType.Seconds, 1);\n break;\n case 'ss':\n formatter = dateGetter(DateType.Seconds, 2);\n break;\n // Fractional second\n case 'S':\n formatter = dateGetter(DateType.FractionalSeconds, 1);\n break;\n case 'SS':\n formatter = dateGetter(DateType.FractionalSeconds, 2);\n break;\n case 'SSS':\n formatter = dateGetter(DateType.FractionalSeconds, 3);\n break;\n // Timezone ISO8601 short format (-0430)\n case 'Z':\n case 'ZZ':\n case 'ZZZ':\n formatter = timeZoneGetter(ZoneWidth.Short);\n break;\n // Timezone ISO8601 extended format (-04:30)\n case 'ZZZZZ':\n formatter = timeZoneGetter(ZoneWidth.Extended);\n break;\n // Timezone GMT short format (GMT+4)\n case 'O':\n case 'OO':\n case 'OOO':\n // Should be location, but fallback to format O instead because we don't have the data yet\n case 'z':\n case 'zz':\n case 'zzz':\n formatter = timeZoneGetter(ZoneWidth.ShortGMT);\n break;\n // Timezone GMT long format (GMT+0430)\n case 'OOOO':\n case 'ZZZZ':\n // Should be location, but fallback to format O instead because we don't have the data yet\n case 'zzzz':\n formatter = timeZoneGetter(ZoneWidth.Long);\n break;\n default:\n return null;\n }\n DATE_FORMATS[format] = formatter;\n return formatter;\n}\nfunction timezoneToOffset(timezone, fallback) {\n // Support: IE 9-11 only, Edge 13-15+\n // IE/Edge do not \"understand\" colon (`:`) in timezone\n timezone = timezone.replace(/:/g, '');\n const requestedTimezoneOffset = Date.parse('Jan 01, 1970 00:00:00 ' + timezone) / 60000;\n return isNaN(requestedTimezoneOffset) ? fallback : requestedTimezoneOffset;\n}\nfunction addDateMinutes(date, minutes) {\n date = new Date(date.getTime());\n date.setMinutes(date.getMinutes() + minutes);\n return date;\n}\nfunction convertTimezoneToLocal(date, timezone, reverse) {\n const reverseValue = reverse ? -1 : 1;\n const dateTimezoneOffset = date.getTimezoneOffset();\n const timezoneOffset = timezoneToOffset(timezone, dateTimezoneOffset);\n return addDateMinutes(date, reverseValue * (timezoneOffset - dateTimezoneOffset));\n}\n/**\n * Converts a value to date.\n *\n * Supported input formats:\n * - `Date`\n * - number: timestamp\n * - string: numeric (e.g. \"1234\"), ISO and date strings in a format supported by\n * [Date.parse()](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Date/parse).\n * Note: ISO strings without time return a date without timeoffset.\n *\n * Throws if unable to convert to a date.\n */\nfunction toDate(value) {\n if (isDate(value)) {\n return value;\n }\n if (typeof value === 'number' && !isNaN(value)) {\n return new Date(value);\n }\n if (typeof value === 'string') {\n value = value.trim();\n const parsedNb = parseFloat(value);\n // any string that only contains numbers, like \"1234\" but not like \"1234hello\"\n if (!isNaN(value - parsedNb)) {\n return new Date(parsedNb);\n }\n if (/^(\\d{4}-\\d{1,2}-\\d{1,2})$/.test(value)) {\n /* For ISO Strings without time the day, month and year must be extracted from the ISO String\n before Date creation to avoid time offset and errors in the new Date.\n If we only replace '-' with ',' in the ISO String (\"2015,01,01\"), and try to create a new\n date, some browsers (e.g. IE 9) will throw an invalid Date error.\n If we leave the '-' (\"2015-01-01\") and try to create a new Date(\"2015-01-01\") the timeoffset\n is applied.\n Note: ISO months are 0 for January, 1 for February, ... */\n const [y, m, d] = value.split('-').map((val) => +val);\n return new Date(y, m - 1, d);\n }\n let match;\n if (match = value.match(ISO8601_DATE_REGEX)) {\n return isoStringToDate(match);\n }\n }\n const date = new Date(value);\n if (!isDate(date)) {\n throw new Error(`Unable to convert \"${value}\" into a date`);\n }\n return date;\n}\n/**\n * Converts a date in ISO8601 to a Date.\n * Used instead of `Date.parse` because of browser discrepancies.\n */\nfunction isoStringToDate(match) {\n const date = new Date(0);\n let tzHour = 0;\n let tzMin = 0;\n // match[8] means that the string contains \"Z\" (UTC) or a timezone like \"+01:00\" or \"+0100\"\n const dateSetter = match[8] ? date.setUTCFullYear : date.setFullYear;\n const timeSetter = match[8] ? date.setUTCHours : date.setHours;\n // if there is a timezone defined like \"+01:00\" or \"+0100\"\n if (match[9]) {\n tzHour = Number(match[9] + match[10]);\n tzMin = Number(match[9] + match[11]);\n }\n dateSetter.call(date, Number(match[1]), Number(match[2]) - 1, Number(match[3]));\n const h = Number(match[4] || 0) - tzHour;\n const m = Number(match[5] || 0) - tzMin;\n const s = Number(match[6] || 0);\n const ms = Math.round(parseFloat('0.' + (match[7] || 0)) * 1000);\n timeSetter.call(date, h, m, s, ms);\n return date;\n}\nfunction isDate(value) {\n return value instanceof Date && !isNaN(value.valueOf());\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst NUMBER_FORMAT_REGEXP = /^(\\d+)?\\.((\\d+)(-(\\d+))?)?$/;\nconst MAX_DIGITS = 22;\nconst DECIMAL_SEP = '.';\nconst ZERO_CHAR = '0';\nconst PATTERN_SEP = ';';\nconst GROUP_SEP = ',';\nconst DIGIT_CHAR = '#';\nconst CURRENCY_CHAR = '¤';\nconst PERCENT_CHAR = '%';\n/**\n * Transforms a number to a locale string based on a style and a format.\n */\nfunction formatNumberToLocaleString(value, pattern, locale, groupSymbol, decimalSymbol, digitsInfo, isPercent = false) {\n let formattedText = '';\n let isZero = false;\n if (!isFinite(value)) {\n formattedText = getLocaleNumberSymbol(locale, NumberSymbol.Infinity);\n }\n else {\n let parsedNumber = parseNumber(value);\n if (isPercent) {\n parsedNumber = toPercent(parsedNumber);\n }\n let minInt = pattern.minInt;\n let minFraction = pattern.minFrac;\n let maxFraction = pattern.maxFrac;\n if (digitsInfo) {\n const parts = digitsInfo.match(NUMBER_FORMAT_REGEXP);\n if (parts === null) {\n throw new Error(`${digitsInfo} is not a valid digit info`);\n }\n const minIntPart = parts[1];\n const minFractionPart = parts[3];\n const maxFractionPart = parts[5];\n if (minIntPart != null) {\n minInt = parseIntAutoRadix(minIntPart);\n }\n if (minFractionPart != null) {\n minFraction = parseIntAutoRadix(minFractionPart);\n }\n if (maxFractionPart != null) {\n maxFraction = parseIntAutoRadix(maxFractionPart);\n }\n else if (minFractionPart != null && minFraction > maxFraction) {\n maxFraction = minFraction;\n }\n }\n roundNumber(parsedNumber, minFraction, maxFraction);\n let digits = parsedNumber.digits;\n let integerLen = parsedNumber.integerLen;\n const exponent = parsedNumber.exponent;\n let decimals = [];\n isZero = digits.every(d => !d);\n // pad zeros for small numbers\n for (; integerLen < minInt; integerLen++) {\n digits.unshift(0);\n }\n // pad zeros for small numbers\n for (; integerLen < 0; integerLen++) {\n digits.unshift(0);\n }\n // extract decimals digits\n if (integerLen > 0) {\n decimals = digits.splice(integerLen, digits.length);\n }\n else {\n decimals = digits;\n digits = [0];\n }\n // format the integer digits with grouping separators\n const groups = [];\n if (digits.length >= pattern.lgSize) {\n groups.unshift(digits.splice(-pattern.lgSize, digits.length).join(''));\n }\n while (digits.length > pattern.gSize) {\n groups.unshift(digits.splice(-pattern.gSize, digits.length).join(''));\n }\n if (digits.length) {\n groups.unshift(digits.join(''));\n }\n formattedText = groups.join(getLocaleNumberSymbol(locale, groupSymbol));\n // append the decimal digits\n if (decimals.length) {\n formattedText += getLocaleNumberSymbol(locale, decimalSymbol) + decimals.join('');\n }\n if (exponent) {\n formattedText += getLocaleNumberSymbol(locale, NumberSymbol.Exponential) + '+' + exponent;\n }\n }\n if (value < 0 && !isZero) {\n formattedText = pattern.negPre + formattedText + pattern.negSuf;\n }\n else {\n formattedText = pattern.posPre + formattedText + pattern.posSuf;\n }\n return formattedText;\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a number as currency using locale rules.\n *\n * @param value The number to format.\n * @param locale A locale code for the locale format rules to use.\n * @param currency A string containing the currency symbol or its name,\n * such as \"$\" or \"Canadian Dollar\". Used in output string, but does not affect the operation\n * of the function.\n * @param currencyCode The [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217)\n * currency code, such as `USD` for the US dollar and `EUR` for the euro.\n * Used to determine the number of digits in the decimal part.\n * @param digitInfo Decimal representation options, specified by a string in the following format:\n * `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details.\n *\n * @returns The formatted currency value.\n *\n * @see `formatNumber()`\n * @see `DecimalPipe`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nfunction formatCurrency(value, locale, currency, currencyCode, digitsInfo) {\n const format = getLocaleNumberFormat(locale, NumberFormatStyle.Currency);\n const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n pattern.minFrac = getNumberOfCurrencyDigits(currencyCode);\n pattern.maxFrac = pattern.minFrac;\n const res = formatNumberToLocaleString(value, pattern, locale, NumberSymbol.CurrencyGroup, NumberSymbol.CurrencyDecimal, digitsInfo);\n return res\n .replace(CURRENCY_CHAR, currency)\n // if we have 2 time the currency character, the second one is ignored\n .replace(CURRENCY_CHAR, '')\n // If there is a spacing between currency character and the value and\n // the currency character is supressed by passing an empty string, the\n // spacing character would remain as part of the string. Then we\n // should remove it.\n .trim();\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a number as a percentage according to locale rules.\n *\n * @param value The number to format.\n * @param locale A locale code for the locale format rules to use.\n * @param digitInfo Decimal representation options, specified by a string in the following format:\n * `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details.\n *\n * @returns The formatted percentage value.\n *\n * @see `formatNumber()`\n * @see `DecimalPipe`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n * @publicApi\n *\n */\nfunction formatPercent(value, locale, digitsInfo) {\n const format = getLocaleNumberFormat(locale, NumberFormatStyle.Percent);\n const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n const res = formatNumberToLocaleString(value, pattern, locale, NumberSymbol.Group, NumberSymbol.Decimal, digitsInfo, true);\n return res.replace(new RegExp(PERCENT_CHAR, 'g'), getLocaleNumberSymbol(locale, NumberSymbol.PercentSign));\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a number as text, with group sizing, separator, and other\n * parameters based on the locale.\n *\n * @param value The number to format.\n * @param locale A locale code for the locale format rules to use.\n * @param digitInfo Decimal representation options, specified by a string in the following format:\n * `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details.\n *\n * @returns The formatted text string.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nfunction formatNumber(value, locale, digitsInfo) {\n const format = getLocaleNumberFormat(locale, NumberFormatStyle.Decimal);\n const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n return formatNumberToLocaleString(value, pattern, locale, NumberSymbol.Group, NumberSymbol.Decimal, digitsInfo);\n}\nfunction parseNumberFormat(format, minusSign = '-') {\n const p = {\n minInt: 1,\n minFrac: 0,\n maxFrac: 0,\n posPre: '',\n posSuf: '',\n negPre: '',\n negSuf: '',\n gSize: 0,\n lgSize: 0\n };\n const patternParts = format.split(PATTERN_SEP);\n const positive = patternParts[0];\n const negative = patternParts[1];\n const positiveParts = positive.indexOf(DECIMAL_SEP) !== -1 ?\n positive.split(DECIMAL_SEP) :\n [\n positive.substring(0, positive.lastIndexOf(ZERO_CHAR) + 1),\n positive.substring(positive.lastIndexOf(ZERO_CHAR) + 1)\n ], integer = positiveParts[0], fraction = positiveParts[1] || '';\n p.posPre = integer.substr(0, integer.indexOf(DIGIT_CHAR));\n for (let i = 0; i < fraction.length; i++) {\n const ch = fraction.charAt(i);\n if (ch === ZERO_CHAR) {\n p.minFrac = p.maxFrac = i + 1;\n }\n else if (ch === DIGIT_CHAR) {\n p.maxFrac = i + 1;\n }\n else {\n p.posSuf += ch;\n }\n }\n const groups = integer.split(GROUP_SEP);\n p.gSize = groups[1] ? groups[1].length : 0;\n p.lgSize = (groups[2] || groups[1]) ? (groups[2] || groups[1]).length : 0;\n if (negative) {\n const trunkLen = positive.length - p.posPre.length - p.posSuf.length, pos = negative.indexOf(DIGIT_CHAR);\n p.negPre = negative.substr(0, pos).replace(/'/g, '');\n p.negSuf = negative.substr(pos + trunkLen).replace(/'/g, '');\n }\n else {\n p.negPre = minusSign + p.posPre;\n p.negSuf = p.posSuf;\n }\n return p;\n}\n// Transforms a parsed number into a percentage by multiplying it by 100\nfunction toPercent(parsedNumber) {\n // if the number is 0, don't do anything\n if (parsedNumber.digits[0] === 0) {\n return parsedNumber;\n }\n // Getting the current number of decimals\n const fractionLen = parsedNumber.digits.length - parsedNumber.integerLen;\n if (parsedNumber.exponent) {\n parsedNumber.exponent += 2;\n }\n else {\n if (fractionLen === 0) {\n parsedNumber.digits.push(0, 0);\n }\n else if (fractionLen === 1) {\n parsedNumber.digits.push(0);\n }\n parsedNumber.integerLen += 2;\n }\n return parsedNumber;\n}\n/**\n * Parses a number.\n * Significant bits of this parse algorithm came from https://github.com/MikeMcl/big.js/\n */\nfunction parseNumber(num) {\n let numStr = Math.abs(num) + '';\n let exponent = 0, digits, integerLen;\n let i, j, zeros;\n // Decimal point?\n if ((integerLen = numStr.indexOf(DECIMAL_SEP)) > -1) {\n numStr = numStr.replace(DECIMAL_SEP, '');\n }\n // Exponential form?\n if ((i = numStr.search(/e/i)) > 0) {\n // Work out the exponent.\n if (integerLen < 0)\n integerLen = i;\n integerLen += +numStr.slice(i + 1);\n numStr = numStr.substring(0, i);\n }\n else if (integerLen < 0) {\n // There was no decimal point or exponent so it is an integer.\n integerLen = numStr.length;\n }\n // Count the number of leading zeros.\n for (i = 0; numStr.charAt(i) === ZERO_CHAR; i++) { /* empty */\n }\n if (i === (zeros = numStr.length)) {\n // The digits are all zero.\n digits = [0];\n integerLen = 1;\n }\n else {\n // Count the number of trailing zeros\n zeros--;\n while (numStr.charAt(zeros) === ZERO_CHAR)\n zeros--;\n // Trailing zeros are insignificant so ignore them\n integerLen -= i;\n digits = [];\n // Convert string to array of digits without leading/trailing zeros.\n for (j = 0; i <= zeros; i++, j++) {\n digits[j] = Number(numStr.charAt(i));\n }\n }\n // If the number overflows the maximum allowed digits then use an exponent.\n if (integerLen > MAX_DIGITS) {\n digits = digits.splice(0, MAX_DIGITS - 1);\n exponent = integerLen - 1;\n integerLen = 1;\n }\n return { digits, exponent, integerLen };\n}\n/**\n * Round the parsed number to the specified number of decimal places\n * This function changes the parsedNumber in-place\n */\nfunction roundNumber(parsedNumber, minFrac, maxFrac) {\n if (minFrac > maxFrac) {\n throw new Error(`The minimum number of digits after fraction (${minFrac}) is higher than the maximum (${maxFrac}).`);\n }\n let digits = parsedNumber.digits;\n let fractionLen = digits.length - parsedNumber.integerLen;\n const fractionSize = Math.min(Math.max(minFrac, fractionLen), maxFrac);\n // The index of the digit to where rounding is to occur\n let roundAt = fractionSize + parsedNumber.integerLen;\n let digit = digits[roundAt];\n if (roundAt > 0) {\n // Drop fractional digits beyond `roundAt`\n digits.splice(Math.max(parsedNumber.integerLen, roundAt));\n // Set non-fractional digits beyond `roundAt` to 0\n for (let j = roundAt; j < digits.length; j++) {\n digits[j] = 0;\n }\n }\n else {\n // We rounded to zero so reset the parsedNumber\n fractionLen = Math.max(0, fractionLen);\n parsedNumber.integerLen = 1;\n digits.length = Math.max(1, roundAt = fractionSize + 1);\n digits[0] = 0;\n for (let i = 1; i < roundAt; i++)\n digits[i] = 0;\n }\n if (digit >= 5) {\n if (roundAt - 1 < 0) {\n for (let k = 0; k > roundAt; k--) {\n digits.unshift(0);\n parsedNumber.integerLen++;\n }\n digits.unshift(1);\n parsedNumber.integerLen++;\n }\n else {\n digits[roundAt - 1]++;\n }\n }\n // Pad out with zeros to get the required fraction length\n for (; fractionLen < Math.max(0, fractionSize); fractionLen++)\n digits.push(0);\n let dropTrailingZeros = fractionSize !== 0;\n // Minimal length = nb of decimals required + current nb of integers\n // Any number besides that is optional and can be removed if it's a trailing 0\n const minLen = minFrac + parsedNumber.integerLen;\n // Do any carrying, e.g. a digit was rounded up to 10\n const carry = digits.reduceRight(function (carry, d, i, digits) {\n d = d + carry;\n digits[i] = d < 10 ? d : d - 10; // d % 10\n if (dropTrailingZeros) {\n // Do not keep meaningless fractional trailing zeros (e.g. 15.52000 --> 15.52)\n if (digits[i] === 0 && i >= minLen) {\n digits.pop();\n }\n else {\n dropTrailingZeros = false;\n }\n }\n return d >= 10 ? 1 : 0; // Math.floor(d / 10);\n }, 0);\n if (carry) {\n digits.unshift(carry);\n parsedNumber.integerLen++;\n }\n}\nfunction parseIntAutoRadix(text) {\n const result = parseInt(text);\n if (isNaN(result)) {\n throw new Error('Invalid integer literal when parsing ' + text);\n }\n return result;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @publicApi\n */\nclass NgLocalization {\n}\n/**\n * Returns the plural category for a given value.\n * - \"=value\" when the case exists,\n * - the plural category otherwise\n */\nfunction getPluralCategory(value, cases, ngLocalization, locale) {\n let key = `=${value}`;\n if (cases.indexOf(key) > -1) {\n return key;\n }\n key = ngLocalization.getPluralCategory(value, locale);\n if (cases.indexOf(key) > -1) {\n return key;\n }\n if (cases.indexOf('other') > -1) {\n return 'other';\n }\n throw new Error(`No plural message found for value \"${value}\"`);\n}\n/**\n * Returns the plural case based on the locale\n *\n * @publicApi\n */\nclass NgLocaleLocalization extends NgLocalization {\n constructor(locale) {\n super();\n this.locale = locale;\n }\n getPluralCategory(value, locale) {\n const plural = getLocalePluralCase(locale || this.locale)(value);\n switch (plural) {\n case Plural.Zero:\n return 'zero';\n case Plural.One:\n return 'one';\n case Plural.Two:\n return 'two';\n case Plural.Few:\n return 'few';\n case Plural.Many:\n return 'many';\n default:\n return 'other';\n }\n }\n}\nNgLocaleLocalization.ɵfac = function NgLocaleLocalization_Factory(t) { return new (t || NgLocaleLocalization)(ɵngcc0.ɵɵinject(LOCALE_ID)); };\nNgLocaleLocalization.ɵprov = ɵngcc0.ɵɵdefineInjectable({ token: NgLocaleLocalization, factory: NgLocaleLocalization.ɵfac });\nNgLocaleLocalization.ctorParameters = () => [\n { type: String, decorators: [{ type: Inject, args: [LOCALE_ID,] }] }\n];\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(NgLocaleLocalization, [{\n type: Injectable\n }], function () { return [{ type: String, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }]; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Register global data to be used internally by Angular. See the\n * [\"I18n guide\"](guide/i18n#i18n-pipes) to know how to import additional locale data.\n *\n * The signature registerLocaleData(data: any, extraData?: any) is deprecated since v5.1\n *\n * @publicApi\n */\nfunction registerLocaleData(data, localeId, extraData) {\n return ɵregisterLocaleData(data, localeId, extraData);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction parseCookieValue(cookieStr, name) {\n name = encodeURIComponent(name);\n for (const cookie of cookieStr.split(';')) {\n const eqIndex = cookie.indexOf('=');\n const [cookieName, cookieValue] = eqIndex == -1 ? [cookie, ''] : [cookie.slice(0, eqIndex), cookie.slice(eqIndex + 1)];\n if (cookieName.trim() === name) {\n return decodeURIComponent(cookieValue);\n }\n }\n return null;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n *\n * @usageNotes\n * ```\n * ...\n *\n * ...\n *\n * ...\n *\n * ...\n *\n * ...\n * ```\n *\n * @description\n *\n * Adds and removes CSS classes on an HTML element.\n *\n * The CSS classes are updated as follows, depending on the type of the expression evaluation:\n * - `string` - the CSS classes listed in the string (space delimited) are added,\n * - `Array` - the CSS classes declared as Array elements are added,\n * - `Object` - keys are CSS classes that get added when the expression given in the value\n * evaluates to a truthy value, otherwise they are removed.\n *\n * @publicApi\n */\nclass NgClass {\n constructor(_iterableDiffers, _keyValueDiffers, _ngEl, _renderer) {\n this._iterableDiffers = _iterableDiffers;\n this._keyValueDiffers = _keyValueDiffers;\n this._ngEl = _ngEl;\n this._renderer = _renderer;\n this._iterableDiffer = null;\n this._keyValueDiffer = null;\n this._initialClasses = [];\n this._rawClass = null;\n }\n set klass(value) {\n this._removeClasses(this._initialClasses);\n this._initialClasses = typeof value === 'string' ? value.split(/\\s+/) : [];\n this._applyClasses(this._initialClasses);\n this._applyClasses(this._rawClass);\n }\n set ngClass(value) {\n this._removeClasses(this._rawClass);\n this._applyClasses(this._initialClasses);\n this._iterableDiffer = null;\n this._keyValueDiffer = null;\n this._rawClass = typeof value === 'string' ? value.split(/\\s+/) : value;\n if (this._rawClass) {\n if (ɵisListLikeIterable(this._rawClass)) {\n this._iterableDiffer = this._iterableDiffers.find(this._rawClass).create();\n }\n else {\n this._keyValueDiffer = this._keyValueDiffers.find(this._rawClass).create();\n }\n }\n }\n ngDoCheck() {\n if (this._iterableDiffer) {\n const iterableChanges = this._iterableDiffer.diff(this._rawClass);\n if (iterableChanges) {\n this._applyIterableChanges(iterableChanges);\n }\n }\n else if (this._keyValueDiffer) {\n const keyValueChanges = this._keyValueDiffer.diff(this._rawClass);\n if (keyValueChanges) {\n this._applyKeyValueChanges(keyValueChanges);\n }\n }\n }\n _applyKeyValueChanges(changes) {\n changes.forEachAddedItem((record) => this._toggleClass(record.key, record.currentValue));\n changes.forEachChangedItem((record) => this._toggleClass(record.key, record.currentValue));\n changes.forEachRemovedItem((record) => {\n if (record.previousValue) {\n this._toggleClass(record.key, false);\n }\n });\n }\n _applyIterableChanges(changes) {\n changes.forEachAddedItem((record) => {\n if (typeof record.item === 'string') {\n this._toggleClass(record.item, true);\n }\n else {\n throw new Error(`NgClass can only toggle CSS classes expressed as strings, got ${ɵstringify(record.item)}`);\n }\n });\n changes.forEachRemovedItem((record) => this._toggleClass(record.item, false));\n }\n /**\n * Applies a collection of CSS classes to the DOM element.\n *\n * For argument of type Set and Array CSS class names contained in those collections are always\n * added.\n * For argument of type Map CSS class name in the map's key is toggled based on the value (added\n * for truthy and removed for falsy).\n */\n _applyClasses(rawClassVal) {\n if (rawClassVal) {\n if (Array.isArray(rawClassVal) || rawClassVal instanceof Set) {\n rawClassVal.forEach((klass) => this._toggleClass(klass, true));\n }\n else {\n Object.keys(rawClassVal).forEach(klass => this._toggleClass(klass, !!rawClassVal[klass]));\n }\n }\n }\n /**\n * Removes a collection of CSS classes from the DOM element. This is mostly useful for cleanup\n * purposes.\n */\n _removeClasses(rawClassVal) {\n if (rawClassVal) {\n if (Array.isArray(rawClassVal) || rawClassVal instanceof Set) {\n rawClassVal.forEach((klass) => this._toggleClass(klass, false));\n }\n else {\n Object.keys(rawClassVal).forEach(klass => this._toggleClass(klass, false));\n }\n }\n }\n _toggleClass(klass, enabled) {\n klass = klass.trim();\n if (klass) {\n klass.split(/\\s+/g).forEach(klass => {\n if (enabled) {\n this._renderer.addClass(this._ngEl.nativeElement, klass);\n }\n else {\n this._renderer.removeClass(this._ngEl.nativeElement, klass);\n }\n });\n }\n }\n}\nNgClass.ɵfac = function NgClass_Factory(t) { return new (t || NgClass)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.IterableDiffers), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.KeyValueDiffers), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ElementRef), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.Renderer2)); };\nNgClass.ɵdir = ɵngcc0.ɵɵdefineDirective({ type: NgClass, selectors: [[\"\", \"ngClass\", \"\"]], inputs: { klass: [\"class\", \"klass\"], ngClass: \"ngClass\" } });\nNgClass.ctorParameters = () => [\n { type: IterableDiffers },\n { type: KeyValueDiffers },\n { type: ElementRef },\n { type: Renderer2 }\n];\nNgClass.propDecorators = {\n klass: [{ type: Input, args: ['class',] }],\n ngClass: [{ type: Input, args: ['ngClass',] }]\n};\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(NgClass, [{\n type: Directive,\n args: [{ selector: '[ngClass]' }]\n }], function () { return [{ type: ɵngcc0.IterableDiffers }, { type: ɵngcc0.KeyValueDiffers }, { type: ɵngcc0.ElementRef }, { type: ɵngcc0.Renderer2 }]; }, { klass: [{\n type: Input,\n args: ['class']\n }], ngClass: [{\n type: Input,\n args: ['ngClass']\n }] }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Instantiates a single {@link Component} type and inserts its Host View into current View.\n * `NgComponentOutlet` provides a declarative approach for dynamic component creation.\n *\n * `NgComponentOutlet` requires a component type, if a falsy value is set the view will clear and\n * any existing component will get destroyed.\n *\n * @usageNotes\n *\n * ### Fine tune control\n *\n * You can control the component creation process by using the following optional attributes:\n *\n * * `ngComponentOutletInjector`: Optional custom {@link Injector} that will be used as parent for\n * the Component. Defaults to the injector of the current view container.\n *\n * * `ngComponentOutletContent`: Optional list of projectable nodes to insert into the content\n * section of the component, if exists.\n *\n * * `ngComponentOutletNgModuleFactory`: Optional module factory to allow dynamically loading other\n * module, then load a component from that module.\n *\n * ### Syntax\n *\n * Simple\n * ```\n * \n * ```\n *\n * Customized injector/content\n * ```\n * \n * \n * ```\n *\n * Customized ngModuleFactory\n * ```\n * \n * \n * ```\n *\n * ### A simple example\n *\n * {@example common/ngComponentOutlet/ts/module.ts region='SimpleExample'}\n *\n * A more complete example with additional options:\n *\n * {@example common/ngComponentOutlet/ts/module.ts region='CompleteExample'}\n *\n * @publicApi\n * @ngModule CommonModule\n */\nclass NgComponentOutlet {\n constructor(_viewContainerRef) {\n this._viewContainerRef = _viewContainerRef;\n this._componentRef = null;\n this._moduleRef = null;\n }\n ngOnChanges(changes) {\n this._viewContainerRef.clear();\n this._componentRef = null;\n if (this.ngComponentOutlet) {\n const elInjector = this.ngComponentOutletInjector || this._viewContainerRef.parentInjector;\n if (changes['ngComponentOutletNgModuleFactory']) {\n if (this._moduleRef)\n this._moduleRef.destroy();\n if (this.ngComponentOutletNgModuleFactory) {\n const parentModule = elInjector.get(NgModuleRef);\n this._moduleRef = this.ngComponentOutletNgModuleFactory.create(parentModule.injector);\n }\n else {\n this._moduleRef = null;\n }\n }\n const componentFactoryResolver = this._moduleRef ? this._moduleRef.componentFactoryResolver :\n elInjector.get(ComponentFactoryResolver);\n const componentFactory = componentFactoryResolver.resolveComponentFactory(this.ngComponentOutlet);\n this._componentRef = this._viewContainerRef.createComponent(componentFactory, this._viewContainerRef.length, elInjector, this.ngComponentOutletContent);\n }\n }\n ngOnDestroy() {\n if (this._moduleRef)\n this._moduleRef.destroy();\n }\n}\nNgComponentOutlet.ɵfac = function NgComponentOutlet_Factory(t) { return new (t || NgComponentOutlet)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ViewContainerRef)); };\nNgComponentOutlet.ɵdir = ɵngcc0.ɵɵdefineDirective({ type: NgComponentOutlet, selectors: [[\"\", \"ngComponentOutlet\", \"\"]], inputs: { ngComponentOutlet: \"ngComponentOutlet\", ngComponentOutletInjector: \"ngComponentOutletInjector\", ngComponentOutletContent: \"ngComponentOutletContent\", ngComponentOutletNgModuleFactory: \"ngComponentOutletNgModuleFactory\" }, features: [ɵngcc0.ɵɵNgOnChangesFeature] });\nNgComponentOutlet.ctorParameters = () => [\n { type: ViewContainerRef }\n];\nNgComponentOutlet.propDecorators = {\n ngComponentOutlet: [{ type: Input }],\n ngComponentOutletInjector: [{ type: Input }],\n ngComponentOutletContent: [{ type: Input }],\n ngComponentOutletNgModuleFactory: [{ type: Input }]\n};\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(NgComponentOutlet, [{\n type: Directive,\n args: [{ selector: '[ngComponentOutlet]' }]\n }], function () { return [{ type: ɵngcc0.ViewContainerRef }]; }, { ngComponentOutlet: [{\n type: Input\n }], ngComponentOutletInjector: [{\n type: Input\n }], ngComponentOutletContent: [{\n type: Input\n }], ngComponentOutletNgModuleFactory: [{\n type: Input\n }] }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @publicApi\n */\nclass NgForOfContext {\n constructor($implicit, ngForOf, index, count) {\n this.$implicit = $implicit;\n this.ngForOf = ngForOf;\n this.index = index;\n this.count = count;\n }\n get first() {\n return this.index === 0;\n }\n get last() {\n return this.index === this.count - 1;\n }\n get even() {\n return this.index % 2 === 0;\n }\n get odd() {\n return !this.even;\n }\n}\n/**\n * A [structural directive](guide/structural-directives) that renders\n * a template for each item in a collection.\n * The directive is placed on an element, which becomes the parent\n * of the cloned templates.\n *\n * The `ngForOf` directive is generally used in the\n * [shorthand form](guide/structural-directives#the-asterisk--prefix) `*ngFor`.\n * In this form, the template to be rendered for each iteration is the content\n * of an anchor element containing the directive.\n *\n * The following example shows the shorthand syntax with some options,\n * contained in an `
  • ` element.\n *\n * ```\n *
  • ...
  • \n * ```\n *\n * The shorthand form expands into a long form that uses the `ngForOf` selector\n * on an `` element.\n * The content of the `` element is the `
  • ` element that held the\n * short-form directive.\n *\n * Here is the expanded version of the short-form example.\n *\n * ```\n * \n *
  • ...
  • \n *
    \n * ```\n *\n * Angular automatically expands the shorthand syntax as it compiles the template.\n * The context for each embedded view is logically merged to the current component\n * context according to its lexical position.\n *\n * When using the shorthand syntax, Angular allows only [one structural directive\n * on an element](guide/structural-directives#one-structural-directive-per-host-element).\n * If you want to iterate conditionally, for example,\n * put the `*ngIf` on a container element that wraps the `*ngFor` element.\n * For futher discussion, see\n * [Structural Directives](guide/structural-directives#one-per-element).\n *\n * @usageNotes\n *\n * ### Local variables\n *\n * `NgForOf` provides exported values that can be aliased to local variables.\n * For example:\n *\n * ```\n *
  • \n * {{i}}/{{users.length}}. {{user}} default\n *
  • \n * ```\n *\n * The following exported values can be aliased to local variables:\n *\n * - `$implicit: T`: The value of the individual items in the iterable (`ngForOf`).\n * - `ngForOf: NgIterable`: The value of the iterable expression. Useful when the expression is\n * more complex then a property access, for example when using the async pipe (`userStreams |\n * async`).\n * - `index: number`: The index of the current item in the iterable.\n * - `count: number`: The length of the iterable.\n * - `first: boolean`: True when the item is the first item in the iterable.\n * - `last: boolean`: True when the item is the last item in the iterable.\n * - `even: boolean`: True when the item has an even index in the iterable.\n * - `odd: boolean`: True when the item has an odd index in the iterable.\n *\n * ### Change propagation\n *\n * When the contents of the iterator changes, `NgForOf` makes the corresponding changes to the DOM:\n *\n * * When an item is added, a new instance of the template is added to the DOM.\n * * When an item is removed, its template instance is removed from the DOM.\n * * When items are reordered, their respective templates are reordered in the DOM.\n *\n * Angular uses object identity to track insertions and deletions within the iterator and reproduce\n * those changes in the DOM. This has important implications for animations and any stateful\n * controls that are present, such as `` elements that accept user input. Inserted rows can\n * be animated in, deleted rows can be animated out, and unchanged rows retain any unsaved state\n * such as user input.\n * For more on animations, see [Transitions and Triggers](guide/transition-and-triggers).\n *\n * The identities of elements in the iterator can change while the data does not.\n * This can happen, for example, if the iterator is produced from an RPC to the server, and that\n * RPC is re-run. Even if the data hasn't changed, the second response produces objects with\n * different identities, and Angular must tear down the entire DOM and rebuild it (as if all old\n * elements were deleted and all new elements inserted).\n *\n * To avoid this expensive operation, you can customize the default tracking algorithm.\n * by supplying the `trackBy` option to `NgForOf`.\n * `trackBy` takes a function that has two arguments: `index` and `item`.\n * If `trackBy` is given, Angular tracks changes by the return value of the function.\n *\n * @see [Structural Directives](guide/structural-directives)\n * @ngModule CommonModule\n * @publicApi\n */\nclass NgForOf {\n constructor(_viewContainer, _template, _differs) {\n this._viewContainer = _viewContainer;\n this._template = _template;\n this._differs = _differs;\n this._ngForOf = null;\n this._ngForOfDirty = true;\n this._differ = null;\n }\n /**\n * The value of the iterable expression, which can be used as a\n * [template input variable](guide/structural-directives#template-input-variable).\n */\n set ngForOf(ngForOf) {\n this._ngForOf = ngForOf;\n this._ngForOfDirty = true;\n }\n /**\n * A function that defines how to track changes for items in the iterable.\n *\n * When items are added, moved, or removed in the iterable,\n * the directive must re-render the appropriate DOM nodes.\n * To minimize churn in the DOM, only nodes that have changed\n * are re-rendered.\n *\n * By default, the change detector assumes that\n * the object instance identifies the node in the iterable.\n * When this function is supplied, the directive uses\n * the result of calling this function to identify the item node,\n * rather than the identity of the object itself.\n *\n * The function receives two inputs,\n * the iteration index and the node object ID.\n */\n set ngForTrackBy(fn) {\n if (isDevMode() && fn != null && typeof fn !== 'function') {\n // TODO(vicb): use a log service once there is a public one available\n if (console && console.warn) {\n console.warn(`trackBy must be a function, but received ${JSON.stringify(fn)}. ` +\n `See https://angular.io/api/common/NgForOf#change-propagation for more information.`);\n }\n }\n this._trackByFn = fn;\n }\n get ngForTrackBy() {\n return this._trackByFn;\n }\n /**\n * A reference to the template that is stamped out for each item in the iterable.\n * @see [template reference variable](guide/template-reference-variables)\n */\n set ngForTemplate(value) {\n // TODO(TS2.1): make TemplateRef>> once we move to TS v2.1\n // The current type is too restrictive; a template that just uses index, for example,\n // should be acceptable.\n if (value) {\n this._template = value;\n }\n }\n /**\n * Applies the changes when needed.\n */\n ngDoCheck() {\n if (this._ngForOfDirty) {\n this._ngForOfDirty = false;\n // React on ngForOf changes only once all inputs have been initialized\n const value = this._ngForOf;\n if (!this._differ && value) {\n try {\n this._differ = this._differs.find(value).create(this.ngForTrackBy);\n }\n catch (_a) {\n throw new Error(`Cannot find a differ supporting object '${value}' of type '${getTypeName(value)}'. NgFor only supports binding to Iterables such as Arrays.`);\n }\n }\n }\n if (this._differ) {\n const changes = this._differ.diff(this._ngForOf);\n if (changes)\n this._applyChanges(changes);\n }\n }\n _applyChanges(changes) {\n const insertTuples = [];\n changes.forEachOperation((item, adjustedPreviousIndex, currentIndex) => {\n if (item.previousIndex == null) {\n // NgForOf is never \"null\" or \"undefined\" here because the differ detected\n // that a new item needs to be inserted from the iterable. This implies that\n // there is an iterable value for \"_ngForOf\".\n const view = this._viewContainer.createEmbeddedView(this._template, new NgForOfContext(null, this._ngForOf, -1, -1), currentIndex === null ? undefined : currentIndex);\n const tuple = new RecordViewTuple(item, view);\n insertTuples.push(tuple);\n }\n else if (currentIndex == null) {\n this._viewContainer.remove(adjustedPreviousIndex === null ? undefined : adjustedPreviousIndex);\n }\n else if (adjustedPreviousIndex !== null) {\n const view = this._viewContainer.get(adjustedPreviousIndex);\n this._viewContainer.move(view, currentIndex);\n const tuple = new RecordViewTuple(item, view);\n insertTuples.push(tuple);\n }\n });\n for (let i = 0; i < insertTuples.length; i++) {\n this._perViewChange(insertTuples[i].view, insertTuples[i].record);\n }\n for (let i = 0, ilen = this._viewContainer.length; i < ilen; i++) {\n const viewRef = this._viewContainer.get(i);\n viewRef.context.index = i;\n viewRef.context.count = ilen;\n viewRef.context.ngForOf = this._ngForOf;\n }\n changes.forEachIdentityChange((record) => {\n const viewRef = this._viewContainer.get(record.currentIndex);\n viewRef.context.$implicit = record.item;\n });\n }\n _perViewChange(view, record) {\n view.context.$implicit = record.item;\n }\n /**\n * Asserts the correct type of the context for the template that `NgForOf` will render.\n *\n * The presence of this method is a signal to the Ivy template type-check compiler that the\n * `NgForOf` structural directive renders its template with a specific context type.\n */\n static ngTemplateContextGuard(dir, ctx) {\n return true;\n }\n}\nNgForOf.ɵfac = function NgForOf_Factory(t) { return new (t || NgForOf)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ViewContainerRef), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.TemplateRef), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.IterableDiffers)); };\nNgForOf.ɵdir = ɵngcc0.ɵɵdefineDirective({ type: NgForOf, selectors: [[\"\", \"ngFor\", \"\", \"ngForOf\", \"\"]], inputs: { ngForOf: \"ngForOf\", ngForTrackBy: \"ngForTrackBy\", ngForTemplate: \"ngForTemplate\" } });\nNgForOf.ctorParameters = () => [\n { type: ViewContainerRef },\n { type: TemplateRef },\n { type: IterableDiffers }\n];\nNgForOf.propDecorators = {\n ngForOf: [{ type: Input }],\n ngForTrackBy: [{ type: Input }],\n ngForTemplate: [{ type: Input }]\n};\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(NgForOf, [{\n type: Directive,\n args: [{ selector: '[ngFor][ngForOf]' }]\n }], function () { return [{ type: ɵngcc0.ViewContainerRef }, { type: ɵngcc0.TemplateRef }, { type: ɵngcc0.IterableDiffers }]; }, { ngForOf: [{\n type: Input\n }], ngForTrackBy: [{\n type: Input\n }], ngForTemplate: [{\n type: Input\n }] }); })();\nclass RecordViewTuple {\n constructor(record, view) {\n this.record = record;\n this.view = view;\n }\n}\nfunction getTypeName(type) {\n return type['name'] || typeof type;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A structural directive that conditionally includes a template based on the value of\n * an expression coerced to Boolean.\n * When the expression evaluates to true, Angular renders the template\n * provided in a `then` clause, and when false or null,\n * Angular renders the template provided in an optional `else` clause. The default\n * template for the `else` clause is blank.\n *\n * A [shorthand form](guide/structural-directives#the-asterisk--prefix) of the directive,\n * `*ngIf=\"condition\"`, is generally used, provided\n * as an attribute of the anchor element for the inserted template.\n * Angular expands this into a more explicit version, in which the anchor element\n * is contained in an `` element.\n *\n * Simple form with shorthand syntax:\n *\n * ```\n *
    Content to render when condition is true.
    \n * ```\n *\n * Simple form with expanded syntax:\n *\n * ```\n *
    Content to render when condition is\n * true.
    \n * ```\n *\n * Form with an \"else\" block:\n *\n * ```\n *
    Content to render when condition is true.
    \n * Content to render when condition is false.\n * ```\n *\n * Shorthand form with \"then\" and \"else\" blocks:\n *\n * ```\n *
    \n * Content to render when condition is true.\n * Content to render when condition is false.\n * ```\n *\n * Form with storing the value locally:\n *\n * ```\n *
    {{value}}
    \n * Content to render when value is null.\n * ```\n *\n * @usageNotes\n *\n * The `*ngIf` directive is most commonly used to conditionally show an inline template,\n * as seen in the following example.\n * The default `else` template is blank.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfSimple'}\n *\n * ### Showing an alternative template using `else`\n *\n * To display a template when `expression` evaluates to false, use an `else` template\n * binding as shown in the following example.\n * The `else` binding points to an `` element labeled `#elseBlock`.\n * The template can be defined anywhere in the component view, but is typically placed right after\n * `ngIf` for readability.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfElse'}\n *\n * ### Using an external `then` template\n *\n * In the previous example, the then-clause template is specified inline, as the content of the\n * tag that contains the `ngIf` directive. You can also specify a template that is defined\n * externally, by referencing a labeled `` element. When you do this, you can\n * change which template to use at runtime, as shown in the following example.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfThenElse'}\n *\n * ### Storing a conditional result in a variable\n *\n * You might want to show a set of properties from the same object. If you are waiting\n * for asynchronous data, the object can be undefined.\n * In this case, you can use `ngIf` and store the result of the condition in a local\n * variable as shown in the the following example.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfAs'}\n *\n * This code uses only one `AsyncPipe`, so only one subscription is created.\n * The conditional statement stores the result of `userStream|async` in the local variable `user`.\n * You can then bind the local `user` repeatedly.\n *\n * The conditional displays the data only if `userStream` returns a value,\n * so you don't need to use the\n * [safe-navigation-operator](guide/template-expression-operators#safe-navigation-operator) (`?.`)\n * to guard against null values when accessing properties.\n * You can display an alternative template while waiting for the data.\n *\n * ### Shorthand syntax\n *\n * The shorthand syntax `*ngIf` expands into two separate template specifications\n * for the \"then\" and \"else\" clauses. For example, consider the following shorthand statement,\n * that is meant to show a loading page while waiting for data to be loaded.\n *\n * ```\n *
    \n * ...\n *
    \n *\n * \n *
    Loading...
    \n *
    \n * ```\n *\n * You can see that the \"else\" clause references the ``\n * with the `#loading` label, and the template for the \"then\" clause\n * is provided as the content of the anchor element.\n *\n * However, when Angular expands the shorthand syntax, it creates\n * another `` tag, with `ngIf` and `ngIfElse` directives.\n * The anchor element containing the template for the \"then\" clause becomes\n * the content of this unlabeled `` tag.\n *\n * ```\n * \n *
    \n * ...\n *
    \n *
    \n *\n * \n *
    Loading...
    \n *
    \n * ```\n *\n * The presence of the implicit template object has implications for the nesting of\n * structural directives. For more on this subject, see\n * [Structural Directives](https://angular.io/guide/structural-directives#one-per-element).\n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass NgIf {\n constructor(_viewContainer, templateRef) {\n this._viewContainer = _viewContainer;\n this._context = new NgIfContext();\n this._thenTemplateRef = null;\n this._elseTemplateRef = null;\n this._thenViewRef = null;\n this._elseViewRef = null;\n this._thenTemplateRef = templateRef;\n }\n /**\n * The Boolean expression to evaluate as the condition for showing a template.\n */\n set ngIf(condition) {\n this._context.$implicit = this._context.ngIf = condition;\n this._updateView();\n }\n /**\n * A template to show if the condition expression evaluates to true.\n */\n set ngIfThen(templateRef) {\n assertTemplate('ngIfThen', templateRef);\n this._thenTemplateRef = templateRef;\n this._thenViewRef = null; // clear previous view if any.\n this._updateView();\n }\n /**\n * A template to show if the condition expression evaluates to false.\n */\n set ngIfElse(templateRef) {\n assertTemplate('ngIfElse', templateRef);\n this._elseTemplateRef = templateRef;\n this._elseViewRef = null; // clear previous view if any.\n this._updateView();\n }\n _updateView() {\n if (this._context.$implicit) {\n if (!this._thenViewRef) {\n this._viewContainer.clear();\n this._elseViewRef = null;\n if (this._thenTemplateRef) {\n this._thenViewRef =\n this._viewContainer.createEmbeddedView(this._thenTemplateRef, this._context);\n }\n }\n }\n else {\n if (!this._elseViewRef) {\n this._viewContainer.clear();\n this._thenViewRef = null;\n if (this._elseTemplateRef) {\n this._elseViewRef =\n this._viewContainer.createEmbeddedView(this._elseTemplateRef, this._context);\n }\n }\n }\n }\n /**\n * Asserts the correct type of the context for the template that `NgIf` will render.\n *\n * The presence of this method is a signal to the Ivy template type-check compiler that the\n * `NgIf` structural directive renders its template with a specific context type.\n */\n static ngTemplateContextGuard(dir, ctx) {\n return true;\n }\n}\nNgIf.ɵfac = function NgIf_Factory(t) { return new (t || NgIf)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ViewContainerRef), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.TemplateRef)); };\nNgIf.ɵdir = ɵngcc0.ɵɵdefineDirective({ type: NgIf, selectors: [[\"\", \"ngIf\", \"\"]], inputs: { ngIf: \"ngIf\", ngIfThen: \"ngIfThen\", ngIfElse: \"ngIfElse\" } });\nNgIf.ctorParameters = () => [\n { type: ViewContainerRef },\n { type: TemplateRef }\n];\nNgIf.propDecorators = {\n ngIf: [{ type: Input }],\n ngIfThen: [{ type: Input }],\n ngIfElse: [{ type: Input }]\n};\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(NgIf, [{\n type: Directive,\n args: [{ selector: '[ngIf]' }]\n }], function () { return [{ type: ɵngcc0.ViewContainerRef }, { type: ɵngcc0.TemplateRef }]; }, { ngIf: [{\n type: Input\n }], ngIfThen: [{\n type: Input\n }], ngIfElse: [{\n type: Input\n }] }); })();\n/**\n * @publicApi\n */\nclass NgIfContext {\n constructor() {\n this.$implicit = null;\n this.ngIf = null;\n }\n}\nfunction assertTemplate(property, templateRef) {\n const isTemplateRefOrNull = !!(!templateRef || templateRef.createEmbeddedView);\n if (!isTemplateRefOrNull) {\n throw new Error(`${property} must be a TemplateRef, but received '${ɵstringify(templateRef)}'.`);\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass SwitchView {\n constructor(_viewContainerRef, _templateRef) {\n this._viewContainerRef = _viewContainerRef;\n this._templateRef = _templateRef;\n this._created = false;\n }\n create() {\n this._created = true;\n this._viewContainerRef.createEmbeddedView(this._templateRef);\n }\n destroy() {\n this._created = false;\n this._viewContainerRef.clear();\n }\n enforceState(created) {\n if (created && !this._created) {\n this.create();\n }\n else if (!created && this._created) {\n this.destroy();\n }\n }\n}\n/**\n * @ngModule CommonModule\n *\n * @description\n * The `[ngSwitch]` directive on a container specifies an expression to match against.\n * The expressions to match are provided by `ngSwitchCase` directives on views within the container.\n * - Every view that matches is rendered.\n * - If there are no matches, a view with the `ngSwitchDefault` directive is rendered.\n * - Elements within the `[NgSwitch]` statement but outside of any `NgSwitchCase`\n * or `ngSwitchDefault` directive are preserved at the location.\n *\n * @usageNotes\n * Define a container element for the directive, and specify the switch expression\n * to match against as an attribute:\n *\n * ```\n * \n * ```\n *\n * Within the container, `*ngSwitchCase` statements specify the match expressions\n * as attributes. Include `*ngSwitchDefault` as the final case.\n *\n * ```\n * \n * ...\n * ...\n * ...\n * \n * ```\n *\n * ### Usage Examples\n *\n * The following example shows how to use more than one case to display the same view:\n *\n * ```\n * \n * \n * ...\n * ...\n * ...\n * \n * ...\n * \n * ```\n *\n * The following example shows how cases can be nested:\n * ```\n * \n * ...\n * ...\n * ...\n * \n * \n * \n * \n * \n * ...\n * \n * ```\n *\n * @publicApi\n * @see `NgSwitchCase`\n * @see `NgSwitchDefault`\n * @see [Structural Directives](guide/structural-directives)\n *\n */\nclass NgSwitch {\n constructor() {\n this._defaultUsed = false;\n this._caseCount = 0;\n this._lastCaseCheckIndex = 0;\n this._lastCasesMatched = false;\n }\n set ngSwitch(newValue) {\n this._ngSwitch = newValue;\n if (this._caseCount === 0) {\n this._updateDefaultCases(true);\n }\n }\n /** @internal */\n _addCase() {\n return this._caseCount++;\n }\n /** @internal */\n _addDefault(view) {\n if (!this._defaultViews) {\n this._defaultViews = [];\n }\n this._defaultViews.push(view);\n }\n /** @internal */\n _matchCase(value) {\n const matched = value == this._ngSwitch;\n this._lastCasesMatched = this._lastCasesMatched || matched;\n this._lastCaseCheckIndex++;\n if (this._lastCaseCheckIndex === this._caseCount) {\n this._updateDefaultCases(!this._lastCasesMatched);\n this._lastCaseCheckIndex = 0;\n this._lastCasesMatched = false;\n }\n return matched;\n }\n _updateDefaultCases(useDefault) {\n if (this._defaultViews && useDefault !== this._defaultUsed) {\n this._defaultUsed = useDefault;\n for (let i = 0; i < this._defaultViews.length; i++) {\n const defaultView = this._defaultViews[i];\n defaultView.enforceState(useDefault);\n }\n }\n }\n}\nNgSwitch.ɵfac = function NgSwitch_Factory(t) { return new (t || NgSwitch)(); };\nNgSwitch.ɵdir = ɵngcc0.ɵɵdefineDirective({ type: NgSwitch, selectors: [[\"\", \"ngSwitch\", \"\"]], inputs: { ngSwitch: \"ngSwitch\" } });\nNgSwitch.propDecorators = {\n ngSwitch: [{ type: Input }]\n};\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(NgSwitch, [{\n type: Directive,\n args: [{ selector: '[ngSwitch]' }]\n }], function () { return []; }, { ngSwitch: [{\n type: Input\n }] }); })();\n/**\n * @ngModule CommonModule\n *\n * @description\n * Provides a switch case expression to match against an enclosing `ngSwitch` expression.\n * When the expressions match, the given `NgSwitchCase` template is rendered.\n * If multiple match expressions match the switch expression value, all of them are displayed.\n *\n * @usageNotes\n *\n * Within a switch container, `*ngSwitchCase` statements specify the match expressions\n * as attributes. Include `*ngSwitchDefault` as the final case.\n *\n * ```\n * \n * ...\n * ...\n * ...\n * \n * ```\n *\n * Each switch-case statement contains an in-line HTML template or template reference\n * that defines the subtree to be selected if the value of the match expression\n * matches the value of the switch expression.\n *\n * Unlike JavaScript, which uses strict equality, Angular uses loose equality.\n * This means that the empty string, `\"\"` matches 0.\n *\n * @publicApi\n * @see `NgSwitch`\n * @see `NgSwitchDefault`\n *\n */\nclass NgSwitchCase {\n constructor(viewContainer, templateRef, ngSwitch) {\n this.ngSwitch = ngSwitch;\n ngSwitch._addCase();\n this._view = new SwitchView(viewContainer, templateRef);\n }\n /**\n * Performs case matching. For internal use only.\n */\n ngDoCheck() {\n this._view.enforceState(this.ngSwitch._matchCase(this.ngSwitchCase));\n }\n}\nNgSwitchCase.ɵfac = function NgSwitchCase_Factory(t) { return new (t || NgSwitchCase)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ViewContainerRef), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.TemplateRef), ɵngcc0.ɵɵdirectiveInject(NgSwitch, 1)); };\nNgSwitchCase.ɵdir = ɵngcc0.ɵɵdefineDirective({ type: NgSwitchCase, selectors: [[\"\", \"ngSwitchCase\", \"\"]], inputs: { ngSwitchCase: \"ngSwitchCase\" } });\nNgSwitchCase.ctorParameters = () => [\n { type: ViewContainerRef },\n { type: TemplateRef },\n { type: NgSwitch, decorators: [{ type: Host }] }\n];\nNgSwitchCase.propDecorators = {\n ngSwitchCase: [{ type: Input }]\n};\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(NgSwitchCase, [{\n type: Directive,\n args: [{ selector: '[ngSwitchCase]' }]\n }], function () { return [{ type: ɵngcc0.ViewContainerRef }, { type: ɵngcc0.TemplateRef }, { type: NgSwitch, decorators: [{\n type: Host\n }] }]; }, { ngSwitchCase: [{\n type: Input\n }] }); })();\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Creates a view that is rendered when no `NgSwitchCase` expressions\n * match the `NgSwitch` expression.\n * This statement should be the final case in an `NgSwitch`.\n *\n * @publicApi\n * @see `NgSwitch`\n * @see `NgSwitchCase`\n *\n */\nclass NgSwitchDefault {\n constructor(viewContainer, templateRef, ngSwitch) {\n ngSwitch._addDefault(new SwitchView(viewContainer, templateRef));\n }\n}\nNgSwitchDefault.ɵfac = function NgSwitchDefault_Factory(t) { return new (t || NgSwitchDefault)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ViewContainerRef), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.TemplateRef), ɵngcc0.ɵɵdirectiveInject(NgSwitch, 1)); };\nNgSwitchDefault.ɵdir = ɵngcc0.ɵɵdefineDirective({ type: NgSwitchDefault, selectors: [[\"\", \"ngSwitchDefault\", \"\"]] });\nNgSwitchDefault.ctorParameters = () => [\n { type: ViewContainerRef },\n { type: TemplateRef },\n { type: NgSwitch, decorators: [{ type: Host }] }\n];\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(NgSwitchDefault, [{\n type: Directive,\n args: [{ selector: '[ngSwitchDefault]' }]\n }], function () { return [{ type: ɵngcc0.ViewContainerRef }, { type: ɵngcc0.TemplateRef }, { type: NgSwitch, decorators: [{\n type: Host\n }] }]; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n *\n * @usageNotes\n * ```\n * \n * there is nothing\n * there is one\n * there are a few\n * \n * ```\n *\n * @description\n *\n * Adds / removes DOM sub-trees based on a numeric value. Tailored for pluralization.\n *\n * Displays DOM sub-trees that match the switch expression value, or failing that, DOM sub-trees\n * that match the switch expression's pluralization category.\n *\n * To use this directive you must provide a container element that sets the `[ngPlural]` attribute\n * to a switch expression. Inner elements with a `[ngPluralCase]` will display based on their\n * expression:\n * - if `[ngPluralCase]` is set to a value starting with `=`, it will only display if the value\n * matches the switch expression exactly,\n * - otherwise, the view will be treated as a \"category match\", and will only display if exact\n * value matches aren't found and the value maps to its category for the defined locale.\n *\n * See http://cldr.unicode.org/index/cldr-spec/plural-rules\n *\n * @publicApi\n */\nclass NgPlural {\n constructor(_localization) {\n this._localization = _localization;\n this._caseViews = {};\n }\n set ngPlural(value) {\n this._switchValue = value;\n this._updateView();\n }\n addCase(value, switchView) {\n this._caseViews[value] = switchView;\n }\n _updateView() {\n this._clearViews();\n const cases = Object.keys(this._caseViews);\n const key = getPluralCategory(this._switchValue, cases, this._localization);\n this._activateView(this._caseViews[key]);\n }\n _clearViews() {\n if (this._activeView)\n this._activeView.destroy();\n }\n _activateView(view) {\n if (view) {\n this._activeView = view;\n this._activeView.create();\n }\n }\n}\nNgPlural.ɵfac = function NgPlural_Factory(t) { return new (t || NgPlural)(ɵngcc0.ɵɵdirectiveInject(NgLocalization)); };\nNgPlural.ɵdir = ɵngcc0.ɵɵdefineDirective({ type: NgPlural, selectors: [[\"\", \"ngPlural\", \"\"]], inputs: { ngPlural: \"ngPlural\" } });\nNgPlural.ctorParameters = () => [\n { type: NgLocalization }\n];\nNgPlural.propDecorators = {\n ngPlural: [{ type: Input }]\n};\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(NgPlural, [{\n type: Directive,\n args: [{ selector: '[ngPlural]' }]\n }], function () { return [{ type: NgLocalization }]; }, { ngPlural: [{\n type: Input\n }] }); })();\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Creates a view that will be added/removed from the parent {@link NgPlural} when the\n * given expression matches the plural expression according to CLDR rules.\n *\n * @usageNotes\n * ```\n * \n * ...\n * ...\n * \n *```\n *\n * See {@link NgPlural} for more details and example.\n *\n * @publicApi\n */\nclass NgPluralCase {\n constructor(value, template, viewContainer, ngPlural) {\n this.value = value;\n const isANumber = !isNaN(Number(value));\n ngPlural.addCase(isANumber ? `=${value}` : value, new SwitchView(viewContainer, template));\n }\n}\nNgPluralCase.ɵfac = function NgPluralCase_Factory(t) { return new (t || NgPluralCase)(ɵngcc0.ɵɵinjectAttribute('ngPluralCase'), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.TemplateRef), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ViewContainerRef), ɵngcc0.ɵɵdirectiveInject(NgPlural, 1)); };\nNgPluralCase.ɵdir = ɵngcc0.ɵɵdefineDirective({ type: NgPluralCase, selectors: [[\"\", \"ngPluralCase\", \"\"]] });\nNgPluralCase.ctorParameters = () => [\n { type: String, decorators: [{ type: Attribute, args: ['ngPluralCase',] }] },\n { type: TemplateRef },\n { type: ViewContainerRef },\n { type: NgPlural, decorators: [{ type: Host }] }\n];\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(NgPluralCase, [{\n type: Directive,\n args: [{ selector: '[ngPluralCase]' }]\n }], function () { return [{ type: String, decorators: [{\n type: Attribute,\n args: ['ngPluralCase']\n }] }, { type: ɵngcc0.TemplateRef }, { type: ɵngcc0.ViewContainerRef }, { type: NgPlural, decorators: [{\n type: Host\n }] }]; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n *\n * @usageNotes\n *\n * Set the font of the containing element to the result of an expression.\n *\n * ```\n * ...\n * ```\n *\n * Set the width of the containing element to a pixel value returned by an expression.\n *\n * ```\n * ...\n * ```\n *\n * Set a collection of style values using an expression that returns key-value pairs.\n *\n * ```\n * ...\n * ```\n *\n * @description\n *\n * An attribute directive that updates styles for the containing HTML element.\n * Sets one or more style properties, specified as colon-separated key-value pairs.\n * The key is a style name, with an optional `.` suffix\n * (such as 'top.px', 'font-style.em').\n * The value is an expression to be evaluated.\n * The resulting non-null value, expressed in the given unit,\n * is assigned to the given style property.\n * If the result of evaluation is null, the corresponding style is removed.\n *\n * @publicApi\n */\nclass NgStyle {\n constructor(_ngEl, _differs, _renderer) {\n this._ngEl = _ngEl;\n this._differs = _differs;\n this._renderer = _renderer;\n this._ngStyle = null;\n this._differ = null;\n }\n set ngStyle(values) {\n this._ngStyle = values;\n if (!this._differ && values) {\n this._differ = this._differs.find(values).create();\n }\n }\n ngDoCheck() {\n if (this._differ) {\n const changes = this._differ.diff(this._ngStyle);\n if (changes) {\n this._applyChanges(changes);\n }\n }\n }\n _setStyle(nameAndUnit, value) {\n const [name, unit] = nameAndUnit.split('.');\n value = value != null && unit ? `${value}${unit}` : value;\n if (value != null) {\n this._renderer.setStyle(this._ngEl.nativeElement, name, value);\n }\n else {\n this._renderer.removeStyle(this._ngEl.nativeElement, name);\n }\n }\n _applyChanges(changes) {\n changes.forEachRemovedItem((record) => this._setStyle(record.key, null));\n changes.forEachAddedItem((record) => this._setStyle(record.key, record.currentValue));\n changes.forEachChangedItem((record) => this._setStyle(record.key, record.currentValue));\n }\n}\nNgStyle.ɵfac = function NgStyle_Factory(t) { return new (t || NgStyle)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ElementRef), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.KeyValueDiffers), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.Renderer2)); };\nNgStyle.ɵdir = ɵngcc0.ɵɵdefineDirective({ type: NgStyle, selectors: [[\"\", \"ngStyle\", \"\"]], inputs: { ngStyle: \"ngStyle\" } });\nNgStyle.ctorParameters = () => [\n { type: ElementRef },\n { type: KeyValueDiffers },\n { type: Renderer2 }\n];\nNgStyle.propDecorators = {\n ngStyle: [{ type: Input, args: ['ngStyle',] }]\n};\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(NgStyle, [{\n type: Directive,\n args: [{ selector: '[ngStyle]' }]\n }], function () { return [{ type: ɵngcc0.ElementRef }, { type: ɵngcc0.KeyValueDiffers }, { type: ɵngcc0.Renderer2 }]; }, { ngStyle: [{\n type: Input,\n args: ['ngStyle']\n }] }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Inserts an embedded view from a prepared `TemplateRef`.\n *\n * You can attach a context object to the `EmbeddedViewRef` by setting `[ngTemplateOutletContext]`.\n * `[ngTemplateOutletContext]` should be an object, the object's keys will be available for binding\n * by the local template `let` declarations.\n *\n * @usageNotes\n * ```\n * \n * ```\n *\n * Using the key `$implicit` in the context object will set its value as default.\n *\n * ### Example\n *\n * {@example common/ngTemplateOutlet/ts/module.ts region='NgTemplateOutlet'}\n *\n * @publicApi\n */\nclass NgTemplateOutlet {\n constructor(_viewContainerRef) {\n this._viewContainerRef = _viewContainerRef;\n this._viewRef = null;\n /**\n * A context object to attach to the {@link EmbeddedViewRef}. This should be an\n * object, the object's keys will be available for binding by the local template `let`\n * declarations.\n * Using the key `$implicit` in the context object will set its value as default.\n */\n this.ngTemplateOutletContext = null;\n /**\n * A string defining the template reference and optionally the context object for the template.\n */\n this.ngTemplateOutlet = null;\n }\n ngOnChanges(changes) {\n const recreateView = this._shouldRecreateView(changes);\n if (recreateView) {\n const viewContainerRef = this._viewContainerRef;\n if (this._viewRef) {\n viewContainerRef.remove(viewContainerRef.indexOf(this._viewRef));\n }\n this._viewRef = this.ngTemplateOutlet ?\n viewContainerRef.createEmbeddedView(this.ngTemplateOutlet, this.ngTemplateOutletContext) :\n null;\n }\n else if (this._viewRef && this.ngTemplateOutletContext) {\n this._updateExistingContext(this.ngTemplateOutletContext);\n }\n }\n /**\n * We need to re-create existing embedded view if:\n * - templateRef has changed\n * - context has changes\n *\n * We mark context object as changed when the corresponding object\n * shape changes (new properties are added or existing properties are removed).\n * In other words we consider context with the same properties as \"the same\" even\n * if object reference changes (see https://github.com/angular/angular/issues/13407).\n */\n _shouldRecreateView(changes) {\n const ctxChange = changes['ngTemplateOutletContext'];\n return !!changes['ngTemplateOutlet'] || (ctxChange && this._hasContextShapeChanged(ctxChange));\n }\n _hasContextShapeChanged(ctxChange) {\n const prevCtxKeys = Object.keys(ctxChange.previousValue || {});\n const currCtxKeys = Object.keys(ctxChange.currentValue || {});\n if (prevCtxKeys.length === currCtxKeys.length) {\n for (let propName of currCtxKeys) {\n if (prevCtxKeys.indexOf(propName) === -1) {\n return true;\n }\n }\n return false;\n }\n return true;\n }\n _updateExistingContext(ctx) {\n for (let propName of Object.keys(ctx)) {\n this._viewRef.context[propName] = this.ngTemplateOutletContext[propName];\n }\n }\n}\nNgTemplateOutlet.ɵfac = function NgTemplateOutlet_Factory(t) { return new (t || NgTemplateOutlet)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ViewContainerRef)); };\nNgTemplateOutlet.ɵdir = ɵngcc0.ɵɵdefineDirective({ type: NgTemplateOutlet, selectors: [[\"\", \"ngTemplateOutlet\", \"\"]], inputs: { ngTemplateOutletContext: \"ngTemplateOutletContext\", ngTemplateOutlet: \"ngTemplateOutlet\" }, features: [ɵngcc0.ɵɵNgOnChangesFeature] });\nNgTemplateOutlet.ctorParameters = () => [\n { type: ViewContainerRef }\n];\nNgTemplateOutlet.propDecorators = {\n ngTemplateOutletContext: [{ type: Input }],\n ngTemplateOutlet: [{ type: Input }]\n};\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(NgTemplateOutlet, [{\n type: Directive,\n args: [{ selector: '[ngTemplateOutlet]' }]\n }], function () { return [{ type: ɵngcc0.ViewContainerRef }]; }, { ngTemplateOutletContext: [{\n type: Input\n }], ngTemplateOutlet: [{\n type: Input\n }] }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A collection of Angular directives that are likely to be used in each and every Angular\n * application.\n */\nconst COMMON_DIRECTIVES = [\n NgClass,\n NgComponentOutlet,\n NgForOf,\n NgIf,\n NgTemplateOutlet,\n NgStyle,\n NgSwitch,\n NgSwitchCase,\n NgSwitchDefault,\n NgPlural,\n NgPluralCase,\n];\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction invalidPipeArgumentError(type, value) {\n return Error(`InvalidPipeArgument: '${value}' for pipe '${ɵstringify(type)}'`);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass ObservableStrategy {\n createSubscription(async, updateLatestValue) {\n return async.subscribe({\n next: updateLatestValue,\n error: (e) => {\n throw e;\n }\n });\n }\n dispose(subscription) {\n subscription.unsubscribe();\n }\n onDestroy(subscription) {\n subscription.unsubscribe();\n }\n}\nclass PromiseStrategy {\n createSubscription(async, updateLatestValue) {\n return async.then(updateLatestValue, e => {\n throw e;\n });\n }\n dispose(subscription) { }\n onDestroy(subscription) { }\n}\nconst _promiseStrategy = new PromiseStrategy();\nconst _observableStrategy = new ObservableStrategy();\n/**\n * @ngModule CommonModule\n * @description\n *\n * Unwraps a value from an asynchronous primitive.\n *\n * The `async` pipe subscribes to an `Observable` or `Promise` and returns the latest value it has\n * emitted. When a new value is emitted, the `async` pipe marks the component to be checked for\n * changes. When the component gets destroyed, the `async` pipe unsubscribes automatically to avoid\n * potential memory leaks.\n *\n * @usageNotes\n *\n * ### Examples\n *\n * This example binds a `Promise` to the view. Clicking the `Resolve` button resolves the\n * promise.\n *\n * {@example common/pipes/ts/async_pipe.ts region='AsyncPipePromise'}\n *\n * It's also possible to use `async` with Observables. The example below binds the `time` Observable\n * to the view. The Observable continuously updates the view with the current time.\n *\n * {@example common/pipes/ts/async_pipe.ts region='AsyncPipeObservable'}\n *\n * @publicApi\n */\nclass AsyncPipe {\n constructor(_ref) {\n this._ref = _ref;\n this._latestValue = null;\n this._subscription = null;\n this._obj = null;\n this._strategy = null;\n }\n ngOnDestroy() {\n if (this._subscription) {\n this._dispose();\n }\n }\n transform(obj) {\n if (!this._obj) {\n if (obj) {\n this._subscribe(obj);\n }\n return this._latestValue;\n }\n if (obj !== this._obj) {\n this._dispose();\n return this.transform(obj);\n }\n return this._latestValue;\n }\n _subscribe(obj) {\n this._obj = obj;\n this._strategy = this._selectStrategy(obj);\n this._subscription = this._strategy.createSubscription(obj, (value) => this._updateLatestValue(obj, value));\n }\n _selectStrategy(obj) {\n if (ɵisPromise(obj)) {\n return _promiseStrategy;\n }\n if (ɵisObservable(obj)) {\n return _observableStrategy;\n }\n throw invalidPipeArgumentError(AsyncPipe, obj);\n }\n _dispose() {\n this._strategy.dispose(this._subscription);\n this._latestValue = null;\n this._subscription = null;\n this._obj = null;\n }\n _updateLatestValue(async, value) {\n if (async === this._obj) {\n this._latestValue = value;\n this._ref.markForCheck();\n }\n }\n}\nAsyncPipe.ɵfac = function AsyncPipe_Factory(t) { return new (t || AsyncPipe)(ɵngcc0.ɵɵinjectPipeChangeDetectorRef()); };\nAsyncPipe.ɵpipe = ɵngcc0.ɵɵdefinePipe({ name: \"async\", type: AsyncPipe, pure: false });\nAsyncPipe.ctorParameters = () => [\n { type: ChangeDetectorRef }\n];\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(AsyncPipe, [{\n type: Pipe,\n args: [{ name: 'async', pure: false }]\n }], function () { return [{ type: ɵngcc0.ChangeDetectorRef }]; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Transforms text to all lower case.\n *\n * @see `UpperCasePipe`\n * @see `TitleCasePipe`\n * @usageNotes\n *\n * The following example defines a view that allows the user to enter\n * text, and then uses the pipe to convert the input text to all lower case.\n *\n * \n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass LowerCasePipe {\n /**\n * @param value The string to transform to lower case.\n */\n transform(value) {\n if (!value)\n return value;\n if (typeof value !== 'string') {\n throw invalidPipeArgumentError(LowerCasePipe, value);\n }\n return value.toLowerCase();\n }\n}\nLowerCasePipe.ɵfac = function LowerCasePipe_Factory(t) { return new (t || LowerCasePipe)(); };\nLowerCasePipe.ɵpipe = ɵngcc0.ɵɵdefinePipe({ name: \"lowercase\", type: LowerCasePipe, pure: true });\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(LowerCasePipe, [{\n type: Pipe,\n args: [{ name: 'lowercase' }]\n }], null, null); })();\n//\n// Regex below matches any Unicode word and compatible with ES5. In ES2018 the same result\n// can be achieved by using /\\p{L}\\S*/gu and also known as Unicode Property Escapes\n// (http://2ality.com/2017/07/regexp-unicode-property-escapes.html). Since there is no\n// transpilation of this functionality down to ES5 without external tool, the only solution is\n// to use already transpiled form. Example can be found here -\n// https://mothereff.in/regexpu#input=var+regex+%3D+/%5Cp%7BL%7D/u%3B&unicodePropertyEscape=1\n//\nconst unicodeWordMatch = /(?:[A-Za-z\\xAA\\xB5\\xBA\\xC0-\\xD6\\xD8-\\xF6\\xF8-\\u02C1\\u02C6-\\u02D1\\u02E0-\\u02E4\\u02EC\\u02EE\\u0370-\\u0374\\u0376\\u0377\\u037A-\\u037D\\u037F\\u0386\\u0388-\\u038A\\u038C\\u038E-\\u03A1\\u03A3-\\u03F5\\u03F7-\\u0481\\u048A-\\u052F\\u0531-\\u0556\\u0559\\u0561-\\u0587\\u05D0-\\u05EA\\u05F0-\\u05F2\\u0620-\\u064A\\u066E\\u066F\\u0671-\\u06D3\\u06D5\\u06E5\\u06E6\\u06EE\\u06EF\\u06FA-\\u06FC\\u06FF\\u0710\\u0712-\\u072F\\u074D-\\u07A5\\u07B1\\u07CA-\\u07EA\\u07F4\\u07F5\\u07FA\\u0800-\\u0815\\u081A\\u0824\\u0828\\u0840-\\u0858\\u0860-\\u086A\\u08A0-\\u08B4\\u08B6-\\u08BD\\u0904-\\u0939\\u093D\\u0950\\u0958-\\u0961\\u0971-\\u0980\\u0985-\\u098C\\u098F\\u0990\\u0993-\\u09A8\\u09AA-\\u09B0\\u09B2\\u09B6-\\u09B9\\u09BD\\u09CE\\u09DC\\u09DD\\u09DF-\\u09E1\\u09F0\\u09F1\\u09FC\\u0A05-\\u0A0A\\u0A0F\\u0A10\\u0A13-\\u0A28\\u0A2A-\\u0A30\\u0A32\\u0A33\\u0A35\\u0A36\\u0A38\\u0A39\\u0A59-\\u0A5C\\u0A5E\\u0A72-\\u0A74\\u0A85-\\u0A8D\\u0A8F-\\u0A91\\u0A93-\\u0AA8\\u0AAA-\\u0AB0\\u0AB2\\u0AB3\\u0AB5-\\u0AB9\\u0ABD\\u0AD0\\u0AE0\\u0AE1\\u0AF9\\u0B05-\\u0B0C\\u0B0F\\u0B10\\u0B13-\\u0B28\\u0B2A-\\u0B30\\u0B32\\u0B33\\u0B35-\\u0B39\\u0B3D\\u0B5C\\u0B5D\\u0B5F-\\u0B61\\u0B71\\u0B83\\u0B85-\\u0B8A\\u0B8E-\\u0B90\\u0B92-\\u0B95\\u0B99\\u0B9A\\u0B9C\\u0B9E\\u0B9F\\u0BA3\\u0BA4\\u0BA8-\\u0BAA\\u0BAE-\\u0BB9\\u0BD0\\u0C05-\\u0C0C\\u0C0E-\\u0C10\\u0C12-\\u0C28\\u0C2A-\\u0C39\\u0C3D\\u0C58-\\u0C5A\\u0C60\\u0C61\\u0C80\\u0C85-\\u0C8C\\u0C8E-\\u0C90\\u0C92-\\u0CA8\\u0CAA-\\u0CB3\\u0CB5-\\u0CB9\\u0CBD\\u0CDE\\u0CE0\\u0CE1\\u0CF1\\u0CF2\\u0D05-\\u0D0C\\u0D0E-\\u0D10\\u0D12-\\u0D3A\\u0D3D\\u0D4E\\u0D54-\\u0D56\\u0D5F-\\u0D61\\u0D7A-\\u0D7F\\u0D85-\\u0D96\\u0D9A-\\u0DB1\\u0DB3-\\u0DBB\\u0DBD\\u0DC0-\\u0DC6\\u0E01-\\u0E30\\u0E32\\u0E33\\u0E40-\\u0E46\\u0E81\\u0E82\\u0E84\\u0E87\\u0E88\\u0E8A\\u0E8D\\u0E94-\\u0E97\\u0E99-\\u0E9F\\u0EA1-\\u0EA3\\u0EA5\\u0EA7\\u0EAA\\u0EAB\\u0EAD-\\u0EB0\\u0EB2\\u0EB3\\u0EBD\\u0EC0-\\u0EC4\\u0EC6\\u0EDC-\\u0EDF\\u0F00\\u0F40-\\u0F47\\u0F49-\\u0F6C\\u0F88-\\u0F8C\\u1000-\\u102A\\u103F\\u1050-\\u1055\\u105A-\\u105D\\u1061\\u1065\\u1066\\u106E-\\u1070\\u1075-\\u1081\\u108E\\u10A0-\\u10C5\\u10C7\\u10CD\\u10D0-\\u10FA\\u10FC-\\u1248\\u124A-\\u124D\\u1250-\\u1256\\u1258\\u125A-\\u125D\\u1260-\\u1288\\u128A-\\u128D\\u1290-\\u12B0\\u12B2-\\u12B5\\u12B8-\\u12BE\\u12C0\\u12C2-\\u12C5\\u12C8-\\u12D6\\u12D8-\\u1310\\u1312-\\u1315\\u1318-\\u135A\\u1380-\\u138F\\u13A0-\\u13F5\\u13F8-\\u13FD\\u1401-\\u166C\\u166F-\\u167F\\u1681-\\u169A\\u16A0-\\u16EA\\u16F1-\\u16F8\\u1700-\\u170C\\u170E-\\u1711\\u1720-\\u1731\\u1740-\\u1751\\u1760-\\u176C\\u176E-\\u1770\\u1780-\\u17B3\\u17D7\\u17DC\\u1820-\\u1877\\u1880-\\u1884\\u1887-\\u18A8\\u18AA\\u18B0-\\u18F5\\u1900-\\u191E\\u1950-\\u196D\\u1970-\\u1974\\u1980-\\u19AB\\u19B0-\\u19C9\\u1A00-\\u1A16\\u1A20-\\u1A54\\u1AA7\\u1B05-\\u1B33\\u1B45-\\u1B4B\\u1B83-\\u1BA0\\u1BAE\\u1BAF\\u1BBA-\\u1BE5\\u1C00-\\u1C23\\u1C4D-\\u1C4F\\u1C5A-\\u1C7D\\u1C80-\\u1C88\\u1CE9-\\u1CEC\\u1CEE-\\u1CF1\\u1CF5\\u1CF6\\u1D00-\\u1DBF\\u1E00-\\u1F15\\u1F18-\\u1F1D\\u1F20-\\u1F45\\u1F48-\\u1F4D\\u1F50-\\u1F57\\u1F59\\u1F5B\\u1F5D\\u1F5F-\\u1F7D\\u1F80-\\u1FB4\\u1FB6-\\u1FBC\\u1FBE\\u1FC2-\\u1FC4\\u1FC6-\\u1FCC\\u1FD0-\\u1FD3\\u1FD6-\\u1FDB\\u1FE0-\\u1FEC\\u1FF2-\\u1FF4\\u1FF6-\\u1FFC\\u2071\\u207F\\u2090-\\u209C\\u2102\\u2107\\u210A-\\u2113\\u2115\\u2119-\\u211D\\u2124\\u2126\\u2128\\u212A-\\u212D\\u212F-\\u2139\\u213C-\\u213F\\u2145-\\u2149\\u214E\\u2183\\u2184\\u2C00-\\u2C2E\\u2C30-\\u2C5E\\u2C60-\\u2CE4\\u2CEB-\\u2CEE\\u2CF2\\u2CF3\\u2D00-\\u2D25\\u2D27\\u2D2D\\u2D30-\\u2D67\\u2D6F\\u2D80-\\u2D96\\u2DA0-\\u2DA6\\u2DA8-\\u2DAE\\u2DB0-\\u2DB6\\u2DB8-\\u2DBE\\u2DC0-\\u2DC6\\u2DC8-\\u2DCE\\u2DD0-\\u2DD6\\u2DD8-\\u2DDE\\u2E2F\\u3005\\u3006\\u3031-\\u3035\\u303B\\u303C\\u3041-\\u3096\\u309D-\\u309F\\u30A1-\\u30FA\\u30FC-\\u30FF\\u3105-\\u312E\\u3131-\\u318E\\u31A0-\\u31BA\\u31F0-\\u31FF\\u3400-\\u4DB5\\u4E00-\\u9FEA\\uA000-\\uA48C\\uA4D0-\\uA4FD\\uA500-\\uA60C\\uA610-\\uA61F\\uA62A\\uA62B\\uA640-\\uA66E\\uA67F-\\uA69D\\uA6A0-\\uA6E5\\uA717-\\uA71F\\uA722-\\uA788\\uA78B-\\uA7AE\\uA7B0-\\uA7B7\\uA7F7-\\uA801\\uA803-\\uA805\\uA807-\\uA80A\\uA80C-\\uA822\\uA840-\\uA873\\uA882-\\uA8B3\\uA8F2-\\uA8F7\\uA8FB\\uA8FD\\uA90A-\\uA925\\uA930-\\uA946\\uA960-\\uA97C\\uA984-\\uA9B2\\uA9CF\\uA9E0-\\uA9E4\\uA9E6-\\uA9EF\\uA9FA-\\uA9FE\\uAA00-\\uAA28\\uAA40-\\uAA42\\uAA44-\\uAA4B\\uAA60-\\uAA76\\uAA7A\\uAA7E-\\uAAAF\\uAAB1\\uAAB5\\uAAB6\\uAAB9-\\uAABD\\uAAC0\\uAAC2\\uAADB-\\uAADD\\uAAE0-\\uAAEA\\uAAF2-\\uAAF4\\uAB01-\\uAB06\\uAB09-\\uAB0E\\uAB11-\\uAB16\\uAB20-\\uAB26\\uAB28-\\uAB2E\\uAB30-\\uAB5A\\uAB5C-\\uAB65\\uAB70-\\uABE2\\uAC00-\\uD7A3\\uD7B0-\\uD7C6\\uD7CB-\\uD7FB\\uF900-\\uFA6D\\uFA70-\\uFAD9\\uFB00-\\uFB06\\uFB13-\\uFB17\\uFB1D\\uFB1F-\\uFB28\\uFB2A-\\uFB36\\uFB38-\\uFB3C\\uFB3E\\uFB40\\uFB41\\uFB43\\uFB44\\uFB46-\\uFBB1\\uFBD3-\\uFD3D\\uFD50-\\uFD8F\\uFD92-\\uFDC7\\uFDF0-\\uFDFB\\uFE70-\\uFE74\\uFE76-\\uFEFC\\uFF21-\\uFF3A\\uFF41-\\uFF5A\\uFF66-\\uFFBE\\uFFC2-\\uFFC7\\uFFCA-\\uFFCF\\uFFD2-\\uFFD7\\uFFDA-\\uFFDC]|\\uD800[\\uDC00-\\uDC0B\\uDC0D-\\uDC26\\uDC28-\\uDC3A\\uDC3C\\uDC3D\\uDC3F-\\uDC4D\\uDC50-\\uDC5D\\uDC80-\\uDCFA\\uDE80-\\uDE9C\\uDEA0-\\uDED0\\uDF00-\\uDF1F\\uDF2D-\\uDF40\\uDF42-\\uDF49\\uDF50-\\uDF75\\uDF80-\\uDF9D\\uDFA0-\\uDFC3\\uDFC8-\\uDFCF]|\\uD801[\\uDC00-\\uDC9D\\uDCB0-\\uDCD3\\uDCD8-\\uDCFB\\uDD00-\\uDD27\\uDD30-\\uDD63\\uDE00-\\uDF36\\uDF40-\\uDF55\\uDF60-\\uDF67]|\\uD802[\\uDC00-\\uDC05\\uDC08\\uDC0A-\\uDC35\\uDC37\\uDC38\\uDC3C\\uDC3F-\\uDC55\\uDC60-\\uDC76\\uDC80-\\uDC9E\\uDCE0-\\uDCF2\\uDCF4\\uDCF5\\uDD00-\\uDD15\\uDD20-\\uDD39\\uDD80-\\uDDB7\\uDDBE\\uDDBF\\uDE00\\uDE10-\\uDE13\\uDE15-\\uDE17\\uDE19-\\uDE33\\uDE60-\\uDE7C\\uDE80-\\uDE9C\\uDEC0-\\uDEC7\\uDEC9-\\uDEE4\\uDF00-\\uDF35\\uDF40-\\uDF55\\uDF60-\\uDF72\\uDF80-\\uDF91]|\\uD803[\\uDC00-\\uDC48\\uDC80-\\uDCB2\\uDCC0-\\uDCF2]|\\uD804[\\uDC03-\\uDC37\\uDC83-\\uDCAF\\uDCD0-\\uDCE8\\uDD03-\\uDD26\\uDD50-\\uDD72\\uDD76\\uDD83-\\uDDB2\\uDDC1-\\uDDC4\\uDDDA\\uDDDC\\uDE00-\\uDE11\\uDE13-\\uDE2B\\uDE80-\\uDE86\\uDE88\\uDE8A-\\uDE8D\\uDE8F-\\uDE9D\\uDE9F-\\uDEA8\\uDEB0-\\uDEDE\\uDF05-\\uDF0C\\uDF0F\\uDF10\\uDF13-\\uDF28\\uDF2A-\\uDF30\\uDF32\\uDF33\\uDF35-\\uDF39\\uDF3D\\uDF50\\uDF5D-\\uDF61]|\\uD805[\\uDC00-\\uDC34\\uDC47-\\uDC4A\\uDC80-\\uDCAF\\uDCC4\\uDCC5\\uDCC7\\uDD80-\\uDDAE\\uDDD8-\\uDDDB\\uDE00-\\uDE2F\\uDE44\\uDE80-\\uDEAA\\uDF00-\\uDF19]|\\uD806[\\uDCA0-\\uDCDF\\uDCFF\\uDE00\\uDE0B-\\uDE32\\uDE3A\\uDE50\\uDE5C-\\uDE83\\uDE86-\\uDE89\\uDEC0-\\uDEF8]|\\uD807[\\uDC00-\\uDC08\\uDC0A-\\uDC2E\\uDC40\\uDC72-\\uDC8F\\uDD00-\\uDD06\\uDD08\\uDD09\\uDD0B-\\uDD30\\uDD46]|\\uD808[\\uDC00-\\uDF99]|\\uD809[\\uDC80-\\uDD43]|[\\uD80C\\uD81C-\\uD820\\uD840-\\uD868\\uD86A-\\uD86C\\uD86F-\\uD872\\uD874-\\uD879][\\uDC00-\\uDFFF]|\\uD80D[\\uDC00-\\uDC2E]|\\uD811[\\uDC00-\\uDE46]|\\uD81A[\\uDC00-\\uDE38\\uDE40-\\uDE5E\\uDED0-\\uDEED\\uDF00-\\uDF2F\\uDF40-\\uDF43\\uDF63-\\uDF77\\uDF7D-\\uDF8F]|\\uD81B[\\uDF00-\\uDF44\\uDF50\\uDF93-\\uDF9F\\uDFE0\\uDFE1]|\\uD821[\\uDC00-\\uDFEC]|\\uD822[\\uDC00-\\uDEF2]|\\uD82C[\\uDC00-\\uDD1E\\uDD70-\\uDEFB]|\\uD82F[\\uDC00-\\uDC6A\\uDC70-\\uDC7C\\uDC80-\\uDC88\\uDC90-\\uDC99]|\\uD835[\\uDC00-\\uDC54\\uDC56-\\uDC9C\\uDC9E\\uDC9F\\uDCA2\\uDCA5\\uDCA6\\uDCA9-\\uDCAC\\uDCAE-\\uDCB9\\uDCBB\\uDCBD-\\uDCC3\\uDCC5-\\uDD05\\uDD07-\\uDD0A\\uDD0D-\\uDD14\\uDD16-\\uDD1C\\uDD1E-\\uDD39\\uDD3B-\\uDD3E\\uDD40-\\uDD44\\uDD46\\uDD4A-\\uDD50\\uDD52-\\uDEA5\\uDEA8-\\uDEC0\\uDEC2-\\uDEDA\\uDEDC-\\uDEFA\\uDEFC-\\uDF14\\uDF16-\\uDF34\\uDF36-\\uDF4E\\uDF50-\\uDF6E\\uDF70-\\uDF88\\uDF8A-\\uDFA8\\uDFAA-\\uDFC2\\uDFC4-\\uDFCB]|\\uD83A[\\uDC00-\\uDCC4\\uDD00-\\uDD43]|\\uD83B[\\uDE00-\\uDE03\\uDE05-\\uDE1F\\uDE21\\uDE22\\uDE24\\uDE27\\uDE29-\\uDE32\\uDE34-\\uDE37\\uDE39\\uDE3B\\uDE42\\uDE47\\uDE49\\uDE4B\\uDE4D-\\uDE4F\\uDE51\\uDE52\\uDE54\\uDE57\\uDE59\\uDE5B\\uDE5D\\uDE5F\\uDE61\\uDE62\\uDE64\\uDE67-\\uDE6A\\uDE6C-\\uDE72\\uDE74-\\uDE77\\uDE79-\\uDE7C\\uDE7E\\uDE80-\\uDE89\\uDE8B-\\uDE9B\\uDEA1-\\uDEA3\\uDEA5-\\uDEA9\\uDEAB-\\uDEBB]|\\uD869[\\uDC00-\\uDED6\\uDF00-\\uDFFF]|\\uD86D[\\uDC00-\\uDF34\\uDF40-\\uDFFF]|\\uD86E[\\uDC00-\\uDC1D\\uDC20-\\uDFFF]|\\uD873[\\uDC00-\\uDEA1\\uDEB0-\\uDFFF]|\\uD87A[\\uDC00-\\uDFE0]|\\uD87E[\\uDC00-\\uDE1D])\\S*/g;\n/**\n * Transforms text to title case.\n * Capitalizes the first letter of each word and transforms the\n * rest of the word to lower case.\n * Words are delimited by any whitespace character, such as a space, tab, or line-feed character.\n *\n * @see `LowerCasePipe`\n * @see `UpperCasePipe`\n *\n * @usageNotes\n * The following example shows the result of transforming various strings into title case.\n *\n * \n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass TitleCasePipe {\n /**\n * @param value The string to transform to title case.\n */\n transform(value) {\n if (!value)\n return value;\n if (typeof value !== 'string') {\n throw invalidPipeArgumentError(TitleCasePipe, value);\n }\n return value.replace(unicodeWordMatch, (txt => txt[0].toUpperCase() + txt.substr(1).toLowerCase()));\n }\n}\nTitleCasePipe.ɵfac = function TitleCasePipe_Factory(t) { return new (t || TitleCasePipe)(); };\nTitleCasePipe.ɵpipe = ɵngcc0.ɵɵdefinePipe({ name: \"titlecase\", type: TitleCasePipe, pure: true });\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(TitleCasePipe, [{\n type: Pipe,\n args: [{ name: 'titlecase' }]\n }], null, null); })();\n/**\n * Transforms text to all upper case.\n * @see `LowerCasePipe`\n * @see `TitleCasePipe`\n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass UpperCasePipe {\n /**\n * @param value The string to transform to upper case.\n */\n transform(value) {\n if (!value)\n return value;\n if (typeof value !== 'string') {\n throw invalidPipeArgumentError(UpperCasePipe, value);\n }\n return value.toUpperCase();\n }\n}\nUpperCasePipe.ɵfac = function UpperCasePipe_Factory(t) { return new (t || UpperCasePipe)(); };\nUpperCasePipe.ɵpipe = ɵngcc0.ɵɵdefinePipe({ name: \"uppercase\", type: UpperCasePipe, pure: true });\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(UpperCasePipe, [{\n type: Pipe,\n args: [{ name: 'uppercase' }]\n }], null, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// clang-format off\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a date value according to locale rules.\n *\n * Only the `en-US` locale data comes with Angular. To localize dates\n * in another language, you must import the corresponding locale data.\n * See the [I18n guide](guide/i18n#i18n-pipes) for more information.\n *\n * @see `formatDate()`\n *\n *\n * @usageNotes\n *\n * The result of this pipe is not reevaluated when the input is mutated. To avoid the need to\n * reformat the date on every change-detection cycle, treat the date as an immutable object\n * and change the reference when the pipe needs to run again.\n *\n * ### Pre-defined format options\n *\n * Examples are given in `en-US` locale.\n *\n * - `'short'`: equivalent to `'M/d/yy, h:mm a'` (`6/15/15, 9:03 AM`).\n * - `'medium'`: equivalent to `'MMM d, y, h:mm:ss a'` (`Jun 15, 2015, 9:03:01 AM`).\n * - `'long'`: equivalent to `'MMMM d, y, h:mm:ss a z'` (`June 15, 2015 at 9:03:01 AM\n * GMT+1`).\n * - `'full'`: equivalent to `'EEEE, MMMM d, y, h:mm:ss a zzzz'` (`Monday, June 15, 2015 at\n * 9:03:01 AM GMT+01:00`).\n * - `'shortDate'`: equivalent to `'M/d/yy'` (`6/15/15`).\n * - `'mediumDate'`: equivalent to `'MMM d, y'` (`Jun 15, 2015`).\n * - `'longDate'`: equivalent to `'MMMM d, y'` (`June 15, 2015`).\n * - `'fullDate'`: equivalent to `'EEEE, MMMM d, y'` (`Monday, June 15, 2015`).\n * - `'shortTime'`: equivalent to `'h:mm a'` (`9:03 AM`).\n * - `'mediumTime'`: equivalent to `'h:mm:ss a'` (`9:03:01 AM`).\n * - `'longTime'`: equivalent to `'h:mm:ss a z'` (`9:03:01 AM GMT+1`).\n * - `'fullTime'`: equivalent to `'h:mm:ss a zzzz'` (`9:03:01 AM GMT+01:00`).\n *\n * ### Custom format options\n *\n * You can construct a format string using symbols to specify the components\n * of a date-time value, as described in the following table.\n * Format details depend on the locale.\n * Fields marked with (*) are only available in the extra data set for the given locale.\n *\n * | Field type | Format | Description | Example Value |\n * |--------------------|-------------|---------------------------------------------------------------|------------------------------------------------------------|\n * | Era | G, GG & GGG | Abbreviated | AD |\n * | | GGGG | Wide | Anno Domini |\n * | | GGGGG | Narrow | A |\n * | Year | y | Numeric: minimum digits | 2, 20, 201, 2017, 20173 |\n * | | yy | Numeric: 2 digits + zero padded | 02, 20, 01, 17, 73 |\n * | | yyy | Numeric: 3 digits + zero padded | 002, 020, 201, 2017, 20173 |\n * | | yyyy | Numeric: 4 digits or more + zero padded | 0002, 0020, 0201, 2017, 20173 |\n * | Month | M | Numeric: 1 digit | 9, 12 |\n * | | MM | Numeric: 2 digits + zero padded | 09, 12 |\n * | | MMM | Abbreviated | Sep |\n * | | MMMM | Wide | September |\n * | | MMMMM | Narrow | S |\n * | Month standalone | L | Numeric: 1 digit | 9, 12 |\n * | | LL | Numeric: 2 digits + zero padded | 09, 12 |\n * | | LLL | Abbreviated | Sep |\n * | | LLLL | Wide | September |\n * | | LLLLL | Narrow | S |\n * | Week of year | w | Numeric: minimum digits | 1... 53 |\n * | | ww | Numeric: 2 digits + zero padded | 01... 53 |\n * | Week of month | W | Numeric: 1 digit | 1... 5 |\n * | Day of month | d | Numeric: minimum digits | 1 |\n * | | dd | Numeric: 2 digits + zero padded | 01 |\n * | Week day | E, EE & EEE | Abbreviated | Tue |\n * | | EEEE | Wide | Tuesday |\n * | | EEEEE | Narrow | T |\n * | | EEEEEE | Short | Tu |\n * | Period | a, aa & aaa | Abbreviated | am/pm or AM/PM |\n * | | aaaa | Wide (fallback to `a` when missing) | ante meridiem/post meridiem |\n * | | aaaaa | Narrow | a/p |\n * | Period* | B, BB & BBB | Abbreviated | mid. |\n * | | BBBB | Wide | am, pm, midnight, noon, morning, afternoon, evening, night |\n * | | BBBBB | Narrow | md |\n * | Period standalone* | b, bb & bbb | Abbreviated | mid. |\n * | | bbbb | Wide | am, pm, midnight, noon, morning, afternoon, evening, night |\n * | | bbbbb | Narrow | md |\n * | Hour 1-12 | h | Numeric: minimum digits | 1, 12 |\n * | | hh | Numeric: 2 digits + zero padded | 01, 12 |\n * | Hour 0-23 | H | Numeric: minimum digits | 0, 23 |\n * | | HH | Numeric: 2 digits + zero padded | 00, 23 |\n * | Minute | m | Numeric: minimum digits | 8, 59 |\n * | | mm | Numeric: 2 digits + zero padded | 08, 59 |\n * | Second | s | Numeric: minimum digits | 0... 59 |\n * | | ss | Numeric: 2 digits + zero padded | 00... 59 |\n * | Fractional seconds | S | Numeric: 1 digit | 0... 9 |\n * | | SS | Numeric: 2 digits + zero padded | 00... 99 |\n * | | SSS | Numeric: 3 digits + zero padded (= milliseconds) | 000... 999 |\n * | Zone | z, zz & zzz | Short specific non location format (fallback to O) | GMT-8 |\n * | | zzzz | Long specific non location format (fallback to OOOO) | GMT-08:00 |\n * | | Z, ZZ & ZZZ | ISO8601 basic format | -0800 |\n * | | ZZZZ | Long localized GMT format | GMT-8:00 |\n * | | ZZZZZ | ISO8601 extended format + Z indicator for offset 0 (= XXXXX) | -08:00 |\n * | | O, OO & OOO | Short localized GMT format | GMT-8 |\n * | | OOOO | Long localized GMT format | GMT-08:00 |\n *\n * Note that timezone correction is not applied to an ISO string that has no time component, such as \"2016-09-19\"\n *\n * ### Format examples\n *\n * These examples transform a date into various formats,\n * assuming that `dateObj` is a JavaScript `Date` object for\n * year: 2015, month: 6, day: 15, hour: 21, minute: 43, second: 11,\n * given in the local time for the `en-US` locale.\n *\n * ```\n * {{ dateObj | date }} // output is 'Jun 15, 2015'\n * {{ dateObj | date:'medium' }} // output is 'Jun 15, 2015, 9:43:11 PM'\n * {{ dateObj | date:'shortTime' }} // output is '9:43 PM'\n * {{ dateObj | date:'mm:ss' }} // output is '43:11'\n * ```\n *\n * ### Usage example\n *\n * The following component uses a date pipe to display the current date in different formats.\n *\n * ```\n * @Component({\n * selector: 'date-pipe',\n * template: `
    \n *

    Today is {{today | date}}

    \n *

    Or if you prefer, {{today | date:'fullDate'}}

    \n *

    The time is {{today | date:'h:mm a z'}}

    \n *
    `\n * })\n * // Get the current date and time as a date-time value.\n * export class DatePipeComponent {\n * today: number = Date.now();\n * }\n * ```\n *\n * @publicApi\n */\n// clang-format on\nclass DatePipe {\n constructor(locale) {\n this.locale = locale;\n }\n /**\n * @param value The date expression: a `Date` object, a number\n * (milliseconds since UTC epoch), or an ISO string (https://www.w3.org/TR/NOTE-datetime).\n * @param format The date/time components to include, using predefined options or a\n * custom format string.\n * @param timezone A timezone offset (such as `'+0430'`), or a standard\n * UTC/GMT or continental US timezone abbreviation.\n * When not supplied, uses the end-user's local system timezone.\n * @param locale A locale code for the locale format rules to use.\n * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.\n * See [Setting your app locale](guide/i18n#setting-up-the-locale-of-your-app).\n * @returns A date string in the desired format.\n */\n transform(value, format = 'mediumDate', timezone, locale) {\n if (value == null || value === '' || value !== value)\n return null;\n try {\n return formatDate(value, format, locale || this.locale, timezone);\n }\n catch (error) {\n throw invalidPipeArgumentError(DatePipe, error.message);\n }\n }\n}\nDatePipe.ɵfac = function DatePipe_Factory(t) { return new (t || DatePipe)(ɵngcc0.ɵɵdirectiveInject(LOCALE_ID)); };\nDatePipe.ɵpipe = ɵngcc0.ɵɵdefinePipe({ name: \"date\", type: DatePipe, pure: true });\nDatePipe.ctorParameters = () => [\n { type: String, decorators: [{ type: Inject, args: [LOCALE_ID,] }] }\n];\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(DatePipe, [{\n type: Pipe,\n args: [{ name: 'date', pure: true }]\n }], function () { return [{ type: String, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }]; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst _INTERPOLATION_REGEXP = /#/g;\n/**\n * @ngModule CommonModule\n * @description\n *\n * Maps a value to a string that pluralizes the value according to locale rules.\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example common/pipes/ts/i18n_pipe.ts region='I18nPluralPipeComponent'}\n *\n * @publicApi\n */\nclass I18nPluralPipe {\n constructor(_localization) {\n this._localization = _localization;\n }\n /**\n * @param value the number to be formatted\n * @param pluralMap an object that mimics the ICU format, see\n * http://userguide.icu-project.org/formatparse/messages.\n * @param locale a `string` defining the locale to use (uses the current {@link LOCALE_ID} by\n * default).\n */\n transform(value, pluralMap, locale) {\n if (value == null)\n return '';\n if (typeof pluralMap !== 'object' || pluralMap === null) {\n throw invalidPipeArgumentError(I18nPluralPipe, pluralMap);\n }\n const key = getPluralCategory(value, Object.keys(pluralMap), this._localization, locale);\n return pluralMap[key].replace(_INTERPOLATION_REGEXP, value.toString());\n }\n}\nI18nPluralPipe.ɵfac = function I18nPluralPipe_Factory(t) { return new (t || I18nPluralPipe)(ɵngcc0.ɵɵdirectiveInject(NgLocalization)); };\nI18nPluralPipe.ɵpipe = ɵngcc0.ɵɵdefinePipe({ name: \"i18nPlural\", type: I18nPluralPipe, pure: true });\nI18nPluralPipe.ctorParameters = () => [\n { type: NgLocalization }\n];\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(I18nPluralPipe, [{\n type: Pipe,\n args: [{ name: 'i18nPlural', pure: true }]\n }], function () { return [{ type: NgLocalization }]; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n * @description\n *\n * Generic selector that displays the string that matches the current value.\n *\n * If none of the keys of the `mapping` match the `value`, then the content\n * of the `other` key is returned when present, otherwise an empty string is returned.\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example common/pipes/ts/i18n_pipe.ts region='I18nSelectPipeComponent'}\n *\n * @publicApi\n */\nclass I18nSelectPipe {\n /**\n * @param value a string to be internationalized.\n * @param mapping an object that indicates the text that should be displayed\n * for different values of the provided `value`.\n */\n transform(value, mapping) {\n if (value == null)\n return '';\n if (typeof mapping !== 'object' || typeof value !== 'string') {\n throw invalidPipeArgumentError(I18nSelectPipe, mapping);\n }\n if (mapping.hasOwnProperty(value)) {\n return mapping[value];\n }\n if (mapping.hasOwnProperty('other')) {\n return mapping['other'];\n }\n return '';\n }\n}\nI18nSelectPipe.ɵfac = function I18nSelectPipe_Factory(t) { return new (t || I18nSelectPipe)(); };\nI18nSelectPipe.ɵpipe = ɵngcc0.ɵɵdefinePipe({ name: \"i18nSelect\", type: I18nSelectPipe, pure: true });\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(I18nSelectPipe, [{\n type: Pipe,\n args: [{ name: 'i18nSelect', pure: true }]\n }], null, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n * @description\n *\n * Converts a value into its JSON-format representation. Useful for debugging.\n *\n * @usageNotes\n *\n * The following component uses a JSON pipe to convert an object\n * to JSON format, and displays the string in both formats for comparison.\n *\n * {@example common/pipes/ts/json_pipe.ts region='JsonPipe'}\n *\n * @publicApi\n */\nclass JsonPipe {\n /**\n * @param value A value of any type to convert into a JSON-format string.\n */\n transform(value) {\n return JSON.stringify(value, null, 2);\n }\n}\nJsonPipe.ɵfac = function JsonPipe_Factory(t) { return new (t || JsonPipe)(); };\nJsonPipe.ɵpipe = ɵngcc0.ɵɵdefinePipe({ name: \"json\", type: JsonPipe, pure: false });\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(JsonPipe, [{\n type: Pipe,\n args: [{ name: 'json', pure: false }]\n }], null, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction makeKeyValuePair(key, value) {\n return { key: key, value: value };\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Transforms Object or Map into an array of key value pairs.\n *\n * The output array will be ordered by keys.\n * By default the comparator will be by Unicode point value.\n * You can optionally pass a compareFn if your keys are complex types.\n *\n * @usageNotes\n * ### Examples\n *\n * This examples show how an Object or a Map can be iterated by ngFor with the use of this keyvalue\n * pipe.\n *\n * {@example common/pipes/ts/keyvalue_pipe.ts region='KeyValuePipe'}\n *\n * @publicApi\n */\nclass KeyValuePipe {\n constructor(differs) {\n this.differs = differs;\n this.keyValues = [];\n }\n transform(input, compareFn = defaultComparator) {\n if (!input || (!(input instanceof Map) && typeof input !== 'object')) {\n return null;\n }\n if (!this.differ) {\n // make a differ for whatever type we've been passed in\n this.differ = this.differs.find(input).create();\n }\n const differChanges = this.differ.diff(input);\n if (differChanges) {\n this.keyValues = [];\n differChanges.forEachItem((r) => {\n this.keyValues.push(makeKeyValuePair(r.key, r.currentValue));\n });\n this.keyValues.sort(compareFn);\n }\n return this.keyValues;\n }\n}\nKeyValuePipe.ɵfac = function KeyValuePipe_Factory(t) { return new (t || KeyValuePipe)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.KeyValueDiffers)); };\nKeyValuePipe.ɵpipe = ɵngcc0.ɵɵdefinePipe({ name: \"keyvalue\", type: KeyValuePipe, pure: false });\nKeyValuePipe.ctorParameters = () => [\n { type: KeyValueDiffers }\n];\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(KeyValuePipe, [{\n type: Pipe,\n args: [{ name: 'keyvalue', pure: false }]\n }], function () { return [{ type: ɵngcc0.KeyValueDiffers }]; }, null); })();\nfunction defaultComparator(keyValueA, keyValueB) {\n const a = keyValueA.key;\n const b = keyValueB.key;\n // if same exit with 0;\n if (a === b)\n return 0;\n // make sure that undefined are at the end of the sort.\n if (a === undefined)\n return 1;\n if (b === undefined)\n return -1;\n // make sure that nulls are at the end of the sort.\n if (a === null)\n return 1;\n if (b === null)\n return -1;\n if (typeof a == 'string' && typeof b == 'string') {\n return a < b ? -1 : 1;\n }\n if (typeof a == 'number' && typeof b == 'number') {\n return a - b;\n }\n if (typeof a == 'boolean' && typeof b == 'boolean') {\n return a < b ? -1 : 1;\n }\n // `a` and `b` are of different types. Compare their string values.\n const aString = String(a);\n const bString = String(b);\n return aString == bString ? 0 : aString < bString ? -1 : 1;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n * @description\n *\n * Transforms a number into a string,\n * formatted according to locale rules that determine group sizing and\n * separator, decimal-point character, and other locale-specific\n * configurations.\n *\n * If no parameters are specified, the function rounds off to the nearest value using this\n * [rounding method](https://en.wikibooks.org/wiki/Arithmetic/Rounding).\n * The behavior differs from that of the JavaScript ```Math.round()``` function.\n * In the following case for example, the pipe rounds down where\n * ```Math.round()``` rounds up:\n *\n * ```html\n * -2.5 | number:'1.0-0'\n * > -3\n * Math.round(-2.5)\n * > -2\n * ```\n *\n * @see `formatNumber()`\n *\n * @usageNotes\n * The following code shows how the pipe transforms numbers\n * into text strings, according to various format specifications,\n * where the caller's default locale is `en-US`.\n *\n * ### Example\n *\n * \n *\n * @publicApi\n */\nclass DecimalPipe {\n constructor(_locale) {\n this._locale = _locale;\n }\n /**\n * @param value The number to be formatted.\n * @param digitsInfo Decimal representation options, specified by a string\n * in the following format:
    \n * {minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}.\n * - `minIntegerDigits`: The minimum number of integer digits before the decimal point.\n * Default is `1`.\n * - `minFractionDigits`: The minimum number of digits after the decimal point.\n * Default is `0`.\n * - `maxFractionDigits`: The maximum number of digits after the decimal point.\n * Default is `3`.\n * @param locale A locale code for the locale format rules to use.\n * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.\n * See [Setting your app locale](guide/i18n#setting-up-the-locale-of-your-app).\n */\n transform(value, digitsInfo, locale) {\n if (isEmpty(value))\n return null;\n locale = locale || this._locale;\n try {\n const num = strToNumber(value);\n return formatNumber(num, locale, digitsInfo);\n }\n catch (error) {\n throw invalidPipeArgumentError(DecimalPipe, error.message);\n }\n }\n}\nDecimalPipe.ɵfac = function DecimalPipe_Factory(t) { return new (t || DecimalPipe)(ɵngcc0.ɵɵdirectiveInject(LOCALE_ID)); };\nDecimalPipe.ɵpipe = ɵngcc0.ɵɵdefinePipe({ name: \"number\", type: DecimalPipe, pure: true });\nDecimalPipe.ctorParameters = () => [\n { type: String, decorators: [{ type: Inject, args: [LOCALE_ID,] }] }\n];\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(DecimalPipe, [{\n type: Pipe,\n args: [{ name: 'number' }]\n }], function () { return [{ type: String, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }]; }, null); })();\n/**\n * @ngModule CommonModule\n * @description\n *\n * Transforms a number to a percentage\n * string, formatted according to locale rules that determine group sizing and\n * separator, decimal-point character, and other locale-specific\n * configurations.\n *\n * @see `formatPercent()`\n *\n * @usageNotes\n * The following code shows how the pipe transforms numbers\n * into text strings, according to various format specifications,\n * where the caller's default locale is `en-US`.\n *\n * \n *\n * @publicApi\n */\nclass PercentPipe {\n constructor(_locale) {\n this._locale = _locale;\n }\n /**\n *\n * @param value The number to be formatted as a percentage.\n * @param digitsInfo Decimal representation options, specified by a string\n * in the following format:
    \n * {minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}.\n * - `minIntegerDigits`: The minimum number of integer digits before the decimal point.\n * Default is `1`.\n * - `minFractionDigits`: The minimum number of digits after the decimal point.\n * Default is `0`.\n * - `maxFractionDigits`: The maximum number of digits after the decimal point.\n * Default is `0`.\n * @param locale A locale code for the locale format rules to use.\n * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.\n * See [Setting your app locale](guide/i18n#setting-up-the-locale-of-your-app).\n */\n transform(value, digitsInfo, locale) {\n if (isEmpty(value))\n return null;\n locale = locale || this._locale;\n try {\n const num = strToNumber(value);\n return formatPercent(num, locale, digitsInfo);\n }\n catch (error) {\n throw invalidPipeArgumentError(PercentPipe, error.message);\n }\n }\n}\nPercentPipe.ɵfac = function PercentPipe_Factory(t) { return new (t || PercentPipe)(ɵngcc0.ɵɵdirectiveInject(LOCALE_ID)); };\nPercentPipe.ɵpipe = ɵngcc0.ɵɵdefinePipe({ name: \"percent\", type: PercentPipe, pure: true });\nPercentPipe.ctorParameters = () => [\n { type: String, decorators: [{ type: Inject, args: [LOCALE_ID,] }] }\n];\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(PercentPipe, [{\n type: Pipe,\n args: [{ name: 'percent' }]\n }], function () { return [{ type: String, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }]; }, null); })();\n/**\n * @ngModule CommonModule\n * @description\n *\n * Transforms a number to a currency string, formatted according to locale rules\n * that determine group sizing and separator, decimal-point character,\n * and other locale-specific configurations.\n *\n * {@a currency-code-deprecation}\n *
    \n *\n * **Deprecation notice:**\n *\n * The default currency code is currently always `USD` but this is deprecated from v9.\n *\n * **In v11 the default currency code will be taken from the current locale identified by\n * the `LOCAL_ID` token. See the [i18n guide](guide/i18n#setting-up-the-locale-of-your-app) for\n * more information.**\n *\n * If you need the previous behavior then set it by creating a `DEFAULT_CURRENCY_CODE` provider in\n * your application `NgModule`:\n *\n * ```ts\n * {provide: DEFAULT_CURRENCY_CODE, useValue: 'USD'}\n * ```\n *\n *
    \n *\n * @see `getCurrencySymbol()`\n * @see `formatCurrency()`\n *\n * @usageNotes\n * The following code shows how the pipe transforms numbers\n * into text strings, according to various format specifications,\n * where the caller's default locale is `en-US`.\n *\n * \n *\n * @publicApi\n */\nclass CurrencyPipe {\n constructor(_locale, _defaultCurrencyCode = 'USD') {\n this._locale = _locale;\n this._defaultCurrencyCode = _defaultCurrencyCode;\n }\n /**\n *\n * @param value The number to be formatted as currency.\n * @param currencyCode The [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217) currency code,\n * such as `USD` for the US dollar and `EUR` for the euro. The default currency code can be\n * configured using the `DEFAULT_CURRENCY_CODE` injection token.\n * @param display The format for the currency indicator. One of the following:\n * - `code`: Show the code (such as `USD`).\n * - `symbol`(default): Show the symbol (such as `$`).\n * - `symbol-narrow`: Use the narrow symbol for locales that have two symbols for their\n * currency.\n * For example, the Canadian dollar CAD has the symbol `CA$` and the symbol-narrow `$`. If the\n * locale has no narrow symbol, uses the standard symbol for the locale.\n * - String: Use the given string value instead of a code or a symbol.\n * For example, an empty string will suppress the currency & symbol.\n * - Boolean (marked deprecated in v5): `true` for symbol and false for `code`.\n *\n * @param digitsInfo Decimal representation options, specified by a string\n * in the following format:
    \n * {minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}.\n * - `minIntegerDigits`: The minimum number of integer digits before the decimal point.\n * Default is `1`.\n * - `minFractionDigits`: The minimum number of digits after the decimal point.\n * Default is `2`.\n * - `maxFractionDigits`: The maximum number of digits after the decimal point.\n * Default is `2`.\n * If not provided, the number will be formatted with the proper amount of digits,\n * depending on what the [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217) specifies.\n * For example, the Canadian dollar has 2 digits, whereas the Chilean peso has none.\n * @param locale A locale code for the locale format rules to use.\n * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.\n * See [Setting your app locale](guide/i18n#setting-up-the-locale-of-your-app).\n */\n transform(value, currencyCode, display = 'symbol', digitsInfo, locale) {\n if (isEmpty(value))\n return null;\n locale = locale || this._locale;\n if (typeof display === 'boolean') {\n if (console && console.warn) {\n console.warn(`Warning: the currency pipe has been changed in Angular v5. The symbolDisplay option (third parameter) is now a string instead of a boolean. The accepted values are \"code\", \"symbol\" or \"symbol-narrow\".`);\n }\n display = display ? 'symbol' : 'code';\n }\n let currency = currencyCode || this._defaultCurrencyCode;\n if (display !== 'code') {\n if (display === 'symbol' || display === 'symbol-narrow') {\n currency = getCurrencySymbol(currency, display === 'symbol' ? 'wide' : 'narrow', locale);\n }\n else {\n currency = display;\n }\n }\n try {\n const num = strToNumber(value);\n return formatCurrency(num, locale, currency, currencyCode, digitsInfo);\n }\n catch (error) {\n throw invalidPipeArgumentError(CurrencyPipe, error.message);\n }\n }\n}\nCurrencyPipe.ɵfac = function CurrencyPipe_Factory(t) { return new (t || CurrencyPipe)(ɵngcc0.ɵɵdirectiveInject(LOCALE_ID), ɵngcc0.ɵɵdirectiveInject(DEFAULT_CURRENCY_CODE)); };\nCurrencyPipe.ɵpipe = ɵngcc0.ɵɵdefinePipe({ name: \"currency\", type: CurrencyPipe, pure: true });\nCurrencyPipe.ctorParameters = () => [\n { type: String, decorators: [{ type: Inject, args: [LOCALE_ID,] }] },\n { type: String, decorators: [{ type: Inject, args: [DEFAULT_CURRENCY_CODE,] }] }\n];\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(CurrencyPipe, [{\n type: Pipe,\n args: [{ name: 'currency' }]\n }], function () { return [{ type: String, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }, { type: String, decorators: [{\n type: Inject,\n args: [DEFAULT_CURRENCY_CODE]\n }] }]; }, null); })();\nfunction isEmpty(value) {\n return value == null || value === '' || value !== value;\n}\n/**\n * Transforms a string into a number (if needed).\n */\nfunction strToNumber(value) {\n // Convert strings to numbers\n if (typeof value === 'string' && !isNaN(Number(value) - parseFloat(value))) {\n return Number(value);\n }\n if (typeof value !== 'number') {\n throw new Error(`${value} is not a number`);\n }\n return value;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n * @description\n *\n * Creates a new `Array` or `String` containing a subset (slice) of the elements.\n *\n * @usageNotes\n *\n * All behavior is based on the expected behavior of the JavaScript API `Array.prototype.slice()`\n * and `String.prototype.slice()`.\n *\n * When operating on an `Array`, the returned `Array` is always a copy even when all\n * the elements are being returned.\n *\n * When operating on a blank value, the pipe returns the blank value.\n *\n * ### List Example\n *\n * This `ngFor` example:\n *\n * {@example common/pipes/ts/slice_pipe.ts region='SlicePipe_list'}\n *\n * produces the following:\n *\n * ```html\n *
  • b
  • \n *
  • c
  • \n * ```\n *\n * ### String Examples\n *\n * {@example common/pipes/ts/slice_pipe.ts region='SlicePipe_string'}\n *\n * @publicApi\n */\nclass SlicePipe {\n transform(value, start, end) {\n if (value == null)\n return value;\n if (!this.supports(value)) {\n throw invalidPipeArgumentError(SlicePipe, value);\n }\n return value.slice(start, end);\n }\n supports(obj) {\n return typeof obj === 'string' || Array.isArray(obj);\n }\n}\nSlicePipe.ɵfac = function SlicePipe_Factory(t) { return new (t || SlicePipe)(); };\nSlicePipe.ɵpipe = ɵngcc0.ɵɵdefinePipe({ name: \"slice\", type: SlicePipe, pure: false });\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(SlicePipe, [{\n type: Pipe,\n args: [{ name: 'slice', pure: false }]\n }], null, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A collection of Angular pipes that are likely to be used in each and every application.\n */\nconst COMMON_PIPES = [\n AsyncPipe,\n UpperCasePipe,\n LowerCasePipe,\n JsonPipe,\n SlicePipe,\n DecimalPipe,\n PercentPipe,\n TitleCasePipe,\n CurrencyPipe,\n DatePipe,\n I18nPluralPipe,\n I18nSelectPipe,\n KeyValuePipe,\n];\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// Note: This does not contain the location providers,\n// as they need some platform specific implementations to work.\n/**\n * Exports all the basic Angular directives and pipes,\n * such as `NgIf`, `NgForOf`, `DecimalPipe`, and so on.\n * Re-exported by `BrowserModule`, which is included automatically in the root\n * `AppModule` when you create a new app with the CLI `new` command.\n *\n * * The `providers` options configure the NgModule's injector to provide\n * localization dependencies to members.\n * * The `exports` options make the declared directives and pipes available for import\n * by other NgModules.\n *\n * @publicApi\n */\nclass CommonModule {\n}\nCommonModule.ɵmod = ɵngcc0.ɵɵdefineNgModule({ type: CommonModule });\nCommonModule.ɵinj = ɵngcc0.ɵɵdefineInjector({ factory: function CommonModule_Factory(t) { return new (t || CommonModule)(); }, providers: [\n { provide: NgLocalization, useClass: NgLocaleLocalization },\n ] });\n(function () { (typeof ngJitMode === \"undefined\" || ngJitMode) && ɵngcc0.ɵɵsetNgModuleScope(CommonModule, { declarations: [NgClass, NgComponentOutlet, NgForOf, NgIf, NgTemplateOutlet, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgPlural, NgPluralCase, AsyncPipe, UpperCasePipe, LowerCasePipe, JsonPipe, SlicePipe, DecimalPipe, PercentPipe, TitleCasePipe, CurrencyPipe, DatePipe, I18nPluralPipe, I18nSelectPipe, KeyValuePipe], exports: [NgClass, NgComponentOutlet, NgForOf, NgIf, NgTemplateOutlet, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgPlural, NgPluralCase, AsyncPipe, UpperCasePipe, LowerCasePipe, JsonPipe, SlicePipe, DecimalPipe, PercentPipe, TitleCasePipe, CurrencyPipe, DatePipe, I18nPluralPipe, I18nSelectPipe, KeyValuePipe] }); })();\n/*@__PURE__*/ (function () { ɵngcc0.ɵsetClassMetadata(CommonModule, [{\n type: NgModule,\n args: [{\n declarations: [COMMON_DIRECTIVES, COMMON_PIPES],\n exports: [COMMON_DIRECTIVES, COMMON_PIPES],\n providers: [\n { provide: NgLocalization, useClass: NgLocaleLocalization },\n ]\n }]\n }], null, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst PLATFORM_BROWSER_ID = 'browser';\nconst PLATFORM_SERVER_ID = 'server';\nconst PLATFORM_WORKER_APP_ID = 'browserWorkerApp';\nconst PLATFORM_WORKER_UI_ID = 'browserWorkerUi';\n/**\n * Returns whether a platform id represents a browser platform.\n * @publicApi\n */\nfunction isPlatformBrowser(platformId) {\n return platformId === PLATFORM_BROWSER_ID;\n}\n/**\n * Returns whether a platform id represents a server platform.\n * @publicApi\n */\nfunction isPlatformServer(platformId) {\n return platformId === PLATFORM_SERVER_ID;\n}\n/**\n * Returns whether a platform id represents a web worker app platform.\n * @publicApi\n */\nfunction isPlatformWorkerApp(platformId) {\n return platformId === PLATFORM_WORKER_APP_ID;\n}\n/**\n * Returns whether a platform id represents a web worker UI platform.\n * @publicApi\n */\nfunction isPlatformWorkerUi(platformId) {\n return platformId === PLATFORM_WORKER_UI_ID;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @publicApi\n */\nconst VERSION = new Version('10.0.7');\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Defines a scroll position manager. Implemented by `BrowserViewportScroller`.\n *\n * @publicApi\n */\nclass ViewportScroller {\n}\n// De-sugared tree-shakable injection\n// See #23917\n/** @nocollapse */\nViewportScroller.ɵprov = ɵɵdefineInjectable({\n token: ViewportScroller,\n providedIn: 'root',\n factory: () => new BrowserViewportScroller(ɵɵinject(DOCUMENT), window, ɵɵinject(ErrorHandler))\n});\n/**\n * Manages the scroll position for a browser window.\n */\nclass BrowserViewportScroller {\n constructor(document, window, errorHandler) {\n this.document = document;\n this.window = window;\n this.errorHandler = errorHandler;\n this.offset = () => [0, 0];\n }\n /**\n * Configures the top offset used when scrolling to an anchor.\n * @param offset A position in screen coordinates (a tuple with x and y values)\n * or a function that returns the top offset position.\n *\n */\n setOffset(offset) {\n if (Array.isArray(offset)) {\n this.offset = () => offset;\n }\n else {\n this.offset = offset;\n }\n }\n /**\n * Retrieves the current scroll position.\n * @returns The position in screen coordinates.\n */\n getScrollPosition() {\n if (this.supportScrollRestoration()) {\n return [this.window.scrollX, this.window.scrollY];\n }\n else {\n return [0, 0];\n }\n }\n /**\n * Sets the scroll position.\n * @param position The new position in screen coordinates.\n */\n scrollToPosition(position) {\n if (this.supportScrollRestoration()) {\n this.window.scrollTo(position[0], position[1]);\n }\n }\n /**\n * Scrolls to an anchor element.\n * @param anchor The ID of the anchor element.\n */\n scrollToAnchor(anchor) {\n if (this.supportScrollRestoration()) {\n // Escape anything passed to `querySelector` as it can throw errors and stop the application\n // from working if invalid values are passed.\n if (this.window.CSS && this.window.CSS.escape) {\n anchor = this.window.CSS.escape(anchor);\n }\n else {\n anchor = anchor.replace(/(\\\"|\\'\\ |:|\\.|\\[|\\]|,|=)/g, '\\\\$1');\n }\n try {\n const elSelectedById = this.document.querySelector(`#${anchor}`);\n if (elSelectedById) {\n this.scrollToElement(elSelectedById);\n return;\n }\n const elSelectedByName = this.document.querySelector(`[name='${anchor}']`);\n if (elSelectedByName) {\n this.scrollToElement(elSelectedByName);\n return;\n }\n }\n catch (e) {\n this.errorHandler.handleError(e);\n }\n }\n }\n /**\n * Disables automatic scroll restoration provided by the browser.\n */\n setHistoryScrollRestoration(scrollRestoration) {\n if (this.supportScrollRestoration()) {\n const history = this.window.history;\n if (history && history.scrollRestoration) {\n history.scrollRestoration = scrollRestoration;\n }\n }\n }\n scrollToElement(el) {\n const rect = el.getBoundingClientRect();\n const left = rect.left + this.window.pageXOffset;\n const top = rect.top + this.window.pageYOffset;\n const offset = this.offset();\n this.window.scrollTo(left - offset[0], top - offset[1]);\n }\n /**\n * We only support scroll restoration when we can get a hold of window.\n * This means that we do not support this behavior when running in a web worker.\n *\n * Lifting this restriction right now would require more changes in the dom adapter.\n * Since webworkers aren't widely used, we will lift it once RouterScroller is\n * battle-tested.\n */\n supportScrollRestoration() {\n try {\n return !!this.window && !!this.window.scrollTo;\n }\n catch (_a) {\n return false;\n }\n }\n}\n/**\n * Provides an empty implementation of the viewport scroller. This will\n * live in @angular/common as it will be used by both platform-server and platform-webworker.\n */\nclass NullViewportScroller {\n /**\n * Empty implementation\n */\n setOffset(offset) { }\n /**\n * Empty implementation\n */\n getScrollPosition() {\n return [0, 0];\n }\n /**\n * Empty implementation\n */\n scrollToPosition(position) { }\n /**\n * Empty implementation\n */\n scrollToAnchor(anchor) { }\n /**\n * Empty implementation\n */\n setHistoryScrollRestoration(scrollRestoration) { }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// This file only reexports content of the `src` folder. Keep it that way.\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { APP_BASE_HREF, AsyncPipe, CommonModule, CurrencyPipe, DOCUMENT, DatePipe, DecimalPipe, FormStyle, FormatWidth, HashLocationStrategy, I18nPluralPipe, I18nSelectPipe, JsonPipe, KeyValuePipe, LOCATION_INITIALIZED, Location, LocationStrategy, LowerCasePipe, NgClass, NgComponentOutlet, NgForOf, NgForOfContext, NgIf, NgIfContext, NgLocaleLocalization, NgLocalization, NgPlural, NgPluralCase, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgTemplateOutlet, NumberFormatStyle, NumberSymbol, PathLocationStrategy, PercentPipe, PlatformLocation, Plural, SlicePipe, TitleCasePipe, TranslationWidth, UpperCasePipe, VERSION, ViewportScroller, WeekDay, formatCurrency, formatDate, formatNumber, formatPercent, getCurrencySymbol, getLocaleCurrencyCode, getLocaleCurrencyName, getLocaleCurrencySymbol, getLocaleDateFormat, getLocaleDateTimeFormat, getLocaleDayNames, getLocaleDayPeriods, getLocaleDirection, getLocaleEraNames, getLocaleExtraDayPeriodRules, getLocaleExtraDayPeriods, getLocaleFirstDayOfWeek, getLocaleId, getLocaleMonthNames, getLocaleNumberFormat, getLocaleNumberSymbol, getLocalePluralCase, getLocaleTimeFormat, getLocaleWeekEndRange, getNumberOfCurrencyDigits, isPlatformBrowser, isPlatformServer, isPlatformWorkerApp, isPlatformWorkerUi, registerLocaleData, BrowserPlatformLocation as ɵBrowserPlatformLocation, DomAdapter as ɵDomAdapter, NullViewportScroller as ɵNullViewportScroller, PLATFORM_BROWSER_ID as ɵPLATFORM_BROWSER_ID, PLATFORM_SERVER_ID as ɵPLATFORM_SERVER_ID, PLATFORM_WORKER_APP_ID as ɵPLATFORM_WORKER_APP_ID, PLATFORM_WORKER_UI_ID as ɵPLATFORM_WORKER_UI_ID, useBrowserPlatformLocation as ɵangular_packages_common_common_a, createBrowserPlatformLocation as ɵangular_packages_common_common_b, createLocation as ɵangular_packages_common_common_c, provideLocationStrategy as ɵangular_packages_common_common_d, COMMON_DIRECTIVES as ɵangular_packages_common_common_e, COMMON_PIPES as ɵangular_packages_common_common_f, getDOM as ɵgetDOM, parseCookieValue as ɵparseCookieValue, setRootDomAdapter as ɵsetRootDomAdapter };\n\n//# sourceMappingURL=common.js.map","/**\n * @license Angular v10.0.7\n * (c) 2010-2020 Google LLC. https://angular.io/\n * License: MIT\n */\n\nimport { Subject, Subscription, Observable, merge as merge$1 } from 'rxjs';\nimport { share } from 'rxjs/operators';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Convince closure compiler that the wrapped function has no side-effects.\n *\n * Closure compiler always assumes that `toString` has no side-effects. We use this quirk to\n * allow us to execute a function but have closure compiler mark the call as no-side-effects.\n * It is important that the return value for the `noSideEffects` function be assigned\n * to something which is retained otherwise the call to `noSideEffects` will be removed by closure\n * compiler.\n */\nfunction noSideEffects(fn) {\n return { toString: fn }.toString();\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst ANNOTATIONS = '__annotations__';\nconst PARAMETERS = '__parameters__';\nconst PROP_METADATA = '__prop__metadata__';\n/**\n * @suppress {globalThis}\n */\nfunction makeDecorator(name, props, parentClass, additionalProcessing, typeFn) {\n return noSideEffects(() => {\n const metaCtor = makeMetadataCtor(props);\n function DecoratorFactory(...args) {\n if (this instanceof DecoratorFactory) {\n metaCtor.call(this, ...args);\n return this;\n }\n const annotationInstance = new DecoratorFactory(...args);\n return function TypeDecorator(cls) {\n if (typeFn)\n typeFn(cls, ...args);\n // Use of Object.defineProperty is important since it creates non-enumerable property which\n // prevents the property is copied during subclassing.\n const annotations = cls.hasOwnProperty(ANNOTATIONS) ?\n cls[ANNOTATIONS] :\n Object.defineProperty(cls, ANNOTATIONS, { value: [] })[ANNOTATIONS];\n annotations.push(annotationInstance);\n if (additionalProcessing)\n additionalProcessing(cls);\n return cls;\n };\n }\n if (parentClass) {\n DecoratorFactory.prototype = Object.create(parentClass.prototype);\n }\n DecoratorFactory.prototype.ngMetadataName = name;\n DecoratorFactory.annotationCls = DecoratorFactory;\n return DecoratorFactory;\n });\n}\nfunction makeMetadataCtor(props) {\n return function ctor(...args) {\n if (props) {\n const values = props(...args);\n for (const propName in values) {\n this[propName] = values[propName];\n }\n }\n };\n}\nfunction makeParamDecorator(name, props, parentClass) {\n return noSideEffects(() => {\n const metaCtor = makeMetadataCtor(props);\n function ParamDecoratorFactory(...args) {\n if (this instanceof ParamDecoratorFactory) {\n metaCtor.apply(this, args);\n return this;\n }\n const annotationInstance = new ParamDecoratorFactory(...args);\n ParamDecorator.annotation = annotationInstance;\n return ParamDecorator;\n function ParamDecorator(cls, unusedKey, index) {\n // Use of Object.defineProperty is important since it creates non-enumerable property which\n // prevents the property is copied during subclassing.\n const parameters = cls.hasOwnProperty(PARAMETERS) ?\n cls[PARAMETERS] :\n Object.defineProperty(cls, PARAMETERS, { value: [] })[PARAMETERS];\n // there might be gaps if some in between parameters do not have annotations.\n // we pad with nulls.\n while (parameters.length <= index) {\n parameters.push(null);\n }\n (parameters[index] = parameters[index] || []).push(annotationInstance);\n return cls;\n }\n }\n if (parentClass) {\n ParamDecoratorFactory.prototype = Object.create(parentClass.prototype);\n }\n ParamDecoratorFactory.prototype.ngMetadataName = name;\n ParamDecoratorFactory.annotationCls = ParamDecoratorFactory;\n return ParamDecoratorFactory;\n });\n}\nfunction makePropDecorator(name, props, parentClass, additionalProcessing) {\n return noSideEffects(() => {\n const metaCtor = makeMetadataCtor(props);\n function PropDecoratorFactory(...args) {\n if (this instanceof PropDecoratorFactory) {\n metaCtor.apply(this, args);\n return this;\n }\n const decoratorInstance = new PropDecoratorFactory(...args);\n function PropDecorator(target, name) {\n const constructor = target.constructor;\n // Use of Object.defineProperty is important because it creates a non-enumerable property\n // which prevents the property from being copied during subclassing.\n const meta = constructor.hasOwnProperty(PROP_METADATA) ?\n constructor[PROP_METADATA] :\n Object.defineProperty(constructor, PROP_METADATA, { value: {} })[PROP_METADATA];\n meta[name] = meta.hasOwnProperty(name) && meta[name] || [];\n meta[name].unshift(decoratorInstance);\n if (additionalProcessing)\n additionalProcessing(target, name, ...args);\n }\n return PropDecorator;\n }\n if (parentClass) {\n PropDecoratorFactory.prototype = Object.create(parentClass.prototype);\n }\n PropDecoratorFactory.prototype.ngMetadataName = name;\n PropDecoratorFactory.annotationCls = PropDecoratorFactory;\n return PropDecoratorFactory;\n });\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst ɵ0 = (token) => ({ token });\n/**\n * Inject decorator and metadata.\n *\n * @Annotation\n * @publicApi\n */\nconst Inject = makeParamDecorator('Inject', ɵ0);\n/**\n * Optional decorator and metadata.\n *\n * @Annotation\n * @publicApi\n */\nconst Optional = makeParamDecorator('Optional');\n/**\n * Self decorator and metadata.\n *\n * @Annotation\n * @publicApi\n */\nconst Self = makeParamDecorator('Self');\n/**\n * `SkipSelf` decorator and metadata.\n *\n * @Annotation\n * @publicApi\n */\nconst SkipSelf = makeParamDecorator('SkipSelf');\n/**\n * Host decorator and metadata.\n *\n * @Annotation\n * @publicApi\n */\nconst Host = makeParamDecorator('Host');\nconst ɵ1 = (attributeName) => ({ attributeName });\n/**\n * Attribute decorator and metadata.\n *\n * @Annotation\n * @publicApi\n */\nconst Attribute = makeParamDecorator('Attribute', ɵ1);\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Injection flags for DI.\n *\n * @publicApi\n */\nvar InjectFlags;\n(function (InjectFlags) {\n // TODO(alxhub): make this 'const' when ngc no longer writes exports of it into ngfactory files.\n /** Check self and check parent injector if needed */\n InjectFlags[InjectFlags[\"Default\"] = 0] = \"Default\";\n /**\n * Specifies that an injector should retrieve a dependency from any injector until reaching the\n * host element of the current component. (Only used with Element Injector)\n */\n InjectFlags[InjectFlags[\"Host\"] = 1] = \"Host\";\n /** Don't ascend to ancestors of the node requesting injection. */\n InjectFlags[InjectFlags[\"Self\"] = 2] = \"Self\";\n /** Skip the node that is requesting injection. */\n InjectFlags[InjectFlags[\"SkipSelf\"] = 4] = \"SkipSelf\";\n /** Inject `defaultValue` instead if token not found. */\n InjectFlags[InjectFlags[\"Optional\"] = 8] = \"Optional\";\n})(InjectFlags || (InjectFlags = {}));\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction getClosureSafeProperty(objWithPropertyToExtract) {\n for (let key in objWithPropertyToExtract) {\n if (objWithPropertyToExtract[key] === getClosureSafeProperty) {\n return key;\n }\n }\n throw Error('Could not find renamed property on target object.');\n}\n/**\n * Sets properties on a target object from a source object, but only if\n * the property doesn't already exist on the target object.\n * @param target The target to set properties on\n * @param source The source of the property keys and values to set\n */\nfunction fillProperties(target, source) {\n for (const key in source) {\n if (source.hasOwnProperty(key) && !target.hasOwnProperty(key)) {\n target[key] = source[key];\n }\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Construct an `InjectableDef` which defines how a token will be constructed by the DI system, and\n * in which injectors (if any) it will be available.\n *\n * This should be assigned to a static `ɵprov` field on a type, which will then be an\n * `InjectableType`.\n *\n * Options:\n * * `providedIn` determines which injectors will include the injectable, by either associating it\n * with an `@NgModule` or other `InjectorType`, or by specifying that this injectable should be\n * provided in the `'root'` injector, which will be the application-level injector in most apps.\n * * `factory` gives the zero argument function which will create an instance of the injectable.\n * The factory can call `inject` to access the `Injector` and request injection of dependencies.\n *\n * @codeGenApi\n * @publicApi This instruction has been emitted by ViewEngine for some time and is deployed to npm.\n */\nfunction ɵɵdefineInjectable(opts) {\n return {\n token: opts.token,\n providedIn: opts.providedIn || null,\n factory: opts.factory,\n value: undefined,\n };\n}\n/**\n * @deprecated in v8, delete after v10. This API should be used only be generated code, and that\n * code should now use ɵɵdefineInjectable instead.\n * @publicApi\n */\nconst defineInjectable = ɵɵdefineInjectable;\n/**\n * Construct an `InjectorDef` which configures an injector.\n *\n * This should be assigned to a static injector def (`ɵinj`) field on a type, which will then be an\n * `InjectorType`.\n *\n * Options:\n *\n * * `factory`: an `InjectorType` is an instantiable type, so a zero argument `factory` function to\n * create the type must be provided. If that factory function needs to inject arguments, it can\n * use the `inject` function.\n * * `providers`: an optional array of providers to add to the injector. Each provider must\n * either have a factory or point to a type which has a `ɵprov` static property (the\n * type must be an `InjectableType`).\n * * `imports`: an optional array of imports of other `InjectorType`s or `InjectorTypeWithModule`s\n * whose providers will also be added to the injector. Locally provided types will override\n * providers from imports.\n *\n * @codeGenApi\n */\nfunction ɵɵdefineInjector(options) {\n return {\n factory: options.factory,\n providers: options.providers || [],\n imports: options.imports || [],\n };\n}\n/**\n * Read the injectable def (`ɵprov`) for `type` in a way which is immune to accidentally reading\n * inherited value.\n *\n * @param type A type which may have its own (non-inherited) `ɵprov`.\n */\nfunction getInjectableDef(type) {\n return getOwnDefinition(type, type[NG_PROV_DEF]) ||\n getOwnDefinition(type, type[NG_INJECTABLE_DEF]);\n}\n/**\n * Return `def` only if it is defined directly on `type` and is not inherited from a base\n * class of `type`.\n *\n * The function `Object.hasOwnProperty` is not sufficient to distinguish this case because in older\n * browsers (e.g. IE10) static property inheritance is implemented by copying the properties.\n *\n * Instead, the definition's `token` is compared to the `type`, and if they don't match then the\n * property was not defined directly on the type itself, and was likely inherited. The definition\n * is only returned if the `type` matches the `def.token`.\n */\nfunction getOwnDefinition(type, def) {\n return def && def.token === type ? def : null;\n}\n/**\n * Read the injectable def (`ɵprov`) for `type` or read the `ɵprov` from one of its ancestors.\n *\n * @param type A type which may have `ɵprov`, via inheritance.\n *\n * @deprecated Will be removed in a future version of Angular, where an error will occur in the\n * scenario if we find the `ɵprov` on an ancestor only.\n */\nfunction getInheritedInjectableDef(type) {\n // See `jit/injectable.ts#compileInjectable` for context on NG_PROV_DEF_FALLBACK.\n const def = type &&\n (type[NG_PROV_DEF] || type[NG_INJECTABLE_DEF] ||\n (type[NG_PROV_DEF_FALLBACK] && type[NG_PROV_DEF_FALLBACK]()));\n if (def) {\n const typeName = getTypeName(type);\n // TODO(FW-1307): Re-add ngDevMode when closure can handle it\n // ngDevMode &&\n console.warn(`DEPRECATED: DI is instantiating a token \"${typeName}\" that inherits its @Injectable decorator but does not provide one itself.\\n` +\n `This will become an error in a future version of Angular. Please add @Injectable() to the \"${typeName}\" class.`);\n return def;\n }\n else {\n return null;\n }\n}\n/** Gets the name of a type, accounting for some cross-browser differences. */\nfunction getTypeName(type) {\n // `Function.prototype.name` behaves differently between IE and other browsers. In most browsers\n // it'll always return the name of the function itself, no matter how many other functions it\n // inherits from. On IE the function doesn't have its own `name` property, but it takes it from\n // the lowest level in the prototype chain. E.g. if we have `class Foo extends Parent` most\n // browsers will evaluate `Foo.name` to `Foo` while IE will return `Parent`. We work around\n // the issue by converting the function to a string and parsing its name out that way via a regex.\n if (type.hasOwnProperty('name')) {\n return type.name;\n }\n const match = ('' + type).match(/^function\\s*([^\\s(]+)/);\n return match === null ? '' : match[1];\n}\n/**\n * Read the injector def type in a way which is immune to accidentally reading inherited value.\n *\n * @param type type which may have an injector def (`ɵinj`)\n */\nfunction getInjectorDef(type) {\n return type && (type.hasOwnProperty(NG_INJ_DEF) || type.hasOwnProperty(NG_INJECTOR_DEF)) ?\n type[NG_INJ_DEF] :\n null;\n}\nconst NG_PROV_DEF = getClosureSafeProperty({ ɵprov: getClosureSafeProperty });\nconst NG_INJ_DEF = getClosureSafeProperty({ ɵinj: getClosureSafeProperty });\n// On IE10 properties defined via `defineProperty` won't be inherited by child classes,\n// which will break inheriting the injectable definition from a grandparent through an\n// undecorated parent class. We work around it by defining a fallback method which will be\n// used to retrieve the definition. This should only be a problem in JIT mode, because in\n// AOT TypeScript seems to have a workaround for static properties. When inheriting from an\n// undecorated parent is no longer supported in v10, this can safely be removed.\nconst NG_PROV_DEF_FALLBACK = getClosureSafeProperty({ ɵprovFallback: getClosureSafeProperty });\n// We need to keep these around so we can read off old defs if new defs are unavailable\nconst NG_INJECTABLE_DEF = getClosureSafeProperty({ ngInjectableDef: getClosureSafeProperty });\nconst NG_INJECTOR_DEF = getClosureSafeProperty({ ngInjectorDef: getClosureSafeProperty });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction stringify(token) {\n if (typeof token === 'string') {\n return token;\n }\n if (Array.isArray(token)) {\n return '[' + token.map(stringify).join(', ') + ']';\n }\n if (token == null) {\n return '' + token;\n }\n if (token.overriddenName) {\n return `${token.overriddenName}`;\n }\n if (token.name) {\n return `${token.name}`;\n }\n const res = token.toString();\n if (res == null) {\n return '' + res;\n }\n const newLineIndex = res.indexOf('\\n');\n return newLineIndex === -1 ? res : res.substring(0, newLineIndex);\n}\n/**\n * Concatenates two strings with separator, allocating new strings only when necessary.\n *\n * @param before before string.\n * @param separator separator string.\n * @param after after string.\n * @returns concatenated string.\n */\nfunction concatStringsWithSpace(before, after) {\n return (before == null || before === '') ?\n (after === null ? '' : after) :\n ((after == null || after === '') ? before : before + ' ' + after);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst __forward_ref__ = getClosureSafeProperty({ __forward_ref__: getClosureSafeProperty });\n/**\n * Allows to refer to references which are not yet defined.\n *\n * For instance, `forwardRef` is used when the `token` which we need to refer to for the purposes of\n * DI is declared, but not yet defined. It is also used when the `token` which we use when creating\n * a query is not yet defined.\n *\n * @usageNotes\n * ### Example\n * {@example core/di/ts/forward_ref/forward_ref_spec.ts region='forward_ref'}\n * @publicApi\n */\nfunction forwardRef(forwardRefFn) {\n forwardRefFn.__forward_ref__ = forwardRef;\n forwardRefFn.toString = function () {\n return stringify(this());\n };\n return forwardRefFn;\n}\n/**\n * Lazily retrieves the reference value from a forwardRef.\n *\n * Acts as the identity function when given a non-forward-ref value.\n *\n * @usageNotes\n * ### Example\n *\n * {@example core/di/ts/forward_ref/forward_ref_spec.ts region='resolve_forward_ref'}\n *\n * @see `forwardRef`\n * @publicApi\n */\nfunction resolveForwardRef(type) {\n return isForwardRef(type) ? type() : type;\n}\n/** Checks whether a function is wrapped by a `forwardRef`. */\nfunction isForwardRef(fn) {\n return typeof fn === 'function' && fn.hasOwnProperty(__forward_ref__) &&\n fn.__forward_ref__ === forwardRef;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst __globalThis = typeof globalThis !== 'undefined' && globalThis;\nconst __window = typeof window !== 'undefined' && window;\nconst __self = typeof self !== 'undefined' && typeof WorkerGlobalScope !== 'undefined' &&\n self instanceof WorkerGlobalScope && self;\nconst __global = typeof global !== 'undefined' && global;\n// Always use __globalThis if available, which is the spec-defined global variable across all\n// environments, then fallback to __global first, because in Node tests both __global and\n// __window may be defined and _global should be __global in that case.\nconst _global = __globalThis || __global || __window || __self;\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nvar R3ResolvedDependencyType;\n(function (R3ResolvedDependencyType) {\n R3ResolvedDependencyType[R3ResolvedDependencyType[\"Token\"] = 0] = \"Token\";\n R3ResolvedDependencyType[R3ResolvedDependencyType[\"Attribute\"] = 1] = \"Attribute\";\n R3ResolvedDependencyType[R3ResolvedDependencyType[\"ChangeDetectorRef\"] = 2] = \"ChangeDetectorRef\";\n R3ResolvedDependencyType[R3ResolvedDependencyType[\"Invalid\"] = 3] = \"Invalid\";\n})(R3ResolvedDependencyType || (R3ResolvedDependencyType = {}));\nvar R3FactoryTarget;\n(function (R3FactoryTarget) {\n R3FactoryTarget[R3FactoryTarget[\"Directive\"] = 0] = \"Directive\";\n R3FactoryTarget[R3FactoryTarget[\"Component\"] = 1] = \"Component\";\n R3FactoryTarget[R3FactoryTarget[\"Injectable\"] = 2] = \"Injectable\";\n R3FactoryTarget[R3FactoryTarget[\"Pipe\"] = 3] = \"Pipe\";\n R3FactoryTarget[R3FactoryTarget[\"NgModule\"] = 4] = \"NgModule\";\n})(R3FactoryTarget || (R3FactoryTarget = {}));\nvar ViewEncapsulation;\n(function (ViewEncapsulation) {\n ViewEncapsulation[ViewEncapsulation[\"Emulated\"] = 0] = \"Emulated\";\n ViewEncapsulation[ViewEncapsulation[\"Native\"] = 1] = \"Native\";\n ViewEncapsulation[ViewEncapsulation[\"None\"] = 2] = \"None\";\n ViewEncapsulation[ViewEncapsulation[\"ShadowDom\"] = 3] = \"ShadowDom\";\n})(ViewEncapsulation || (ViewEncapsulation = {}));\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction getCompilerFacade() {\n const globalNg = _global['ng'];\n if (!globalNg || !globalNg.ɵcompilerFacade) {\n throw new Error(`Angular JIT compilation failed: '@angular/compiler' not loaded!\\n` +\n ` - JIT compilation is discouraged for production use-cases! Consider AOT mode instead.\\n` +\n ` - Did you bootstrap using '@angular/platform-browser-dynamic' or '@angular/platform-server'?\\n` +\n ` - Alternatively provide the compiler with 'import \"@angular/compiler\";' before bootstrapping.`);\n }\n return globalNg.ɵcompilerFacade;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst NG_COMP_DEF = getClosureSafeProperty({ ɵcmp: getClosureSafeProperty });\nconst NG_DIR_DEF = getClosureSafeProperty({ ɵdir: getClosureSafeProperty });\nconst NG_PIPE_DEF = getClosureSafeProperty({ ɵpipe: getClosureSafeProperty });\nconst NG_MOD_DEF = getClosureSafeProperty({ ɵmod: getClosureSafeProperty });\nconst NG_LOC_ID_DEF = getClosureSafeProperty({ ɵloc: getClosureSafeProperty });\nconst NG_FACTORY_DEF = getClosureSafeProperty({ ɵfac: getClosureSafeProperty });\n/**\n * If a directive is diPublic, bloomAdd sets a property on the type with this constant as\n * the key and the directive's unique ID as the value. This allows us to map directives to their\n * bloom filter bit for DI.\n */\n// TODO(misko): This is wrong. The NG_ELEMENT_ID should never be minified.\nconst NG_ELEMENT_ID = getClosureSafeProperty({ __NG_ELEMENT_ID__: getClosureSafeProperty });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction ngDevModeResetPerfCounters() {\n const locationString = typeof location !== 'undefined' ? location.toString() : '';\n const newCounters = {\n namedConstructors: locationString.indexOf('ngDevMode=namedConstructors') != -1,\n firstCreatePass: 0,\n tNode: 0,\n tView: 0,\n rendererCreateTextNode: 0,\n rendererSetText: 0,\n rendererCreateElement: 0,\n rendererAddEventListener: 0,\n rendererSetAttribute: 0,\n rendererRemoveAttribute: 0,\n rendererSetProperty: 0,\n rendererSetClassName: 0,\n rendererAddClass: 0,\n rendererRemoveClass: 0,\n rendererSetStyle: 0,\n rendererRemoveStyle: 0,\n rendererDestroy: 0,\n rendererDestroyNode: 0,\n rendererMoveNode: 0,\n rendererRemoveNode: 0,\n rendererAppendChild: 0,\n rendererInsertBefore: 0,\n rendererCreateComment: 0,\n };\n // Make sure to refer to ngDevMode as ['ngDevMode'] for closure.\n const allowNgDevModeTrue = locationString.indexOf('ngDevMode=false') === -1;\n _global['ngDevMode'] = allowNgDevModeTrue && newCounters;\n return newCounters;\n}\n/**\n * This function checks to see if the `ngDevMode` has been set. If yes,\n * then we honor it, otherwise we default to dev mode with additional checks.\n *\n * The idea is that unless we are doing production build where we explicitly\n * set `ngDevMode == false` we should be helping the developer by providing\n * as much early warning and errors as possible.\n *\n * `ɵɵdefineComponent` is guaranteed to have been called before any component template functions\n * (and thus Ivy instructions), so a single initialization there is sufficient to ensure ngDevMode\n * is defined for the entire instruction set.\n *\n * When checking `ngDevMode` on toplevel, always init it before referencing it\n * (e.g. `((typeof ngDevMode === 'undefined' || ngDevMode) && initNgDevMode())`), otherwise you can\n * get a `ReferenceError` like in https://github.com/angular/angular/issues/31595.\n *\n * Details on possible values for `ngDevMode` can be found on its docstring.\n *\n * NOTE:\n * - changes to the `ngDevMode` name must be synced with `compiler-cli/src/tooling.ts`.\n */\nfunction initNgDevMode() {\n // The below checks are to ensure that calling `initNgDevMode` multiple times does not\n // reset the counters.\n // If the `ngDevMode` is not an object, then it means we have not created the perf counters\n // yet.\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n if (typeof ngDevMode !== 'object') {\n ngDevModeResetPerfCounters();\n }\n return !!ngDevMode;\n }\n return false;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Creates a token that can be used in a DI Provider.\n *\n * Use an `InjectionToken` whenever the type you are injecting is not reified (does not have a\n * runtime representation) such as when injecting an interface, callable type, array or\n * parameterized type.\n *\n * `InjectionToken` is parameterized on `T` which is the type of object which will be returned by\n * the `Injector`. This provides additional level of type safety.\n *\n * ```\n * interface MyInterface {...}\n * var myInterface = injector.get(new InjectionToken('SomeToken'));\n * // myInterface is inferred to be MyInterface.\n * ```\n *\n * When creating an `InjectionToken`, you can optionally specify a factory function which returns\n * (possibly by creating) a default value of the parameterized type `T`. This sets up the\n * `InjectionToken` using this factory as a provider as if it was defined explicitly in the\n * application's root injector. If the factory function, which takes zero arguments, needs to inject\n * dependencies, it can do so using the `inject` function. See below for an example.\n *\n * Additionally, if a `factory` is specified you can also specify the `providedIn` option, which\n * overrides the above behavior and marks the token as belonging to a particular `@NgModule`. As\n * mentioned above, `'root'` is the default value for `providedIn`.\n *\n * @usageNotes\n * ### Basic Example\n *\n * ### Plain InjectionToken\n *\n * {@example core/di/ts/injector_spec.ts region='InjectionToken'}\n *\n * ### Tree-shakable InjectionToken\n *\n * {@example core/di/ts/injector_spec.ts region='ShakableInjectionToken'}\n *\n *\n * @publicApi\n */\nclass InjectionToken {\n constructor(_desc, options) {\n this._desc = _desc;\n /** @internal */\n this.ngMetadataName = 'InjectionToken';\n this.ɵprov = undefined;\n if (typeof options == 'number') {\n // This is a special hack to assign __NG_ELEMENT_ID__ to this instance.\n // __NG_ELEMENT_ID__ is Used by Ivy to determine bloom filter id.\n // We are using it to assign `-1` which is used to identify `Injector`.\n this.__NG_ELEMENT_ID__ = options;\n }\n else if (options !== undefined) {\n this.ɵprov = ɵɵdefineInjectable({\n token: this,\n providedIn: options.providedIn || 'root',\n factory: options.factory,\n });\n }\n }\n toString() {\n return `InjectionToken ${this._desc}`;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * An InjectionToken that gets the current `Injector` for `createInjector()`-style injectors.\n *\n * Requesting this token instead of `Injector` allows `StaticInjector` to be tree-shaken from a\n * project.\n *\n * @publicApi\n */\nconst INJECTOR = new InjectionToken('INJECTOR', -1 // `-1` is used by Ivy DI system as special value to recognize it as `Injector`.\n);\nconst _THROW_IF_NOT_FOUND = {};\nconst THROW_IF_NOT_FOUND = _THROW_IF_NOT_FOUND;\nconst NG_TEMP_TOKEN_PATH = 'ngTempTokenPath';\nconst NG_TOKEN_PATH = 'ngTokenPath';\nconst NEW_LINE = /\\n/gm;\nconst NO_NEW_LINE = 'ɵ';\nconst SOURCE = '__source';\nconst ɵ0$1 = getClosureSafeProperty;\nconst USE_VALUE = getClosureSafeProperty({ provide: String, useValue: ɵ0$1 });\n/**\n * Current injector value used by `inject`.\n * - `undefined`: it is an error to call `inject`\n * - `null`: `inject` can be called but there is no injector (limp-mode).\n * - Injector instance: Use the injector for resolution.\n */\nlet _currentInjector = undefined;\nfunction setCurrentInjector(injector) {\n const former = _currentInjector;\n _currentInjector = injector;\n return former;\n}\n/**\n * Current implementation of inject.\n *\n * By default, it is `injectInjectorOnly`, which makes it `Injector`-only aware. It can be changed\n * to `directiveInject`, which brings in the `NodeInjector` system of ivy. It is designed this\n * way for two reasons:\n * 1. `Injector` should not depend on ivy logic.\n * 2. To maintain tree shake-ability we don't want to bring in unnecessary code.\n */\nlet _injectImplementation;\n/**\n * Sets the current inject implementation.\n */\nfunction setInjectImplementation(impl) {\n const previous = _injectImplementation;\n _injectImplementation = impl;\n return previous;\n}\nfunction injectInjectorOnly(token, flags = InjectFlags.Default) {\n if (_currentInjector === undefined) {\n throw new Error(`inject() must be called from an injection context`);\n }\n else if (_currentInjector === null) {\n return injectRootLimpMode(token, undefined, flags);\n }\n else {\n return _currentInjector.get(token, flags & InjectFlags.Optional ? null : undefined, flags);\n }\n}\nfunction ɵɵinject(token, flags = InjectFlags.Default) {\n return (_injectImplementation || injectInjectorOnly)(resolveForwardRef(token), flags);\n}\n/**\n * Throws an error indicating that a factory function could not be generated by the compiler for a\n * particular class.\n *\n * This instruction allows the actual error message to be optimized away when ngDevMode is turned\n * off, saving bytes of generated code while still providing a good experience in dev mode.\n *\n * The name of the class is not mentioned here, but will be in the generated factory function name\n * and thus in the stack trace.\n *\n * @codeGenApi\n */\nfunction ɵɵinvalidFactoryDep(index) {\n const msg = ngDevMode ?\n `This constructor is not compatible with Angular Dependency Injection because its dependency at index ${index} of the parameter list is invalid.\nThis can happen if the dependency type is a primitive like a string or if an ancestor of this class is missing an Angular decorator.\n\nPlease check that 1) the type for the parameter at index ${index} is correct and 2) the correct Angular decorators are defined for this class and its ancestors.` :\n 'invalid';\n throw new Error(msg);\n}\n/**\n * Injects a token from the currently active injector.\n *\n * Must be used in the context of a factory function such as one defined for an\n * `InjectionToken`. Throws an error if not called from such a context.\n *\n * Within such a factory function, using this function to request injection of a dependency\n * is faster and more type-safe than providing an additional array of dependencies\n * (as has been common with `useFactory` providers).\n *\n * @param token The injection token for the dependency to be injected.\n * @param flags Optional flags that control how injection is executed.\n * The flags correspond to injection strategies that can be specified with\n * parameter decorators `@Host`, `@Self`, `@SkipSef`, and `@Optional`.\n * @returns True if injection is successful, null otherwise.\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example core/di/ts/injector_spec.ts region='ShakableInjectionToken'}\n *\n * @publicApi\n */\nconst inject = ɵɵinject;\n/**\n * Injects `root` tokens in limp mode.\n *\n * If no injector exists, we can still inject tree-shakable providers which have `providedIn` set to\n * `\"root\"`. This is known as the limp mode injection. In such case the value is stored in the\n * `InjectableDef`.\n */\nfunction injectRootLimpMode(token, notFoundValue, flags) {\n const injectableDef = getInjectableDef(token);\n if (injectableDef && injectableDef.providedIn == 'root') {\n return injectableDef.value === undefined ? injectableDef.value = injectableDef.factory() :\n injectableDef.value;\n }\n if (flags & InjectFlags.Optional)\n return null;\n if (notFoundValue !== undefined)\n return notFoundValue;\n throw new Error(`Injector: NOT_FOUND [${stringify(token)}]`);\n}\nfunction injectArgs(types) {\n const args = [];\n for (let i = 0; i < types.length; i++) {\n const arg = resolveForwardRef(types[i]);\n if (Array.isArray(arg)) {\n if (arg.length === 0) {\n throw new Error('Arguments array must have arguments.');\n }\n let type = undefined;\n let flags = InjectFlags.Default;\n for (let j = 0; j < arg.length; j++) {\n const meta = arg[j];\n if (meta instanceof Optional || meta.ngMetadataName === 'Optional' || meta === Optional) {\n flags |= InjectFlags.Optional;\n }\n else if (meta instanceof SkipSelf || meta.ngMetadataName === 'SkipSelf' || meta === SkipSelf) {\n flags |= InjectFlags.SkipSelf;\n }\n else if (meta instanceof Self || meta.ngMetadataName === 'Self' || meta === Self) {\n flags |= InjectFlags.Self;\n }\n else if (meta instanceof Inject || meta === Inject) {\n type = meta.token;\n }\n else {\n type = meta;\n }\n }\n args.push(ɵɵinject(type, flags));\n }\n else {\n args.push(ɵɵinject(arg));\n }\n }\n return args;\n}\nclass NullInjector {\n get(token, notFoundValue = THROW_IF_NOT_FOUND) {\n if (notFoundValue === THROW_IF_NOT_FOUND) {\n // Intentionally left behind: With dev tools open the debugger will stop here. There is no\n // reason why correctly written application should cause this exception.\n // TODO(misko): uncomment the next line once `ngDevMode` works with closure.\n // if (ngDevMode) debugger;\n const error = new Error(`NullInjectorError: No provider for ${stringify(token)}!`);\n error.name = 'NullInjectorError';\n throw error;\n }\n return notFoundValue;\n }\n}\nfunction catchInjectorError(e, token, injectorErrorName, source) {\n const tokenPath = e[NG_TEMP_TOKEN_PATH];\n if (token[SOURCE]) {\n tokenPath.unshift(token[SOURCE]);\n }\n e.message = formatError('\\n' + e.message, tokenPath, injectorErrorName, source);\n e[NG_TOKEN_PATH] = tokenPath;\n e[NG_TEMP_TOKEN_PATH] = null;\n throw e;\n}\nfunction formatError(text, obj, injectorErrorName, source = null) {\n text = text && text.charAt(0) === '\\n' && text.charAt(1) == NO_NEW_LINE ? text.substr(2) : text;\n let context = stringify(obj);\n if (Array.isArray(obj)) {\n context = obj.map(stringify).join(' -> ');\n }\n else if (typeof obj === 'object') {\n let parts = [];\n for (let key in obj) {\n if (obj.hasOwnProperty(key)) {\n let value = obj[key];\n parts.push(key + ':' + (typeof value === 'string' ? JSON.stringify(value) : stringify(value)));\n }\n }\n context = `{${parts.join(', ')}}`;\n }\n return `${injectorErrorName}${source ? '(' + source + ')' : ''}[${context}]: ${text.replace(NEW_LINE, '\\n ')}`;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A mapping of the @angular/core API surface used in generated expressions to the actual symbols.\n *\n * This should be kept up to date with the public exports of @angular/core.\n */\nconst angularCoreDiEnv = {\n 'ɵɵdefineInjectable': ɵɵdefineInjectable,\n 'ɵɵdefineInjector': ɵɵdefineInjector,\n 'ɵɵinject': ɵɵinject,\n 'ɵɵgetFactoryOf': getFactoryOf,\n 'ɵɵinvalidFactoryDep': ɵɵinvalidFactoryDep,\n};\nfunction getFactoryOf(type) {\n const typeAny = type;\n if (isForwardRef(type)) {\n return (() => {\n const factory = getFactoryOf(resolveForwardRef(typeAny));\n return factory ? factory() : null;\n });\n }\n const def = getInjectableDef(typeAny) || getInjectorDef(typeAny);\n if (!def || def.factory === undefined) {\n return null;\n }\n return def.factory;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Represents an instance of an `NgModule` created by an `NgModuleFactory`.\n * Provides access to the `NgModule` instance and related objects.\n *\n * @publicApi\n */\nclass NgModuleRef {\n}\n/**\n * @publicApi\n */\nclass NgModuleFactory {\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction assertNumber(actual, msg) {\n if (!(typeof actual === 'number')) {\n throwError(msg, typeof actual, 'number', '===');\n }\n}\nfunction assertNumberInRange(actual, minInclusive, maxInclusive) {\n assertNumber(actual, 'Expected a number');\n assertLessThanOrEqual(actual, maxInclusive, 'Expected number to be less than or equal to');\n assertGreaterThanOrEqual(actual, minInclusive, 'Expected number to be greater than or equal to');\n}\nfunction assertString(actual, msg) {\n if (!(typeof actual === 'string')) {\n throwError(msg, actual === null ? 'null' : typeof actual, 'string', '===');\n }\n}\nfunction assertEqual(actual, expected, msg) {\n if (!(actual == expected)) {\n throwError(msg, actual, expected, '==');\n }\n}\nfunction assertNotEqual(actual, expected, msg) {\n if (!(actual != expected)) {\n throwError(msg, actual, expected, '!=');\n }\n}\nfunction assertSame(actual, expected, msg) {\n if (!(actual === expected)) {\n throwError(msg, actual, expected, '===');\n }\n}\nfunction assertNotSame(actual, expected, msg) {\n if (!(actual !== expected)) {\n throwError(msg, actual, expected, '!==');\n }\n}\nfunction assertLessThan(actual, expected, msg) {\n if (!(actual < expected)) {\n throwError(msg, actual, expected, '<');\n }\n}\nfunction assertLessThanOrEqual(actual, expected, msg) {\n if (!(actual <= expected)) {\n throwError(msg, actual, expected, '<=');\n }\n}\nfunction assertGreaterThan(actual, expected, msg) {\n if (!(actual > expected)) {\n throwError(msg, actual, expected, '>');\n }\n}\nfunction assertGreaterThanOrEqual(actual, expected, msg) {\n if (!(actual >= expected)) {\n throwError(msg, actual, expected, '>=');\n }\n}\nfunction assertNotDefined(actual, msg) {\n if (actual != null) {\n throwError(msg, actual, null, '==');\n }\n}\nfunction assertDefined(actual, msg) {\n if (actual == null) {\n throwError(msg, actual, null, '!=');\n }\n}\nfunction throwError(msg, actual, expected, comparison) {\n throw new Error(`ASSERTION ERROR: ${msg}` +\n (comparison == null ? '' : ` [Expected=> ${expected} ${comparison} ${actual} <=Actual]`));\n}\nfunction assertDomNode(node) {\n // If we're in a worker, `Node` will not be defined.\n assertEqual((typeof Node !== 'undefined' && node instanceof Node) ||\n (typeof node === 'object' && node != null &&\n node.constructor.name === 'WebWorkerRenderNode'), true, `The provided value must be an instance of a DOM Node but got ${stringify(node)}`);\n}\nfunction assertDataInRange(arr, index) {\n const maxLen = arr ? arr.length : 0;\n assertLessThan(index, maxLen, `Index expected to be less than ${maxLen} but got ${index}`);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Equivalent to ES6 spread, add each item to an array.\n *\n * @param items The items to add\n * @param arr The array to which you want to add the items\n */\nfunction addAllToArray(items, arr) {\n for (let i = 0; i < items.length; i++) {\n arr.push(items[i]);\n }\n}\n/**\n * Flattens an array.\n */\nfunction flatten(list, dst) {\n if (dst === undefined)\n dst = list;\n for (let i = 0; i < list.length; i++) {\n let item = list[i];\n if (Array.isArray(item)) {\n // we need to inline it.\n if (dst === list) {\n // Our assumption that the list was already flat was wrong and\n // we need to clone flat since we need to write to it.\n dst = list.slice(0, i);\n }\n flatten(item, dst);\n }\n else if (dst !== list) {\n dst.push(item);\n }\n }\n return dst;\n}\nfunction deepForEach(input, fn) {\n input.forEach(value => Array.isArray(value) ? deepForEach(value, fn) : fn(value));\n}\nfunction addToArray(arr, index, value) {\n // perf: array.push is faster than array.splice!\n if (index >= arr.length) {\n arr.push(value);\n }\n else {\n arr.splice(index, 0, value);\n }\n}\nfunction removeFromArray(arr, index) {\n // perf: array.pop is faster than array.splice!\n if (index >= arr.length - 1) {\n return arr.pop();\n }\n else {\n return arr.splice(index, 1)[0];\n }\n}\nfunction newArray(size, value) {\n const list = [];\n for (let i = 0; i < size; i++) {\n list.push(value);\n }\n return list;\n}\n/**\n * Remove item from array (Same as `Array.splice()` but faster.)\n *\n * `Array.splice()` is not as fast because it has to allocate an array for the elements which were\n * removed. This causes memory pressure and slows down code when most of the time we don't\n * care about the deleted items array.\n *\n * https://jsperf.com/fast-array-splice (About 20x faster)\n *\n * @param array Array to splice\n * @param index Index of element in array to remove.\n * @param count Number of items to remove.\n */\nfunction arraySplice(array, index, count) {\n const length = array.length - count;\n while (index < length) {\n array[index] = array[index + count];\n index++;\n }\n while (count--) {\n array.pop(); // shrink the array\n }\n}\n/**\n * Same as `Array.splice(index, 0, value)` but faster.\n *\n * `Array.splice()` is not fast because it has to allocate an array for the elements which were\n * removed. This causes memory pressure and slows down code when most of the time we don't\n * care about the deleted items array.\n *\n * @param array Array to splice.\n * @param index Index in array where the `value` should be added.\n * @param value Value to add to array.\n */\nfunction arrayInsert(array, index, value) {\n ngDevMode && assertLessThanOrEqual(index, array.length, 'Can\\'t insert past array end.');\n let end = array.length;\n while (end > index) {\n const previousEnd = end - 1;\n array[end] = array[previousEnd];\n end = previousEnd;\n }\n array[index] = value;\n}\n/**\n * Same as `Array.splice2(index, 0, value1, value2)` but faster.\n *\n * `Array.splice()` is not fast because it has to allocate an array for the elements which were\n * removed. This causes memory pressure and slows down code when most of the time we don't\n * care about the deleted items array.\n *\n * @param array Array to splice.\n * @param index Index in array where the `value` should be added.\n * @param value1 Value to add to array.\n * @param value2 Value to add to array.\n */\nfunction arrayInsert2(array, index, value1, value2) {\n ngDevMode && assertLessThanOrEqual(index, array.length, 'Can\\'t insert past array end.');\n let end = array.length;\n if (end == index) {\n // inserting at the end.\n array.push(value1, value2);\n }\n else if (end === 1) {\n // corner case when we have less items in array than we have items to insert.\n array.push(value2, array[0]);\n array[0] = value1;\n }\n else {\n end--;\n array.push(array[end - 1], array[end]);\n while (end > index) {\n const previousEnd = end - 2;\n array[end] = array[previousEnd];\n end--;\n }\n array[index] = value1;\n array[index + 1] = value2;\n }\n}\n/**\n * Insert a `value` into an `array` so that the array remains sorted.\n *\n * NOTE:\n * - Duplicates are not allowed, and are ignored.\n * - This uses binary search algorithm for fast inserts.\n *\n * @param array A sorted array to insert into.\n * @param value The value to insert.\n * @returns index of the inserted value.\n */\nfunction arrayInsertSorted(array, value) {\n let index = arrayIndexOfSorted(array, value);\n if (index < 0) {\n // if we did not find it insert it.\n index = ~index;\n arrayInsert(array, index, value);\n }\n return index;\n}\n/**\n * Remove `value` from a sorted `array`.\n *\n * NOTE:\n * - This uses binary search algorithm for fast removals.\n *\n * @param array A sorted array to remove from.\n * @param value The value to remove.\n * @returns index of the removed value.\n * - positive index if value found and removed.\n * - negative index if value not found. (`~index` to get the value where it should have been\n * inserted)\n */\nfunction arrayRemoveSorted(array, value) {\n const index = arrayIndexOfSorted(array, value);\n if (index >= 0) {\n arraySplice(array, index, 1);\n }\n return index;\n}\n/**\n * Get an index of an `value` in a sorted `array`.\n *\n * NOTE:\n * - This uses binary search algorithm for fast removals.\n *\n * @param array A sorted array to binary search.\n * @param value The value to look for.\n * @returns index of the value.\n * - positive index if value found.\n * - negative index if value not found. (`~index` to get the value where it should have been\n * located)\n */\nfunction arrayIndexOfSorted(array, value) {\n return _arrayIndexOfSorted(array, value, 0);\n}\n/**\n * Set a `value` for a `key`.\n *\n * @param keyValueArray to modify.\n * @param key The key to locate or create.\n * @param value The value to set for a `key`.\n * @returns index (always even) of where the value vas set.\n */\nfunction keyValueArraySet(keyValueArray, key, value) {\n let index = keyValueArrayIndexOf(keyValueArray, key);\n if (index >= 0) {\n // if we found it set it.\n keyValueArray[index | 1] = value;\n }\n else {\n index = ~index;\n arrayInsert2(keyValueArray, index, key, value);\n }\n return index;\n}\n/**\n * Retrieve a `value` for a `key` (on `undefined` if not found.)\n *\n * @param keyValueArray to search.\n * @param key The key to locate.\n * @return The `value` stored at the `key` location or `undefined if not found.\n */\nfunction keyValueArrayGet(keyValueArray, key) {\n const index = keyValueArrayIndexOf(keyValueArray, key);\n if (index >= 0) {\n // if we found it retrieve it.\n return keyValueArray[index | 1];\n }\n return undefined;\n}\n/**\n * Retrieve a `key` index value in the array or `-1` if not found.\n *\n * @param keyValueArray to search.\n * @param key The key to locate.\n * @returns index of where the key is (or should have been.)\n * - positive (even) index if key found.\n * - negative index if key not found. (`~index` (even) to get the index where it should have\n * been inserted.)\n */\nfunction keyValueArrayIndexOf(keyValueArray, key) {\n return _arrayIndexOfSorted(keyValueArray, key, 1);\n}\n/**\n * Delete a `key` (and `value`) from the `KeyValueArray`.\n *\n * @param keyValueArray to modify.\n * @param key The key to locate or delete (if exist).\n * @returns index of where the key was (or should have been.)\n * - positive (even) index if key found and deleted.\n * - negative index if key not found. (`~index` (even) to get the index where it should have\n * been.)\n */\nfunction keyValueArrayDelete(keyValueArray, key) {\n const index = keyValueArrayIndexOf(keyValueArray, key);\n if (index >= 0) {\n // if we found it remove it.\n arraySplice(keyValueArray, index, 2);\n }\n return index;\n}\n/**\n * INTERNAL: Get an index of an `value` in a sorted `array` by grouping search by `shift`.\n *\n * NOTE:\n * - This uses binary search algorithm for fast removals.\n *\n * @param array A sorted array to binary search.\n * @param value The value to look for.\n * @param shift grouping shift.\n * - `0` means look at every location\n * - `1` means only look at every other (even) location (the odd locations are to be ignored as\n * they are values.)\n * @returns index of the value.\n * - positive index if value found.\n * - negative index if value not found. (`~index` to get the value where it should have been\n * inserted)\n */\nfunction _arrayIndexOfSorted(array, value, shift) {\n ngDevMode && assertEqual(Array.isArray(array), true, 'Expecting an array');\n let start = 0;\n let end = array.length >> shift;\n while (end !== start) {\n const middle = start + ((end - start) >> 1); // find the middle.\n const current = array[middle << shift];\n if (value === current) {\n return (middle << shift);\n }\n else if (current > value) {\n end = middle;\n }\n else {\n start = middle + 1; // We already searched middle so make it non-inclusive by adding 1\n }\n }\n return ~(end << shift);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * The strategy that the default change detector uses to detect changes.\n * When set, takes effect the next time change detection is triggered.\n *\n * @see {@link ChangeDetectorRef#usage-notes Change detection usage}\n *\n * @publicApi\n */\nvar ChangeDetectionStrategy;\n(function (ChangeDetectionStrategy) {\n /**\n * Use the `CheckOnce` strategy, meaning that automatic change detection is deactivated\n * until reactivated by setting the strategy to `Default` (`CheckAlways`).\n * Change detection can still be explicitly invoked.\n * This strategy applies to all child directives and cannot be overridden.\n */\n ChangeDetectionStrategy[ChangeDetectionStrategy[\"OnPush\"] = 0] = \"OnPush\";\n /**\n * Use the default `CheckAlways` strategy, in which change detection is automatic until\n * explicitly deactivated.\n */\n ChangeDetectionStrategy[ChangeDetectionStrategy[\"Default\"] = 1] = \"Default\";\n})(ChangeDetectionStrategy || (ChangeDetectionStrategy = {}));\n/**\n * Defines the possible states of the default change detector.\n * @see `ChangeDetectorRef`\n */\nvar ChangeDetectorStatus;\n(function (ChangeDetectorStatus) {\n /**\n * A state in which, after calling `detectChanges()`, the change detector\n * state becomes `Checked`, and must be explicitly invoked or reactivated.\n */\n ChangeDetectorStatus[ChangeDetectorStatus[\"CheckOnce\"] = 0] = \"CheckOnce\";\n /**\n * A state in which change detection is skipped until the change detector mode\n * becomes `CheckOnce`.\n */\n ChangeDetectorStatus[ChangeDetectorStatus[\"Checked\"] = 1] = \"Checked\";\n /**\n * A state in which change detection continues automatically until explicitly\n * deactivated.\n */\n ChangeDetectorStatus[ChangeDetectorStatus[\"CheckAlways\"] = 2] = \"CheckAlways\";\n /**\n * A state in which a change detector sub tree is not a part of the main tree and\n * should be skipped.\n */\n ChangeDetectorStatus[ChangeDetectorStatus[\"Detached\"] = 3] = \"Detached\";\n /**\n * Indicates that the change detector encountered an error checking a binding\n * or calling a directive lifecycle method and is now in an inconsistent state. Change\n * detectors in this state do not detect changes.\n */\n ChangeDetectorStatus[ChangeDetectorStatus[\"Errored\"] = 4] = \"Errored\";\n /**\n * Indicates that the change detector has been destroyed.\n */\n ChangeDetectorStatus[ChangeDetectorStatus[\"Destroyed\"] = 5] = \"Destroyed\";\n})(ChangeDetectorStatus || (ChangeDetectorStatus = {}));\n/**\n * Reports whether a given strategy is currently the default for change detection.\n * @param changeDetectionStrategy The strategy to check.\n * @returns True if the given strategy is the current default, false otherwise.\n * @see `ChangeDetectorStatus`\n * @see `ChangeDetectorRef`\n */\nfunction isDefaultChangeDetectionStrategy(changeDetectionStrategy) {\n return changeDetectionStrategy == null ||\n changeDetectionStrategy === ChangeDetectionStrategy.Default;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Defines template and style encapsulation options available for Component's {@link Component}.\n *\n * See {@link Component#encapsulation encapsulation}.\n *\n * @usageNotes\n * ### Example\n *\n * {@example core/ts/metadata/encapsulation.ts region='longform'}\n *\n * @publicApi\n */\nvar ViewEncapsulation$1;\n(function (ViewEncapsulation) {\n /**\n * Emulate `Native` scoping of styles by adding an attribute containing surrogate id to the Host\n * Element and pre-processing the style rules provided via {@link Component#styles styles} or\n * {@link Component#styleUrls styleUrls}, and adding the new Host Element attribute to all\n * selectors.\n *\n * This is the default option.\n */\n ViewEncapsulation[ViewEncapsulation[\"Emulated\"] = 0] = \"Emulated\";\n /**\n * @deprecated v6.1.0 - use {ViewEncapsulation.ShadowDom} instead.\n * Use the native encapsulation mechanism of the renderer.\n *\n * For the DOM this means using the deprecated [Shadow DOM\n * v0](https://w3c.github.io/webcomponents/spec/shadow/) and\n * creating a ShadowRoot for Component's Host Element.\n */\n ViewEncapsulation[ViewEncapsulation[\"Native\"] = 1] = \"Native\";\n /**\n * Don't provide any template or style encapsulation.\n */\n ViewEncapsulation[ViewEncapsulation[\"None\"] = 2] = \"None\";\n /**\n * Use Shadow DOM to encapsulate styles.\n *\n * For the DOM this means using modern [Shadow\n * DOM](https://w3c.github.io/webcomponents/spec/shadow/) and\n * creating a ShadowRoot for Component's Host Element.\n */\n ViewEncapsulation[ViewEncapsulation[\"ShadowDom\"] = 3] = \"ShadowDom\";\n})(ViewEncapsulation$1 || (ViewEncapsulation$1 = {}));\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * This file contains reuseable \"empty\" symbols that can be used as default return values\n * in different parts of the rendering code. Because the same symbols are returned, this\n * allows for identity checks against these values to be consistently used by the framework\n * code.\n */\nconst EMPTY_OBJ = {};\nconst EMPTY_ARRAY = [];\n// freezing the values prevents any code from accidentally inserting new values in\nif ((typeof ngDevMode === 'undefined' || ngDevMode) && initNgDevMode()) {\n // These property accesses can be ignored because ngDevMode will be set to false\n // when optimizing code and the whole if statement will be dropped.\n // tslint:disable-next-line:no-toplevel-property-access\n Object.freeze(EMPTY_OBJ);\n // tslint:disable-next-line:no-toplevel-property-access\n Object.freeze(EMPTY_ARRAY);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nlet _renderCompCount = 0;\n/**\n * Create a component definition object.\n *\n *\n * # Example\n * ```\n * class MyDirective {\n * // Generated by Angular Template Compiler\n * // [Symbol] syntax will not be supported by TypeScript until v2.7\n * static ɵcmp = defineComponent({\n * ...\n * });\n * }\n * ```\n * @codeGenApi\n */\nfunction ɵɵdefineComponent(componentDefinition) {\n return noSideEffects(() => {\n // Initialize ngDevMode. This must be the first statement in ɵɵdefineComponent.\n // See the `initNgDevMode` docstring for more information.\n (typeof ngDevMode === 'undefined' || ngDevMode) && initNgDevMode();\n const type = componentDefinition.type;\n const typePrototype = type.prototype;\n const declaredInputs = {};\n const def = {\n type: type,\n providersResolver: null,\n decls: componentDefinition.decls,\n vars: componentDefinition.vars,\n factory: null,\n template: componentDefinition.template || null,\n consts: componentDefinition.consts || null,\n ngContentSelectors: componentDefinition.ngContentSelectors,\n hostBindings: componentDefinition.hostBindings || null,\n hostVars: componentDefinition.hostVars || 0,\n hostAttrs: componentDefinition.hostAttrs || null,\n contentQueries: componentDefinition.contentQueries || null,\n declaredInputs: declaredInputs,\n inputs: null,\n outputs: null,\n exportAs: componentDefinition.exportAs || null,\n onPush: componentDefinition.changeDetection === ChangeDetectionStrategy.OnPush,\n directiveDefs: null,\n pipeDefs: null,\n selectors: componentDefinition.selectors || EMPTY_ARRAY,\n viewQuery: componentDefinition.viewQuery || null,\n features: componentDefinition.features || null,\n data: componentDefinition.data || {},\n // TODO(misko): convert ViewEncapsulation into const enum so that it can be used\n // directly in the next line. Also `None` should be 0 not 2.\n encapsulation: componentDefinition.encapsulation || ViewEncapsulation$1.Emulated,\n id: 'c',\n styles: componentDefinition.styles || EMPTY_ARRAY,\n _: null,\n setInput: null,\n schemas: componentDefinition.schemas || null,\n tView: null,\n };\n const directiveTypes = componentDefinition.directives;\n const feature = componentDefinition.features;\n const pipeTypes = componentDefinition.pipes;\n def.id += _renderCompCount++;\n def.inputs = invertObject(componentDefinition.inputs, declaredInputs),\n def.outputs = invertObject(componentDefinition.outputs),\n feature && feature.forEach((fn) => fn(def));\n def.directiveDefs = directiveTypes ?\n () => (typeof directiveTypes === 'function' ? directiveTypes() : directiveTypes)\n .map(extractDirectiveDef) :\n null;\n def.pipeDefs = pipeTypes ?\n () => (typeof pipeTypes === 'function' ? pipeTypes() : pipeTypes).map(extractPipeDef) :\n null;\n return def;\n });\n}\n/**\n * @codeGenApi\n */\nfunction ɵɵsetComponentScope(type, directives, pipes) {\n const def = type.ɵcmp;\n def.directiveDefs = () => directives.map(extractDirectiveDef);\n def.pipeDefs = () => pipes.map(extractPipeDef);\n}\nfunction extractDirectiveDef(type) {\n const def = getComponentDef(type) || getDirectiveDef(type);\n if (ngDevMode && !def) {\n throw new Error(`'${type.name}' is neither 'ComponentType' or 'DirectiveType'.`);\n }\n return def;\n}\nfunction extractPipeDef(type) {\n const def = getPipeDef(type);\n if (ngDevMode && !def) {\n throw new Error(`'${type.name}' is not a 'PipeType'.`);\n }\n return def;\n}\nconst autoRegisterModuleById = {};\n/**\n * @codeGenApi\n */\nfunction ɵɵdefineNgModule(def) {\n const res = {\n type: def.type,\n bootstrap: def.bootstrap || EMPTY_ARRAY,\n declarations: def.declarations || EMPTY_ARRAY,\n imports: def.imports || EMPTY_ARRAY,\n exports: def.exports || EMPTY_ARRAY,\n transitiveCompileScopes: null,\n schemas: def.schemas || null,\n id: def.id || null,\n };\n if (def.id != null) {\n noSideEffects(() => {\n autoRegisterModuleById[def.id] = def.type;\n });\n }\n return res;\n}\n/**\n * Adds the module metadata that is necessary to compute the module's transitive scope to an\n * existing module definition.\n *\n * Scope metadata of modules is not used in production builds, so calls to this function can be\n * marked pure to tree-shake it from the bundle, allowing for all referenced declarations\n * to become eligible for tree-shaking as well.\n *\n * @codeGenApi\n */\nfunction ɵɵsetNgModuleScope(type, scope) {\n return noSideEffects(() => {\n const ngModuleDef = getNgModuleDef(type, true);\n ngModuleDef.declarations = scope.declarations || EMPTY_ARRAY;\n ngModuleDef.imports = scope.imports || EMPTY_ARRAY;\n ngModuleDef.exports = scope.exports || EMPTY_ARRAY;\n });\n}\n/**\n * Inverts an inputs or outputs lookup such that the keys, which were the\n * minified keys, are part of the values, and the values are parsed so that\n * the publicName of the property is the new key\n *\n * e.g. for\n *\n * ```\n * class Comp {\n * @Input()\n * propName1: string;\n *\n * @Input('publicName2')\n * declaredPropName2: number;\n * }\n * ```\n *\n * will be serialized as\n *\n * ```\n * {\n * propName1: 'propName1',\n * declaredPropName2: ['publicName2', 'declaredPropName2'],\n * }\n * ```\n *\n * which is than translated by the minifier as:\n *\n * ```\n * {\n * minifiedPropName1: 'propName1',\n * minifiedPropName2: ['publicName2', 'declaredPropName2'],\n * }\n * ```\n *\n * becomes: (public name => minifiedName)\n *\n * ```\n * {\n * 'propName1': 'minifiedPropName1',\n * 'publicName2': 'minifiedPropName2',\n * }\n * ```\n *\n * Optionally the function can take `secondary` which will result in: (public name => declared name)\n *\n * ```\n * {\n * 'propName1': 'propName1',\n * 'publicName2': 'declaredPropName2',\n * }\n * ```\n *\n\n */\nfunction invertObject(obj, secondary) {\n if (obj == null)\n return EMPTY_OBJ;\n const newLookup = {};\n for (const minifiedKey in obj) {\n if (obj.hasOwnProperty(minifiedKey)) {\n let publicName = obj[minifiedKey];\n let declaredName = publicName;\n if (Array.isArray(publicName)) {\n declaredName = publicName[1];\n publicName = publicName[0];\n }\n newLookup[publicName] = minifiedKey;\n if (secondary) {\n (secondary[publicName] = declaredName);\n }\n }\n }\n return newLookup;\n}\n/**\n * Create a directive definition object.\n *\n * # Example\n * ```ts\n * class MyDirective {\n * // Generated by Angular Template Compiler\n * // [Symbol] syntax will not be supported by TypeScript until v2.7\n * static ɵdir = ɵɵdefineDirective({\n * ...\n * });\n * }\n * ```\n *\n * @codeGenApi\n */\nconst ɵɵdefineDirective = ɵɵdefineComponent;\n/**\n * Create a pipe definition object.\n *\n * # Example\n * ```\n * class MyPipe implements PipeTransform {\n * // Generated by Angular Template Compiler\n * static ɵpipe = definePipe({\n * ...\n * });\n * }\n * ```\n * @param pipeDef Pipe definition generated by the compiler\n *\n * @codeGenApi\n */\nfunction ɵɵdefinePipe(pipeDef) {\n return {\n type: pipeDef.type,\n name: pipeDef.name,\n factory: null,\n pure: pipeDef.pure !== false,\n onDestroy: pipeDef.type.prototype.ngOnDestroy || null\n };\n}\n/**\n * The following getter methods retrieve the definition form the type. Currently the retrieval\n * honors inheritance, but in the future we may change the rule to require that definitions are\n * explicit. This would require some sort of migration strategy.\n */\nfunction getComponentDef(type) {\n return type[NG_COMP_DEF] || null;\n}\nfunction getDirectiveDef(type) {\n return type[NG_DIR_DEF] || null;\n}\nfunction getPipeDef(type) {\n return type[NG_PIPE_DEF] || null;\n}\nfunction getFactoryDef(type, throwNotFound) {\n const hasFactoryDef = type.hasOwnProperty(NG_FACTORY_DEF);\n if (!hasFactoryDef && throwNotFound === true && ngDevMode) {\n throw new Error(`Type ${stringify(type)} does not have 'ɵfac' property.`);\n }\n return hasFactoryDef ? type[NG_FACTORY_DEF] : null;\n}\nfunction getNgModuleDef(type, throwNotFound) {\n const ngModuleDef = type[NG_MOD_DEF] || null;\n if (!ngModuleDef && throwNotFound === true) {\n throw new Error(`Type ${stringify(type)} does not have 'ɵmod' property.`);\n }\n return ngModuleDef;\n}\nfunction getNgLocaleIdDef(type) {\n return type[NG_LOC_ID_DEF] || null;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// Below are constants for LView indices to help us look up LView members\n// without having to remember the specific indices.\n// Uglify will inline these when minifying so there shouldn't be a cost.\nconst HOST = 0;\nconst TVIEW = 1;\nconst FLAGS = 2;\nconst PARENT = 3;\nconst NEXT = 4;\nconst TRANSPLANTED_VIEWS_TO_REFRESH = 5;\nconst T_HOST = 6;\nconst CLEANUP = 7;\nconst CONTEXT = 8;\nconst INJECTOR$1 = 9;\nconst RENDERER_FACTORY = 10;\nconst RENDERER = 11;\nconst SANITIZER = 12;\nconst CHILD_HEAD = 13;\nconst CHILD_TAIL = 14;\nconst DECLARATION_VIEW = 15;\nconst DECLARATION_COMPONENT_VIEW = 16;\nconst DECLARATION_LCONTAINER = 17;\nconst PREORDER_HOOK_FLAGS = 18;\nconst QUERIES = 19;\n/** Size of LView's header. Necessary to adjust for it when setting slots. */\nconst HEADER_OFFSET = 20;\n// Note: This hack is necessary so we don't erroneously get a circular dependency\n// failure based on types.\nconst unusedValueExportToPlacateAjd = 1;\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Special location which allows easy identification of type. If we have an array which was\n * retrieved from the `LView` and that array has `true` at `TYPE` location, we know it is\n * `LContainer`.\n */\nconst TYPE = 1;\n/**\n * Below are constants for LContainer indices to help us look up LContainer members\n * without having to remember the specific indices.\n * Uglify will inline these when minifying so there shouldn't be a cost.\n */\n/**\n * Flag to signify that this `LContainer` may have transplanted views which need to be change\n * detected. (see: `LView[DECLARATION_COMPONENT_VIEW])`.\n *\n * This flag, once set, is never unset for the `LContainer`. This means that when unset we can skip\n * a lot of work in `refreshEmbeddedViews`. But when set we still need to verify\n * that the `MOVED_VIEWS` are transplanted and on-push.\n */\nconst HAS_TRANSPLANTED_VIEWS = 2;\n// PARENT, NEXT, TRANSPLANTED_VIEWS_TO_REFRESH are indices 3, 4, and 5\n// As we already have these constants in LView, we don't need to re-create them.\n// T_HOST is index 6\n// We already have this constants in LView, we don't need to re-create it.\nconst NATIVE = 7;\nconst VIEW_REFS = 8;\nconst MOVED_VIEWS = 9;\n/**\n * Size of LContainer's header. Represents the index after which all views in the\n * container will be inserted. We need to keep a record of current views so we know\n * which views are already in the DOM (and don't need to be re-added) and so we can\n * remove views from the DOM when they are no longer required.\n */\nconst CONTAINER_HEADER_OFFSET = 10;\n// Note: This hack is necessary so we don't erroneously get a circular dependency\n// failure based on types.\nconst unusedValueExportToPlacateAjd$1 = 1;\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * True if `value` is `LView`.\n * @param value wrapped value of `RNode`, `LView`, `LContainer`\n */\nfunction isLView(value) {\n return Array.isArray(value) && typeof value[TYPE] === 'object';\n}\n/**\n * True if `value` is `LContainer`.\n * @param value wrapped value of `RNode`, `LView`, `LContainer`\n */\nfunction isLContainer(value) {\n return Array.isArray(value) && value[TYPE] === true;\n}\nfunction isContentQueryHost(tNode) {\n return (tNode.flags & 8 /* hasContentQuery */) !== 0;\n}\nfunction isComponentHost(tNode) {\n return (tNode.flags & 2 /* isComponentHost */) === 2 /* isComponentHost */;\n}\nfunction isDirectiveHost(tNode) {\n return (tNode.flags & 1 /* isDirectiveHost */) === 1 /* isDirectiveHost */;\n}\nfunction isComponentDef(def) {\n return def.template !== null;\n}\nfunction isRootView(target) {\n return (target[FLAGS] & 512 /* IsRoot */) !== 0;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// [Assert functions do not constraint type when they are guarded by a truthy\n// expression.](https://github.com/microsoft/TypeScript/issues/37295)\nfunction assertTNodeForLView(tNode, lView) {\n tNode.hasOwnProperty('tView_') &&\n assertEqual(tNode.tView_, lView[TVIEW], 'This TNode does not belong to this LView.');\n}\nfunction assertComponentType(actual, msg = 'Type passed in is not ComponentType, it does not have \\'ɵcmp\\' property.') {\n if (!getComponentDef(actual)) {\n throwError(msg);\n }\n}\nfunction assertNgModuleType(actual, msg = 'Type passed in is not NgModuleType, it does not have \\'ɵmod\\' property.') {\n if (!getNgModuleDef(actual)) {\n throwError(msg);\n }\n}\nfunction assertPreviousIsParent(isParent) {\n assertEqual(isParent, true, 'previousOrParentTNode should be a parent');\n}\nfunction assertHasParent(tNode) {\n assertDefined(tNode, 'previousOrParentTNode should exist!');\n assertDefined(tNode.parent, 'previousOrParentTNode should have a parent');\n}\nfunction assertDataNext(lView, index, arr) {\n if (arr == null)\n arr = lView;\n assertEqual(arr.length, index, `index ${index} expected to be at the end of arr (length ${arr.length})`);\n}\nfunction assertLContainer(value) {\n assertDefined(value, 'LContainer must be defined');\n assertEqual(isLContainer(value), true, 'Expecting LContainer');\n}\nfunction assertLViewOrUndefined(value) {\n value && assertEqual(isLView(value), true, 'Expecting LView or undefined or null');\n}\nfunction assertLView(value) {\n assertDefined(value, 'LView must be defined');\n assertEqual(isLView(value), true, 'Expecting LView');\n}\nfunction assertFirstCreatePass(tView, errMessage) {\n assertEqual(tView.firstCreatePass, true, errMessage || 'Should only be called in first create pass.');\n}\nfunction assertFirstUpdatePass(tView, errMessage) {\n assertEqual(tView.firstUpdatePass, true, errMessage || 'Should only be called in first update pass.');\n}\n/**\n * This is a basic sanity check that an object is probably a directive def. DirectiveDef is\n * an interface, so we can't do a direct instanceof check.\n */\nfunction assertDirectiveDef(obj) {\n if (obj.type === undefined || obj.selectors == undefined || obj.inputs === undefined) {\n throwError(`Expected a DirectiveDef/ComponentDef and this object does not seem to have the expected shape.`);\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Represents a basic change from a previous to a new value for a single\n * property on a directive instance. Passed as a value in a\n * {@link SimpleChanges} object to the `ngOnChanges` hook.\n *\n * @see `OnChanges`\n *\n * @publicApi\n */\nclass SimpleChange {\n constructor(previousValue, currentValue, firstChange) {\n this.previousValue = previousValue;\n this.currentValue = currentValue;\n this.firstChange = firstChange;\n }\n /**\n * Check whether the new value is the first value assigned.\n */\n isFirstChange() {\n return this.firstChange;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * The NgOnChangesFeature decorates a component with support for the ngOnChanges\n * lifecycle hook, so it should be included in any component that implements\n * that hook.\n *\n * If the component or directive uses inheritance, the NgOnChangesFeature MUST\n * be included as a feature AFTER {@link InheritDefinitionFeature}, otherwise\n * inherited properties will not be propagated to the ngOnChanges lifecycle\n * hook.\n *\n * Example usage:\n *\n * ```\n * static ɵcmp = defineComponent({\n * ...\n * inputs: {name: 'publicName'},\n * features: [NgOnChangesFeature]\n * });\n * ```\n *\n * @codeGenApi\n */\nfunction ɵɵNgOnChangesFeature() {\n return NgOnChangesFeatureImpl;\n}\nfunction NgOnChangesFeatureImpl(definition) {\n if (definition.type.prototype.ngOnChanges) {\n definition.setInput = ngOnChangesSetInput;\n }\n return rememberChangeHistoryAndInvokeOnChangesHook;\n}\n// This option ensures that the ngOnChanges lifecycle hook will be inherited\n// from superclasses (in InheritDefinitionFeature).\n/** @nocollapse */\n// tslint:disable-next-line:no-toplevel-property-access\nɵɵNgOnChangesFeature.ngInherit = true;\n/**\n * This is a synthetic lifecycle hook which gets inserted into `TView.preOrderHooks` to simulate\n * `ngOnChanges`.\n *\n * The hook reads the `NgSimpleChangesStore` data from the component instance and if changes are\n * found it invokes `ngOnChanges` on the component instance.\n *\n * @param this Component instance. Because this function gets inserted into `TView.preOrderHooks`,\n * it is guaranteed to be called with component instance.\n */\nfunction rememberChangeHistoryAndInvokeOnChangesHook() {\n const simpleChangesStore = getSimpleChangesStore(this);\n const current = simpleChangesStore === null || simpleChangesStore === void 0 ? void 0 : simpleChangesStore.current;\n if (current) {\n const previous = simpleChangesStore.previous;\n if (previous === EMPTY_OBJ) {\n simpleChangesStore.previous = current;\n }\n else {\n // New changes are copied to the previous store, so that we don't lose history for inputs\n // which were not changed this time\n for (let key in current) {\n previous[key] = current[key];\n }\n }\n simpleChangesStore.current = null;\n this.ngOnChanges(current);\n }\n}\nfunction ngOnChangesSetInput(instance, value, publicName, privateName) {\n const simpleChangesStore = getSimpleChangesStore(instance) ||\n setSimpleChangesStore(instance, { previous: EMPTY_OBJ, current: null });\n const current = simpleChangesStore.current || (simpleChangesStore.current = {});\n const previous = simpleChangesStore.previous;\n const declaredName = this.declaredInputs[publicName];\n const previousChange = previous[declaredName];\n current[declaredName] = new SimpleChange(previousChange && previousChange.currentValue, value, previous === EMPTY_OBJ);\n instance[privateName] = value;\n}\nconst SIMPLE_CHANGES_STORE = '__ngSimpleChanges__';\nfunction getSimpleChangesStore(instance) {\n return instance[SIMPLE_CHANGES_STORE] || null;\n}\nfunction setSimpleChangesStore(instance, store) {\n return instance[SIMPLE_CHANGES_STORE] = store;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst SVG_NAMESPACE = 'http://www.w3.org/2000/svg';\nconst MATH_ML_NAMESPACE = 'http://www.w3.org/1998/MathML/';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * This property will be monkey-patched on elements, components and directives\n */\nconst MONKEY_PATCH_KEY_NAME = '__ngContext__';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Most of the use of `document` in Angular is from within the DI system so it is possible to simply\n * inject the `DOCUMENT` token and are done.\n *\n * Ivy is special because it does not rely upon the DI and must get hold of the document some other\n * way.\n *\n * The solution is to define `getDocument()` and `setDocument()` top-level functions for ivy.\n * Wherever ivy needs the global document, it calls `getDocument()` instead.\n *\n * When running ivy outside of a browser environment, it is necessary to call `setDocument()` to\n * tell ivy what the global `document` is.\n *\n * Angular does this for us in each of the standard platforms (`Browser`, `Server`, and `WebWorker`)\n * by calling `setDocument()` when providing the `DOCUMENT` token.\n */\nlet DOCUMENT = undefined;\n/**\n * Tell ivy what the `document` is for this platform.\n *\n * It is only necessary to call this if the current platform is not a browser.\n *\n * @param document The object representing the global `document` in this environment.\n */\nfunction setDocument(document) {\n DOCUMENT = document;\n}\n/**\n * Access the object that represents the `document` for this platform.\n *\n * Ivy calls this whenever it needs to access the `document` object.\n * For example to create the renderer or to do sanitization.\n */\nfunction getDocument() {\n if (DOCUMENT !== undefined) {\n return DOCUMENT;\n }\n else if (typeof document !== 'undefined') {\n return document;\n }\n // No \"document\" can be found. This should only happen if we are running ivy outside Angular and\n // the current platform is not a browser. Since this is not a supported scenario at the moment\n // this should not happen in Angular apps.\n // Once we support running ivy outside of Angular we will need to publish `setDocument()` as a\n // public API. Meanwhile we just return `undefined` and let the application fail.\n return undefined;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// TODO: cleanup once the code is merged in angular/angular\nvar RendererStyleFlags3;\n(function (RendererStyleFlags3) {\n RendererStyleFlags3[RendererStyleFlags3[\"Important\"] = 1] = \"Important\";\n RendererStyleFlags3[RendererStyleFlags3[\"DashCase\"] = 2] = \"DashCase\";\n})(RendererStyleFlags3 || (RendererStyleFlags3 = {}));\n/** Returns whether the `renderer` is a `ProceduralRenderer3` */\nfunction isProceduralRenderer(renderer) {\n return !!(renderer.listen);\n}\nconst ɵ0$2 = (hostElement, rendererType) => {\n return getDocument();\n};\nconst domRendererFactory3 = {\n createRenderer: ɵ0$2\n};\n// Note: This hack is necessary so we don't erroneously get a circular dependency\n// failure based on types.\nconst unusedValueExportToPlacateAjd$2 = 1;\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * For efficiency reasons we often put several different data types (`RNode`, `LView`, `LContainer`)\n * in same location in `LView`. This is because we don't want to pre-allocate space for it\n * because the storage is sparse. This file contains utilities for dealing with such data types.\n *\n * How do we know what is stored at a given location in `LView`.\n * - `Array.isArray(value) === false` => `RNode` (The normal storage value)\n * - `Array.isArray(value) === true` => then the `value[0]` represents the wrapped value.\n * - `typeof value[TYPE] === 'object'` => `LView`\n * - This happens when we have a component at a given location\n * - `typeof value[TYPE] === true` => `LContainer`\n * - This happens when we have `LContainer` binding at a given location.\n *\n *\n * NOTE: it is assumed that `Array.isArray` and `typeof` operations are very efficient.\n */\n/**\n * Returns `RNode`.\n * @param value wrapped value of `RNode`, `LView`, `LContainer`\n */\nfunction unwrapRNode(value) {\n while (Array.isArray(value)) {\n value = value[HOST];\n }\n return value;\n}\n/**\n * Returns `LView` or `null` if not found.\n * @param value wrapped value of `RNode`, `LView`, `LContainer`\n */\nfunction unwrapLView(value) {\n while (Array.isArray(value)) {\n // This check is same as `isLView()` but we don't call at as we don't want to call\n // `Array.isArray()` twice and give JITer more work for inlining.\n if (typeof value[TYPE] === 'object')\n return value;\n value = value[HOST];\n }\n return null;\n}\n/**\n * Returns `LContainer` or `null` if not found.\n * @param value wrapped value of `RNode`, `LView`, `LContainer`\n */\nfunction unwrapLContainer(value) {\n while (Array.isArray(value)) {\n // This check is same as `isLContainer()` but we don't call at as we don't want to call\n // `Array.isArray()` twice and give JITer more work for inlining.\n if (value[TYPE] === true)\n return value;\n value = value[HOST];\n }\n return null;\n}\n/**\n * Retrieves an element value from the provided `viewData`, by unwrapping\n * from any containers, component views, or style contexts.\n */\nfunction getNativeByIndex(index, lView) {\n return unwrapRNode(lView[index + HEADER_OFFSET]);\n}\n/**\n * Retrieve an `RNode` for a given `TNode` and `LView`.\n *\n * This function guarantees in dev mode to retrieve a non-null `RNode`.\n *\n * @param tNode\n * @param lView\n */\nfunction getNativeByTNode(tNode, lView) {\n ngDevMode && assertTNodeForLView(tNode, lView);\n ngDevMode && assertDataInRange(lView, tNode.index);\n const node = unwrapRNode(lView[tNode.index]);\n ngDevMode && !isProceduralRenderer(lView[RENDERER]) && assertDomNode(node);\n return node;\n}\n/**\n * Retrieve an `RNode` or `null` for a given `TNode` and `LView`.\n *\n * Some `TNode`s don't have associated `RNode`s. For example `Projection`\n *\n * @param tNode\n * @param lView\n */\nfunction getNativeByTNodeOrNull(tNode, lView) {\n const index = tNode.index;\n if (index !== -1) {\n ngDevMode && assertTNodeForLView(tNode, lView);\n const node = unwrapRNode(lView[index]);\n ngDevMode && node !== null && !isProceduralRenderer(lView[RENDERER]) && assertDomNode(node);\n return node;\n }\n return null;\n}\nfunction getTNode(tView, index) {\n ngDevMode && assertGreaterThan(index, -1, 'wrong index for TNode');\n ngDevMode && assertLessThan(index, tView.data.length, 'wrong index for TNode');\n return tView.data[index + HEADER_OFFSET];\n}\n/** Retrieves a value from any `LView` or `TData`. */\nfunction load(view, index) {\n ngDevMode && assertDataInRange(view, index + HEADER_OFFSET);\n return view[index + HEADER_OFFSET];\n}\nfunction getComponentLViewByIndex(nodeIndex, hostView) {\n // Could be an LView or an LContainer. If LContainer, unwrap to find LView.\n ngDevMode && assertDataInRange(hostView, nodeIndex);\n const slotValue = hostView[nodeIndex];\n const lView = isLView(slotValue) ? slotValue : slotValue[HOST];\n return lView;\n}\n/**\n * Returns the monkey-patch value data present on the target (which could be\n * a component, directive or a DOM node).\n */\nfunction readPatchedData(target) {\n ngDevMode && assertDefined(target, 'Target expected');\n return target[MONKEY_PATCH_KEY_NAME] || null;\n}\nfunction readPatchedLView(target) {\n const value = readPatchedData(target);\n if (value) {\n return Array.isArray(value) ? value : value.lView;\n }\n return null;\n}\n/** Checks whether a given view is in creation mode */\nfunction isCreationMode(view) {\n return (view[FLAGS] & 4 /* CreationMode */) === 4 /* CreationMode */;\n}\n/**\n * Returns a boolean for whether the view is attached to the change detection tree.\n *\n * Note: This determines whether a view should be checked, not whether it's inserted\n * into a container. For that, you'll want `viewAttachedToContainer` below.\n */\nfunction viewAttachedToChangeDetector(view) {\n return (view[FLAGS] & 128 /* Attached */) === 128 /* Attached */;\n}\n/** Returns a boolean for whether the view is attached to a container. */\nfunction viewAttachedToContainer(view) {\n return isLContainer(view[PARENT]);\n}\n/** Returns a constant from `TConstants` instance. */\nfunction getConstant(consts, index) {\n return consts === null || index == null ? null : consts[index];\n}\n/**\n * Resets the pre-order hook flags of the view.\n * @param lView the LView on which the flags are reset\n */\nfunction resetPreOrderHookFlags(lView) {\n lView[PREORDER_HOOK_FLAGS] = 0;\n}\n/**\n * Updates the `TRANSPLANTED_VIEWS_TO_REFRESH` counter on the `LContainer` as well as the parents\n * whose\n * 1. counter goes from 0 to 1, indicating that there is a new child that has a view to refresh\n * or\n * 2. counter goes from 1 to 0, indicating there are no more descendant views to refresh\n */\nfunction updateTransplantedViewCount(lContainer, amount) {\n lContainer[TRANSPLANTED_VIEWS_TO_REFRESH] += amount;\n let viewOrContainer = lContainer;\n let parent = lContainer[PARENT];\n while (parent !== null &&\n ((amount === 1 && viewOrContainer[TRANSPLANTED_VIEWS_TO_REFRESH] === 1) ||\n (amount === -1 && viewOrContainer[TRANSPLANTED_VIEWS_TO_REFRESH] === 0))) {\n parent[TRANSPLANTED_VIEWS_TO_REFRESH] += amount;\n viewOrContainer = parent;\n parent = parent[PARENT];\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst instructionState = {\n lFrame: createLFrame(null),\n bindingsEnabled: true,\n checkNoChangesMode: false,\n};\nfunction getElementDepthCount() {\n return instructionState.lFrame.elementDepthCount;\n}\nfunction increaseElementDepthCount() {\n instructionState.lFrame.elementDepthCount++;\n}\nfunction decreaseElementDepthCount() {\n instructionState.lFrame.elementDepthCount--;\n}\nfunction getBindingsEnabled() {\n return instructionState.bindingsEnabled;\n}\n/**\n * Enables directive matching on elements.\n *\n * * Example:\n * ```\n * \n * Should match component / directive.\n * \n *
    \n * \n * \n * Should not match component / directive because we are in ngNonBindable.\n * \n * \n *
    \n * ```\n *\n * @codeGenApi\n */\nfunction ɵɵenableBindings() {\n instructionState.bindingsEnabled = true;\n}\n/**\n * Disables directive matching on element.\n *\n * * Example:\n * ```\n * \n * Should match component / directive.\n * \n *
    \n * \n * \n * Should not match component / directive because we are in ngNonBindable.\n * \n * \n *
    \n * ```\n *\n * @codeGenApi\n */\nfunction ɵɵdisableBindings() {\n instructionState.bindingsEnabled = false;\n}\n/**\n * Return the current `LView`.\n */\nfunction getLView() {\n return instructionState.lFrame.lView;\n}\n/**\n * Return the current `TView`.\n */\nfunction getTView() {\n return instructionState.lFrame.tView;\n}\n/**\n * Restores `contextViewData` to the given OpaqueViewState instance.\n *\n * Used in conjunction with the getCurrentView() instruction to save a snapshot\n * of the current view and restore it when listeners are invoked. This allows\n * walking the declaration view tree in listeners to get vars from parent views.\n *\n * @param viewToRestore The OpaqueViewState instance to restore.\n *\n * @codeGenApi\n */\nfunction ɵɵrestoreView(viewToRestore) {\n instructionState.lFrame.contextLView = viewToRestore;\n}\nfunction getPreviousOrParentTNode() {\n return instructionState.lFrame.previousOrParentTNode;\n}\nfunction setPreviousOrParentTNode(tNode, isParent) {\n instructionState.lFrame.previousOrParentTNode = tNode;\n instructionState.lFrame.isParent = isParent;\n}\nfunction getIsParent() {\n return instructionState.lFrame.isParent;\n}\nfunction setIsNotParent() {\n instructionState.lFrame.isParent = false;\n}\nfunction setIsParent() {\n instructionState.lFrame.isParent = true;\n}\nfunction getContextLView() {\n return instructionState.lFrame.contextLView;\n}\nfunction getCheckNoChangesMode() {\n // TODO(misko): remove this from the LView since it is ngDevMode=true mode only.\n return instructionState.checkNoChangesMode;\n}\nfunction setCheckNoChangesMode(mode) {\n instructionState.checkNoChangesMode = mode;\n}\n// top level variables should not be exported for performance reasons (PERF_NOTES.md)\nfunction getBindingRoot() {\n const lFrame = instructionState.lFrame;\n let index = lFrame.bindingRootIndex;\n if (index === -1) {\n index = lFrame.bindingRootIndex = lFrame.tView.bindingStartIndex;\n }\n return index;\n}\nfunction getBindingIndex() {\n return instructionState.lFrame.bindingIndex;\n}\nfunction setBindingIndex(value) {\n return instructionState.lFrame.bindingIndex = value;\n}\nfunction nextBindingIndex() {\n return instructionState.lFrame.bindingIndex++;\n}\nfunction incrementBindingIndex(count) {\n const lFrame = instructionState.lFrame;\n const index = lFrame.bindingIndex;\n lFrame.bindingIndex = lFrame.bindingIndex + count;\n return index;\n}\n/**\n * Set a new binding root index so that host template functions can execute.\n *\n * Bindings inside the host template are 0 index. But because we don't know ahead of time\n * how many host bindings we have we can't pre-compute them. For this reason they are all\n * 0 index and we just shift the root so that they match next available location in the LView.\n *\n * @param bindingRootIndex Root index for `hostBindings`\n * @param currentDirectiveIndex `TData[currentDirectiveIndex]` will point to the current directive\n * whose `hostBindings` are being processed.\n */\nfunction setBindingRootForHostBindings(bindingRootIndex, currentDirectiveIndex) {\n const lFrame = instructionState.lFrame;\n lFrame.bindingIndex = lFrame.bindingRootIndex = bindingRootIndex;\n setCurrentDirectiveIndex(currentDirectiveIndex);\n}\n/**\n * When host binding is executing this points to the directive index.\n * `TView.data[getCurrentDirectiveIndex()]` is `DirectiveDef`\n * `LView[getCurrentDirectiveIndex()]` is directive instance.\n */\nfunction getCurrentDirectiveIndex() {\n return instructionState.lFrame.currentDirectiveIndex;\n}\n/**\n * Sets an index of a directive whose `hostBindings` are being processed.\n *\n * @param currentDirectiveIndex `TData` index where current directive instance can be found.\n */\nfunction setCurrentDirectiveIndex(currentDirectiveIndex) {\n instructionState.lFrame.currentDirectiveIndex = currentDirectiveIndex;\n}\n/**\n * Retrieve the current `DirectiveDef` which is active when `hostBindings` instruction is being\n * executed.\n *\n * @param tData Current `TData` where the `DirectiveDef` will be looked up at.\n */\nfunction getCurrentDirectiveDef(tData) {\n const currentDirectiveIndex = instructionState.lFrame.currentDirectiveIndex;\n return currentDirectiveIndex === -1 ? null : tData[currentDirectiveIndex];\n}\nfunction getCurrentQueryIndex() {\n return instructionState.lFrame.currentQueryIndex;\n}\nfunction setCurrentQueryIndex(value) {\n instructionState.lFrame.currentQueryIndex = value;\n}\n/**\n * This is a light weight version of the `enterView` which is needed by the DI system.\n * @param newView\n * @param tNode\n */\nfunction enterDI(newView, tNode) {\n ngDevMode && assertLViewOrUndefined(newView);\n const newLFrame = allocLFrame();\n instructionState.lFrame = newLFrame;\n newLFrame.previousOrParentTNode = tNode;\n newLFrame.lView = newView;\n}\n/**\n * Swap the current lView with a new lView.\n *\n * For performance reasons we store the lView in the top level of the module.\n * This way we minimize the number of properties to read. Whenever a new view\n * is entered we have to store the lView for later, and when the view is\n * exited the state has to be restored\n *\n * @param newView New lView to become active\n * @param tNode Element to which the View is a child of\n * @returns the previously active lView;\n */\nfunction enterView(newView, tNode) {\n ngDevMode && assertLViewOrUndefined(newView);\n const newLFrame = allocLFrame();\n if (ngDevMode) {\n assertEqual(newLFrame.isParent, true, 'Expected clean LFrame');\n assertEqual(newLFrame.lView, null, 'Expected clean LFrame');\n assertEqual(newLFrame.tView, null, 'Expected clean LFrame');\n assertEqual(newLFrame.selectedIndex, 0, 'Expected clean LFrame');\n assertEqual(newLFrame.elementDepthCount, 0, 'Expected clean LFrame');\n assertEqual(newLFrame.currentDirectiveIndex, -1, 'Expected clean LFrame');\n assertEqual(newLFrame.currentNamespace, null, 'Expected clean LFrame');\n assertEqual(newLFrame.bindingRootIndex, -1, 'Expected clean LFrame');\n assertEqual(newLFrame.currentQueryIndex, 0, 'Expected clean LFrame');\n }\n const tView = newView[TVIEW];\n instructionState.lFrame = newLFrame;\n newLFrame.previousOrParentTNode = tNode;\n newLFrame.lView = newView;\n newLFrame.tView = tView;\n newLFrame.contextLView = newView;\n newLFrame.bindingIndex = tView.bindingStartIndex;\n}\n/**\n * Allocates next free LFrame. This function tries to reuse the `LFrame`s to lower memory pressure.\n */\nfunction allocLFrame() {\n const currentLFrame = instructionState.lFrame;\n const childLFrame = currentLFrame === null ? null : currentLFrame.child;\n const newLFrame = childLFrame === null ? createLFrame(currentLFrame) : childLFrame;\n return newLFrame;\n}\nfunction createLFrame(parent) {\n const lFrame = {\n previousOrParentTNode: null,\n isParent: true,\n lView: null,\n tView: null,\n selectedIndex: 0,\n contextLView: null,\n elementDepthCount: 0,\n currentNamespace: null,\n currentDirectiveIndex: -1,\n bindingRootIndex: -1,\n bindingIndex: -1,\n currentQueryIndex: 0,\n parent: parent,\n child: null,\n };\n parent !== null && (parent.child = lFrame); // link the new LFrame for reuse.\n return lFrame;\n}\n/**\n * A lightweight version of leave which is used with DI.\n *\n * This function only resets `previousOrParentTNode` and `LView` as those are the only properties\n * used with DI (`enterDI()`).\n *\n * NOTE: This function is reexported as `leaveDI`. However `leaveDI` has return type of `void` where\n * as `leaveViewLight` has `LFrame`. This is so that `leaveViewLight` can be used in `leaveView`.\n */\nfunction leaveViewLight() {\n const oldLFrame = instructionState.lFrame;\n instructionState.lFrame = oldLFrame.parent;\n oldLFrame.previousOrParentTNode = null;\n oldLFrame.lView = null;\n return oldLFrame;\n}\n/**\n * This is a lightweight version of the `leaveView` which is needed by the DI system.\n *\n * NOTE: this function is an alias so that we can change the type of the function to have `void`\n * return type.\n */\nconst leaveDI = leaveViewLight;\n/**\n * Leave the current `LView`\n *\n * This pops the `LFrame` with the associated `LView` from the stack.\n *\n * IMPORTANT: We must zero out the `LFrame` values here otherwise they will be retained. This is\n * because for performance reasons we don't release `LFrame` but rather keep it for next use.\n */\nfunction leaveView() {\n const oldLFrame = leaveViewLight();\n oldLFrame.isParent = true;\n oldLFrame.tView = null;\n oldLFrame.selectedIndex = 0;\n oldLFrame.contextLView = null;\n oldLFrame.elementDepthCount = 0;\n oldLFrame.currentDirectiveIndex = -1;\n oldLFrame.currentNamespace = null;\n oldLFrame.bindingRootIndex = -1;\n oldLFrame.bindingIndex = -1;\n oldLFrame.currentQueryIndex = 0;\n}\nfunction nextContextImpl(level) {\n const contextLView = instructionState.lFrame.contextLView =\n walkUpViews(level, instructionState.lFrame.contextLView);\n return contextLView[CONTEXT];\n}\nfunction walkUpViews(nestingLevel, currentView) {\n while (nestingLevel > 0) {\n ngDevMode &&\n assertDefined(currentView[DECLARATION_VIEW], 'Declaration view should be defined if nesting level is greater than 0.');\n currentView = currentView[DECLARATION_VIEW];\n nestingLevel--;\n }\n return currentView;\n}\n/**\n * Gets the currently selected element index.\n *\n * Used with {@link property} instruction (and more in the future) to identify the index in the\n * current `LView` to act on.\n */\nfunction getSelectedIndex() {\n return instructionState.lFrame.selectedIndex;\n}\n/**\n * Sets the most recent index passed to {@link select}\n *\n * Used with {@link property} instruction (and more in the future) to identify the index in the\n * current `LView` to act on.\n *\n * (Note that if an \"exit function\" was set earlier (via `setElementExitFn()`) then that will be\n * run if and when the provided `index` value is different from the current selected index value.)\n */\nfunction setSelectedIndex(index) {\n instructionState.lFrame.selectedIndex = index;\n}\n/**\n * Gets the `tNode` that represents currently selected element.\n */\nfunction getSelectedTNode() {\n const lFrame = instructionState.lFrame;\n return getTNode(lFrame.tView, lFrame.selectedIndex);\n}\n/**\n * Sets the namespace used to create elements to `'http://www.w3.org/2000/svg'` in global state.\n *\n * @codeGenApi\n */\nfunction ɵɵnamespaceSVG() {\n instructionState.lFrame.currentNamespace = SVG_NAMESPACE;\n}\n/**\n * Sets the namespace used to create elements to `'http://www.w3.org/1998/MathML/'` in global state.\n *\n * @codeGenApi\n */\nfunction ɵɵnamespaceMathML() {\n instructionState.lFrame.currentNamespace = MATH_ML_NAMESPACE;\n}\n/**\n * Sets the namespace used to create elements to `null`, which forces element creation to use\n * `createElement` rather than `createElementNS`.\n *\n * @codeGenApi\n */\nfunction ɵɵnamespaceHTML() {\n namespaceHTMLInternal();\n}\n/**\n * Sets the namespace used to create elements to `null`, which forces element creation to use\n * `createElement` rather than `createElementNS`.\n */\nfunction namespaceHTMLInternal() {\n instructionState.lFrame.currentNamespace = null;\n}\nfunction getNamespace() {\n return instructionState.lFrame.currentNamespace;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Adds all directive lifecycle hooks from the given `DirectiveDef` to the given `TView`.\n *\n * Must be run *only* on the first template pass.\n *\n * Sets up the pre-order hooks on the provided `tView`,\n * see {@link HookData} for details about the data structure.\n *\n * @param directiveIndex The index of the directive in LView\n * @param directiveDef The definition containing the hooks to setup in tView\n * @param tView The current TView\n */\nfunction registerPreOrderHooks(directiveIndex, directiveDef, tView) {\n ngDevMode && assertFirstCreatePass(tView);\n const { ngOnChanges, ngOnInit, ngDoCheck } = directiveDef.type.prototype;\n if (ngOnChanges) {\n const wrappedOnChanges = NgOnChangesFeatureImpl(directiveDef);\n (tView.preOrderHooks || (tView.preOrderHooks = [])).push(directiveIndex, wrappedOnChanges);\n (tView.preOrderCheckHooks || (tView.preOrderCheckHooks = []))\n .push(directiveIndex, wrappedOnChanges);\n }\n if (ngOnInit) {\n (tView.preOrderHooks || (tView.preOrderHooks = [])).push(0 - directiveIndex, ngOnInit);\n }\n if (ngDoCheck) {\n (tView.preOrderHooks || (tView.preOrderHooks = [])).push(directiveIndex, ngDoCheck);\n (tView.preOrderCheckHooks || (tView.preOrderCheckHooks = [])).push(directiveIndex, ngDoCheck);\n }\n}\n/**\n *\n * Loops through the directives on the provided `tNode` and queues hooks to be\n * run that are not initialization hooks.\n *\n * Should be executed during `elementEnd()` and similar to\n * preserve hook execution order. Content, view, and destroy hooks for projected\n * components and directives must be called *before* their hosts.\n *\n * Sets up the content, view, and destroy hooks on the provided `tView`,\n * see {@link HookData} for details about the data structure.\n *\n * NOTE: This does not set up `onChanges`, `onInit` or `doCheck`, those are set up\n * separately at `elementStart`.\n *\n * @param tView The current TView\n * @param tNode The TNode whose directives are to be searched for hooks to queue\n */\nfunction registerPostOrderHooks(tView, tNode) {\n ngDevMode && assertFirstCreatePass(tView);\n // It's necessary to loop through the directives at elementEnd() (rather than processing in\n // directiveCreate) so we can preserve the current hook order. Content, view, and destroy\n // hooks for projected components and directives must be called *before* their hosts.\n for (let i = tNode.directiveStart, end = tNode.directiveEnd; i < end; i++) {\n const directiveDef = tView.data[i];\n const lifecycleHooks = directiveDef.type.prototype;\n const { ngAfterContentInit, ngAfterContentChecked, ngAfterViewInit, ngAfterViewChecked, ngOnDestroy } = lifecycleHooks;\n if (ngAfterContentInit) {\n (tView.contentHooks || (tView.contentHooks = [])).push(-i, ngAfterContentInit);\n }\n if (ngAfterContentChecked) {\n (tView.contentHooks || (tView.contentHooks = [])).push(i, ngAfterContentChecked);\n (tView.contentCheckHooks || (tView.contentCheckHooks = [])).push(i, ngAfterContentChecked);\n }\n if (ngAfterViewInit) {\n (tView.viewHooks || (tView.viewHooks = [])).push(-i, ngAfterViewInit);\n }\n if (ngAfterViewChecked) {\n (tView.viewHooks || (tView.viewHooks = [])).push(i, ngAfterViewChecked);\n (tView.viewCheckHooks || (tView.viewCheckHooks = [])).push(i, ngAfterViewChecked);\n }\n if (ngOnDestroy != null) {\n (tView.destroyHooks || (tView.destroyHooks = [])).push(i, ngOnDestroy);\n }\n }\n}\n/**\n * Executing hooks requires complex logic as we need to deal with 2 constraints.\n *\n * 1. Init hooks (ngOnInit, ngAfterContentInit, ngAfterViewInit) must all be executed once and only\n * once, across many change detection cycles. This must be true even if some hooks throw, or if\n * some recursively trigger a change detection cycle.\n * To solve that, it is required to track the state of the execution of these init hooks.\n * This is done by storing and maintaining flags in the view: the {@link InitPhaseState},\n * and the index within that phase. They can be seen as a cursor in the following structure:\n * [[onInit1, onInit2], [afterContentInit1], [afterViewInit1, afterViewInit2, afterViewInit3]]\n * They are are stored as flags in LView[FLAGS].\n *\n * 2. Pre-order hooks can be executed in batches, because of the select instruction.\n * To be able to pause and resume their execution, we also need some state about the hook's array\n * that is being processed:\n * - the index of the next hook to be executed\n * - the number of init hooks already found in the processed part of the array\n * They are are stored as flags in LView[PREORDER_HOOK_FLAGS].\n */\n/**\n * Executes pre-order check hooks ( OnChanges, DoChanges) given a view where all the init hooks were\n * executed once. This is a light version of executeInitAndCheckPreOrderHooks where we can skip read\n * / write of the init-hooks related flags.\n * @param lView The LView where hooks are defined\n * @param hooks Hooks to be run\n * @param nodeIndex 3 cases depending on the value:\n * - undefined: all hooks from the array should be executed (post-order case)\n * - null: execute hooks only from the saved index until the end of the array (pre-order case, when\n * flushing the remaining hooks)\n * - number: execute hooks only from the saved index until that node index exclusive (pre-order\n * case, when executing select(number))\n */\nfunction executeCheckHooks(lView, hooks, nodeIndex) {\n callHooks(lView, hooks, 3 /* InitPhaseCompleted */, nodeIndex);\n}\n/**\n * Executes post-order init and check hooks (one of AfterContentInit, AfterContentChecked,\n * AfterViewInit, AfterViewChecked) given a view where there are pending init hooks to be executed.\n * @param lView The LView where hooks are defined\n * @param hooks Hooks to be run\n * @param initPhase A phase for which hooks should be run\n * @param nodeIndex 3 cases depending on the value:\n * - undefined: all hooks from the array should be executed (post-order case)\n * - null: execute hooks only from the saved index until the end of the array (pre-order case, when\n * flushing the remaining hooks)\n * - number: execute hooks only from the saved index until that node index exclusive (pre-order\n * case, when executing select(number))\n */\nfunction executeInitAndCheckHooks(lView, hooks, initPhase, nodeIndex) {\n ngDevMode &&\n assertNotEqual(initPhase, 3 /* InitPhaseCompleted */, 'Init pre-order hooks should not be called more than once');\n if ((lView[FLAGS] & 3 /* InitPhaseStateMask */) === initPhase) {\n callHooks(lView, hooks, initPhase, nodeIndex);\n }\n}\nfunction incrementInitPhaseFlags(lView, initPhase) {\n ngDevMode &&\n assertNotEqual(initPhase, 3 /* InitPhaseCompleted */, 'Init hooks phase should not be incremented after all init hooks have been run.');\n let flags = lView[FLAGS];\n if ((flags & 3 /* InitPhaseStateMask */) === initPhase) {\n flags &= 2047 /* IndexWithinInitPhaseReset */;\n flags += 1 /* InitPhaseStateIncrementer */;\n lView[FLAGS] = flags;\n }\n}\n/**\n * Calls lifecycle hooks with their contexts, skipping init hooks if it's not\n * the first LView pass\n *\n * @param currentView The current view\n * @param arr The array in which the hooks are found\n * @param initPhaseState the current state of the init phase\n * @param currentNodeIndex 3 cases depending on the value:\n * - undefined: all hooks from the array should be executed (post-order case)\n * - null: execute hooks only from the saved index until the end of the array (pre-order case, when\n * flushing the remaining hooks)\n * - number: execute hooks only from the saved index until that node index exclusive (pre-order\n * case, when executing select(number))\n */\nfunction callHooks(currentView, arr, initPhase, currentNodeIndex) {\n ngDevMode &&\n assertEqual(getCheckNoChangesMode(), false, 'Hooks should never be run in the check no changes mode.');\n const startIndex = currentNodeIndex !== undefined ?\n (currentView[PREORDER_HOOK_FLAGS] & 65535 /* IndexOfTheNextPreOrderHookMaskMask */) :\n 0;\n const nodeIndexLimit = currentNodeIndex != null ? currentNodeIndex : -1;\n let lastNodeIndexFound = 0;\n for (let i = startIndex; i < arr.length; i++) {\n const hook = arr[i + 1];\n if (typeof hook === 'number') {\n lastNodeIndexFound = arr[i];\n if (currentNodeIndex != null && lastNodeIndexFound >= currentNodeIndex) {\n break;\n }\n }\n else {\n const isInitHook = arr[i] < 0;\n if (isInitHook)\n currentView[PREORDER_HOOK_FLAGS] += 65536 /* NumberOfInitHooksCalledIncrementer */;\n if (lastNodeIndexFound < nodeIndexLimit || nodeIndexLimit == -1) {\n callHook(currentView, initPhase, arr, i);\n currentView[PREORDER_HOOK_FLAGS] =\n (currentView[PREORDER_HOOK_FLAGS] & 4294901760 /* NumberOfInitHooksCalledMask */) + i +\n 2;\n }\n i++;\n }\n }\n}\n/**\n * Execute one hook against the current `LView`.\n *\n * @param currentView The current view\n * @param initPhaseState the current state of the init phase\n * @param arr The array in which the hooks are found\n * @param i The current index within the hook data array\n */\nfunction callHook(currentView, initPhase, arr, i) {\n const isInitHook = arr[i] < 0;\n const hook = arr[i + 1];\n const directiveIndex = isInitHook ? -arr[i] : arr[i];\n const directive = currentView[directiveIndex];\n if (isInitHook) {\n const indexWithintInitPhase = currentView[FLAGS] >> 11 /* IndexWithinInitPhaseShift */;\n // The init phase state must be always checked here as it may have been recursively\n // updated\n if (indexWithintInitPhase <\n (currentView[PREORDER_HOOK_FLAGS] >> 16 /* NumberOfInitHooksCalledShift */) &&\n (currentView[FLAGS] & 3 /* InitPhaseStateMask */) === initPhase) {\n currentView[FLAGS] += 2048 /* IndexWithinInitPhaseIncrementer */;\n hook.call(directive);\n }\n }\n else {\n hook.call(directive);\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst TNODE = 8;\nconst PARENT_INJECTOR = 8;\nconst INJECTOR_BLOOM_PARENT_SIZE = 9;\nconst NO_PARENT_INJECTOR = -1;\n/**\n * Each injector is saved in 9 contiguous slots in `LView` and 9 contiguous slots in\n * `TView.data`. This allows us to store information about the current node's tokens (which\n * can be shared in `TView`) as well as the tokens of its ancestor nodes (which cannot be\n * shared, so they live in `LView`).\n *\n * Each of these slots (aside from the last slot) contains a bloom filter. This bloom filter\n * determines whether a directive is available on the associated node or not. This prevents us\n * from searching the directives array at this level unless it's probable the directive is in it.\n *\n * See: https://en.wikipedia.org/wiki/Bloom_filter for more about bloom filters.\n *\n * Because all injectors have been flattened into `LView` and `TViewData`, they cannot typed\n * using interfaces as they were previously. The start index of each `LInjector` and `TInjector`\n * will differ based on where it is flattened into the main array, so it's not possible to know\n * the indices ahead of time and save their types here. The interfaces are still included here\n * for documentation purposes.\n *\n * export interface LInjector extends Array {\n *\n * // Cumulative bloom for directive IDs 0-31 (IDs are % BLOOM_SIZE)\n * [0]: number;\n *\n * // Cumulative bloom for directive IDs 32-63\n * [1]: number;\n *\n * // Cumulative bloom for directive IDs 64-95\n * [2]: number;\n *\n * // Cumulative bloom for directive IDs 96-127\n * [3]: number;\n *\n * // Cumulative bloom for directive IDs 128-159\n * [4]: number;\n *\n * // Cumulative bloom for directive IDs 160 - 191\n * [5]: number;\n *\n * // Cumulative bloom for directive IDs 192 - 223\n * [6]: number;\n *\n * // Cumulative bloom for directive IDs 224 - 255\n * [7]: number;\n *\n * // We need to store a reference to the injector's parent so DI can keep looking up\n * // the injector tree until it finds the dependency it's looking for.\n * [PARENT_INJECTOR]: number;\n * }\n *\n * export interface TInjector extends Array {\n *\n * // Shared node bloom for directive IDs 0-31 (IDs are % BLOOM_SIZE)\n * [0]: number;\n *\n * // Shared node bloom for directive IDs 32-63\n * [1]: number;\n *\n * // Shared node bloom for directive IDs 64-95\n * [2]: number;\n *\n * // Shared node bloom for directive IDs 96-127\n * [3]: number;\n *\n * // Shared node bloom for directive IDs 128-159\n * [4]: number;\n *\n * // Shared node bloom for directive IDs 160 - 191\n * [5]: number;\n *\n * // Shared node bloom for directive IDs 192 - 223\n * [6]: number;\n *\n * // Shared node bloom for directive IDs 224 - 255\n * [7]: number;\n *\n * // Necessary to find directive indices for a particular node.\n * [TNODE]: TElementNode|TElementContainerNode|TContainerNode;\n * }\n */\n/**\n * Factory for creating instances of injectors in the NodeInjector.\n *\n * This factory is complicated by the fact that it can resolve `multi` factories as well.\n *\n * NOTE: Some of the fields are optional which means that this class has two hidden classes.\n * - One without `multi` support (most common)\n * - One with `multi` values, (rare).\n *\n * Since VMs can cache up to 4 inline hidden classes this is OK.\n *\n * - Single factory: Only `resolving` and `factory` is defined.\n * - `providers` factory: `componentProviders` is a number and `index = -1`.\n * - `viewProviders` factory: `componentProviders` is a number and `index` points to `providers`.\n */\nclass NodeInjectorFactory {\n constructor(\n /**\n * Factory to invoke in order to create a new instance.\n */\n factory, \n /**\n * Set to `true` if the token is declared in `viewProviders` (or if it is component).\n */\n isViewProvider, injectImplementation) {\n this.factory = factory;\n /**\n * Marker set to true during factory invocation to see if we get into recursive loop.\n * Recursive loop causes an error to be displayed.\n */\n this.resolving = false;\n this.canSeeViewProviders = isViewProvider;\n this.injectImpl = injectImplementation;\n }\n}\nfunction isFactory(obj) {\n return obj instanceof NodeInjectorFactory;\n}\n// Note: This hack is necessary so we don't erroneously get a circular dependency\n// failure based on types.\nconst unusedValueExportToPlacateAjd$3 = 1;\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction assertNodeType(tNode, type) {\n assertDefined(tNode, 'should be called with a TNode');\n assertEqual(tNode.type, type, `should be a ${typeName(type)}`);\n}\nfunction assertNodeOfPossibleTypes(tNode, types, message) {\n assertDefined(tNode, 'should be called with a TNode');\n const found = types.some(type => tNode.type === type);\n assertEqual(found, true, message !== null && message !== void 0 ? message : `Should be one of ${types.map(typeName).join(', ')} but got ${typeName(tNode.type)}`);\n}\nfunction assertNodeNotOfTypes(tNode, types, message) {\n assertDefined(tNode, 'should be called with a TNode');\n const found = types.some(type => tNode.type === type);\n assertEqual(found, false, message !== null && message !== void 0 ? message : `Should not be one of ${types.map(typeName).join(', ')} but got ${typeName(tNode.type)}`);\n}\nfunction typeName(type) {\n if (type == 1 /* Projection */)\n return 'Projection';\n if (type == 0 /* Container */)\n return 'Container';\n if (type == 5 /* IcuContainer */)\n return 'IcuContainer';\n if (type == 2 /* View */)\n return 'View';\n if (type == 3 /* Element */)\n return 'Element';\n if (type == 4 /* ElementContainer */)\n return 'ElementContainer';\n return '';\n}\n\n/**\n * Assigns all attribute values to the provided element via the inferred renderer.\n *\n * This function accepts two forms of attribute entries:\n *\n * default: (key, value):\n * attrs = [key1, value1, key2, value2]\n *\n * namespaced: (NAMESPACE_MARKER, uri, name, value)\n * attrs = [NAMESPACE_MARKER, uri, name, value, NAMESPACE_MARKER, uri, name, value]\n *\n * The `attrs` array can contain a mix of both the default and namespaced entries.\n * The \"default\" values are set without a marker, but if the function comes across\n * a marker value then it will attempt to set a namespaced value. If the marker is\n * not of a namespaced value then the function will quit and return the index value\n * where it stopped during the iteration of the attrs array.\n *\n * See [AttributeMarker] to understand what the namespace marker value is.\n *\n * Note that this instruction does not support assigning style and class values to\n * an element. See `elementStart` and `elementHostAttrs` to learn how styling values\n * are applied to an element.\n * @param renderer The renderer to be used\n * @param native The element that the attributes will be assigned to\n * @param attrs The attribute array of values that will be assigned to the element\n * @returns the index value that was last accessed in the attributes array\n */\nfunction setUpAttributes(renderer, native, attrs) {\n const isProc = isProceduralRenderer(renderer);\n let i = 0;\n while (i < attrs.length) {\n const value = attrs[i];\n if (typeof value === 'number') {\n // only namespaces are supported. Other value types (such as style/class\n // entries) are not supported in this function.\n if (value !== 0 /* NamespaceURI */) {\n break;\n }\n // we just landed on the marker value ... therefore\n // we should skip to the next entry\n i++;\n const namespaceURI = attrs[i++];\n const attrName = attrs[i++];\n const attrVal = attrs[i++];\n ngDevMode && ngDevMode.rendererSetAttribute++;\n isProc ?\n renderer.setAttribute(native, attrName, attrVal, namespaceURI) :\n native.setAttributeNS(namespaceURI, attrName, attrVal);\n }\n else {\n // attrName is string;\n const attrName = value;\n const attrVal = attrs[++i];\n // Standard attributes\n ngDevMode && ngDevMode.rendererSetAttribute++;\n if (isAnimationProp(attrName)) {\n if (isProc) {\n renderer.setProperty(native, attrName, attrVal);\n }\n }\n else {\n isProc ?\n renderer.setAttribute(native, attrName, attrVal) :\n native.setAttribute(attrName, attrVal);\n }\n i++;\n }\n }\n // another piece of code may iterate over the same attributes array. Therefore\n // it may be helpful to return the exact spot where the attributes array exited\n // whether by running into an unsupported marker or if all the static values were\n // iterated over.\n return i;\n}\n/**\n * Test whether the given value is a marker that indicates that the following\n * attribute values in a `TAttributes` array are only the names of attributes,\n * and not name-value pairs.\n * @param marker The attribute marker to test.\n * @returns true if the marker is a \"name-only\" marker (e.g. `Bindings`, `Template` or `I18n`).\n */\nfunction isNameOnlyAttributeMarker(marker) {\n return marker === 3 /* Bindings */ || marker === 4 /* Template */ ||\n marker === 6 /* I18n */;\n}\nfunction isAnimationProp(name) {\n // Perf note: accessing charCodeAt to check for the first character of a string is faster as\n // compared to accessing a character at index 0 (ex. name[0]). The main reason for this is that\n // charCodeAt doesn't allocate memory to return a substring.\n return name.charCodeAt(0) === 64 /* AT_SIGN */;\n}\n/**\n * Merges `src` `TAttributes` into `dst` `TAttributes` removing any duplicates in the process.\n *\n * This merge function keeps the order of attrs same.\n *\n * @param dst Location of where the merged `TAttributes` should end up.\n * @param src `TAttributes` which should be appended to `dst`\n */\nfunction mergeHostAttrs(dst, src) {\n if (src === null || src.length === 0) {\n // do nothing\n }\n else if (dst === null || dst.length === 0) {\n // We have source, but dst is empty, just make a copy.\n dst = src.slice();\n }\n else {\n let srcMarker = -1 /* ImplicitAttributes */;\n for (let i = 0; i < src.length; i++) {\n const item = src[i];\n if (typeof item === 'number') {\n srcMarker = item;\n }\n else {\n if (srcMarker === 0 /* NamespaceURI */) {\n // Case where we need to consume `key1`, `key2`, `value` items.\n }\n else if (srcMarker === -1 /* ImplicitAttributes */ ||\n srcMarker === 2 /* Styles */) {\n // Case where we have to consume `key1` and `value` only.\n mergeHostAttribute(dst, srcMarker, item, null, src[++i]);\n }\n else {\n // Case where we have to consume `key1` only.\n mergeHostAttribute(dst, srcMarker, item, null, null);\n }\n }\n }\n }\n return dst;\n}\n/**\n * Append `key`/`value` to existing `TAttributes` taking region marker and duplicates into account.\n *\n * @param dst `TAttributes` to append to.\n * @param marker Region where the `key`/`value` should be added.\n * @param key1 Key to add to `TAttributes`\n * @param key2 Key to add to `TAttributes` (in case of `AttributeMarker.NamespaceURI`)\n * @param value Value to add or to overwrite to `TAttributes` Only used if `marker` is not Class.\n */\nfunction mergeHostAttribute(dst, marker, key1, key2, value) {\n let i = 0;\n // Assume that new markers will be inserted at the end.\n let markerInsertPosition = dst.length;\n // scan until correct type.\n if (marker === -1 /* ImplicitAttributes */) {\n markerInsertPosition = -1;\n }\n else {\n while (i < dst.length) {\n const dstValue = dst[i++];\n if (typeof dstValue === 'number') {\n if (dstValue === marker) {\n markerInsertPosition = -1;\n break;\n }\n else if (dstValue > marker) {\n // We need to save this as we want the markers to be inserted in specific order.\n markerInsertPosition = i - 1;\n break;\n }\n }\n }\n }\n // search until you find place of insertion\n while (i < dst.length) {\n const item = dst[i];\n if (typeof item === 'number') {\n // since `i` started as the index after the marker, we did not find it if we are at the next\n // marker\n break;\n }\n else if (item === key1) {\n // We already have same token\n if (key2 === null) {\n if (value !== null) {\n dst[i + 1] = value;\n }\n return;\n }\n else if (key2 === dst[i + 1]) {\n dst[i + 2] = value;\n return;\n }\n }\n // Increment counter.\n i++;\n if (key2 !== null)\n i++;\n if (value !== null)\n i++;\n }\n // insert at location.\n if (markerInsertPosition !== -1) {\n dst.splice(markerInsertPosition, 0, marker);\n i = markerInsertPosition + 1;\n }\n dst.splice(i++, 0, key1);\n if (key2 !== null) {\n dst.splice(i++, 0, key2);\n }\n if (value !== null) {\n dst.splice(i++, 0, value);\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/// Parent Injector Utils ///////////////////////////////////////////////////////////////\nfunction hasParentInjector(parentLocation) {\n return parentLocation !== NO_PARENT_INJECTOR;\n}\nfunction getParentInjectorIndex(parentLocation) {\n return parentLocation & 32767 /* InjectorIndexMask */;\n}\nfunction getParentInjectorViewOffset(parentLocation) {\n return parentLocation >> 16 /* ViewOffsetShift */;\n}\n/**\n * Unwraps a parent injector location number to find the view offset from the current injector,\n * then walks up the declaration view tree until the view is found that contains the parent\n * injector.\n *\n * @param location The location of the parent injector, which contains the view offset\n * @param startView The LView instance from which to start walking up the view tree\n * @returns The LView instance that contains the parent injector\n */\nfunction getParentInjectorView(location, startView) {\n let viewOffset = getParentInjectorViewOffset(location);\n let parentView = startView;\n // For most cases, the parent injector can be found on the host node (e.g. for component\n // or container), but we must keep the loop here to support the rarer case of deeply nested\n // tags or inline views, where the parent injector might live many views\n // above the child injector.\n while (viewOffset > 0) {\n parentView = parentView[DECLARATION_VIEW];\n viewOffset--;\n }\n return parentView;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Used for stringify render output in Ivy.\n * Important! This function is very performance-sensitive and we should\n * be extra careful not to introduce megamorphic reads in it.\n */\nfunction renderStringify(value) {\n if (typeof value === 'string')\n return value;\n if (value == null)\n return '';\n return '' + value;\n}\n/**\n * Used to stringify a value so that it can be displayed in an error message.\n * Important! This function contains a megamorphic read and should only be\n * used for error messages.\n */\nfunction stringifyForError(value) {\n if (typeof value === 'function')\n return value.name || value.toString();\n if (typeof value === 'object' && value != null && typeof value.type === 'function') {\n return value.type.name || value.type.toString();\n }\n return renderStringify(value);\n}\nconst ɵ0$3 = () => (typeof requestAnimationFrame !== 'undefined' &&\n requestAnimationFrame || // browser only\n setTimeout // everything else\n)\n .bind(_global);\nconst defaultScheduler = (ɵ0$3)();\n/**\n *\n * @codeGenApi\n */\nfunction ɵɵresolveWindow(element) {\n return { name: 'window', target: element.ownerDocument.defaultView };\n}\n/**\n *\n * @codeGenApi\n */\nfunction ɵɵresolveDocument(element) {\n return { name: 'document', target: element.ownerDocument };\n}\n/**\n *\n * @codeGenApi\n */\nfunction ɵɵresolveBody(element) {\n return { name: 'body', target: element.ownerDocument.body };\n}\n/**\n * The special delimiter we use to separate property names, prefixes, and suffixes\n * in property binding metadata. See storeBindingMetadata().\n *\n * We intentionally use the Unicode \"REPLACEMENT CHARACTER\" (U+FFFD) as a delimiter\n * because it is a very uncommon character that is unlikely to be part of a user's\n * property names or interpolation strings. If it is in fact used in a property\n * binding, DebugElement.properties will not return the correct value for that\n * binding. However, there should be no runtime effect for real applications.\n *\n * This character is typically rendered as a question mark inside of a diamond.\n * See https://en.wikipedia.org/wiki/Specials_(Unicode_block)\n *\n */\nconst INTERPOLATION_DELIMITER = `�`;\n/**\n * Unwrap a value which might be behind a closure (for forward declaration reasons).\n */\nfunction maybeUnwrapFn(value) {\n if (value instanceof Function) {\n return value();\n }\n else {\n return value;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Defines if the call to `inject` should include `viewProviders` in its resolution.\n *\n * This is set to true when we try to instantiate a component. This value is reset in\n * `getNodeInjectable` to a value which matches the declaration location of the token about to be\n * instantiated. This is done so that if we are injecting a token which was declared outside of\n * `viewProviders` we don't accidentally pull `viewProviders` in.\n *\n * Example:\n *\n * ```\n * @Injectable()\n * class MyService {\n * constructor(public value: String) {}\n * }\n *\n * @Component({\n * providers: [\n * MyService,\n * {provide: String, value: 'providers' }\n * ]\n * viewProviders: [\n * {provide: String, value: 'viewProviders'}\n * ]\n * })\n * class MyComponent {\n * constructor(myService: MyService, value: String) {\n * // We expect that Component can see into `viewProviders`.\n * expect(value).toEqual('viewProviders');\n * // `MyService` was not declared in `viewProviders` hence it can't see it.\n * expect(myService.value).toEqual('providers');\n * }\n * }\n *\n * ```\n */\nlet includeViewProviders = true;\nfunction setIncludeViewProviders(v) {\n const oldValue = includeViewProviders;\n includeViewProviders = v;\n return oldValue;\n}\n/**\n * The number of slots in each bloom filter (used by DI). The larger this number, the fewer\n * directives that will share slots, and thus, the fewer false positives when checking for\n * the existence of a directive.\n */\nconst BLOOM_SIZE = 256;\nconst BLOOM_MASK = BLOOM_SIZE - 1;\n/** Counter used to generate unique IDs for directives. */\nlet nextNgElementId = 0;\n/**\n * Registers this directive as present in its node's injector by flipping the directive's\n * corresponding bit in the injector's bloom filter.\n *\n * @param injectorIndex The index of the node injector where this token should be registered\n * @param tView The TView for the injector's bloom filters\n * @param type The directive token to register\n */\nfunction bloomAdd(injectorIndex, tView, type) {\n ngDevMode && assertEqual(tView.firstCreatePass, true, 'expected firstCreatePass to be true');\n let id;\n if (typeof type === 'string') {\n id = type.charCodeAt(0) || 0;\n }\n else if (type.hasOwnProperty(NG_ELEMENT_ID)) {\n id = type[NG_ELEMENT_ID];\n }\n // Set a unique ID on the directive type, so if something tries to inject the directive,\n // we can easily retrieve the ID and hash it into the bloom bit that should be checked.\n if (id == null) {\n id = type[NG_ELEMENT_ID] = nextNgElementId++;\n }\n // We only have BLOOM_SIZE (256) slots in our bloom filter (8 buckets * 32 bits each),\n // so all unique IDs must be modulo-ed into a number from 0 - 255 to fit into the filter.\n const bloomBit = id & BLOOM_MASK;\n // Create a mask that targets the specific bit associated with the directive.\n // JS bit operations are 32 bits, so this will be a number between 2^0 and 2^31, corresponding\n // to bit positions 0 - 31 in a 32 bit integer.\n const mask = 1 << bloomBit;\n // Use the raw bloomBit number to determine which bloom filter bucket we should check\n // e.g: bf0 = [0 - 31], bf1 = [32 - 63], bf2 = [64 - 95], bf3 = [96 - 127], etc\n const b7 = bloomBit & 0x80;\n const b6 = bloomBit & 0x40;\n const b5 = bloomBit & 0x20;\n const tData = tView.data;\n if (b7) {\n b6 ? (b5 ? (tData[injectorIndex + 7] |= mask) : (tData[injectorIndex + 6] |= mask)) :\n (b5 ? (tData[injectorIndex + 5] |= mask) : (tData[injectorIndex + 4] |= mask));\n }\n else {\n b6 ? (b5 ? (tData[injectorIndex + 3] |= mask) : (tData[injectorIndex + 2] |= mask)) :\n (b5 ? (tData[injectorIndex + 1] |= mask) : (tData[injectorIndex] |= mask));\n }\n}\n/**\n * Creates (or gets an existing) injector for a given element or container.\n *\n * @param tNode for which an injector should be retrieved / created.\n * @param hostView View where the node is stored\n * @returns Node injector\n */\nfunction getOrCreateNodeInjectorForNode(tNode, hostView) {\n const existingInjectorIndex = getInjectorIndex(tNode, hostView);\n if (existingInjectorIndex !== -1) {\n return existingInjectorIndex;\n }\n const tView = hostView[TVIEW];\n if (tView.firstCreatePass) {\n tNode.injectorIndex = hostView.length;\n insertBloom(tView.data, tNode); // foundation for node bloom\n insertBloom(hostView, null); // foundation for cumulative bloom\n insertBloom(tView.blueprint, null);\n }\n const parentLoc = getParentInjectorLocation(tNode, hostView);\n const injectorIndex = tNode.injectorIndex;\n // If a parent injector can't be found, its location is set to -1.\n // In that case, we don't need to set up a cumulative bloom\n if (hasParentInjector(parentLoc)) {\n const parentIndex = getParentInjectorIndex(parentLoc);\n const parentLView = getParentInjectorView(parentLoc, hostView);\n const parentData = parentLView[TVIEW].data;\n // Creates a cumulative bloom filter that merges the parent's bloom filter\n // and its own cumulative bloom (which contains tokens for all ancestors)\n for (let i = 0; i < 8; i++) {\n hostView[injectorIndex + i] = parentLView[parentIndex + i] | parentData[parentIndex + i];\n }\n }\n hostView[injectorIndex + PARENT_INJECTOR] = parentLoc;\n return injectorIndex;\n}\nfunction insertBloom(arr, footer) {\n arr.push(0, 0, 0, 0, 0, 0, 0, 0, footer);\n}\nfunction getInjectorIndex(tNode, hostView) {\n if (tNode.injectorIndex === -1 ||\n // If the injector index is the same as its parent's injector index, then the index has been\n // copied down from the parent node. No injector has been created yet on this node.\n (tNode.parent && tNode.parent.injectorIndex === tNode.injectorIndex) ||\n // After the first template pass, the injector index might exist but the parent values\n // might not have been calculated yet for this instance\n hostView[tNode.injectorIndex + PARENT_INJECTOR] == null) {\n return -1;\n }\n else {\n return tNode.injectorIndex;\n }\n}\n/**\n * Finds the index of the parent injector, with a view offset if applicable. Used to set the\n * parent injector initially.\n *\n * Returns a combination of number of `ViewData` we have to go up and index in that `Viewdata`\n */\nfunction getParentInjectorLocation(tNode, view) {\n if (tNode.parent && tNode.parent.injectorIndex !== -1) {\n return tNode.parent.injectorIndex; // ViewOffset is 0\n }\n // For most cases, the parent injector index can be found on the host node (e.g. for component\n // or container), so this loop will be skipped, but we must keep the loop here to support\n // the rarer case of deeply nested tags or inline views.\n let hostTNode = view[T_HOST];\n let viewOffset = 1;\n while (hostTNode && hostTNode.injectorIndex === -1) {\n view = view[DECLARATION_VIEW];\n hostTNode = view ? view[T_HOST] : null;\n viewOffset++;\n }\n return hostTNode ?\n hostTNode.injectorIndex | (viewOffset << 16 /* ViewOffsetShift */) :\n -1;\n}\n/**\n * Makes a type or an injection token public to the DI system by adding it to an\n * injector's bloom filter.\n *\n * @param di The node injector in which a directive will be added\n * @param token The type or the injection token to be made public\n */\nfunction diPublicInInjector(injectorIndex, tView, token) {\n bloomAdd(injectorIndex, tView, token);\n}\n/**\n * Inject static attribute value into directive constructor.\n *\n * This method is used with `factory` functions which are generated as part of\n * `defineDirective` or `defineComponent`. The method retrieves the static value\n * of an attribute. (Dynamic attributes are not supported since they are not resolved\n * at the time of injection and can change over time.)\n *\n * # Example\n * Given:\n * ```\n * @Component(...)\n * class MyComponent {\n * constructor(@Attribute('title') title: string) { ... }\n * }\n * ```\n * When instantiated with\n * ```\n * \n * ```\n *\n * Then factory method generated is:\n * ```\n * MyComponent.ɵcmp = defineComponent({\n * factory: () => new MyComponent(injectAttribute('title'))\n * ...\n * })\n * ```\n *\n * @publicApi\n */\nfunction injectAttributeImpl(tNode, attrNameToInject) {\n ngDevMode &&\n assertNodeOfPossibleTypes(tNode, [0 /* Container */, 3 /* Element */, 4 /* ElementContainer */]);\n ngDevMode && assertDefined(tNode, 'expecting tNode');\n if (attrNameToInject === 'class') {\n return tNode.classes;\n }\n if (attrNameToInject === 'style') {\n return tNode.styles;\n }\n const attrs = tNode.attrs;\n if (attrs) {\n const attrsLength = attrs.length;\n let i = 0;\n while (i < attrsLength) {\n const value = attrs[i];\n // If we hit a `Bindings` or `Template` marker then we are done.\n if (isNameOnlyAttributeMarker(value))\n break;\n // Skip namespaced attributes\n if (value === 0 /* NamespaceURI */) {\n // we skip the next two values\n // as namespaced attributes looks like\n // [..., AttributeMarker.NamespaceURI, 'http://someuri.com/test', 'test:exist',\n // 'existValue', ...]\n i = i + 2;\n }\n else if (typeof value === 'number') {\n // Skip to the first value of the marked attribute.\n i++;\n while (i < attrsLength && typeof attrs[i] === 'string') {\n i++;\n }\n }\n else if (value === attrNameToInject) {\n return attrs[i + 1];\n }\n else {\n i = i + 2;\n }\n }\n }\n return null;\n}\n/**\n * Returns the value associated to the given token from the NodeInjectors => ModuleInjector.\n *\n * Look for the injector providing the token by walking up the node injector tree and then\n * the module injector tree.\n *\n * This function patches `token` with `__NG_ELEMENT_ID__` which contains the id for the bloom\n * filter. Negative values are reserved for special objects.\n * - `-1` is reserved for injecting `Injector` (implemented by `NodeInjector`)\n *\n * @param tNode The Node where the search for the injector should start\n * @param lView The `LView` that contains the `tNode`\n * @param token The token to look for\n * @param flags Injection flags\n * @param notFoundValue The value to return when the injection flags is `InjectFlags.Optional`\n * @returns the value from the injector, `null` when not found, or `notFoundValue` if provided\n */\nfunction getOrCreateInjectable(tNode, lView, token, flags = InjectFlags.Default, notFoundValue) {\n if (tNode !== null) {\n const bloomHash = bloomHashBitOrFactory(token);\n // If the ID stored here is a function, this is a special object like ElementRef or TemplateRef\n // so just call the factory function to create it.\n if (typeof bloomHash === 'function') {\n enterDI(lView, tNode);\n try {\n const value = bloomHash();\n if (value == null && !(flags & InjectFlags.Optional)) {\n throw new Error(`No provider for ${stringifyForError(token)}!`);\n }\n else {\n return value;\n }\n }\n finally {\n leaveDI();\n }\n }\n else if (typeof bloomHash == 'number') {\n if (bloomHash === -1) {\n // `-1` is a special value used to identify `Injector` types.\n return new NodeInjector(tNode, lView);\n }\n // If the token has a bloom hash, then it is a token which could be in NodeInjector.\n // A reference to the previous injector TView that was found while climbing the element\n // injector tree. This is used to know if viewProviders can be accessed on the current\n // injector.\n let previousTView = null;\n let injectorIndex = getInjectorIndex(tNode, lView);\n let parentLocation = NO_PARENT_INJECTOR;\n let hostTElementNode = flags & InjectFlags.Host ? lView[DECLARATION_COMPONENT_VIEW][T_HOST] : null;\n // If we should skip this injector, or if there is no injector on this node, start by\n // searching\n // the parent injector.\n if (injectorIndex === -1 || flags & InjectFlags.SkipSelf) {\n parentLocation = injectorIndex === -1 ? getParentInjectorLocation(tNode, lView) :\n lView[injectorIndex + PARENT_INJECTOR];\n if (!shouldSearchParent(flags, false)) {\n injectorIndex = -1;\n }\n else {\n previousTView = lView[TVIEW];\n injectorIndex = getParentInjectorIndex(parentLocation);\n lView = getParentInjectorView(parentLocation, lView);\n }\n }\n // Traverse up the injector tree until we find a potential match or until we know there\n // *isn't* a match.\n while (injectorIndex !== -1) {\n parentLocation = lView[injectorIndex + PARENT_INJECTOR];\n // Check the current injector. If it matches, see if it contains token.\n const tView = lView[TVIEW];\n if (bloomHasToken(bloomHash, injectorIndex, tView.data)) {\n // At this point, we have an injector which *may* contain the token, so we step through\n // the providers and directives associated with the injector's corresponding node to get\n // the instance.\n const instance = searchTokensOnInjector(injectorIndex, lView, token, previousTView, flags, hostTElementNode);\n if (instance !== NOT_FOUND) {\n return instance;\n }\n }\n if (shouldSearchParent(flags, lView[TVIEW].data[injectorIndex + TNODE] === hostTElementNode) &&\n bloomHasToken(bloomHash, injectorIndex, lView)) {\n // The def wasn't found anywhere on this node, so it was a false positive.\n // Traverse up the tree and continue searching.\n previousTView = tView;\n injectorIndex = getParentInjectorIndex(parentLocation);\n lView = getParentInjectorView(parentLocation, lView);\n }\n else {\n // If we should not search parent OR If the ancestor bloom filter value does not have the\n // bit corresponding to the directive we can give up on traversing up to find the specific\n // injector.\n injectorIndex = -1;\n }\n }\n }\n }\n if (flags & InjectFlags.Optional && notFoundValue === undefined) {\n // This must be set or the NullInjector will throw for optional deps\n notFoundValue = null;\n }\n if ((flags & (InjectFlags.Self | InjectFlags.Host)) === 0) {\n const moduleInjector = lView[INJECTOR$1];\n // switch to `injectInjectorOnly` implementation for module injector, since module injector\n // should not have access to Component/Directive DI scope (that may happen through\n // `directiveInject` implementation)\n const previousInjectImplementation = setInjectImplementation(undefined);\n try {\n if (moduleInjector) {\n return moduleInjector.get(token, notFoundValue, flags & InjectFlags.Optional);\n }\n else {\n return injectRootLimpMode(token, notFoundValue, flags & InjectFlags.Optional);\n }\n }\n finally {\n setInjectImplementation(previousInjectImplementation);\n }\n }\n if (flags & InjectFlags.Optional) {\n return notFoundValue;\n }\n else {\n throw new Error(`NodeInjector: NOT_FOUND [${stringifyForError(token)}]`);\n }\n}\nconst NOT_FOUND = {};\nfunction searchTokensOnInjector(injectorIndex, lView, token, previousTView, flags, hostTElementNode) {\n const currentTView = lView[TVIEW];\n const tNode = currentTView.data[injectorIndex + TNODE];\n // First, we need to determine if view providers can be accessed by the starting element.\n // There are two possibities\n const canAccessViewProviders = previousTView == null ?\n // 1) This is the first invocation `previousTView == null` which means that we are at the\n // `TNode` of where injector is starting to look. In such a case the only time we are allowed\n // to look into the ViewProviders is if:\n // - we are on a component\n // - AND the injector set `includeViewProviders` to true (implying that the token can see\n // ViewProviders because it is the Component or a Service which itself was declared in\n // ViewProviders)\n (isComponentHost(tNode) && includeViewProviders) :\n // 2) `previousTView != null` which means that we are now walking across the parent nodes.\n // In such a case we are only allowed to look into the ViewProviders if:\n // - We just crossed from child View to Parent View `previousTView != currentTView`\n // - AND the parent TNode is an Element.\n // This means that we just came from the Component's View and therefore are allowed to see\n // into the ViewProviders.\n (previousTView != currentTView && (tNode.type === 3 /* Element */));\n // This special case happens when there is a @host on the inject and when we are searching\n // on the host element node.\n const isHostSpecialCase = (flags & InjectFlags.Host) && hostTElementNode === tNode;\n const injectableIdx = locateDirectiveOrProvider(tNode, currentTView, token, canAccessViewProviders, isHostSpecialCase);\n if (injectableIdx !== null) {\n return getNodeInjectable(lView, currentTView, injectableIdx, tNode);\n }\n else {\n return NOT_FOUND;\n }\n}\n/**\n * Searches for the given token among the node's directives and providers.\n *\n * @param tNode TNode on which directives are present.\n * @param tView The tView we are currently processing\n * @param token Provider token or type of a directive to look for.\n * @param canAccessViewProviders Whether view providers should be considered.\n * @param isHostSpecialCase Whether the host special case applies.\n * @returns Index of a found directive or provider, or null when none found.\n */\nfunction locateDirectiveOrProvider(tNode, tView, token, canAccessViewProviders, isHostSpecialCase) {\n const nodeProviderIndexes = tNode.providerIndexes;\n const tInjectables = tView.data;\n const injectablesStart = nodeProviderIndexes & 1048575 /* ProvidersStartIndexMask */;\n const directivesStart = tNode.directiveStart;\n const directiveEnd = tNode.directiveEnd;\n const cptViewProvidersCount = nodeProviderIndexes >> 20 /* CptViewProvidersCountShift */;\n const startingIndex = canAccessViewProviders ? injectablesStart : injectablesStart + cptViewProvidersCount;\n // When the host special case applies, only the viewProviders and the component are visible\n const endIndex = isHostSpecialCase ? injectablesStart + cptViewProvidersCount : directiveEnd;\n for (let i = startingIndex; i < endIndex; i++) {\n const providerTokenOrDef = tInjectables[i];\n if (i < directivesStart && token === providerTokenOrDef ||\n i >= directivesStart && providerTokenOrDef.type === token) {\n return i;\n }\n }\n if (isHostSpecialCase) {\n const dirDef = tInjectables[directivesStart];\n if (dirDef && isComponentDef(dirDef) && dirDef.type === token) {\n return directivesStart;\n }\n }\n return null;\n}\n/**\n * Retrieve or instantiate the injectable from the `LView` at particular `index`.\n *\n * This function checks to see if the value has already been instantiated and if so returns the\n * cached `injectable`. Otherwise if it detects that the value is still a factory it\n * instantiates the `injectable` and caches the value.\n */\nfunction getNodeInjectable(lView, tView, index, tNode) {\n let value = lView[index];\n const tData = tView.data;\n if (isFactory(value)) {\n const factory = value;\n if (factory.resolving) {\n throw new Error(`Circular dep for ${stringifyForError(tData[index])}`);\n }\n const previousIncludeViewProviders = setIncludeViewProviders(factory.canSeeViewProviders);\n factory.resolving = true;\n let previousInjectImplementation;\n if (factory.injectImpl) {\n previousInjectImplementation = setInjectImplementation(factory.injectImpl);\n }\n enterDI(lView, tNode);\n try {\n value = lView[index] = factory.factory(undefined, tData, lView, tNode);\n // This code path is hit for both directives and providers.\n // For perf reasons, we want to avoid searching for hooks on providers.\n // It does no harm to try (the hooks just won't exist), but the extra\n // checks are unnecessary and this is a hot path. So we check to see\n // if the index of the dependency is in the directive range for this\n // tNode. If it's not, we know it's a provider and skip hook registration.\n if (tView.firstCreatePass && index >= tNode.directiveStart) {\n ngDevMode && assertDirectiveDef(tData[index]);\n registerPreOrderHooks(index, tData[index], tView);\n }\n }\n finally {\n if (factory.injectImpl)\n setInjectImplementation(previousInjectImplementation);\n setIncludeViewProviders(previousIncludeViewProviders);\n factory.resolving = false;\n leaveDI();\n }\n }\n return value;\n}\n/**\n * Returns the bit in an injector's bloom filter that should be used to determine whether or not\n * the directive might be provided by the injector.\n *\n * When a directive is public, it is added to the bloom filter and given a unique ID that can be\n * retrieved on the Type. When the directive isn't public or the token is not a directive `null`\n * is returned as the node injector can not possibly provide that token.\n *\n * @param token the injection token\n * @returns the matching bit to check in the bloom filter or `null` if the token is not known.\n * When the returned value is negative then it represents special values such as `Injector`.\n */\nfunction bloomHashBitOrFactory(token) {\n ngDevMode && assertDefined(token, 'token must be defined');\n if (typeof token === 'string') {\n return token.charCodeAt(0) || 0;\n }\n const tokenId = \n // First check with `hasOwnProperty` so we don't get an inherited ID.\n token.hasOwnProperty(NG_ELEMENT_ID) ? token[NG_ELEMENT_ID] : undefined;\n // Negative token IDs are used for special objects such as `Injector`\n return (typeof tokenId === 'number' && tokenId > 0) ? tokenId & BLOOM_MASK : tokenId;\n}\nfunction bloomHasToken(bloomHash, injectorIndex, injectorView) {\n // Create a mask that targets the specific bit associated with the directive we're looking for.\n // JS bit operations are 32 bits, so this will be a number between 2^0 and 2^31, corresponding\n // to bit positions 0 - 31 in a 32 bit integer.\n const mask = 1 << bloomHash;\n const b7 = bloomHash & 0x80;\n const b6 = bloomHash & 0x40;\n const b5 = bloomHash & 0x20;\n // Our bloom filter size is 256 bits, which is eight 32-bit bloom filter buckets:\n // bf0 = [0 - 31], bf1 = [32 - 63], bf2 = [64 - 95], bf3 = [96 - 127], etc.\n // Get the bloom filter value from the appropriate bucket based on the directive's bloomBit.\n let value;\n if (b7) {\n value = b6 ? (b5 ? injectorView[injectorIndex + 7] : injectorView[injectorIndex + 6]) :\n (b5 ? injectorView[injectorIndex + 5] : injectorView[injectorIndex + 4]);\n }\n else {\n value = b6 ? (b5 ? injectorView[injectorIndex + 3] : injectorView[injectorIndex + 2]) :\n (b5 ? injectorView[injectorIndex + 1] : injectorView[injectorIndex]);\n }\n // If the bloom filter value has the bit corresponding to the directive's bloomBit flipped on,\n // this injector is a potential match.\n return !!(value & mask);\n}\n/** Returns true if flags prevent parent injector from being searched for tokens */\nfunction shouldSearchParent(flags, isFirstHostTNode) {\n return !(flags & InjectFlags.Self) && !(flags & InjectFlags.Host && isFirstHostTNode);\n}\nclass NodeInjector {\n constructor(_tNode, _lView) {\n this._tNode = _tNode;\n this._lView = _lView;\n }\n get(token, notFoundValue) {\n return getOrCreateInjectable(this._tNode, this._lView, token, undefined, notFoundValue);\n }\n}\n/**\n * @codeGenApi\n */\nfunction ɵɵgetFactoryOf(type) {\n const typeAny = type;\n if (isForwardRef(type)) {\n return (() => {\n const factory = ɵɵgetFactoryOf(resolveForwardRef(typeAny));\n return factory ? factory() : null;\n });\n }\n let factory = getFactoryDef(typeAny);\n if (factory === null) {\n const injectorDef = getInjectorDef(typeAny);\n factory = injectorDef && injectorDef.factory;\n }\n return factory || null;\n}\n/**\n * @codeGenApi\n */\nfunction ɵɵgetInheritedFactory(type) {\n return noSideEffects(() => {\n const ownConstructor = type.prototype.constructor;\n const ownFactory = ownConstructor[NG_FACTORY_DEF] || ɵɵgetFactoryOf(ownConstructor);\n const objectPrototype = Object.prototype;\n let parent = Object.getPrototypeOf(type.prototype).constructor;\n // Go up the prototype until we hit `Object`.\n while (parent && parent !== objectPrototype) {\n const factory = parent[NG_FACTORY_DEF] || ɵɵgetFactoryOf(parent);\n // If we hit something that has a factory and the factory isn't the same as the type,\n // we've found the inherited factory. Note the check that the factory isn't the type's\n // own factory is redundant in most cases, but if the user has custom decorators on the\n // class, this lookup will start one level down in the prototype chain, causing us to\n // find the own factory first and potentially triggering an infinite loop downstream.\n if (factory && factory !== ownFactory) {\n return factory;\n }\n parent = Object.getPrototypeOf(parent);\n }\n // There is no factory defined. Either this was improper usage of inheritance\n // (no Angular decorator on the superclass) or there is no constructor at all\n // in the inheritance chain. Since the two cases cannot be distinguished, the\n // latter has to be assumed.\n return t => new t();\n });\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst ERROR_TYPE = 'ngType';\nconst ERROR_DEBUG_CONTEXT = 'ngDebugContext';\nconst ERROR_ORIGINAL_ERROR = 'ngOriginalError';\nconst ERROR_LOGGER = 'ngErrorLogger';\nfunction wrappedError(message, originalError) {\n const msg = `${message} caused by: ${originalError instanceof Error ? originalError.message : originalError}`;\n const error = Error(msg);\n error[ERROR_ORIGINAL_ERROR] = originalError;\n return error;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction getType(error) {\n return error[ERROR_TYPE];\n}\nfunction getDebugContext(error) {\n return error[ERROR_DEBUG_CONTEXT];\n}\nfunction getOriginalError(error) {\n return error[ERROR_ORIGINAL_ERROR];\n}\nfunction getErrorLogger(error) {\n return error[ERROR_LOGGER] || defaultErrorLogger;\n}\nfunction defaultErrorLogger(console, ...values) {\n console.error(...values);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Provides a hook for centralized exception handling.\n *\n * The default implementation of `ErrorHandler` prints error messages to the `console`. To\n * intercept error handling, write a custom exception handler that replaces this default as\n * appropriate for your app.\n *\n * @usageNotes\n * ### Example\n *\n * ```\n * class MyErrorHandler implements ErrorHandler {\n * handleError(error) {\n * // do something with the exception\n * }\n * }\n *\n * @NgModule({\n * providers: [{provide: ErrorHandler, useClass: MyErrorHandler}]\n * })\n * class MyModule {}\n * ```\n *\n * @publicApi\n */\nclass ErrorHandler {\n constructor() {\n /**\n * @internal\n */\n this._console = console;\n }\n handleError(error) {\n const originalError = this._findOriginalError(error);\n const context = this._findContext(error);\n // Note: Browser consoles show the place from where console.error was called.\n // We can use this to give users additional information about the error.\n const errorLogger = getErrorLogger(error);\n errorLogger(this._console, `ERROR`, error);\n if (originalError) {\n errorLogger(this._console, `ORIGINAL ERROR`, originalError);\n }\n if (context) {\n errorLogger(this._console, 'ERROR CONTEXT', context);\n }\n }\n /** @internal */\n _findContext(error) {\n if (error) {\n return getDebugContext(error) ? getDebugContext(error) :\n this._findContext(getOriginalError(error));\n }\n return null;\n }\n /** @internal */\n _findOriginalError(error) {\n let e = getOriginalError(error);\n while (e && getOriginalError(e)) {\n e = getOriginalError(e);\n }\n return e;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Defines a schema that allows an NgModule to contain the following:\n * - Non-Angular elements named with dash case (`-`).\n * - Element properties named with dash case (`-`).\n * Dash case is the naming convention for custom elements.\n *\n * @publicApi\n */\nconst CUSTOM_ELEMENTS_SCHEMA = {\n name: 'custom-elements'\n};\n/**\n * Defines a schema that allows any property on any element.\n *\n * @publicApi\n */\nconst NO_ERRORS_SCHEMA = {\n name: 'no-errors-schema'\n};\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass SafeValueImpl {\n constructor(changingThisBreaksApplicationSecurity) {\n this.changingThisBreaksApplicationSecurity = changingThisBreaksApplicationSecurity;\n }\n toString() {\n return `SafeValue must use [property]=binding: ${this.changingThisBreaksApplicationSecurity}` +\n ` (see http://g.co/ng/security#xss)`;\n }\n}\nclass SafeHtmlImpl extends SafeValueImpl {\n getTypeName() {\n return \"HTML\" /* Html */;\n }\n}\nclass SafeStyleImpl extends SafeValueImpl {\n getTypeName() {\n return \"Style\" /* Style */;\n }\n}\nclass SafeScriptImpl extends SafeValueImpl {\n getTypeName() {\n return \"Script\" /* Script */;\n }\n}\nclass SafeUrlImpl extends SafeValueImpl {\n getTypeName() {\n return \"URL\" /* Url */;\n }\n}\nclass SafeResourceUrlImpl extends SafeValueImpl {\n getTypeName() {\n return \"ResourceURL\" /* ResourceUrl */;\n }\n}\nfunction unwrapSafeValue(value) {\n return value instanceof SafeValueImpl ? value.changingThisBreaksApplicationSecurity :\n value;\n}\nfunction allowSanitizationBypassAndThrow(value, type) {\n const actualType = getSanitizationBypassType(value);\n if (actualType != null && actualType !== type) {\n // Allow ResourceURLs in URL contexts, they are strictly more trusted.\n if (actualType === \"ResourceURL\" /* ResourceUrl */ && type === \"URL\" /* Url */)\n return true;\n throw new Error(`Required a safe ${type}, got a ${actualType} (see http://g.co/ng/security#xss)`);\n }\n return actualType === type;\n}\nfunction getSanitizationBypassType(value) {\n return value instanceof SafeValueImpl && value.getTypeName() || null;\n}\n/**\n * Mark `html` string as trusted.\n *\n * This function wraps the trusted string in `String` and brands it in a way which makes it\n * recognizable to {@link htmlSanitizer} to be trusted implicitly.\n *\n * @param trustedHtml `html` string which needs to be implicitly trusted.\n * @returns a `html` which has been branded to be implicitly trusted.\n */\nfunction bypassSanitizationTrustHtml(trustedHtml) {\n return new SafeHtmlImpl(trustedHtml);\n}\n/**\n * Mark `style` string as trusted.\n *\n * This function wraps the trusted string in `String` and brands it in a way which makes it\n * recognizable to {@link styleSanitizer} to be trusted implicitly.\n *\n * @param trustedStyle `style` string which needs to be implicitly trusted.\n * @returns a `style` hich has been branded to be implicitly trusted.\n */\nfunction bypassSanitizationTrustStyle(trustedStyle) {\n return new SafeStyleImpl(trustedStyle);\n}\n/**\n * Mark `script` string as trusted.\n *\n * This function wraps the trusted string in `String` and brands it in a way which makes it\n * recognizable to {@link scriptSanitizer} to be trusted implicitly.\n *\n * @param trustedScript `script` string which needs to be implicitly trusted.\n * @returns a `script` which has been branded to be implicitly trusted.\n */\nfunction bypassSanitizationTrustScript(trustedScript) {\n return new SafeScriptImpl(trustedScript);\n}\n/**\n * Mark `url` string as trusted.\n *\n * This function wraps the trusted string in `String` and brands it in a way which makes it\n * recognizable to {@link urlSanitizer} to be trusted implicitly.\n *\n * @param trustedUrl `url` string which needs to be implicitly trusted.\n * @returns a `url` which has been branded to be implicitly trusted.\n */\nfunction bypassSanitizationTrustUrl(trustedUrl) {\n return new SafeUrlImpl(trustedUrl);\n}\n/**\n * Mark `url` string as trusted.\n *\n * This function wraps the trusted string in `String` and brands it in a way which makes it\n * recognizable to {@link resourceUrlSanitizer} to be trusted implicitly.\n *\n * @param trustedResourceUrl `url` string which needs to be implicitly trusted.\n * @returns a `url` which has been branded to be implicitly trusted.\n */\nfunction bypassSanitizationTrustResourceUrl(trustedResourceUrl) {\n return new SafeResourceUrlImpl(trustedResourceUrl);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * This file is used to control if the default rendering pipeline should be `ViewEngine` or `Ivy`.\n *\n * For more information on how to run and debug tests with either Ivy or View Engine (legacy),\n * please see [BAZEL.md](./docs/BAZEL.md).\n */\nlet _devMode = true;\nlet _runModeLocked = false;\n/**\n * Returns whether Angular is in development mode. After called once,\n * the value is locked and won't change any more.\n *\n * By default, this is true, unless a user calls `enableProdMode` before calling this.\n *\n * @publicApi\n */\nfunction isDevMode() {\n _runModeLocked = true;\n return _devMode;\n}\n/**\n * Disable Angular's development mode, which turns off assertions and other\n * checks within the framework.\n *\n * One important assertion this disables verifies that a change detection pass\n * does not result in additional changes to any bindings (also known as\n * unidirectional data flow).\n *\n * @publicApi\n */\nfunction enableProdMode() {\n if (_runModeLocked) {\n throw new Error('Cannot enable prod mode after platform setup.');\n }\n _devMode = false;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * This helper is used to get hold of an inert tree of DOM elements containing dirty HTML\n * that needs sanitizing.\n * Depending upon browser support we use one of two strategies for doing this.\n * Default: DOMParser strategy\n * Fallback: InertDocument strategy\n */\nfunction getInertBodyHelper(defaultDoc) {\n return isDOMParserAvailable() ? new DOMParserHelper() : new InertDocumentHelper(defaultDoc);\n}\n/**\n * Uses DOMParser to create and fill an inert body element.\n * This is the default strategy used in browsers that support it.\n */\nclass DOMParserHelper {\n getInertBodyElement(html) {\n // We add these extra elements to ensure that the rest of the content is parsed as expected\n // e.g. leading whitespace is maintained and tags like `` do not get hoisted to the\n // `` tag.\n html = '' + html + '';\n try {\n const body = new window.DOMParser().parseFromString(html, 'text/html').body;\n body.removeChild(body.firstChild);\n return body;\n }\n catch (_a) {\n return null;\n }\n }\n}\n/**\n * Use an HTML5 `template` element, if supported, or an inert body element created via\n * `createHtmlDocument` to create and fill an inert DOM element.\n * This is the fallback strategy if the browser does not support DOMParser.\n */\nclass InertDocumentHelper {\n constructor(defaultDoc) {\n this.defaultDoc = defaultDoc;\n this.inertDocument = this.defaultDoc.implementation.createHTMLDocument('sanitization-inert');\n if (this.inertDocument.body == null) {\n // usually there should be only one body element in the document, but IE doesn't have any, so\n // we need to create one.\n const inertHtml = this.inertDocument.createElement('html');\n this.inertDocument.appendChild(inertHtml);\n const inertBodyElement = this.inertDocument.createElement('body');\n inertHtml.appendChild(inertBodyElement);\n }\n }\n getInertBodyElement(html) {\n // Prefer using